Totale ZZS-lijst Risico's van Stoffen
Totale lijst van Zeer Zorgwekkende Stoffen
- Versie
- 12-03-2026
- Bron
- website "Risico’s van stoffen": https://rvs.rivm.nl
Hieronder vindt u het overzicht van alle afzonderlijke Zeer Zorgwekkende Stoffen (ZZS) in het Risico's van stoffen zoeksysteem.
U kunt de lijst exporteren voor gebruik in een spreadsheet via de knop "Download als Excel bestand".
Lees meer over ZZS.
Vragen of opmerkingen over de lijst kunt u indienen via de Helpdesk 'Risico’s van stoffen'.
| CAS-nummer | EG-nummer | Nederlandse stofnaam | Engelse stofnaam | ZZS volgens EU gevaarsindeling | ZZS volgens REACH SVHC | ZZS volgens REACH Restricties | ZZS volgens KRW | ZZS volgens OSPAR | ZZS volgens EU-POP Verordening | Stofklasse voor luchtemissies | Emissiegrenswaarde | Datum toevoeging | Voetnoot |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1257737-04-4 | 693-959-5 | (~18~O)diarsoxaan-1,3-(~18~O_2_)dion | (~18~O)diarsoxane-1,3-(~18~O_2_)dione | Ja | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 56, 91 | |||||
| 14149-58-7 | 689-532-8 | (~2~H_3_)boorzuur | (~2~H_3_)boric acid | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 36861-47-9 | 253-242-6 | (±)-1,7,7-trimethyl-3-[(4-methylfenyl)methyleen]bicyclo[2.2.1]-2-heptanon (4-methylbenzylideenkamfer) | (±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one (4-Methylbenzylidenecamphor) | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | |||||
| (±)-1,7,7-trimethyl-3-[(4-methylfenyl)methyleen]bicyclo[2.2.1]-2-heptanon, omvattend elk van de individuele isomeren en/of combinaties daarvan | (±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one covering any of the individual isomers and/or combinations thereof (4-MBC) | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | |||||||
| 41766-73-8 | (1,1'-bifenyl)-4,4'-diamine, dihydrofluoride | (1,1'-biphenyl)-4,4'-diamine, dihydrofluoride | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 56, 68 | |||||||
| 52754-64-0 | (1,1'-bifenyl)-4,4'-diamine, monoazijnzuur | (1,1'-biphenyl)-4,4'-diamine, monoacetate | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 56, 68 | |||||||
| 66836-18-8 | (1,1'-bifenyl)-ar,ar',4,4'-tetramine | (1,1'-biphenyl)-ar,ar',4,4'-tetramine | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 56, 68 | |||||||
| 2230140-59-5 | 878-583-3 | (1,3-dimesitylimidazol-2-ylideen)nikkel(0) bis(di-tert-butylfumaraat) | (1,3-dimesitylimidazol-2-ylidene)nickel(0) bis(di-tert-butyl fumarate) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 32488-44-1 | 685-232-6 | (13C6)benzeen | (13C6)benzene | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 56, 67 | ||||||
| 80220-63-9 | 800-604-1 | (1H,1H,2H,2H-heptadecafluordec-1-yl)fosfonzuur | (1H,1H,2H,2H-heptadecafluorodec-1-yl)phosphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 179055-21-1 | 621-950-8 | (1-methyl-1H-pyrazol-4-yl)tributylstannaan | (1-methyl-1H-pyrazol-4-yl)tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 95342-41-9 | (1R,3E,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1R,3E,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | ||||||
| 852541-21-0 | (1R,3Z,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1R,3Z,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | ||||||
| 741687-98-9 | (1R,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1R,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | ||||||
| 2440-02-0 | (1R,4S,5S)-1,2,3,4,5,7,7-heptachloorbicyclo[2.2.1]hept-2-een | (1R,4S,5S)-1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hept-2-ene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 115850-69-6 | (1RS,2SR,5RS)-2-(4-chloorbenzyl)-5-isopropyl-1- (1H-1,2,4-triazool-1- ylmethyl)cyclopentanol | (1RS,2SR,5RS)-2-(4-chlorobenzyl)-5-isopropyl-1- (1H-1,2,4-triazol-1-ylmethyl)cyclopentanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | ||||||
| 115937-89-8 | (1RS,2SR,5SR)-2-(4-chloorbenzyl)-5-isopropyl-1- (1H-1,2,4-triazool-1- ylmethyl)cyclopentanol | (1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1- (1H-1,2,4-triazol-1-ylmethyl)cyclopentanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | ||||||
| 852541-30-1 | (1S,3E,4R)-1,7,7-trimethyl-3-(4- methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1S,3E,4R)-1,7,7-trimethyl-3-(4- methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | ||||||
| 852541-25-4 | (1S,3Z,4R)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1S,3Z,4R)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | ||||||
| 38565-53-6 | 254-006-5 | (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluornonyl)oxiraan | (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)oxirane | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 46389-47-3 | 894-589-9 | (2,2'-bipyridine)nikkel(II)dibromide | (2,2'-bipyridine)nickel(II) dibromide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 93776-15-9 | 297-941-4 | (2-carboxylatoethyl)(dimethyl)[[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl)pentadecyl]amino]propyl]ammonium | (2-carboxylatoethyl)(dimethyl)[[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl]amino]propyl]ammonium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 93776-12-6 | 297-938-8 | (2-carboxylatoethyl)(dimethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluor-2-hydroxypentadecyl)amino]propyl]ammonium | (2-carboxylatoethyl)(dimethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl)amino]propyl]ammonium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 93776-13-7 | 297-939-3 | (2-carboxylatoethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluor-2-hydroxytridecyl)amino]propyl]dimethylammonium | (2-carboxylatoethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl)amino]propyl]dimethylammonium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 541-25-3 | (2-chloorethenyl)arseendichloride | (2-chloroethenyl)arsonous dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 40722-80-3 | 429-740-6 | (2-chloorethyl)(3-hydroxypropyl)ammoniumchloride | (2-chloroethyl)(3-hydroxypropyl)ammonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1239414-55-1 | (2E)-methyl 1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluorhept-2-een-4-yl ether | (2E)-methyl 1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluorohept-2-en-4-yl ether | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 84852-39-1 | 284-351-7 | (2-ethylhexanoato-O)(isodecanoato-O)nikkel | (2-ethylhexanoato-O)(isodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85508-45-8 | 287-470-2 | (2-ethylhexanoato-O)(isononanoato-O)nikkel | (2-ethylhexanoato-O)(isononanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85135-77-9 | 285-698-7 | (2-ethylhexanoato-O)(neodecanoato-O)nikkel | (2-ethylhexanoato-O)(neodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3757-88-8 | 628-194-8 | (2-fenyl-1-ethynyl)tributyltin | (2-phenyl-1-ethynyl)tributyltin | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 1664-98-8 | 216-775-5 | (2H)formaldehyde | (2H)formaldehyde | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 56, 67 | ||||||
| 62314-22-1 | 263-502-0 | (2-hydroxypropyl)trimethylammonium 2-ethylhexanoaat | (2-hydroxypropyl)trimethylammonium 2-ethylhexanoate | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 170682-50-5 | 688-548-2 | (2-methyl-2H-pyrazol-3-yl)tributyltin | (2-methyl-2H-pyrazol-3-yl)tributyltin | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 143142-90-9 | 604-331-7 | (2R)-(+)-3,3,3-trifluor-1,2-propeenoxide | (2R)-(+)-3,3,3-trifluoro-1,2-propenoxide | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 130025-34-2 | 603-381-7 | (2S)-(-)-3,3,3-trifluor-1,2-propeenoxide | (2S)-(-)-3,3,3-trifluoro-1,2-propenoxide | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1448347-49-6 | 811-226-1 | (2S)-1-(4-cyano-2-pyridinyl)-5-oxo-L-prolyl-2-(2-chloorfenyl)-N-(3,3-difluorcyclobutyl)-N2-(5-fluor-3-pyridinyl)-glycinamide | (2S)-1-(4-cyano-2-pyridinyl)-5-oxo-L-prolyl-2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-N2-(5-fluoro-3-pyridinyl)-glycinamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 135312-20-8 | 155-849-0 | (2S)-2-[4-(trifluormethyl)fenyl]oxiraan | (2S)-2-[4-(trifluoromethyl)phenyl]oxirane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 1217486-61-7 | 806-598-7 | (2S)-N1-{4-methyl-5-[2-(1,1,1-trifluor-2-methylpropaan-2-yl)pyridine-4-yl]-1,3-thiazool-2-yl}pyrrolidine-1,2-dicarboxamide | (2S)-N1-{4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-4-yl]-1,3-thiazol-2-yl}pyrrolidine-1,2-dicarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 56124-62-0 | 680-664-1 | (2Scis)-2-[1,2,3,4,6,11-hexahydro-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4[[2,3,6-trideoxy-3-[(trifluoracetyl)amino]-alfa-L-lyxo-hexopyranosyl]oxyl]-2-naftacenyl]-2-oxoethyl pentanoaat | (2Scis)-2-[1,2,3,4,6,11-hexahydro-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4[[2,3,6-trideoxy-3-[(trifluoroacetyl)amino]-alpha-L-lyxo-hexopyranosyl]oxyl]-2-naphtacenyl]-2-oxoethyl pentanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 692-49-9 | 700-651-7 | (2Z)-1,1,1,4,4,4-hexafluor-2-buteen | (2Z)-1,1,1,4,4,4-hexafluorobut-2-ene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 163451-81-8 | 642-273-4 | (2Z)-2-cyaan-3-hydroxy-N-[4-(trifluormethyl)fenyl]but-2-eenamide | (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaantriol | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) silanetriol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97 | |||||||
| (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaantriol en al zijn mono-, di- of tri-O-(alkyl)derivaten | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silanetriol and any of its mono-, di- or tri-O-(alkyl) derivatives | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97, 99 | |||||||
| 1203709-76-5 | 694-755-9 | (3-broomfenyl)(mesityl)jodonium trifluormethaansulfonaat | (3-bromophenyl)(mesityl)iodonium trifluoromethanesulfonate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 207569-13-9 | 693-353-0 | (3E)-1,1,1,5,5,5-hexafluor-4-hydroxypent-3-en-2-on--nikkel--water (2/1/1) | (3E)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one--nickel--water (2/1/1) | Ja | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56, 95 | |||||
| 1782069-81-1 | 701-394-3 | (3E)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (3E)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 80 | |||||
| 1239414-45-9 | (3E)-methyl-1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluorhept-4-een-3-yl ether | (3E)-methyl -1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluorohept-4-en-3-yl ether | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 1802323-89-2 | 840-627-4 | (3β)-17-(1,1,1-trifluormethaansulfonaat)-androsta-5,16-dieen-3,17-diol, 3-(2,2,2-trifluoracetaat) | (3β)-17-(1,1,1-trifluoromethanesulfonate)-androsta-5,16-diene-3,17-diol, 3-(2,2,2-trifluoroacetate) | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 3798-17-2 | 840-626-9 | (3β)-3-[(2,2,2-trifluoracetyl)oxy]-5-androsteen-17-one | (3β)-3-[(2,2,2-trifluoroacetyl)oxy]-androst-5-en-17-one | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 618-25-7 | (4-((2-Amino-2-oxoethyl)amino)fenyl)arsonzuur | (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 94232-26-5 | 303-952-8 | (4-aminofenyl)arsonzuur, verbinding met piperazine (1:1) | (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 164656-22-8 | 112-452-7 | (4aR,4bS,6aS,7S,9aS,9bS,11aR)-N-[2,5-bis(trifluormethyl)fenyl]hexadecahydro-4a,6a-dimethyl-2-oxo-1H-indeno[5,4-f]chinoline-7-carbonzuuramide (9CI, ACI) | (4aR,4bS,6aS,7S,9aS,9bS,11aR)- N-[2,5-Bis(trifluoromethyl)phenyl]hexadecahydro-4a,6a-dimethyl-2-oxo-1H-indeno[5,4-f]quinoline-7-carboxamide (9CI, ACI) | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 17151-48-3 | 106-286-4 | (4-chloorfenyl)tributylstannaan | (4-chlorophenyl)tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 105024-66-6 | 405-020-7 | (4-ethoxyfenyl)(3-(3-fenoxy-4-fluorfenyl)propyl)dimethylsilaan | (4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 910606-39-2 | (4-methylfenyl)difenyl-sulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, (4-methylphenyl)diphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 154598-52-4 | 620-492-6 | (4S)-6-chloor-4-(2-cyclopropylethynyl)-4-(trifluormethyl)-2,4-dihydro-1H-3,1-benzoxazin-2-on | (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazin-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 108225-03-2 | 402-060-7 | (6-(4-hydroxy-3-(2-methoxyfenylazo)-2-sulfonato-7-naftylamino)-1,3,5-triazine-2,4-diyl)bis[(amino-1-methylethyl)ammonium]-formaat | (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 153004-31-0 | 642-948-3 | (7.alpha.,17.beta.)- 7-[9-[(4,4,5,5,5-pentafluorpentyl)thio]nonyl]-estra-1,3,5(10)-trieen-3,17-diol | (7.alpha.,17.beta.)- 7-[9-[(4,4,5,5,5-pentafluoropentyl)thio]nonyl]-estra-1,3,5(10)-triene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 98008-06-1 | 670-947-8 | (7.alpha.,17.beta.)-7-[9-[(4,4,5,5,5-pentafluorpentyl)sulfonyl]nonyl]-estra-1,3,5(10)-trieen-3,17-diol | (7.alpha.,17.beta.)-7-[9-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]nonyl]-estra-1,3,5(10)-triene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 935-958-7 | (7alfa,17beta)-7-[9-[(4,4,5,5,5-pentafluorpentyl)sulfinyl]nonyl]-estra-1,3,5(10)-trieen-6-one-3,17-diol | (7alpha,17beta)-7-[9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl]-estra-1,3,5(10)-triene-6-one-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 415927-29-6 | 642-947-8 | (7R,13S,17S)-13-methyl-3-oxo-7-(9-((4,4,5,5,5-pentafluorpentyl)thio)nonyl)-2,3,6,7,8,9,10,11,12,13,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]fenantreen-17-yl acetaat | (7R,13S,17S)-13-methyl-3-oxo-7-(9-((4,4,5,5,5-pentafluoropentyl)thio)nonyl)-2,3,6,7,8,9,10,11,12,13,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1107606-70-1 | 837-287-4 | (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluorpentylsulfanyl)nonyl]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]fenantreen-6-on | (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1221256-46-7 | 807-171-8 | (7α,17β)-3-methoxy-7-[9-[(4,4,5,5,5-pentafluorpentyl)sulfinyl]nonyl]estra-1,3,5(10)-trieen-17-ol | (7α,17β)-3-methoxy-7-[9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl]estra-1,3,5(10)-trien-17-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 948-724-4 | (8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluorpentylsulfinyl)nonyl]-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]fenantreen-3,17-diol | (8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 948-723-9 | (8R,9S,13S,14S,17S)-13-methyl-7-[9-[9-(4,4,5,5,5-pentafluorpentylsulfinyl)nonylsulfinyl]nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]fenantreen-3,17-diol | (8R,9S,13S,14S,17S)-13-methyl-7-[9-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonylsulfinyl]nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 36635-36-6 | 188-268-6 | (but-3-en-1-yl)tributylstannaan | (but-3-en-1-yl)tributylstannane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 14516-71-3 | 238-523-3 | (butylamine)[[2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)fenolato]](2-)-O,O',S]nikkel | (butylamine)[[2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)phenolato]](2-)-O,O',S]nickel | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 94113-53-8 | 302-587-1 | (difenylarsino)dimethylgallium | (diphenylarsino)dimethylgallium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 82413-20-5 | 428-010-4 | (E)-3-[1-[4-[2-(dimethylamino)ethoxy]fenyl]-2-fenylbut-1-enyl]fenol | (E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1563176-58-8 | 857-955-9 | (E)-isopropyl 7-((1R,2R,3R,5S)-2-((E)-3,3-difluor-4-fenoxy-1-buteen-1-yl)-3,5-dihydroxycyclopentyl)-5-heptenoaat | (E)-isopropyl 7-((1R,2R,3R,5S)-2-((E)-3,3-difluoro-4-phenoxybut-1-en-1-yl)-3,5-dihydroxycyclopentyl)hept-5-enoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 96-09-3 | 202-476-7 | (epoxyethyl)benzeen | styrene oxide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 186043-67-4 | 809-871-9 | (HP-2721)hexakis(1H,1H,9H-perfluornonyloxy)fosfazine | (HP-2721)hexakis(1H,1H,9H-perfluorononyloxy)phosphazine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 84852-36-8 | 284-348-0 | (isodecanoato-O)(isononanoato-O)nikkel | (isodecanoato-O)(isononanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85166-19-4 | 285-909-2 | (isodecanoato-O)(isooctanoato-O)nikkel | (isodecanoato-O)(isooctanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85508-46-9 | 287-471-8 | (isononanoato-O)(isooctanoato-O)nikkel | (isononanoato-O)(isooctanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85551-28-6 | 287-592-6 | (isononanoato-O)(neodecanoato-O)nikkel | (isononanoato-O)(neodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84852-35-7 | 284-347-5 | (isooctanoato-O)(neodecanoato-O)nikkel | (isooctanoato-O)(neodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12275-07-9 | 235-549-7 | (maleato)trioxotetralood | (maleato)trioxotetralead | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 56 | ||||||
| 118658-99-4 | 401-500-5 | (methyleenbis(4,1-fenyleenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridiniumdichloridedihydrochloride | (methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 59447-55-1 | 261-767-7 | (pentabroomfenyl)methylacrylaat | (pentabromophenyl)methyl acrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1539314-06-1 | 855-390-2 | (R)-1-(1-(methylsulfonyl)-2-propanyl)-4-(trifluormethyl)-1H-indool-5-carbonitriel | (R)-1-(1-(methylsulfonyl)propan-2-yl)-4-(trifluoromethyl)-1H-indole-5-carbonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 71411-66-0 | 275-370-1 | (R)-12-hydroxyoliezuur, barium cadmium zout | (R)-12-hydroxyoleic acid, barium cadmium salt | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 85 | ||||||
| 51594-55-9 | 424-280-2 | (R)-1-chloor-2,3-epoxypropaan | R-1-chloro-2,3-epoxypropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 5543-58-8 | 226-908-9 | (R)-3-(1-fenyl-3-oxobutyl)-4-hydroxy-2-benzopyron | (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 834153-87-6 | 824-769-4 | (R)-4-((2-(5-(2-fluor-3-methoxyfenyl)-3-(2-fluor-6-(trifluormethyl)benzyl)-4-methyl-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)-1-fenylethyl)amino)butanoaat | (R)-4-((2-(5-(2-fluoro-3-methoxyphenyl)-3-(2-fluoro-6-(trifluoromethyl)benzyl)-4-methyl-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)-1-phenylethyl)amino)butanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 2408840-26-4 | 959-399-3 | (R)-5-(4-(3-(fluormethyl)azetidin-1-yl)ethoxy)fenyl)-8-(trifluormethyl)-5H-chromeno[4,3-c]chinolin-2-ol | (R)-5-(4-(2-(3-(fluoromethyl)azetidin-1-yl)ethoxy)phenyl)-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 5543-57-7 | 226-907-3 | (S)-3-(1-fenyl-3-oxobutyl)-4-hydroxy-2-benzopyron | (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64681-08-9 | 265-010-1 | (S)-dichloor[2-[[(2,3-dihydroxypropoxy)hydroxyfosfinyl]oxy]triethylmethylammoniumaat]cadmium | (S)-dichloro[2-[[(2,3-dihydroxypropoxy)hydroxyphosphinyl]oxy]triethylmethylammoniumato]cadmium | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 56, 85 | ||||||
| 70987-78-9 | 417-210-7 | (S)-oxiraanmethanol 4-methylbenzeensulfonaat | (S)-oxiranemethanol, 4-methylbenzene-sulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 421555-73-9 | (thiodi-4,1-fenyleen)bis[difenyl-sulfonium, zout met tridecafluorhexaansulfonzuur | sulfonium, (thiodi-4,1-phenylene)bis[diphenyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 27490-33-1 | 631-062-2 | (tributylstannyl)methanol | (tributylstannyl)methanol | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 75166-31-3 | (αR)-4-(1,1-dimethylethyl)-α-methylbenzeenpropanal | (αR)-4-(1,1-dimethylethyl)-α-methylbenzenepropanal | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||||
| 75166-30-2 | (αS)-4-(1,1-dimethylethyl)-α-methylbenzeenpropanal | (αS)-4-(1,1-dimethylethyl)-α-methylbenzenepropanal | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||||
| 167288-95-1 | 188-165-6 | [(1e)-3-bromoprop-1-en-1-yl]tributylstannaan | [(1e)-3-bromoprop-1-en-1-yl]tributylstannane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 1557288-04-6 | 809-158-2 | [(2-aminoethoxy)methyl]tributylstannaan | [(2-aminoethoxy)methyl]tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 115375-60-5 | 806-821-8 | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(trifluormethylsulfonyloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]fenantreen-3-yl]acetaat | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethylsulfonyloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1853279-29-4 | 866-802-5 | [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluorpentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]fenantreen-3-yl]boorzuur | [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]boronic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 100045-83-8 | 808-345-6 | [(methoxymethoxy)methyl]tributylstannaan | [(methoxymethoxy)methyl]tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 29977-13-7 | 249-987-1 | [[N,N'-ethyleenbis[glycinaat]](2-)-N,N',O,O']cadmium | [[N,N'-ethylenebis[glycinato]](2-)-N,N',O,O']cadmium | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 85 | ||||||
| 65405-96-1 | 265-748-4 | [µ-[carbonato(2-)-O:O’]] dihydroxytrinikkel | [µ-[carbonato(2-)-O:O’]] dihydroxy trinickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 77253-67-9 | 278-649-6 | [1,1-2H2]-2,2,2-trifluorethaan-1-[2H]ol | [1,1-2H2]-2,2,2-trifluoroetane-1-[2H]ol | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 38668-12-1 | [1,1'-bifenyl]-4,4'-diamine, perchloraat | [1,1'-biphenyl]-4,4'-diamine, perchlorate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 56, 68 | |||||||
| 67292-34-6 | 625-604-7 | [1,1'-bis(difenylfosfino)ferroceen]dichloornikkel(II) | [1,1'-bis(diphenylphosphino)ferrocene]dichloronickel(II) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 14647-21-3 | 112-189-8 | [1,2-bis(difenylfosfino)ethaan]dibromonikkel(II) | [1,2-bis(diphenylphosphino)ethane]dibromonickel(II) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 903592-98-3 | 679-532-6 | [1,3-bis(2,6-diisopropylfenyl)imidazool-2-ylideen]trifenylfosfine nikkel(II)dichloride | [1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]triphenylphosphine nickel(II) dichloride | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 15629-93-3 | 112-188-2 | [1,3-bis(difenylfosfino)propaan]dibromonikkel | [1,3-bis(diphenylphosphino)propane]dibromonickel | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 13813-79-1 | 237-478-7 | [10B]orthoboorzuur | [10B]orthoboric acid | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 13813-78-0 | 627-827-5 | [11B]orthoboorzuur | [11B]orthoboric acid | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 23582-06-1 | 245-758-5 | [2-(difenylarsino)ethyl]difenylfosfine | [2-(diphenylarsino)ethyl]diphenylphosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 14055-02-8 | 237-893-3 | [29H,31H-ftalocyaninato(2-)-N29,N30,N31,N32]nikkel | [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 462996-04-9 | 103-340-9 | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]difenylfosfine | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl] diphenylphosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 911027-68-4 | [4-[(2-methyl-1-oxo-2-propen-1-yl)oxy]fenyl]difenyl-sulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, [4-[(2-methyl-1-oxo-2-propen-1-yl)oxy]phenyl]diphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 911027-69-5 | [4-[(2-methyl-1-oxo-2-propenyl)oxy]fenyl]difenyl-sulfonium, zout met tridecafluorhexaansulfonzuur (1:1) | sulfonium, [4-[(2-methyl-1-oxo-2-propenyl)oxy]phenyl]diphenyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 5806-89-3 | 227-365-0 | [4-[(4,6-diamino-1,3,5-triazine-2-yl)amino]fenyl]arsonzuur | [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12607-70-4 | 235-715-9 | [carbonato(2-)] tetrahydroxytrinikkel | [carbonato(2-)] tetrahydroxytrinickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 69011-06-9 | 273-688-5 | [ftalato(2-)]dioxotrilood | [phthalato(2-)]dioxotrilead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 264921-97-3 | 678-456-0 | [N-[1-[2-(2-pyridylcarboxamido)fenyl]ethylideen]glycinato]nikkel | [N-[1-[2-(2-pyridylcarboxamido)phenyl]ethylidene]glycinato]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 847654-16-4 | 679-701-4 | [N-[alfa-[2-(dibutylglycinamido)fenyl]benzylideen]glycinato]nikkel | [N-[alpha-[2-(dibutylglycinamido)phenyl]benzylidene]glycinato]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 847654-17-5 | 678-458-1 | [N-[alfa-[2-(piperidinoacetamido)fenyl]benzylideen]glycinato]nikkel | [N-[alpha-[2-(piperidinoacetamido)phenyl]benzylidene]glycinato]nickel | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 961-481-9 | 1-(1-nitrosopiperidine-2-yl)methanamine, trifluorazijnzuur | 1-(1-nitrosopiperidin-2-yl)methanamine, trifluoroacetic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 214353-17-0 | 433-580-2 | 1-(2-amino-5-chloorfenyl)-2,2,2-trifluor-1,1-ethaandiol hydrochloride [met 0,1 procent of meer 4-chlooraniline (EC-nr. 203-401-0)] | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride, [containing ≥ 0.1 % 4-chloroaniline (EC No 203-401-0)] | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 244235-47-0 | 627-083-1 | 1-(2-hydroxy-5-nonyl(vertakt)-fenyl)ethanon oxime | 1-(2-hydroxy-5-nonyl(branched)-phenyl)ethanone oxime | MVP 1 | 0,05 mg/Nm3 | 16-7-2020 | 56, 73 | ||||||
| 544418-04-4 | 620-596-1 | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyl)-3,1-benzoxazine-2,4(1H)-dion | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-3,1-benzoxazine-2,4(1H)-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 468-770-4 | 1-(4-butoxy-1-naftalenyl)tetrahydrothiofenium 1,1,2,2,3,3,4,4,4-nonafluor-1-butaansulfonaat | 1-(4-butoxy-1-naphthalenyl)tetrahydrothiophenium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | |||||
| 475207-59-1 | 641-758-8 | 1-(4-chloor-3-(trifluormethyl)fenyl)-3-(4-((2-(methylcarbamoyl)-4-pyridinyl)oxy)fenyl)urea mono(4-methylbenzeensulfonaat) | 1-(4-chloro-3-(trifluoromethyl)phenyl)-3-(4-((2-(methylcarbamoyl)pyridin-4-yl)oxy)phenyl)urea mono(4-methylbenzenesulfonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 865758-37-8 | 624-005-8 | 1-(4-methoxyfenyl)-1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]-1-fenylmethylchloride | 1-(4-methoxyphenyl)-1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl]-1-phenylmethyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 71356-38-2 | 275-354-4 | 1-(carboxylatomethyl)-1-(2-hydroxyethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluor-1-oxodecyl)piperazinium | 1-(carboxylatomethyl)-1-(2-hydroxyethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-1-oxodecyl)piperazinium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1462414-59-0 | 1-(carboxymethyl)-4-[2-[4-[4-(2,2-difenylethenyl)fenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]ethenyl]-chinolinium, tridecafluorhexaansulfonaat (1:1) | quinolinium, 1-(carboxymethyl)-4-[2-[4-[4-(2,2-diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]ethenyl]-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 882186-02-9 | 118-456-5 | 1-(diacetooxyjodo)-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzeen | 1-(diacetoxyiodo)-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 76733-77-2 | 1,1'-(2,2,2-trichloorethylideen)bis[2-methoxy-benzeen] | 1,1'-(2,2,2-trichloroethylidene)bis[2-methoxy-benzene] | Ja | MVP 1 | 0,05 mg/Nm3 | 1-7-2025 | 56 | ||||||
| 97416-84-7 | 306-832-3 | 1,1'-(isopropylideen)bis[3,5-dibroom-4-(2,3-dibroom-2-methylpropoxy)benzeen] | 1,1'-(isopropylidene)bis[3,5-dibromo-4-(2,3-dibromo-2-methylpropoxy)benzene] | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 56 | ||||||
| 65510-55-6 | 265-800-6 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-nonacosafluor-16-joodhexadecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-nonacosafluoro-16-iodohexadecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 307-60-8 | 206-205-3 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluor-12-jooddodecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 30046-31-2 | 250-014-8 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluor-14-joodtetradecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-14-iodotetradecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 2043-54-1 | 218-054-0 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluor-12-jooddodecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluoro-12-iodododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 65510-56-7 | 265-801-1 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluor-11-joodoundecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluoro-11-iodoundecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 142010-50-2 | 625-442-7 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluor-10-isocyanaatdecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-isocyanatodecane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 2043-53-0 | 218-053-5 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluor-10-jooddecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-iododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 484-450-7 | 1,1,1,2,2,3,3-heptafluor-3-methoxypropaan | 1,1,1,2,2,3,3-heptafluoro-3-methoxypropane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 3248-61-1 | 221-829-6 | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-tetracosafluor-12-jood-2-(trifluormethyl)dodecaan | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-tetracosafluoro-12-iodo-2-(trifluoromethyl)dodecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 811-97-2 | 212-377-0 | 1,1,1,2-tetrafluorethaan | norflurane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 28523-86-6 | 643-089-7 | 1,1,1,3,3,3-hexafluor-2-(fluormethoxy)propaan | 1,1,1,3,3,3-hexafluoro-2-(fluoromethoxy)propane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 690-39-1 | 425-320-1 | 1,1,1,3,3,3-hexafluorpropaan | 1,1,1,3,3,3-hexafluoropropane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 382-26-3 | 609-534-4 | 1,1,1,3,3-pentafluor-3-methoxy-2-(trifluormethyl)-propaan | propane, 1,1,1,3,3-pentafluoro-3-methoxy-2-(trifluoromethyl)- | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 406-58-6 | 430-250-1 | 1,1,1,3,3-pentafluorbutaan | 1,1,1,3,3-pentafluorobutane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 17928-28-8 | 241-867-7 | 1,1,1,3,5,5,5-heptamethyl-3-[(trimethylsilyl)oxy]trisiloxaan | 1,1,1,3,5,5,5-heptamethyl-3-[(trimethylsilyl)oxy]trisiloxane | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 80 | |||||
| 420-46-2 | 206-996-5 | 1,1,1-trifluorethaan | 1,1,1-trifluorethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 3288-80-0 | 628-240-7 | 1,1,1-trimethylhydrazinium jodide | 1,1,1-trimethylhydrazinium iodide | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 971-662-4 | 1,1,2,2,2-pentafluorethaansulfonzuur | 1,1,2,2,2-pentafluoroethanesulfonic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 375-72-4 | 206-792-6 | 1,1,2,2,3,3,4,4,4-nonafluorbutaan-1-sulfonyl fluoride | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonyl fluoride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 68, 95 | ||||
| 34454-97-2 | 252-043-1 | 1,1,2,2,3,3,4,4,4-nonafluor-N-(2-hydroxyethyl)-N-methylbutaan-1-sulfonamide | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 68, 95 | ||||
| 1265205-95-5 | 996-023-7 | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluor-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-N-(trideuteriomethyl)octaan-1-sulfonamide | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-N-(trideuteriomethyl)octane-1-sulfonamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 679-86-7 | 633-257-8 | 1,1,2,2,3-pentafluorpropaan | 1,1,2,2,3-pentafluoropropane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 37853-59-1 | 253-692-3 | 1,1'-[ethaan-1,2-diylbisoxy]bis[2,4,6-tribroombenzeen] | 1,1'-[ethane-1,2-diylbisoxy]bis[2,4,6-tribromobenzene] | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 80 | |||||
| 93776-00-2 | 297-925-7 | 1,1'-[oxybis[(1-methylethyleen)oxy]]bis[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluorpentadecaan-2-ol] | 1,1'-[oxybis[(1-methylethylene)oxy]]bis[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-ol] | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 29806-76-6 | 1,1'-bipifenyl-4,4'-diamine, monoperchloraat | 1,1'-biphenyl-4,4'-diamine, monoperchlorate | MVP 1 | 0,05 mg/Nm3 | 2-1-2022 | 56, 68 | |||||||
| 865758-47-0 | 622-052-9 | 1,1-di-(4-methoxyfenyl)-1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]methanol | 1,1-di-(4-methoxyphenyl)-1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl]methanol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 865758-36-7 | 623-168-2 | 1,1-di-(4-methoxyfenyl)-1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]methylchloride | 1,1-di-(4-methoxyphenyl)-1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl]methyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 75-35-4 | 200-864-0 | 1,1-dichlooretheen | 1,1-dichloroethylene | Ja | gO.1 | 20 mg/Nm3 | 8-7-2025 | 44 | |||||
| 132248-58-9 | 680-430-9 | 1,1-dideuterio-2,2,2-trifluorethanol | 1,1-dideuterio-2,2,2-trifluoroethanol | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 2356-62-9 | 1,2,2,2-tetrafluorethyl (trifluormethyl)ether | 1,1,1,2-tetrafluoro-2-(trifluoromethoxy)ethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 337513-72-1 | 881-746-1 | 1,2,3,4,5-pentabroom-6-(2,4,5-tribromofenoxy)benzeen | 1,2,3,4,5-pentabromo-6-(2,4,5-tribromophenoxy)benzene | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 13, 56 | ||||||
| 39001-02-0 | 694-806-5 | 1,2,3,4,6,7,8,9-octachloordibenzofuraan | 1,2,3,4,6,7,8,9-octachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 3268-87-9 | 694-813-3 | 1,2,3,4,6,7,8,9-octachlorodibenzodioxine | 1,2,3,4,6,7,8,9-octachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 35822-46-9 | 694-835-3 | 1,2,3,4,6,7,8-heptachloordibenzodioxine | 1,2,3,4,6,7,8-heptachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 67562-39-4 | 694-815-4 | 1,2,3,4,6,7,8-heptachloordibenzofuraan | 1,2,3,4,6,7,8-heptachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 55673-89-7 | 694-836-9 | 1,2,3,4,7,8,9-heptachloordibenzofuraan | 1,2,3,4,7,8,9-heptachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 39227-28-6 | 694-767-4 | 1,2,3,4,7,8-hexachloordibenzodioxine | 1,2,3,4,7,8-hexachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 70648-26-9 | 1,2,3,4,7,8-hexachloordibenzofuraan | 1,2,3,4,7,8-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57117-44-9 | 694-837-4 | 1,2,3,6,7,8-hexachloordibenzofuraan | 1,2,3,6,7,8-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 57653-85-7 | 694-811-2 | 1,2,3,6,7,8-hexachloordibenzo-p-dioxine | 1,2,3,6,7,8-hexachlorodibenzo-p-dioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 19408-74-3 | 694-810-7 | 1,2,3,7,8,9-hexachloordibenzodioxine | 1,2,3,7,8,9-hexachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 72918-21-9 | 694-765-3 | 1,2,3,7,8,9-hexachloordibenzofuraan | 1,2,3,7,8,9-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 40321-76-4 | 1,2,3,7,8-pentachloordibenzodioxine | 1,2,3,7,8-pentachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57117-41-6 | 1,2,3,7,8-pentachloordibenzofuraan | 1,2,3,7,8-pentachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 87-61-6 | 201-757-1 | 1,2,3-trichloorbenzeen | 1,2,3-trichlorobenzene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 96-18-4 | 202-486-1 | 1,2,3-trichloorpropaan | 1,2,3-trichloropropane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 288-88-0 | 206-022-9 | 1,2,4-triazool | 1,2,4-triazole | Ja | MVP 2 | 1 mg/Nm3 | 13-7-2021 | 80 | |||||
| 120-82-1 | 204-428-0 | 1,2,4-trichloorbenzeen | 1,2,4-trichlorobenzene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 3194-55-6 | 221-695-9 | 1,2,5,6,9,10-hexabroomcyclododecaan | 1,2,5,6,9,10-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||
| 68515-51-5 | 271-094-0 | 1,2-benzeendicarbonzuur, di-C6-10-alkyl esters | 1,2-benzenedicarboxylic acid, di-C6-10-alkyl esters | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||
| 1,2-benzeendicarbonzuur, di-C6-10-alkylesters of gemengde decyl- en hexyl- en octyl-diësters met ≥ 0,3% dihexylftalaat (EC No. 201-559-5) | 1,2-benzenedicarboxylic acid, di-C6-10-alkyl esters or mixed decyl and hexyl and octyl diesters with ≥ 0.3% of dihexyl phthalate (EC No. 201-559-5) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56 | |||||||
| 71888-89-6 | 276-158-1 | 1,2-benzeendicarbonzuur, di-C6-8-vertakte alkylesters, C7-rijk | 1,2-benzenedicarboxylic acid, di-C6-8-branched alkyl esters, C7-rich | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68515-42-4 | 271-084-6 | 1,2-benzeendicarbonzuur, di-C7-11 vertakte en lineaire alkylesters | 1,2-benzenedicarboxylic acid, di-C7-11-branched and linear alkyl esters | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68515-50-4 | 271-093-5 | 1,2-benzeendicarbonzuur, dihexyl ester, vertakte en lineaire alkylesters | 1,2-benzenedicarboxylic acid, dihexyl ester, branched and linear | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | |||||
| 84777-06-0 | 284-032-2 | 1,2-benzeendicarbonzuur, dipentylester, vertakt en lineair | 1,2-benzenedicarboxylic acid, dipentylester, branched and linear | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68648-93-1 | 272-013-1 | 1,2-benzeendicarbonzuur, mengsel van decyl en hexyl en octyl diesters | 1,2-benzenedicarboxylic acid, mixed decyl and hexyl and octyl diesters | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||
| 14647-23-5 | 629-489-4 | 1,2-bis(difenylfosfino)ethaan nikkel(II) chloride | 1,2-bis(diphenylphosphino)ethane nickel(II) chloride | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 22581-63-1 | 245-102-8 | 1,2-dibroom-[1,1,2,2-2H4]ethaan | 1,2-dibromo-[1,1,2,2-2H4]ethane | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 96-12-8 | 202-479-3 | 1,2-dibroom-3-chloorpropaan | 1,2-dibromo-3-chloropropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 189084-61-5 | 621-543-5 | 1,2-dibroom-4-(2,4-dibroomfenoxy)benzeen | 1,2-dibromo-4-(2,4-dibromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 56 | |||||
| 189084-62-6 | 620-888-9 | 1,2-dibroom-4-(2,6-dibroomfenoxy)benzeen | 1,2-dibromo-4-(2,6-dibromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 56 | |||||
| 93703-48-1 | 621-837-3 | 1,2-dibroom-4-(3,4-dibroomfenoxy)benzeen | 1,2-dibromo-4-(3,4-dibromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 56 | |||||
| 106-93-4 | 203-444-5 | 1,2-dibroomethaan | 1,2-dibromoethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 33458-49-0 | 686-127-8 | 1,2-dibroomethaan-13C2 | 1,2-dibromoethane-13C2 | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 107-06-2 | 203-458-1 | 1,2-dichloorethaan | 1,2-dichloroethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 78-87-5 | 201-152-2 | 1,2-dichloorpropaan | 1,2-dichloropropane | Ja | MVP 2 | 1 mg/Nm3 | 4-1-2017 | ||||||
| 629-14-1 | 211-076-1 | 1,2-diethoxyethaan | 1,2-diethoxyethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 110-71-4 | 203-794-9 | 1,2-dimethoxyethaan | 1,2-dimethoxyethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 86051-75-4 | 107-205-5 | 1,2-dimethyl-5-(tributylstannyl)imidazool | 1,2-dimethyl-5-(tributylstannyl)imidazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 540-73-8 | 1,2-dimethylhydrazine | 1,2-dimethylhydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||||
| 122-60-1 | 204-557-2 | 1,2-epoxy-3-fenoxypropaan | phenyl glycidyl ether | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25637-99-4 | 247-148-4 | 1,3,5,7,9,11-hexabroomcyclododecaan | 1,3,5,7,9,11-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||
| 36065-30-2 | 252-859-8 | 1,3,5-tribroom-2-(2,3-dibroom-2-methylpropoxy)benzeen | 1,3,5-tribromo-2-(2,3-dibromo-2-methylpropoxy)benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 189084-63-7 | 621-541-4 | 1,3,5-tribroom-2-(4-broomfenoxy)benzeen | 1,3,5-tribromo-2-(4-bromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 56 | |||||
| 108-70-3 | 203-608-6 | 1,3,5-trichloorbenzeen | 1,3,5-trichlorobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 59653-74-6 | 423-400-0 | 1,3,5-tris-[(2S en 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H3H5H)-trion | 1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 6426-67-1 | 613-540-2 | 1,3,6-naftaleentrisulfonzuur, 8-hydroxy-7-((4'-((2-hydroxy-1-naftaleen)azo)-(1,1'-bifenyl)-4-yl)-azo)-, trinatriumzout | 1,3,6-Naphthalenetrisulfonic acid, 8-hydroxy-7-((4'-((2-hydroxy-1-naphthalenyl)azo)-(1,1'-biphenyl)-4-yl)-azo)-, trisodium salt | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 56, 68 | ||||||
| 24344-61-4 | 693-893-7 | 1,3-bis(tributylstannyl)benzeen | 1,3-bis(tributylstannyl)benzene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 106-99-0 | 203-450-8 | 1,3-butadieen | 1,3-butadiene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 96-23-1 | 202-491-9 | 1,3-dichloor-2-propanol | 1,3-dichloro-2-propanol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 148240-89-5 | 1,3-propaandiol, 2,2-bis[[(γ-ω-perfluor-C10-20-alkyl) thio]methyl] -derivaten, fosfaten, ammoniumzouten | 1,3-propanediol, 2,2-bis[[(γ-ω-perfluoro-C10-20-alkyl)thio]methyl] derivs., phosphates, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 148240-85-1 | 1,3-propaandiol, 2,2-bis[[(γ-ω-perfluor-C4–10-alkyl) thio]methyl] derivaten, fosfaten, ammoniumzouten | 1,3-propanediol, 2,2-bis[[(γ-ω-perfluoro-C4–10-alkyl)thio]methyl] derivatives, phosphates, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 148240-87-3 | 1,3-propaandiol, 2,2-bis[[(γ-ω-perfluor-C6–12-alkyl) thio]methyl] derivaten, fosfaten, ammoniumzouten | 1,3-propanediol, 2,2-bis[[(γ-ω-perfluoro-C6–12-alkyl)thio]methyl] derivatives, phosphates, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1120-71-4 | 214-317-9 | 1,3-propaansulton | 1,3-propanesultone | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 57-57-8 | 200-340-1 | 1,3-propiolacton | 3-propanolide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 2475-45-8 | 219-603-7 | 1,4,5,8-tetraaminoantrachinon | 1,4,5,8-tetraaminoanthraquinone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68953-84-4 | 273-227-8 | 1,4-benzeendiamine, N,N'-gemengde fenyl- en tolylderivaten | 1,4-benzenediamine, N,N'-mixed Ph and tolyl derivatives | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | |||||
| 17151-51-8 | 803-078-1 | 1,4-bis(tributylstannyl)benzeen | 1,4-bis(tributylstannyl)benzene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 764-41-0 | 212-121-8 | 1,4-dichloorbut-2-een | 1,4-dichlorobut-2-ene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 123-91-1 | 204-661-8 | 1,4-dioxaan | 1,4-dioxane | Ja | Ja | gO.1 | 20 mg/Nm3 | 12-7-2021 | 44 | ||||
| 4904-61-4 | 225-533-8 | 1,5,9-cyclododecatrieen | 1,5,9 cyclododecatriene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1258836-72-4 | 868-354-6 | 1,5-dimethyl-6-thioxo-3-[2,2,7-trifluor-3,4-dihydro-3-oxo-4-(prop-2-ynyl)-2H-1,4-benzoxazin-6-yl]-1,3,5-triazinaaan-2,4-dion | 1,5-dimethyl-6-thioxo-3-[2,2,7-trifluoro-3,4-dihydro-3-oxo-4-(prop-2-ynyl)-2H-1,4-benzoxazin-6-yl]-1,3,5-triazinane-2,4-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 42397-64-8 | 636-984-9 | 1,6-dinitropyreen | 1,6-dinitropyrene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 42397-65-9 | 636-985-4 | 1,8-dinitropyreen | 1,8-dinitropyrene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 94159-80-5 | 303-261-1 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluortridecan-2-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecan-2-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94159-79-2 | 303-260-6 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluorpentadecaan-2-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94159-82-7 | 303-263-2 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-14-(trifluormethyl)pentadecaan-2-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-14-(trifluoromethyl)pentadecan-2-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94159-83-8 | 303-264-8 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluor-12-(trifluormethyl)tridecan-1-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-12-(trifluoromethyl)tridecan-1-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 649561-66-0 | 623-147-8 | 1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]-1,1-difenylmethanol | 1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl)-1,1-diphenylmethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 955946-56-2 | 815-094-6 | 1-{[3-(4-{[(2R)-4-[5-fluor-2-(methyloxy)fenyl]-2-hydroxy-4-methyl-2-(trifluormethyl)pentyl]amino}-6-methyl-1H-indazool-1-yl)fenyl]carbonyl}-D-prolinamide | 1-{[3-(4-{[(2R)-4-[5-fluoro-2-(methyloxy)phenyl]-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]amino}-6-methyl-1H-indazol-1-yl)phenyl]carbonyl}-D-prolinamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 4808-24-6 | 225-368-1 | 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrofenarsazine | 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 2865-70-5 | 220-684-6 | 10-chloor-10H-fenoxarsine | 10-chloro-10H-phenoxarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 211254-73-8 | 664-453-1 | 11ß-(4-acetylfenyl)-17ß-hydroxy-17alfa-(1,1,2,2,2-pentafluorethyl)estra-4,9-dieen-3-on | 11ß-(4-acetylphenyl)-17ß-hydroxy-17alpha-(1,1,2,2,2-pentafluorethyl)estra-4,9-dien-3-on | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 2991-07-3 | 112-277-6 | 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,19-heptadecafluornonadecaanthiol | 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,19-heptadecafluorononadecanethiol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 20636-48-0 | 14-(4-nonylfenoxy)-3,6,9,12-tetraoxatetradecaan-1-ol | 14-(4-nonylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 26264-02-8 | 247-555-7 | 14-(nonylfenoxy)-3,6,9,12-tetraoxatetradecaan-1-ol | 14-(nonylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 34166-38-6 | 17-(4-nonylfenoxy)-3,6,9,12,15-pentaoxaheptadecaan-1-ol | 17-(4-nonylphenoxy)-3,6,9,12,15- pentaoxaheptadecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 27177-01-1 | 17-(nonylfenoxy)-3,6,9,12,15-pentaoxaheptadecaan-1-ol | 17-(nonylphenoxy)-3,6,9,12,15-pentaoxaheptadecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | ||||||
| 928049-42-7 | 19-[4-(1,1-dimethylethyl)fenyl]-6,7,9,10,12,13-hexahydro-dibenzo[k,n][1,4,7,10,13]tetraoxathiacyclopentadecinium, tridecafluorhexaansulfonaat (1:1) | dibenzo[k,n][1,4,7,10,13]tetraoxathiacyclopentadecinium, 19-[4-(1,1-dimethylethyl)phenyl]-6,7,9,10,12,13-hexahydro-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 148961-88-0 | 683-415-5 | 1-benzo[b]thien-2-yltributylstannaan | 1-benzo[b]thien-2-yltributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 206560-77-2 | 999-196-7 | 1-broom-4-(heptadecafluoroctyl)benzeen | 1-bromo-4-(heptadecafluorooctyl)benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 307-43-7 | 206-201-1 | 1-broomhenicosafluordecaan | 1-bromohenicosafluorodecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 106-94-5 | 203-445-0 | 1-broompropaan | 1-bromopropane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 2837-89-0 | 220-629-6 | 1-chloor-1,2,2,2-tetrafluorethaan | 1,1,1,2-tetrafluoro-2-chloroethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 75-88-7 | 200-912-0 | 1-chloor-2,2,2-trifluorethaan | 1-chloro-2,2,2-trifluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 251099-16-8 | 1-decanaminium, N-decyl-N,N-dimethyl-, zout met 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluor-1-octaansulfonzuur (1:1) | 1-decanaminium, N-decyl-N,N-dimethyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonic acid (1:1) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | |||||
| 57678-03-2 | 1-decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluor-, 1-(diwaterstof fosfaat) | 1-decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-, 1-(dihydrogen phosphate) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 433-27-2 | 207-087-6 | 1-ethoxy-2,2,2-trifluorethanol | 1-ethoxy-2,2,2-trifluoroethanol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 754-96-1 | 670-426-5 | 1H,1H,10H,10H-perfluordecaan-1,10-diol | 1H,1H,10H,10H-perfluorodecane-1,10-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 120226-60-0 | 1H,1H,2H,2H-perfluordodecaansulfonzuur | 1H,1H,2H,2H-perfluorododecanesulphonicacid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 757124-72-4 | 816-391-3 | 1H,1H,2H,2H-perfluorohexaansulfonzuur | 1H,1H,2H,2H-perfluorohexanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 355-47-5 | 625-098-8 | 1H,1H-perfluornonylamine | 1H,1H-perfluorononylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 307-29-9 | 671-163-9 | 1H,1H-perfluoroctylamine | 1H,1H-perfluorooctylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 300-88-9 | 1-hepteen-1-arsenigzuur, 2-chloor-, monoammonium zout | 1-heptene-1-arsonic acid, 2-chloro-, monoammonium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | ||||||
| 164656-23-9 | 638-758-5 | 1H-indeno(5,4-f)quinoline-7-carboxamide, N-(2,5-bis(trifluormethyl)fenyl)-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aR)- | 1H-indeno(5,4-f)quinoline-7-carboxamide, N-(2,5-bis(trifluoromethyl)phenyl)-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aR)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 255065-25-9 | 1-methoxy-2-[(1R)-2,2,2-trichloor-1-(4-methoxyfenyl)ethyl]-benzeen | 1-methoxy-2-[(1R)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]-benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 1-7-2025 | 56 | ||||||
| 255065-26-0 | 1-methoxy-2-[(1S)-2,2,2-trichloor-1-(4-methoxyfenyl)ethyl]-benzeen | 1-methoxy-2-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]-benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 1-7-2025 | 56 | ||||||
| 59424-81-6 | 1-methoxy-3-[2,2,2-trichloor-1-(4-methoxyfenyl)ethyl]-benzeen | 1-methoxy-3-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]-benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 56 | ||||||
| 118486-97-8 | 624-775-5 | 1-methyl-2-(tributylstannyl)-1H-pyrol | 1-methyl-2-(tributylstannyl)-1H-pyrrole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 70-25-7 | 200-730-1 | 1-methyl-3-nitro-1-nitrosoguanidine | 1-methyl-3-nitro-1-nitrosoguanidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 446285-73-0 | 689-534-9 | 1-methyl-4-(tributylstannyl)-1H-imidazool | 1-methyl-4-(tributylstannyl)-1H-imidazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 209860-87-7 | 682-458-7 | 1-methylethyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluor-4-fenoxy-1-butenyl]-3,5-dihydroxycyclopentyl}-5-heptenoaat | 1-methylethyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-butenyl]-3,5-dihydroxycyclopentyl}-5-heptenoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 90-12-0 | 201-966-8 | 1-methylnaftaleen | 1-methylnaphthalene | MVP 1 | 0,05 mg/Nm3 | 10-2-2022 | 10, 48 | ||||||
| 423-56-3 | 670-435-4 | 1-nonanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluor- | 1-nonanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro- | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 53517-98-9 | 1-propaanaminium, N,N,N-trimethyl-3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl) amino]-, chloride (1:1) | 1-propanaminium,N,N,N-trimethyl-3- [(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl) amino]-, chloride (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 89685-61-0 | 1-propaansulfonzuur, 3-[ethyl (2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl)amino]-, natriumzout (1 :1) | 1-propanesulfonic acid,3-[ethyl (2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl)amino]-,sodium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 360-53-2 | 671-732-1 | 1-propeen, 1,3,3,3-tetrafluor-1-methoxy-2-(trifluormethyl)- | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 208934-35-4 | 107-067-6 | 1-trifenylmethyl-4-(tributylstannyl)imidazool | 1-triphenylmethyl-4-(tributylstannyl)imidazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 1072-63-5 | 214-012-0 | 1-vinylimidazool | 1-vinylimidazole | Ja | Ja | MVP 2 | 1 mg/Nm3 | 12-10-2018 | |||||
| 1282041-94-4 | 826-984-9 | 2-(1,1-difluorethyl)-5-methyl-N-[4-(pentafluor-λ6-sulfanyl)fenyl] [1,2,4]triazool[1,5-a]pyrimidin-7-amine | 2-(1,1-difluoroethyl)-5-methyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl] [1,2,4]triazolo[1,5-a]pyrimidin-7-amine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 186309-28-4 | 2-(2,4-dimethyl-3-cyclohexen-1-yl)-5-methyl-5-(1-methylpropyl)-1,3-dioxaan | 2-(2,4-dimethyl-3-cyclohexen-1-yl)-5-methyl-5-(1-methylpropyl)-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 9036-19-5 | 618-541-1 | 2-(2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]ethoxy)ethanol | 2-(2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 29-03-2019 | 56 | |||||
| 111-41-1 | 203-867-5 | 2-(2-aminoethylamino)ethanol | 2-(2-aminoethylamino)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3147-75-9 | 221-573-5 | 2-(2H-benzotriazool-2-yl)-4-(1,1,3,3-tetramethylbutyl)fenol | 2-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | |||||
| 36437-37-3 | 253-037-1 | 2-(2H-benzotriazool-2-yl)-4-(tert-butyl)-6-(sec-butyl)fenol | 2-(2H-benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 22-2-2016 | ||||||
| 25973-55-1 | 247-384-8 | 2-(2H-benzotriazool-2-yl)-4,6-di-tert-pentylfenol | 2-(2H-benzotriazol-2-yl)-4,6-ditertpentylphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2015 | |||||
| 111-77-3 | 203-906-6 | 2-(2-methoxyethoxy)ethanol | 2-(2-methoxyethoxy)ethanol | Ja | gO.2 | 50 mg/Nm3 | 8-7-2022 | 44 | |||||
| 929046-33-3 | 629-865-8 | 2-(3,5-bis(trifluormethyl)fenyl)-N-(4-(4-fluor-2-methylfenyl)-6-((7S,9aS)-7-(hydroxymethyl)hexahydropyrazino[2,1-c][1,4]oxazin-8(1H)-yl)pyridin-3-yl)-N,2-dimethylpropanamide | 2-(3,5-bis(trifluoromethyl)phenyl)-N-(4-(4-fluoro-2-methylphenyl)-6-((7S,9aS)-7-(hydroxymethyl)hexahydropyrazino[2,1-c][1,4]oxazin-8(1H)-yl)pyridin-3-yl)-N,2-dimethylpropanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 104-35-8 | 2-(4-nonylfenoxy)ethanol | 2-(4-nonylphenoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 56 | ||||||
| 80-54-6 | 201-289-8 | 2-(4-tert-butylbenzyl)propionaldehyde | 2-(4-tert-butylbenzyl)propionaldehyde | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | ||||
| 57041-67-5 | 688-023-8 | 2-(difluormethoxy)-1,1,1,2-tetrafluorethaan | 2-(difluoromethoxy)-1,1,1,2-tetrafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 119344-86-4 | 438-340-0 | 2-(dimethylamino)-2-[(4-methylfenyl)methyl]-1-[4-(morfoline-4-yl)fenyl]-1-butanon | 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(morpholin-4-yl)phenyl]butan-1-one | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | ||||
| 85005-55-6 | 284-987-5 | 2-(isononylfenoxy)ethanol | 2-(isononylphenoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 27986-36-3 | 248-762-5 | 2-(nonylfenoxy)ethanol | 2-(nonylphenoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 1204580-71-1 | 882-090-9 | 2-(tributylstannyl)-4-chloorpyridine | 2-(tributylstannyl)-4-chloropyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 611168-63-9 | 689-502-4 | 2-(tributylstannyl)-5-chloorpyridine | 2-(tributylstannyl)-5-chloropyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 118486-94-5 | 629-205-9 | 2-(tributylstannyl)furaan | 2-(tributylstannyl)furan | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 205371-27-3 | 625-510-6 | 2-(tributylstannyl)pyrazine | 2-(tributylstannyl)pyrazine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 153435-63-3 | 687-738-2 | 2-(tributylstannyl)pyrimidine | 2-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 8004-59-9 | 616-837-5 | 2,[?]-naftaleendisulfonzuur, 4-[[4-[(4-amino-1-naftaleen)azo]-1-naftaleen]azo]-, dinatriumzout | 2,[?]-naphthalenedisulfonic acid, 4-[[4-[(4-amino-1-naphthalenyl)azo]-1-naphthalenyl]azo]-, disodium salt | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 56, 68 | ||||||
| 1116-54-7 | 214-237-4 | 2,2'-(nitrosoimino)bisethanol | 2,2'-(nitrosoimino)bisethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 75-89-8 | 200-913-6 | 2,2,2-trifluorethanol | 2,2,2-trifluoroethanol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 375-01-9 | 206-782-1 | 2,2,3,3,4,4,4-heptafluor-1-butanol | 2,2,3,3,4,4,4-heptafluorobutan-1-ol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 140-831-7 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-N-{3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctanoïl)amino]propyl}octaanamide | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-{3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]propyl}octanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | ||||||
| 307-30-2 | 206-197-1 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaan-1-ol | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 3934-23-4 | 223-509-1 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctyl methacrylaat | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl methacrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 2328024-56-0 | 977-474-9 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2,3,4,5,6-13C6)decaanzuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2,3,4,5,6-13C6)decanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 960315-51-9 | 998-847-2 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluor(1,2-13C2)undecaanzuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoro(1,2-13C2)undecanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 307-78-8 | 626-276-8 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluordecaandizuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 376-18-1 | 206-806-0 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonaan-1-ol | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 76-21-1 | 200-944-5 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonaanzuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-oic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 10331-08-5 | 977-267-3 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluor-1-octanol | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 7383-71-3 | 230-957-1 | 2,2,3,3-tetrafluorpropylacrylaat | 2,2,3,3-tetrafluoropropyl acrylate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 207122-16-5 | 2,2',3,4,4',5',6-heptabroomdifenylether | heptabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 919005-14-4 | 700-835-7 | 2,2,3-trifluor-3-[1,1,2,2,3,3-hexafluor-3-(trifluormethoxy)propoxy]propaanzuur | 2,2,3-trifluoro-3-[1,1,2,2,3,3-hexafluoro-3-(trifluormethoxy)propoxy]propanoic acid | Ja | MVP 2 | 1 mg/Nm3 | 08-06-2026 | 95, 124 | |||||
| 68631-49-2 | 2,2',4,4',5,5'-hexabroomdifenylether | hexabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 207122-15-4 | 2,2',4,4',5,6'-hexabroomdifenylether | hexabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 60348-60-9 | 2,2',4,4',5-pentabroomdifenylether | pentabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 189084-64-8 | 690-350-6 | 2,2',4,4',6-pentabroomdifenylether | 2,2',4,4',6-pentabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 30-10-2025 | 35 | ||||
| 5436-43-1 | 2,2',4,4'-tetrabroomdifenylether | 2,2',4,4'-tetrabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 79-94-7 | 201-236-9 | 2,2',6,6'-tetrabroom-4,4'-isopropylideendifenol | 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 926-564-6 | 2,2',6,6'-tetrabroom-4,4'-isopropylideendifenol, oligomerische reactieproducten met propyleenoxide en n-butylglycidylether | 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol, oligomeric reaction products with propylene oxide and n-butyl glycidyl ether | MVP 1 | 0,05 mg/Nm3 | 25-9-2023 | 13, 56 | |||||||
| 14849-23-1 | 238-911-2 | 2,2'-[ethyleenbis(oxy)]bis[1,3,2-dioxarsolaan] | 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1464-53-5 | 215-979-1 | 2,2'-bioxiraan | 2,2'-bioxirane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 3296-90-0 | 221-967-7 | 2,2-bis(broommethyl)propaan-1,3-diol | 2,2-bis(bromomethyl)propane-1,3-diol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 56 | ||||
| 306-83-2 | 206-190-3 | 2,2-dichloor-1,1,1-trifluorethaan | 2,2-dichloro-1,1,1-trifluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 36483-57-5 | 253-057-0 | 2,2-dimethyl-1-propanol, tribroomderivaat | 2,2-dimethylpropan-1-ol, tribromo derivative | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||
| 13252-13-6 | 236-236-8 | 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propaanzuur | 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 69, 95 | ||||
| 799-974-4 | 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propaanzuur, zijn zouten en zijn acylhaliden | 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoic acid, its salts and its acyl halides | Ja | Ja | MVP 2 | 1 mg/Nm3 | 17-7-2019 | 95 | |||||
| 2062-98-8 | 218-173-8 | 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propionyl fluoride | 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propionyl fluoride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 95 | ||||
| 359-49-9 | 671-742-6 | 2,3,3,3-tetrafluoropropaanzuur | 2,3,3,3-tetrafluoropropanoic acid | Ja | MVP 2 | 1 mg/Nm3 | 08-06-2026 | 95, 124 | |||||
| 754-12-1 | 468-710-7 | 2,3,3,3-tetrafluorpropeen | 2,3,3,3-tetrafluoropropene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 60851-34-5 | 2,3,4,6,7,8-hexachloordibenzofuraan | 2,3,4,6,7,8-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57117-31-4 | 2,3,4,7,8-pentachloordibenzofuraan | 2,3,4,7,8-pentachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 76523-40-5 | 809-723-3 | 2,3,7,8-tetrachloordibenzo[b,e][1,4]dioxine-13C12 | 2,3,7,8-tetrachlorodibenzo[b,e][1,4]dioxin-13C12 | ERS | 0,05 ng TEQ/Nm3 | 19-8-2024 | 68 | ||||||
| 1746-01-6 | 217-122-7 | 2,3,7,8-tetrachloordibenzodioxine | 2,3,7,8-tetrachlorodibenzo-p-dioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 51207-31-9 | 2,3,7,8-tetrachloordibenzofuraan | 2,3,7,8-tetrachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 96-13-9 | 202-480-9 | 2,3-dibroompropaan-1-ol | 2,3-dibromopropan-1-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 602-01-7 | 210-013-5 | 2,3-dinitrotolueen | 2,3-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 57044-25-4 | 404-660-4 | 2,3-epoxypropaan-1-ol | R-2,3-epoxy-1-propanol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 4016-14-2 | 223-672-9 | 2,3-epoxypropyl isopropyl ether | 2,3-epoxypropyl isopropyl ether | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 80 | |||||
| 106-91-2 | 203-441-9 | 2,3-epoxypropylmethacrylaat | 2,3-epoxypropyl methacrylate | Ja | MVP 2 | 1 mg/Nm3 | 30-05-2017 | ||||||
| 3033-77-0 | 221-221-0 | 2,3-epoxypropyl-trimethylammoniumchloride | 2,3-epoxypropyltrimethylammonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 41318-75-6 | 868-402-6 | 2,4,4'-tribroomdifenylether | 2,4,4'-tribromodiphenyl ether | Ja | ERS | 0,05 ng TEQ/Nm3 | 30-10-2025 | 35 | |||||
| 16606-02-3 | 621-296-3 | 2,4',5-trichloorbifenyl | 2,4',5-trichlorobiphenyl | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 29-11-2024 | 56, 108 | ||||
| 137-17-7 | 205-282-0 | 2,4,5-trimethylaniline | 2,4,5-trimethylaniline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 21436-97-5 | 2,4,5-trimethylanilinehydrochloride | 2,4,5-trimethylaniline hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 12505-67-8 | 2,4,6,8,9,10-Hexaoxa-1,3,5,7-tetraarsatricyclo[3.3.1.13,7]decaan | 2,4,6,8,9,10-Hexaoxa-1,3,5,7-tetraarsatricyclo[3.3.1.13,7]decane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 2374-14-3 | 219-154-7 | 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluorpropyl)cyclotrisiloxaan | 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)cyclotrisiloxane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 21674-38-4 | 244-521-3 | 2,4,6-tris(pentadecafluorheptyl)-1,3,5-triazine | 2,4,6-tris(pentadecafluoroheptyl)-1,3,5-triazine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 732-26-3 | 211-989-5 | 2,4,6-tri-tert-butylfenol | 2,4,6-tri-tert-butylphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 615-05-4 | 210-406-1 | 2,4-diaminoanisool | 4-methoxy-m-phenylenediamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39156-41-7 | 254-323-9 | 2,4-diaminoanisoolsulfaat | 2,4-diaminoanisole sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 121-14-2 | 204-450-0 | 2,4-dinitrotolueen | 2,4-dinitrotoluene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 3864-99-1 | 223-383-8 | 2,4-di-tert-butyl-6-(5-chloorbenzotriazool-2-yl)fenol | 2,4-di-tert-butyl-6-(5-chlorobenzotriazol-2-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 22-2-2016 | ||||||
| 30667-99-3 | 690-154-0 | 2,4'-methoxychloor | 2,4'-methoxychlor | Ja | MVP 1 | 0,05 mg/Nm3 | 1-7-2025 | 56 | |||||
| 95-80-7 | 202-453-1 | 2,4-tolueendiamine | 4-methyl-m-phenylenediamine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 145483-63-2 | 687-043-4 | 2,5-bis(tri-n-butylstannyl)thiofeen | 2,5-bis(tri-n-butylstannyl)thiophene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 89-61-2 | 201-923-3 | 2,5-dichloornitrobenzeen | 1,4-dichloro-2-nitrobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 80 | |||||
| 619-15-8 | 210-581-4 | 2,5-dinitrotolueen | 2,5-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84282-36-0 | 282-682-1 | 2,6-dimethyl-4-(1-naftyl)pyryliumhexafluorarsenaat | 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 84304-15-4 | 282-700-8 | 2,6-dimethyl-4-fenylpyryliumhexafluorarsenaat | 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 606-20-2 | 210-106-0 | 2,6-dinitrotolueen | 2,6-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1668-00-4 | 216-788-6 | 2,7-(bis(2-arsonofenylazo))-1,8-dihydroxynaftaleen-3,6-disulfonzuur | 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 72319-19-8 | 2,7-naftaleendisulfonzuur, nikkel(II)zout | 2,7-naphthalenedisulfonic acid, nickel(II) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 676367-05-8 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 343934-04-3 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-rel-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-rel-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-09-2 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 343934-05-4 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-rel-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-rel-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-04-7 | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-08-1 | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-03-6 | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-07-0 | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-02-5 | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 676367-06-9 | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 350716-42-6 | 626-579-5 | 2-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluor-1,1-dimethylundecyloxy)carbonyloxyimino]-2-fenylacetonitril | 2-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-1,1-dimethylundecyloxy)carbonyloxyimino]-2-phenylacetonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 3772-44-9 | 223-216-9 | 2-[[7-[(2-arsonofenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naftyl]azo]benzoëzuur | 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1265205-97-7 | 996-017-4 | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoroctylsulfonyl(1,1,2,2,2-pentadeuterioethyl)amino]azijnzuur | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(1,1,2,2,2-pentadeuterioethyl)amino]acetic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 20427-84-3 | 243-816-4 | 2-[2-(4-nonylfenoxy)ethoxy]ethanol | 2-[2-(4-nonylphenoxy)ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 27176-93-8 | 248-291-5 | 2-[2-(nonylfenoxy)ethoxy]ethanol | 2-[2-(nonylphenoxy)ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 7311-27-5 | 230-770-5 | 2-[2-[2-[2-(4-nonylfenoxy)ethoxy]ethoxy]ethoxy]ethanol | 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 56 | |||||
| 2315-61-9 | 621-341-7 | 2-[2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]ethoxy]ethanol | 2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-03-2019 | 56 | |||||
| 151798-26-4 | 420-580-2 | 2-[2-hydroxy-3-(2-chloorfenyl)carbamoyl-1-naftylazo]-7-[2-hydroxy-3-(3-methylfenyl)-carbamoyl-1-naftylazo]fluoreen-9-on | 2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1268364-53-9 | 878-305-0 | 2-[3,5-bis(trifluormethyl)fenyl]-n-{4-(4-fluor-2-methylfenyl)-6-[(7s,9as)-7-(hydroxymethyl)hexahydropyrazino[2,1-c][1,4]oxazin-8(1h)-yl]pyridin-3-yl}-n,2-dimethylpropaanamide dihydrochloride isopropanol solvataat | 2-[3,5-bis(trifluoromethyl)phenyl]-n-{4-(4-fluoro-2-methylphenyl)-6-[(7s,9as)-7-(hydroxymethyl)hexahydropyrazino[2,1-c][1,4]oxazin-8(1h)-yl]pyridin-3-yl}-n,2-dimethylpropanamide dihydrochloride isopropanol solvate | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | |||||
| 937-904-8 | 2-[3-[1-octyl-4-(1H)quinolinylideen]-1-propenyl]-3-methylbenzothiazolium trifluormethaansulfonaat | 2-[3-[1-octyl-4-(1H)quinolinylidene]-1-propenyl]-3-methylbenzothiazolium trifluoromethanesulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 2315-67-5 | 621-345-9 | 2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]-ethanol | 4-tert-octylphenol monoethoxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-03-2019 | 56 | |||||
| 1119449-37-4 | 687-832-3 | 2-[4-(3,6-dimethylheptaan-3-yl)fenoxy]ethanol | 2-[4-(3,6-dimethylheptan-3-yl)phenoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 111991-14-1 | 830-355-4 | 2-[4-(trifluormethyl)fenyl]oxiraan | 2-[4-(trifluoromethyl)phenyl]oxirane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 376-14-7 | 206-805-5 | 2-[ethyl[(heptadecafluoroctyl)sulfonyl]amino]ethyl methacrylaat | 2-[ethyl[(heptadecafluorooctyl)sulphonyl]amino]ethyl methacrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 67584-55-8 | 266-733-5 | 2-[methyl[(nonafluorbutyl) sulfonyl]amino]ethyl acrylaat | 2-[methyl[(nonafluorobutyl) sulphonyl]amino]ethyl acrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 1119449-38-5 | 687-833-9 | 2-{2-[4-(3,6-dimethylheptaan-3-yl)fenoxy]ethoxy}ethanol | 2-{2-[4-(3,6-dimethylheptan-3-yl)phenoxy]ethoxy}ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 114248-23-6 | 806-458-5 | 2’,2’-difluor-2’-deoxyuridine | 2’,2’-difluoro-2’-deoxyuridine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 27942-27-4 | 248-743-1 | 20-(4-nonylfenoxy)-3,6,9,12,15,18-hexaoxaicosaan-1-ol | 20-(4-nonylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 56 | |||||
| 65455-69-8 | 265-785-6 | 20-(isononylfenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | 20-(isononylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 27177-03-3 | 248-292-0 | 20-(nonylfenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | 20-(nonylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 2497-59-8 | 219-682-8 | 20-[4-(1,1,3,3-tetramethylbutyl)fenoxy]-3,6,9,12,15,18-hexaoxaicosaan-1-ol | 20-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-03-2019 | 56 | |||||
| 27177-05-5 | 248-293-6 | 23-(nonylfenoxy)-3,6,9,12,15,18,21-heptaoxatricosaan-1-ol | 23-(nonylphenoxy)-3,6,9,12,15,18,21-heptaoxatricosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 14409-72-4 | 604-395-6 | 26-(4-nonylfenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosaan-1-ol | 26-(4-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 56 | |||||
| 26571-11-9 | 247-816-5 | 26-(nonylfenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosaan-1-ol | 26-(nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 42173-90-0 | 255-695-5 | 26-(nonylfenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | 26-(nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 65455-72-3 | 29-(isononylfenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol | 29-(isononylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | ||||||
| 27177-08-8 | 248-294-1 | 29-(nonylfenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol | 29-(nonylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 5311-05-7 | 610-962-9 | 2-amine-4-methoxy-6-(trifluormethyl)-1,3,5-triazine | 1,3,5-triazin-2-amine, 4-methoxy-6-(trifluoromethyl)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 2045-00-3 | 218-064-5 | 2-aminofenylarsenigzuur | 2-aminophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 3846-71-7 | 223-346-6 | 2-benzotriazool-2-yl-4,6-di-tert-butylfenol | 2-benzotriazol-2-yl-4,6-di-tert-butylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2015 | ||||||
| 119313-12-1 | 404-360-3 | 2-benzyl-2-dimethylamino-4′-morfolinobutyrofenon | 2-benzyl-2-dimethylamino-4′-morpholinobutyrophenone | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | |||||
| 4067-80-5 | 694-727-6 | 2-broom(2-~2~H)propaan | 2-bromo(2-~2~H)propane | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 1514-82-5 | 627-872-0 | 2-broom-3,3,3-trifluor-1-propeen | 2-bromo-3,3,3-trifluoroprop-1-ene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||
| 1008756-65-7 | 685-903-3 | 2-broom-5-(tributylstannyl)pyridine | 2-bromo-5-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 189083-81-6 | 623-183-4 | 2-broom-6-(tributylstannyl)pyridine | 2-bromo-6-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 124 | ||||||
| 75-26-3 | 200-855-1 | 2-broompropaan | 2-bromopropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 52809-76-4 | 694-196-0 | 2-broompropaan-1,1,1,3,3,3-d6 | 2-bromopropane-1,1,1,3,3,3-d6 | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 39091-63-9 | 686-145-6 | 2-broompropaan-d7 | 2-bromopropane-d7 | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 1351378-24-9 | 800-777-3 | 2-buteendizuur (2Z)-, reactieproducten met ammonium di-µ3-hydroxyhexacosa-µ-oxododecaoxododecatungstaat(6-) (6:1), ammonium octa-µ-oxodi-µ3-oxo-µ4-oxododecaoxoheptamolybdaat(6-) (6:1), nikkel(2+) nitraat (1:2) en nikkel(2+) sulfaat (1:1) | 2-butenedioic acid (2Z)-, reaction products with ammonium di-µ3-hydroxyhexacosa-µ-oxododecaoxododecatungstate(6-) (6:1), ammonium octa-µ-oxodi-µ3-oxo-µ4-oxododecaoxoheptamolybdate(6-) (6:1), nickel(2+) nitrate (1:2) and nickel(2+) sulfate (1:1) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 4170-30-3 | 224-030-0 | 2-butenal | crotonaldehyde | MVP 1 | 0,05 mg/Nm3 | 24-11-2015 | 8 | ||||||
| 94723-86-1 | 425-150-8 | 2-butyryl-3-hydroxy-5-thiocyclohexaan-3-ylcyclohex-2-een-1-on | 2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39186-68-0 | 254-338-0 | 2-carboxyethylbis(2-hydroxyethyl)-3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl)amino]propylammoniumhydroxide | 2-carboxyethylbis(2-hydroxyethyl)-3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl)amino]propylammonium hydroxide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 2804-50-4 | 2-chloor-1,1,3,3,3-pentafluor-1-propeen | 2-chloropentafluoropropene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 889672-73-5 | 663-233-2 | 2-chloor-5-(tributylstannyl)-1,3-thiazool | 2-chloro-5-(tributylstannyl)-1,3-thiazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 155191-68-7 | 630-868-1 | 2-chloor-5-(tributylstannyl)pyrimidine | 2-chloro-5-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 263698-99-3 | 686-993-7 | 2-chloor-6-(tributylstannyl)pyridine | 2-chloro-6-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 2040-90-6 | 433-890-8 | 2-chloor-6-fluorfenol | 2-chloro-6-fluoro-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 70887-84-2 | 2-deceenzuur, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluor- | 2-decenoic acid, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 70887-94-4 | 2-dodeceenzuur, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-eicosafluor- | 2-dodecenoic acid, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-eicosafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 484-410-9 | 2-ethoxy-3,3,4,4,5-pentafluor-2,5-bis[(1,2,2,2-tetrafluor-1-trifluormethyl)ethyl] tetrahydrofuran | 2-ethoxy-3,3,4,4,5-pentafluoro-2,5-bis[(1,2,2,2-tetrafluoro-1-trifluoromethyl)ethyl] tetrahydrofuran | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 110-80-5 | 203-804-1 | 2-ethoxyethanol | 2-ethoxyethanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 111-15-9 | 203-839-2 | 2-ethoxyethylacetaat | 2-ethoxyethyl acetate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 149-57-5 | 205-743-6 | 2-ethylhexaanzuur | 2-ethylhexanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80, 87 | |||||
| 24593-34-8 | 246-332-1 | 2-ethylhexaanzuur, cerium zout | 2-ethylhexanoic acid, cerium salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 7329-33-1 | 230-822-7 | 2-ethylhexaanzuur, chroomzout | 2-ethylhexanoic acid, chromium salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 19583-54-1 | 243-169-8 | 2-ethylhexaanzuur, ijzerzout | 2-ethylhexanoic acid, iron salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 3164-85-0 | 221-625-7 | 2-ethylhexaanzuur, kaliumzout | potassium 2-ethylhexanoate | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 22221-10-9 | 244-846-0 | 2-ethylhexaanzuur, koperzout | 2-ethylhexanoic acid, copper salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 16996-40-0 | 241-076-7 | 2-ethylhexaanzuur, loodzout | 2-ethylhexanoic acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 14, 56 | ||||||
| 15956-58-8 | 240-085-3 | 2-ethylhexaanzuur, mangaan zout | 2-ethylhexanoic acid, manganese salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 34041-09-3 | 251-807-1 | 2-ethylhexaanzuur, molybdeenzout | 2-ethylhexanoic acid, molybdenum salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 85114-00-7 | 285-503-5 | 2-ethylhexaanzuur, monoester met 1,2-diolpropaan | 2-ethylhexanoic acid, monoester with propane-1,2-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 80 | |||||
| 7580-31-6 | 231-480-1 | 2-ethylhexaanzuur, nikkelzout | 2-ethylhexanoic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 38584-87-1 | 254-020-1 | 2-ethylhexaanzuur, verbinding met 2,2',2''-nitrilotriethanol (1:1) | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 74931-55-8 | 278-031-6 | 2-ethylhexaanzuur, verbinding met 2-aminoethanol (1:1) | 2-ethylhexanoic acid, compound with 2-aminoethanol (1:1) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 58823-74-8 | 261-460-8 | 2-ethylhexaanzuur, verbinding met tributylamine (1:1) | 2-ethylhexanoic acid, compound with tributylamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 79, 80 | ||||||
| 85203-81-2 | 286-272-3 | 2-ethylhexaanzuur, zinkzout, basisch | hexanoic acid, 2-ethyl-, zinc salt, basic | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 22464-99-9 | 245-018-1 | 2-ethylhexaanzuur, zirconium zout | 2-ethylhexanoic acid, zirconium salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 57583-35-4 | 260-829-0 | 2-ethylhexyl 10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | dimethyltin bis(2-ethylhexyl thioglycolate) | MVP 1 | 0,05 mg/Nm3 | 16-5-2019 | 15, 56 | ||||||
| 15571-58-1 | 239-622-4 | 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoaat | 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 57583-34-3 | 260-828-5 | 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4- tintetradecanoaat | 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | MVP 1 | 0,05 mg/Nm3 | 16-5-2019 | 15, 56 | ||||||
| 10584-98-2 | 234-186-1 | 2-ethylhexyl 4,4-dibutyl-10-ethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoaat | 2-ethylhexyl 4,4-dibutyl-10-ethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 80387-97-9 | 279-452-8 | 2-ethylhexyl-[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyfenyl]methyl]thio]acetaat | 2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 155533-81-6 | 624-277-8 | 2-fluor-3-(tributylstannyl)pyridine | 2-fluoro-3-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 457061-31-3 | 106-307-7 | 2-fluor-4-(tributylstannyl)pyridine | 2-fluoro-4-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 138495-42-8 | 2H,3H-decafluoropentaan | 2H,3H-decafluoropentane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 88992-45-4 | 811-523-6 | 2-hydroxy-N,N,N-trimethyl-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)thio]-1-propanimiumchloride | 2-hydroxy-N,N,N-trimethyl-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)thio]-1-propanimium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 6107-83-1 | 629-552-6 | 2-hydroxypropaan-1,2,3-tricarboxylaat, lood(2+), trihydraat | 2-hydroxypropane-1,2,3-tricarboxylate;lead(2+), trihydrate | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 56 | ||||||
| 1105511-65-6 | 664-401-8 | 2-methoxy-3-(tributylstannyl)pyrazine | 2-methoxy-3-(tributylstannyl)pyrazine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 1204580-72-2 | 107-063-4 | 2-methoxy-4-(tributylstannyl)pyridine | 2-methoxy-4-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 164014-94-2 | 810-728-8 | 2-methoxy-6-(tributylstannyl)pyridine | 2-methoxy-6-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 109-86-4 | 203-713-7 | 2-methoxyethanol | ethyleenglycolmono-methylether | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 110-49-6 | 203-772-9 | 2-methoxyethylacetaat | 2-methoxyethyl acetate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 3121-61-7 | 221-499-3 | 2-methoxyethylacrylaat | 2-methoxyethyl acrylate | Ja | MVP 2 | 1 mg/Nm3 | 11-9-2020 | 80 | |||||
| 1589-47-5 | 216-455-5 | 2-methoxypropanol | 2-methoxypropanol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 70657-70-4 | 274-724-2 | 2-methoxypropylacetaat | 2-methoxypropyl acetate | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 36 | |||||
| 1446502-11-9 | 107-597-8 | 2-methyl-1-(4-(6-(trifluormethyl)pyridin-2-yl)-6-(2-(trifluormethyl)pyridin-4-ylamino)-1,3,5-triazin-2-ylamino)propan-2-ol | 2-methyl-1-(4-(6-(trifluoromethyl)pyridin-2-yl)-6-(2-(trifluoromethyl)pyridin-4-ylamino)-1,3,5-triazin-2-ylamino)propan-2-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 71868-10-5 | 400-600-6 | 2-methyl-1-(4-methylthiofenyl)-2-morfolinopropaan-1-on | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | |||||
| 238098-26-5 | 487-120-0 | 2-methyl-4-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]aniline | 2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 259807-95-9 | 677-938-8 | 2-methyl-6-(tri-n-butylstannyl)pyridine | 2-methyl-6-(tri-n-butylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 124 | ||||||
| 75-55-8 | 200-878-7 | 2-methylaziridine | 2-methylaziridine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 693-98-1 | 211-765-7 | 2-methylimidazool | 2-methylimidazole | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | |||||
| 91-57-6 | 202-078-3 | 2-methylnaftaleen | 2-methylnaphthalene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 389625-14-3 | 811-442-6 | 2-naftaceencarboxamide, 4-(dimethylamine)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-7-iodo-1,11-dioxo-, (4S,4aS,5aR,12aS)-, mono(trifluoracetaat) (zout) | 2-naftacencarboxamide, 4-(dimethylamin)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-7-iodo-1,11-dioxo-, (4S,4aS,5aR,12aS)-, mono(trifluoroacetate) (salt) | Ja | MVP 2 | 1 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 91-59-8 | 202-080-4 | 2-naftylamine | 2-naphthylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 25 | |||||
| 553-00-4 | 209-030-0 | 2-naftylamine azijnzuur | 2-naphthylamine acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 40 | |||||
| 612-52-2 | 210-313-6 | 2-naftylamine hydrochloride | 2-naphthylamine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 40 | |||||
| 68411-33-6 | 685-313-6 | 2-nitro-1,3-benzeendiol, loodzout, basisch | 1,3-benzenediol, 2-nitro-, lead salt, basic | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 56 | ||||||
| 91-23-6 | 202-052-1 | 2-nitroanisool | 2-nitroanisole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 5410-29-7 | 226-485-0 | 2-nitrofenylarsenigzuur | 2-nitrophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 581-89-5 | 209-474-5 | 2-nitronaftaleen | 2-nitronaphthalene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 79-46-9 | 201-209-1 | 2-nitropropaan | 2-nitropropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 88-72-2 | 201-853-3 | 2-nitrotolueen | 2-nitrotoluene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 34202-69-2 | 629-519-6 | 2-propanon, hexafluor-, trihydraat | 2-propanone, hexafluoro-, trihydrate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 53515-73-4 | 2-propeenzuur, 2-methyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctylester, polymeer met 2-propeenzuur | 2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl ester, polymer with 2-propenoic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 65104-45-2 | 2-propeenzuur, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12, 12-heneicosafluordodecylester, polymeer met 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluordecyl-2-methyl-2-propenoaat, methyl-2-methyl-2-propenoaat, 3,3,4,4,5,5,6,6,7,7,8,8,9,9 | 2-propenoic acid, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl ester, polymer with 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluorodecyl 2-methyl-2-propenoate, methyl 2-methyl-2-propenoate,3,3,4,4,5,5,6,6,7,7,8,8 | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 125328-29-2 | 2-propeenzuur, 2-methyl-, C10-16-alkylesters, polymeren met 2-hydroxyethylmethacrylaat, Me-methacrylaat en perfluor-C8-14-alkylacrylaat | 2-propenoic acid, 2-methyl-, C10-16-alkyl esters, polymers with 2-hydroxyethyl methacrylate, Me methacrylate and perfluoro-C8-14-alkyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 129783-45-5 | 2-propeenzuur, 2-methyl-, C10-16-alkylesters, polymeren met 2-hydroxyethylmethacrylaat, Me-methacrylaat en γ-ω-perfluor-C8-14-alkylacrylaat | 2-propenoic acid, 2-methyl-, C10-16-alkyl esters, polymers with 2-hydroxyethyl methacrylate, Me methacrylate and γ-ω-perfluoro-C8-14-alkyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 74049-08-4 | 2-propeenzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylester, homopolymeer | 2-propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester, homopolymer | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 116984-14-6 | 2-propeenzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluordodecylester, polymeer met 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluordecyl-2-propenoaat, α-(2-methyl-1-oxo -2-propenyl)-ω-[(2-methyl-1-oxo-2-propenyl)oxy]poly(oxy-1,2- | 2-propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl ester, polymer with 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluorodecyl 2-propenoate, α-(2-methyl-1-oxo-2-propenyl)-ω-[(2-methyl-1-oxo-2-propenyl)oxy]poly(oxy | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 115592-83-1 | 2-propeenzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluordodecylester, polymeer met 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl-2-propenoaat, hexadecyl-2-propenoaat, N-(hydroxymethyl)-2-propenamide, octadecyl-2-propenoaat | 2-propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl ester, polymer with 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 2-propenoate, hexadecyl 2-propenoate, N-(hydroxymethyl)-2-propenamide, octadecyl 2-prop | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 144031-01-6 | 2-propeenzuur, dodecylester, polymeren met Bu (1-oxo-2-propenyl) carbamaat en γ-ω-perfluor-C8-14-alkylacrylaat | 2-propenoic acid, dodecyl ester, polymers with Bu (1-oxo-2-propenyl)carbamate and γ-ω-perfluoro-C8-14-alkyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 85681-64-7 | 288-202-7 | 2-propeenzuur, perfluor-C8-16-alkylesters | 2-propenoic acid, perfluoro-C8-16-alkyl esters | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 85631-54-5 | 288-003-5 | 2-propeenzuur, γ-ω-perfluor-C8-14-alkylesters | 2-propenoic acid, γ-ω-perfluoro-C8-14-alkyl esters | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1199618-56-8 | 690-857-2 | 2-pyridinecarboxamide, 4-[4-[[[[4-chloor-3-(trifluormethyl)fenyl]amino]carbonyl]amino]fenoxy]-N-methyl-, benzeensulfonaat (1:1) | 2-pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-, benzenesulfonate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 157427-46-8 | 677-929-9 | 2-tributylstannyl-1-methyl-1H-indool | 2-tributylstannyl-1-methyl-1H-indole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 88-17-5 | 201-806-7 | 2-trifluormethylaniline | 2-(trifluoromethyl)aniline | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 112-336-6 | 3-(2,2-difluor-3-(4-(piperazin-1-yl)butoxy)propoxy)-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)propanamide hydrochloride | 3-(2,2-difluoro-3-(4-(piperazin-1-yl)butoxy)propoxy)-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)propanamide Hydrochlori | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | ||||||
| 936727-05-8 | 811-416-4 | 3-(6-(1-(2,2-difluorbenzo[d][1,3]dioxol-5-yl)cyclopropaancarboxamido)-3-methylpyridin-2-yl)benzoëzuur | 3-(6-(1-(2,2-difluorobenzo[d][1,3]dioxol-5-yl)cyclopropanecarboxamido)-3-methylpyridin- 2-yl)benzoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | |||||
| 119489-67-7 | 999-197-2 | 3-(heptadecafluoroctyl)aniline | 3-(heptadecafluorooctyl)aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 59020-10-9 | 626-493-8 | 3-(tributylstannyl)pyridine | 3-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 55525-54-7 | 259-695-6 | 3,3-(ureyleendimethyleen)bis(3,5,5-trimethylcyclohexyl)diisocyanaat | 3,3'-(ureylenedimethylene)bis(3,5,5-trimethylcyclohexyl) diisocyanate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 19430-93-4 | 243-053-7 | 3,3,4,4,5,5,6,6,6-nonafluorhexeen | 3,3,4,4,5,5,6,6,6-nonafluorohexene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 27619-97-2 | 248-580-6 | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctaansulfonzuur | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 17527-29-6 | 241-527-8 | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl acrylate | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 2144-53-8 | 218-407-9 | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl methacrylate | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctylmethacrylaat | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 21652-58-4 | 244-503-5 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordec-1-een | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 34143-74-3 | 629-356-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecaan-1-thiol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 17-5-2024 | 56, 68, 95 | ||||
| 39108-34-4 | 254-295-8 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluor-decaansulfonzuur | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 678-39-7 | 211-648-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecan-1-ol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 305849-29-0 | 153-245-1 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl 1-naftylcarbamaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 1-naphthylcarbamate | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | |||||
| 27905-45-9 | 248-722-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1996-88-9 | 217-877-2 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 865-86-1 | 212-748-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecanol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 30389-25-4 | 250-173-3 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodeceen | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 17741-60-5 | 241-732-2 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 57678-05-4 | 260-900-6 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecyldiwaterstof fosfaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 2144-54-9 | 218-408-4 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 39239-77-5 | 254-373-1 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluortetradecanol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 6014-75-1 | 227-870-6 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluortetradecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 60699-51-6 | 262-382-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorhexadecanol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorohexadecanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 4980-53-4 | 225-627-9 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorhexadecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorohexadecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94158-63-1 | 303-135-6 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluor-17-(trifluormethyl) octadecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluoro-17-(trifluoromethyl)octadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94158-65-3 | 303-137-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluor-17-(trifluormethyl) octadecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluoro-17-(trifluoromethyl)octadecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 91615-22-4 | 293-843-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluor-15-(trifluormethyl) hexadecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluoro-15-(trifluoromethyl)hexadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94158-64-2 | 303-136-1 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluor-15-(trifluormethyl) hexadecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluoro-15-(trifluoromethyl)hexadecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 52956-82-8 | 258-277-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluor-13-(trifluormethyl)tetradecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluoro-13-(trifluoromethyl)tetradecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 74256-15-8 | 277-790-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluor-13-(trifluormethyl)tetradecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluoro-13-(trifluoromethyl)tetradecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 74256-14-7 | 277-789-5 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluor-11-(trifluormethyl)dodecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluoro-11-(trifluoromethyl)dodecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1005-73-8 | 688-377-3 | 3,3,4,4,5,5-hexafluorcyclopenteen | 3,3,4,4,5,5-hexafluorocyclopent-1-ene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 74332-73-3 | 277-822-3 | 3,3’-dichloorbenzidine sulfaat | 3,3'-dichlorobenzidine sulphate | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 56, 68 | ||||||
| 91-94-1 | 202-109-0 | 3,3'-dichloorbenzidine | 3,3'-dichlorobenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 26 | |||||
| 612-83-9 | 210-323-0 | 3,3'-dichloorbenzidine dihydrochloride | 3,3'-dichlorobenzidine dihydrochloride | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 56, 68 | ||||||
| 2688115-44-6 | 172-067-5 | 3,3-difluor-1-nitrosoazetidine | 3,3-difluoro-1-nitrosoazetidine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 2648966-19-0 | 117-962-3 | 3,3-difluor-1-nitrosopyrrolidine | 3,3-difluoro-1-nitrosopyrrolidine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 119-90-4 | 204-355-4 | 3,3'-dimethoxybenzidine | 3,3'-dimethoxybenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 20325-40-0 | 243-737-5 | 3,3'-dimethoxybifenyl-4,4'-yleendiammonium dichloride | 3,3'-dimethoxybiphenyl-4,4'-ylenediammonium dichloride | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 56, 68 | ||||||
| 24216-05-5 | 246-083-9 | 3,4-bis[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl)amino]benzeensulfonylchloride | 3,4-bis[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl)amino]benzenesulphonyl chloride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 610-39-9 | 210-222-1 | 3,4-dinitrotolueen | 3,4-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 446285-70-7 | 677-934-6 | 3,5-dichloor-2-(tributylstannyl)pyrazine | 3,5-dichloro-2-(tributylstannyl)pyrazine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 618-85-9 | 210-566-2 | 3,5-dinitrotolueen | 3,5-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 91648-64-5 | 293-926-1 | 3,6,9,12-tetraoxatetradecaan-1-ol, 14-(4-nonylfenoxy)-, vertakt | 3,6,9,12-tetraoxatetradecan-1-ol, 14-(4-nonylphenoxy)-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 5146-66-7 | 225-918-0 | 3,7-dimethylocta-2,6-dieennitril | 3,7-dimethylocta-2,6-dienenitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 170729-80-3 | 677-636-6 | 3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluormethyl)fenyl]ethoxy)-3-(4-fluorfenyl)morfolino]methyl]-1H-1,2,4-triazool-5(4H)-on | 3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy)-3-(4-fluorophenyl)morpholino]methyl]-1H-1,2,4-triazol-5(4H)-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 956-990-8 | 3-[3-({6-[(6S,8R)-8-methyl-7-(2,2,2-trifluorethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinyl}amino)-1-azetidinyl]-1-propanol | 3-[3-({6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinyl}amino)-1-azetidinyl]-1-propanol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 121451-02-3 | 601-779-5 | 3-[3,5-dichloor-2-fluor-4-(1,1,2,3,3,3-hexafluorpropoxy)fenyl]-1-(2,6-difluorbenzoyl)ureum | 3-[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1-(2,6-difluorobenzoyl)urea | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 287974-84-9 | 695-790-2 | 3-[4-(4'-trifluormethylbenzyloxy)fenyl]tetralon | 3-[4-(4'-trifluoromethylbenzyloxy)phenyl] tetralone | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 2163-77-1 | 218-494-3 | 3-amino-4-hydroxyfenylarsonzuur | 3-amino-4-hydroxyphenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 132-32-1 | 205-057-7 | 3-amino-9-ethylcarbazool | 3-amino-9-ethyl carbazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15087-24-8 | 239-139-9 | 3-benzylideenkamfer | 3-benzylidenecamphor | Ja | MVP 1 | 0,05 mg/Nm3 | 11-2-2019 | ||||||
| 1522-92-5 | 622-370-8 | 3-broom-2,2-bis(broommethyl)-1-propanol | 3-bromo-2,2-bis(bromomethyl)-1-propanol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||
| 2113-57-7 | 218-304-9 | 3-broombifenyl | 3-bromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 56 | ||||||
| 206357-78-0 | 803-194-2 | 3-chloor-2-(tributylstannyl)pyridine | 3-chloro-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 297730-93-9 | 435-790-1 | 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluor-2-(trifluormethyl)-hexaan | 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 143860-04-2 | 421-150-7 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 43100-47-6 | 610-104-3 | 3-fenyl-5-(1,1,1-trifluor-2-{6-hydroxy-5-fenyl-[1,1'-bifenyl]-3-yl}propaan-2-yl)-[1,1'-bifenyl]-2-ol | 3-phenyl-5-(1,1,1-trifluoro-2-{6-hydroxy-5-phenyl-[1,1'-biphenyl]-3-yl}propan-2-yl)-[1,1'-biphenyl]-2-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 573675-60-2 | 800-494-5 | 3-fluor-2-(tributylstannyl)pyridine | 3-fluoro-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 60154-16-7 | 262-085-2 | 3-formamido-4-hydroxyfenylarsonzuur | 3-formamido-4-hydroxyphenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 27569-09-1 | 248-532-4 | 3-methyl-4-(pyrrolidin-1-yl)benzeendiazoniumhexafluorarsenaat | 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1453-58-3 | 215-925-7 | 3-methylpyrazool | 3-methylpyrazole | Ja | MVP 2 | 1 mg/Nm3 | 12-7-2021 | 80 | |||||
| 121-17-5 | 204-451-6 | 3-nitro-4-chloorbenzotrifluoride | 3-nitro-4-chlorobenzotrifluoride | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 98-16-8 | 202-643-4 | 3-trifluormethylaniline | 3-(trifluoromethyl)aniline | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 832720-36-2 | 692-765-8 | 4-((2-(5-(2-fluor-3-methoxyfenyl)-3-(2-fluor-6-(trifluormethyl)benzyl)-4-methyl-2,6-dioxo-3,6-dihydropyrimidine-1(2H)-yl)-1-fenylethyl)amino)butaanzuur dinatriumzout | 4-((2-(5-(2-fluoro-3-methoxyphenyl)-3-(2-fluoro-6-(trifluoromethyl) benzyl)-4-methyl-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl)-1-phenylethyl)amino) butanoic acid sodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 72861-06-4 | 4-(1,1,2,2-tetramethylpropyl)-fenol | 4-(1,1,2,2-tetramethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 861011-60-1 | 854-135-2 | 4-(1,1,2-trimethylbutyl)-fenol | 4-(1,1,2-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | |||||
| 33104-11-9 | 4-(1,1,3-trimethylbutyl)-fenol | 4-(1,1,3-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 521947-27-3 | 4-(1,1,5-trimethylhexyl)fenol | 4-(1,1,5-trimethylhexyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 56 | ||||||
| 37872-24-5 | 4-(1,1-diethylpropyl)-fenol | 4-(1,1-diethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 30784-31-7 | 4-(1,1-dimethylpentyl)-fenol | 4-(1,1-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 911371-06-7 | 4-(1,2,2-trimethylbutyl)-fenol | 4-(1,2,2-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 854904-93-1 | 4-(1,2-dimethylpentyl)-fenol | 4-(1,2-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 911371-07-8 | 4-(1,3,3-trimethylbutyl)-fenol | 4-(1,3,3-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 71945-81-8 | 4-(1,3-dimethylpentyl)-fenol | 4-(1,3-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 857629-71-1 | 4-(1,4-dimethylpentyl)-fenol | 4-(1,4-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 30784-27-1 | 4-(1-ethyl-1,2-dimethylpropyl)-fenol | 4-(1-ethyl-1,2-dimethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 30784-32-8 | 4-(1-ethyl-1-methylbutyl)-fenol | 4-(1-ethyl-1-methylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 52427-13-1 | 257-907-1 | 4-(1-ethyl-1-methylhexyl)fenol | 4-(1-ethyl-1-methylhexyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 861010-65-3 | 4-(1-ethyl-2,2-dimethylpropyl)-fenol | 4-(1-ethyl-2,2-dimethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 854904-92-0 | 4-(1-ethyl-3-methylbutyl)-fenol | 4-(1-ethyl-3-methylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 5425-62-7 | 226-569-7 | 4-(2-chlooracetamido)fenylarsonzuur | 4-(2-chloroacetamido)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 915087-16-0 | 857-186-9 | 4-(3-(4-cyaan-3-(trifluormethyl)fenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidine-1-yl)-N-methylbenzamide | 4-(3-(4-cyano-3-(trifluoromethyl)phenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl)-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 356055-77-1 | 623-608-3 | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzylalcohol | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzyl alcohol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 609816-23-1 | 624-217-0 | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzylamine | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 142623-70-9 | 625-041-7 | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylthio)fenol | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylthio)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 186825-36-5 | 635-389-1 | 4-(3,5-dimethylheptan-3-yl)fenol | 4-(3,5-dimethylheptan-3-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 142731-63-3 | 635-391-2 | 4-(3,6-dimethylheptaan-3-yl)fenol | 4-(3,6-dimethylheptan-3-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 56 | |||||
| 186825-39-8 | 4-(3-ethylheptaan-2-yl)fenol | 4-(3-ethylheptan-2-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 56 | ||||||
| 911370-98-4 | 4-(3-ethylpentyl)-fenol | 4-(3-ethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 102570-52-5 | 4-(3-methylhexyl)-fenol | 4-(3-methylhexyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 284461-73-0 | 608-209-4 | 4-(4-((((4-chloor-3-(trifluormethyl)fenyl)amino)carbonyl)amino)fenoxy)-N-methyl-2-pyridinecarboxamide | 4-(4-((((4-chloro-3-(trifluormethyl)phenyl)amino)carboxyl)amino)phenoxy)-N-methyl-2-pyridinecarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 755037-03-7 | 815-051-1 | 4-(4-(3-(4-chloor-3-(trifluormethyl)fenyl)ureido)-3-fluorfenoxy)-N-methylpicolinamide | 4-(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-3-fluorophenoxy)-N-methylpicolinamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 494798-73-1 | 625-634-0 | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyloxy)benzaldehyde | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyloxy) benzaldehyde | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 892155-69-0 | 118-458-6 | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyloxy)benzylalcohol | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyloxy)benzyl alcohol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 6966-64-9 | 230-176-6 | 4-(4-aminofenylazo)fenylarsonzuur | 4-(4-aminophenylazo)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 622-68-4 | 210-750-2 | 4-(4-dimethylaminofenylazo)fenylarsonzuur | 4-(4-dimethylaminophenylazo)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1139800-98-8 | 4-(4-methylhexyl)-fenol | 4-(4-methylhexyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 100532-36-3 | 4-(5-methylhexyl)-fenol | 4-(5-methylhexyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 63217-33-4 | 264-027-1 | 4-(diethylamino)-2-ethoxybenzeendiazonium hexafluorarsenaat | 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 63217-32-3 | 264-026-6 | 4-(diethylamino)-2-ethoxybenzeendiazoniumhexafluorarsenaat | 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 81121-61-1 | 632-855-6 | 4-(dimethylamino)pyridinium chloorchromaat | 4-(Dimethylamino)pyridinium chlorochromate | MVP 1 | 0,05 mg/Nm3 | 9-1-2023 | 12, 56 | ||||||
| 144-87-6 | 205-643-2 | 4-(glycolloylamino)fenylarsonzuur | 4-(glycolloylamino)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 6863-24-7 | 4-(heptaan-2-yl)fenol | 4-(heptan-2-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 83766-52-3 | 628-976-9 | 4-(heptadecafluoroctyl)aniline | 4-(heptadecafluorooctyl)aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 91083-54-4 | 623-055-8 | 4,14,22,32-tetrakis[4-(2-fenylpropaan-2-yl)fenoxy]-9,18,27,36,37,39,40,41-octaza-38lambda2-looddecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1(36),2(7),3,5,8,10(41),11(16),12,14,17,19,21,23,25,27,29(34),30,32,35(40)-nonadecaeen | 4,14,22,32-tetrakis[4-(2-phenylpropan-2-yl)phenoxy]-9,18,27,36,37,39,40,41-octaza-38lambda2-plumbadecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1(36),2(7),3,5,8,10(41),11(16),12,14,17,19,21,23,25,27,29(34),30,32,35(40)-nonadecaene | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 86 | ||||||
| 77-40-7 | 201-025-1 | 4,4'-(1-methylpropylideen)bisfenol | 4,4'-(1-methylpropylidene)bisphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | |||||
| 34598-33-9 | 252-108-4 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecaanzuur | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 17-5-2024 | 56, 68, 95 | ||||
| 89373-67-1 | 625-067-9 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecanoylchloride | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 139175-50-1 | 626-638-5 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecylamine | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 852527-61-8 | 632-950-2 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecylazide | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl azide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 94158-70-0 | 303-142-4 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluor-2-hydroxytridecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 16083-78-6 | 240-236-3 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluor-2-hydroxy-16-(trifluormethyl)heptadecylacrylaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluoro-2-hydroxy-16-(trifluoromethyl)heptadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 63295-29-4 | 264-079-5 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluor-2-hydroxy-16-(trifluormethyl)heptadecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluoro-2-hydroxy-16-(trifluoromethyl)heptadecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 16083-87-7 | 240-237-9 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl)pentadecylacrylaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 63295-28-3 | 264-077-4 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl)pentadecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 63295-27-2 | 264-076-9 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluor-2-hydroxy-12-(trifluormethyl)tridecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1478-61-1 | 216-036-7 | 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]difenol | 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80, 87, 95 | |||
| 64049-29-2 | 4,4’-methylene-bis(2-chloroaniline) hydrochloride | 4,4'-methylene-bis(2-chloroaniline) hydrochloride | MVP 1 | 0,05 mg/Nm3 | 8-2-2022 | 56, 68 | |||||||
| 119-93-7 | 204-358-0 | 4,4'-bi-o-toluïdine | 4,4'-bi-o-toluidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 23 | |||||
| 612-82-8 | 210-322-5 | 4,4'-bi-o-toluidine dihydrochloride | 4,4'-bi-o-toluidine dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64969-36-4 | 265-294-7 | 4,4'-bi-o-toluidine disulfaat | [3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl]diammonium bis(hydrogen sulphate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 74753-18-7 | 277-985-0 | 4,4'-bi-o-toluidinesulfaat | 4,4'-bi-o-toluidine sulphate | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 561-41-1 | 209-218-2 | 4,4'-bis(dimethylamino)-4''-(methylamino)trityl alcohol [met 0,1 procent of meer Michler's keton (EC nr. 202-027-5) of Michler's base (EC No. 202-959-2)] | 4,4'-bis(dimethylamino)-4''-(methylamino)trityl alcohol with >0.1% of Michler's ketone (EC No. 202-027-5) or Michler's base (EC No. 202-959-2)] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92-86-4 | 202-198-6 | 4,4'-dibroombifenyl | 4,4'-dibromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 56 | ||||||
| 6807-17-6 | 401-720-1 | 4,4-isobutylethylideendifenol | 4,4-isobutylethylidenediphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 101-14-4 | 202-918-9 | 4,4'-methyleenbis(2-chlooraniline) | 4,4'-methylenebis[2-chloroaniline] | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 101-77-9 | 202-974-4 | 4,4'-methyleendianiline | 4,4'-diaminodiphenylmethane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 838-88-0 | 212-658-8 | 4,4'-methyleendi-o-toluidine | 4,4'-methylenedi-o-toluidine | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 101-80-4 | 202-977-0 | 4,4'-oxydianiline | 4,4'-oxydianiline | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 27 | ||||
| 39635-79-5 | 254-551-9 | 4,4'-sulfonylbis[2,6-dibroomfenol] | 4,4'-sulphonylbis[2,6-dibromophenol] | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 56 | ||||||
| 80-09-1 | 201-250-5 | 4,4'-sulfonyldifenol | 4,4'-sulfonyldiphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | ||||
| 139-65-1 | 205-370-9 | 4,4'-thiodianiline | 4,4'-thiodianiline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 28 | |||||
| 1950587-20-8 | 942-798-1 | 4-[(1-[[6-cyano-5-(triflurmethyl)pyridine-3-yl]carbamoyl]cyclobutyl)amino]-2-fluor-N-methylbenzamide | 4-[(1-[[6-cyano-5-(trifluoromethyl)pyridin-3-yl]carbamoyl]cyclobutyl)amino]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 132-33-2 | 205-058-2 | 4-[(2-arsonofenyl)azo]-3-hydroxynaftaleen-2,7-disulfonzuur | 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1824346-00-0 | 4-[2-methyl-1-(1-methylethyl)propyl]-fenol | 4-[2-methyl-1-(1-methylethyl)propyl]-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 1242137-18-3 | 857-185-3 | 4-[3-[4-cyaan-3-(trifluormethyl)fenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluor-N-methylbenzamide | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 915087-33-1 | 805-022-1 | 4-[3-[4-cyaan-3-(trifluormethyl)fenyl]-5,5-dimethyl-4-oxo-2-sulfanylideen-imidazolidine-1-yl]-2-fluor-N-methylbenzamide | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylidene-imidazolidin-1-yl]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1431697-81-2 | 112-259-8 | 4-[4-[[[[2-chloor-3-(trifluormethyl)fenyl]amino]carbonyl]amino]fenoxy]-N-methyl-2-pyridinecarboxamide | 4-[4-[[[[2-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-2-pyridinecarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 169590-42-5 | 685-962-5 | 4-[5-(4-methylfenyl)-3-(trifluormethyl)-1H-pyrazool-1-yl]benzeensulfonamide | 4-[5-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1221565-82-7 | 829-305-4 | 4-[5-(4-methylfenyl)-3-(trifluormethyl)-1H-pyrazool-1-yl]benzeensulfonamide en (1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyfenyl)cyclohexanol en waterstofchloride (1:1:1) | 4-[5-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide - (1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol hydrochloride (1:1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 956104-40-8 | 807-449-9 | 4-[7-[6-cyaan-5-(trifluormethyl)pyridine-3-yl]-8-oxo-6-sulfanylideen-5,7-diazaspiro[3.4]-5-octanyl]-2-fluor-N-methylbenzamide | 4-[7-[6-cyano-5-(trifluoromethyl)pyridin-3-yl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 303186-20-1 | 608-462-0 | 4-[difluor(3,4,5-trifluorfenoxy)methyl]-3,5-difluor-4'-propyl-1,1'-bifenyl | 4-[difluor(3,4,5-trifluorphenoxy)methyl]-3,5-difluor-4'-propyl-1,1'-biphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 303186-19-8 | 608-461-5 | 4-[difluor(3,4,5-trifluorfenoxy)methyl]-4'-ethyl-3,5-difluor-1,1'-bifenyl | 4-[difluor(3,4,5-trifluorphenoxy)methyl]-4'-ethyl-3,5-difluor-1,1'-biphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| 57321-10-5 | 260-678-0 | 44-(nonylfenoxy)-3,6,9,12,15,18,21,24,27,30,33,36,39,42-tetradecaoxatetratetracontanol | 44-(nonylphenoxy)-3,6,9,12,15,18,21,24,27,30,33,36,39,42-tetradecaoxatetratetracontanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 56 | |||||
| 618-22-4 | 210-541-6 | 4-acetamidofenylarsonzuur | 4-acetamidophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 399-95-1 | 402-230-0 | 4-amino-3-fluorfenol | 4-amino-3-fluorophenol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 60-09-3 | 200-453-6 | 4-aminoazobenzeen | 4-aminoazobenzene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 92-67-1 | 202-177-1 | 4-aminobifenyl | 4-aminobiphenyl | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1122-90-3 | 4-aminofenylarsenoxide | 4-aminophenylarsenoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 71130-51-3 | 4-arsenoso-benzeensulfonzuur | benzenesulfonic acid, 4-arsenoso- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 71130-50-2 | 4-arsenoso-benzeensulfonzuur, natriumzout | benzenesulfonic acid, 4-arsenoso-, sodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 145745-05-7 | 803-033-6 | 4-benzyloxyfenyltributylstannaan | 4-benzyloxyphenyltributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 92-66-0 | 202-176-6 | 4-broombifenyl | 4-bromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 56 | ||||||
| 104316-83-8 | 620-831-8 | 4-carboxypyridinium dichromaat | 4-carboxypyridinium dichromate | MVP 1 | 0,05 mg/Nm3 | 9-1-2023 | 12, 56 | ||||||
| 106-47-8 | 203-401-0 | 4-chlooraniline | 4-chloroaniline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 5440-04-0 | 226-622-4 | 4-chloorfenylarsonzuur | 4-chlorophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 95-69-2 | 202-441-6 | 4-chloor-o-toluïdine | 4-chloro-o-toluidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3165-93-3 | 221-627-8 | 4-chloor-o-toluidine hydrochloride | 4-chloro-o-toluidinium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 98-56-6 | 202-681-1 | 4-chloor-α,α,α-trifluortolueen | 4-chloro-α,α,α-trifluorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 84304-16-5 | 282-701-3 | 4-cyclohexyl-2,6-dimethylpyryliumhexafluorarsenaat | 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 6465-74-3 | 4-heptaan-3-ylfenol | 4-heptan-3-ylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 6465-71-0 | 4-heptaan-4-ylfenol | 4-heptan-4-ylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | ||||||
| 1987-50-4 | 217-862-0 | 4-heptylfenol | 4-heptylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 56 | |||||
| 352010-68-5 | 688-487-1 | 4-hydroxy-3-{2-[[](2-methoxyethoxy)methyl]-6-(trifluormethyl)pyridine-3-carbonyl}bicyclo[[]3.2.1]oct-3-en-2-on | 4-hydroxy-3-{2-[[](2-methoxyethoxy)methyl]-6-(trifluoromethyl)pyridine-3-carbonyl}bicyclo[[]3.2.1]oct-3-en-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 98-14-6 | 202-641-3 | 4-hydroxyfenylarsenigzuur | 4-hydroxyphenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 27147-75-7 | 608-055-8 | 4-isododecylfenol | phenol, 4-isododecyl- | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | |||||
| 850501-35-8 | 622-264-1 | 4-methoxy-2-(tributylstannyl)pyrimidine | 4-methoxy-2-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 822-36-6 | 212-497-3 | 4-methylimidazool | 4-methylimidazole | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | |||||
| 641571-10-0 | 700-544-5 | 4-methyl-N-[3-(4-methyl-1H-imidazool-1-yl)-5-(trifluormethyl)fenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-benzamide | benzamide, 4-methyl-N-[3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1304125-88-9 | 814-541-2 | 4-methyl-N-[3-(4-methyl-lH-imidazool-l-yl)-5-(trifluormethyl)-fenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-benzamidefumaraat | 4-methyl-N-[3-(4-methyl-lH-imidazol-l-yl)-5-(trifluoromethyl)-phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-benzamide fumarate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 92-93-3 | 202-204-7 | 4-nitrobifenyl | 4-nitrobiphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 57835-92-4 | 678-310-6 | 4-nitropyreen | 4-nitropyrene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 59-89-2 | 627-564-6 | 4-nitrosomorfoline | 4-nitrosomorpholine | Ja | MVP 2 | 1 mg/Nm3 | 25-1-2024 | 80 | |||||
| 84852-15-3 | 284-325-5 | 4-nonylfenol, vertakt | 4-nonylphenol, branched | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 56 | |||
| 4-nonylfenol, vertakt en lineair | 4-nonylphenol, branched and linear | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||||
| 98-73-7 | 202-696-3 | 4-tert-butylbenzoëzuur | 4-tert-butylbenzoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 98-54-4 | 202-679-0 | 4-tert-butylfenol | 4-tert-butylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 16-7-2019 | ||||||
| 288864-02-8 | 4-tert-heptylfenol | 4-tert-heptylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56 | ||||||
| 156609-10-8 | 4-t-nonylfenol-diethoxylaat | 4-t-nonylphenol-diethoxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 387353-98-2 | 803-945-4 | 4-tributylstannyl-1,3,5-trimethylpyrazool | 4-tributylstannyl-1,3,5-trimethylpyrazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 117933-89-8 | 601-499-3 | 5-(butan-2-yl)-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxaan | 5-(butan-2-yl)-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | |||||
| 188-193-9 | 5-(oxaan-4-yl)-1-aza-5-stannabicyclo[3.3.3]undecaan | 5-(oxan-4-yl)-1-aza-5-stannabicyclo[3.3.3]undecane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | |||||||
| 126085-91-4 | 677-924-1 | 5-(tributylstannyl)isoxazool-3-carbonzuurethylester | 5-(tributylstannyl)isoxazole-3-carboxylic acid ethyl ester | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 144173-85-3 | 677-923-6 | 5-(tributylstannyl)pyrimidine | 5-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 171290-94-1 | 688-582-8 | 5,5′-bis(tri-n-butylstannyl)-2,2′-bithiofeen | 5,5′-bis(tri-n-butylstannyl)-2,2′-bithiophene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 94134-56-2 | 302-825-4 | 5,5-dibutyl-3,3,7,7-tetramethoxy-2,4,6,8-tetraoxa-3,7-disila-5-stannanonaan | 5,5-dibutyl-3,3,7,7-tetramethoxy-2,4,6,8-tetraoxa-3,7-disila-5-stannanonane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 63612-50-0 | 624-700-6 | 5,5-dimethyl-3-[4-nitro-2-(trifluormethyl)fenyl]-1H-imidazool-2,4(3H,4H)-dion | 5,5-dimethyl-3-[4-nitro-2-(trifluoromethyl)phenyl]-1H-imidazol-2,4(3H,4H)-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 67485-29-4 | 405-090-9 | 5,5-dimethyl-perhydro-pyrimidin-2-on α-(4-trifluormethylstyryl)-α-(4-trifluormethyl)cinnamylideenhydrazon | 5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 355-43-1 | 206-586-6 | 5,6,6-tridecafluoro-6-iodo-1,1,1,2,2,3,3,4,4,5-hexaan | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | |||||
| 2101700-15-4 | 864-730-9 | 5-amino-3-[4-[[(5-fluor-2-methoxybenzoyl)amino]methyl]fenyl]-1-[(1S)-2,2,2-trifluor-1-methylethyl]-1H-pyrazool-4-carboxamide | 1H-pyrazole-4-carboxamide, 5-amino-3-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]-1-[(1S)-2,2,2-trifluoro-1-methylethyl]- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 611168-46-8 | 684-700-7 | 5-broom-2-(tributylstannyl)pyridine | 5-bromo-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 123061-47-2 | 106-620-9 | 5-chloor-2-(methylthio)-4-(tributylstannyl)pyrimidine | 5-chloro-2-(methylthio)-4-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 1092938-83-4 | 120-766-0 | 5-ethyl-2-(tributylstannyl)pyridine | 5-ethyl-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 1185851-52-8 | 867-521-0 | 5-hepteenamide, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-difluor-4-fenoxy-1-buteen-1-yl]-3,5-dihydroxycyclopentyl]-N-ethyl-, (5Z)- (ACI) | 5-heptenamide, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-N-ethyl-, (5Z)- (ACI) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 2920059-96-5 | 175-553-5 | 5-hepteenzuur,7-{(1R,2R,3R,5S)-2-[(1E)-3,3,4-trifluor-4-fenoxy-1-buteen-1-yl]-3,5-dihydroxycyclopentyl}-, 1-methylethylester, (5Z)- | 5-heptenoic acid,7-{(1R,2R,3R,5S)-2-[(1E)-3,3,4-trifluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-, 1-methylethyl ester, (5Z)- | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 209860-88-8 | 859-365-7 | 5-hepteenzuur,7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluor-4-fenoxy-1-buteen-1-yl]-3,5-dihydroxycyclopentyl}-, (5Z)- | 5-heptenoic acid,7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-, (5Z)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 93253-75-9 | 188-212-0 | 5-methyl-1-aza-5-stannabicyclo[3.3.3]undecaan | 5-methyl-1-aza-5-stannabicyclo[3.3.3]undecane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 3697-24-3 | 681-936-2 | 5-methylchryseen | 5-methylchrysene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 1403564-06-6 | 991-648-1 | 5-methyl-N-[2-(trifluormethyl)fenyl]-1,2-oxazool-4-carboxamide | 5-methyl-N-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 602-87-9 | 210-025-0 | 5-nitroacenafteen | 5-nitroacenaphthene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 5-sec-butyl-2-(2,4-dimethylcyclohex-3-een-1-yl)-5-methyl-1,3-dioxaan | 5-sec-butyl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||||
| 5-sec-butyl-2-(4,6-dimethylcyclohex-3-een-1-yl)-5-methyl-1,3-dioxaan | 5-sec-butyl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||||
| 87735-26-0 | 289-337-4 | 6,6-dibutyl-4,4,8,8-tetraethoxy-3,5,7,9-tetraoxa-4,8-disila-6-stannaundecaan | 6,6-dibutyl-4,4,8,8-tetraethoxy-3,5,7,9-tetraoxa-4,8-disila-6-stannaundecane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 139-93-5 | 205-386-6 | 6,6'-dihydroxy-3,3'-diarseen-1,2-diyldianiliniumdichloride | 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 119-47-1 | 204-327-1 | 6,6'-di-tert-butyl-2,2'-methyleendi-p-cresol | p-cresol, 2,2'-methylenebis(6-tert- butyl- | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-7-2021 | 80 | ||||
| 2156592-54-8 | 701-118-1 | 6-[(C10-C13)-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur | 6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | ||||
| 701-162-1 | 6-[C12-18-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | ||||||
| 701-271-4 | 6-[C12-18-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur, natrium en tris (2-hydroxyethyl)-ammoniumzouten | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | ||||||
| 85136-74-9 | 400-340-3 | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(fenylazo)fenylazo]-1,2-dihydro-3-pyridinecarbonitril | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1630868-67-5 | 140-979-2 | 6-hydroxy-4,8-dioxo-(1,3,2)dioxaplumbocaan-6-carbonzuur | 6-hydroxy-4,8-dioxo-(1,3,2)dioxaplumbocane-6-carboxylic acid | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 126 | ||||||
| 120-71-8 | 204-419-1 | 6-methoxy-m-toluïdine | 6-methoxy-m-toluidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 7496-02-8 | 626-732-6 | 6-nitrochryseen | 6-nitrochrysene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 11, 48 | ||||||
| 194-59-2 | 205-895-3 | 7H-dibenzo[c,g]carbazool | 7H-dibenzo[c,g]carbazole | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 199327-61-2 | 429-400-7 | 7-methoxy-6-(3-morfoline-4-ylpropoxy)-3H-chinazoline-4-on [met 0,5 procent of meer formamide (EC-nr. 200-842-0)] | 7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one, [containing ≥ 0.5 % formamide (EC No 200-842-0) ] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 106-87-6 | 203-437-7 | 7-oxa-3-oxiranylbicyclo[4.1.0]heptaan | 7-oxa-3-oxiranylbicyclo[4.1.0]heptane | Ja | MVP 2 | 1 mg/Nm3 | 12-7-2021 | 80 | |||||
| 13973-14-3 | 640-843-7 | 8H-perfluoroctaanzuur | 8H-perfluorooctanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 578-95-0 | 209-434-7 | 9(10H)acridoon | 9(10H)acridone | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 67968-63-2 | 267-966-5 | 9(of 10)-sulfooctadecaanzuur, kaliumzout | 9(or 10)-sulphooctadecanoic acid, potassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 80 | |||||
| 68609-93-8 | 271-843-1 | 9-octadeceenzuur (Z)-, gesulfoneerd, kaliumzouten | 9-octadecenoic acid (Z)-, sulfonated, potassium salts | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 80 | |||||
| 64741-48-6 | 265-048-9 | aardgas (aardolie), ruw vloeibaar mengsel | natural gas (petroleum), raw liq. mix. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68919-39-1 | 272-896-3 | aardgascondensaten | natural gas condensates | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-47-5 | 265-047-3 | aardgascondensaten (aardolie) | natural gas condensates (petroleum) | Ja | 2-12-2013 | 4, 64 | |||||||
| 8002-05-9 | 232-298-5 | aardolie | petroleum | Ja | 2-12-2013 | 4 | |||||||
| 92045-80-2 | 295-463-0 | aardoliegassen vloeibaar gemaakt, stankvrij gemaakt, c4-fractie | petroleum gases, liquefied, sweetened, C4 fraction | Ja | 2-12-2013 | 4, 59 | |||||||
| 68514-79-4 | 271-058-4 | aardolieproducten hydrofiner-powerformer-reformaten | petroleum products, hydrofiner-powerformer reformates | Ja | 2-12-2013 | 4, 64 | |||||||
| 68607-11-4 | 271-750-6 | aardolieproducten raffinaderijgassen | petroleum products, refinery gases | Ja | 2-12-2013 | 4, 59 | |||||||
| 101316-45-4 | 309-851-5 | absorptieoliën bicyclo-aromatische en heterocyclische koolwaterstoffractie | absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction, | 2-12-2013 | 4 | ||||||||
| 83-32-9 | 201-469-6 | acenafteen | acenaphthene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 208-96-8 | 205-917-1 | acenaftyleen | acenaphthylene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 97-44-9 | 202-582-3 | acetarsol | acetarsol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 534-33-8 | 208-597-1 | acetarsol-diethylamine (1:1) | acetarsol-diethylamine (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 127-06-0 | 204-820-1 | aceton oxime | acetone oxime | Ja | MVP 2 | 1 mg/Nm3 | 10-1-2025 | 80 | |||||
| 5711-19-3 | 227-200-2 | acetoxytrimethyllood | acetoxytrimethylplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 13266-07-4 | 654-802-6 | acetoxytripropyllood | plumbane, acetoxytripropyl- | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 260-94-6 | 205-971-6 | acridine | acridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 101007-06-1 | 600-147-6 | acrinathrin | acrinathrin | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 79-06-1 | 201-173-7 | acrylamide | acrylamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 107-13-1 | 203-466-5 | acrylonitril | acrylonitrile | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 77536-66-4 | actinoliet | actinolite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 56 | ||||||
| 94551-99-2 | 305-445-7 | afval van de opwerking van loodaccu's | wastes, lead battery reprocessing | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 56 | ||||||
| 102110-62-3 | 310-063-9 | afvalslik en bezinksel, afgasreiniging van koper-loodertsroosting, arseenhoudend | slimes and sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg. | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 100995-81-1 | 309-772-6 | afvalslik en bezinksel, electrolytische koper zuivering, ontkoperd, arseen-rijk | slimes and sludges, copper electrolytic refining, decopperized, arsenic-rich | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 94551-87-8 | 305-433-1 | afvalslik en bezinksel, elektrolytische koperzuivering, ontkoperd | slimes and sludges, copper electrolyte refining, decopperised | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92129-57-2 | 295-859-3 | afvalslik en bezinksel, elektrolytische koperzuivering, ontkoperd, nikkelsulfaat | slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 67712-00-9 | 266-977-2 | afvalslik en bezinksel, koper zuivering | slimes and sludges, copper refining | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 69012-21-1 | 273-721-3 | afvalwater, elektrolytische oplossing voornamelijk bestaand uit cadmiumsulfaat en zwavelzuur | wastewater, cadmium sulfate electrolytic, acid | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 309-00-2 | 206-215-8 | aldrin | aldrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 959-98-8 | 625-034-9 | alfa-endosulfan | alpha-endosulfan | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 134237-50-6 | alfa-hexabroomcyclododecaan | alpha-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||
| 319-84-6 | 206-270-8 | alfa-hexachloorcyclohexaan | alpha-hexachlorocyclohexane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 65996-83-0 | 266-017-2 | alkalisch extract koolteerolie | extracts, coal tar oil alk. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 90640-89-4 | 292-611-6 | alkalisch extract, destillaten (koolteer), naftaleenoliën | distillates (coal tar), naphthalene oils, alk. exts. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 68815-21-4 | 272-361-4 | alkalisch extract, teerzuren kresyl-, natriumzouten loogoplossingen | tar acids, cresylic, sodium salts, caustic solns., alkaline extract | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 954-979-2 | alkalische co-precipitatieproducten van oplosbare aluminium-, kobalt- en nikkelzouten | alkaline co-precipitation products of soluble aluminium, cobalt and nickel salts | MVP 1 | 0,05 mg/Nm3 | 23-9-2024 | 34, 56 | |||||||
| 954-825-4 | alkalische co-precipitatieproducten van oplosbare kobalt-, mangaan- en nikkelzouten | alkaline co-precipitation products of soluble cobalt, manganese and nickel salts | MVP 1 | 0,05 mg/Nm3 | 23-9-2024 | 34, 56 | |||||||
| 68475-57-0 | 270-651-5 | alkanen C1-2-, petroleumgas | alkanes, C1-2, petroleum gas | Ja | 2-12-2013 | 4, 59 | |||||||
| 90622-53-0 | 292-454-3 | alkanen C12-26-vertakte en niet-vertakte | alkanes, C12-26-branched and linear | Ja | 2-12-2013 | 4, 63 | |||||||
| 90622-55-2 | 292-456-4 | alkanen C1-4, rijk aan C3, petroleumgas | alkanes, C1-4, C3-rich, petroleum gas | Ja | 2-12-2013 | 4, 59 | |||||||
| 68475-58-1 | 270-652-0 | alkanen C2-3-, petroleumgas | alkanes, C2-3, petroleum gas | Ja | 2-12-2013 | 4, 59 | |||||||
| 68475-59-2 | 270-653-6 | alkanen C3-4-, petroleumgas | alkanes, C3-4, petroleum gas | Ja | 2-12-2013 | 4, 59 | |||||||
| 68475-60-5 | 270-654-1 | alkanen C4-5-, petroleumgas | alkanes, C4-5, petroleum gas | Ja | 2-12-2013 | 4, 59 | |||||||
| 68390-33-0 | alkyl jodiden, C10-12, γ-ω- perfluor | alkyl iodides, C10-12, γ-ω-perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 68188-12-5 | 269-141-5 | alkyl jodiden, C4-20, γ-ω-perfluor | alkyl iodides, C4-20, γ-ω-perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 90622-71-2 | 292-474-2 | alkyl jodiden, C6-18, perfluor | alkyl iodides, C6-18, perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 799-972-3 | alkyleringsproducten van fenol (voornamelijk in para-positie) met C12-rijke vertakte alkylketens van oligomerisatie, omvattend individuele isomeren en/of combinaties daarvan | phenol, alkylation products (mainly in para position) with C12-rich branched alkyl chains from oligomerisation, covering any individual isomers and/ or combinations thereof | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2022 | 80 | ||||||
| 590-34-1 | 209-678-4 | allylarsonzuur | allylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 24850-33-7 | 246-494-3 | allyltributylstannaan | allyltributylstannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 37382-15-3 | 680-872-2 | aluminium gallium arsenide | aluminium gallium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12003-78-0 | 234-439-6 | aluminium, verbinding met nikkel (1:1) | aluminium, compound with nickel (1:1) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 22831-42-1 | 245-255-0 | aluminiumarsenide | aluminium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 198831-12-8 | 196-020-3 | aluminium-magnesium-nikkel-siliciumoxide | aluminiummagnesiumnickelsiliziumoxide | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125 | ||||||
| 142844-00-6 | 604-314-4 | aluminiumsilicaat vuurvaste keramische vezels | aluminosilicate refractory ceramic fibres | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| amfotere gefluoreerde surfactant | amphoteric fluorinated surfactant | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 90622-99-4 | 292-504-4 | amiden, C7-19, α-ω-perfluor-N,N-bis(hydroxyethyl) | amides, C7-19, α-ω-perfluoro-N,N-bis(hydroxyethyl) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 85186-64-7 | 286-048-5 | amines, C10-14-vertakt en lineair alkyl, [1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, [1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 85029-59-0 | 285-084-9 | amines, C10-14-vertakt en lineair alkyl, [2,4-dihydro-4-[(2-hydroxy-5-nitrofenyl)azo]-5-methyl-2-fenyl-3H-pyrazol-3-onaat(2-)][2-[(4,5-dihydro-3-methyl-5-oxo-1-fenyl-1H-pyrazol-4-yl)azo]benzoaat(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, [2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 85186-67-0 | 286-051-1 | amines, C10-14-vertakt en lineair alkyl, bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 85186-66-9 | 286-050-6 | amines, C10-14-vetakt en lineair alkyl, bis[1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 480-310-4 | ammonium 2,2,3 trifluor-3-(1,1,2,2,3,3-hexafluor-3-trifluormethoxypropoxy), propionaat | ammonium 2,2,3 trifluor-3-(1,1,2,2,3,3-hexafluoro-3-trifluormethoxypropoxy), propionate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 62037-80-3 | 700-242-3 | ammonium 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propanoaat | ammonium 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 95 | ||||
| 13573-16-5 | 237-003-3 | ammonium diamminetetrakis(thiocyanaat-N)chromaat(1-) | ammonium diamminetetrakis(thiocyanato-N)chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 68214-26-6 | 269-290-6 | ammonium diaquabis[salicylaat(2-)-O1,O2]chromaat(1-) | ammonium diaquabis[salicylato(2-)-O1,O2]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 908020-52-0 | 700-323-3 | ammonium difluor[1,1,2,2-tetrafluor-2-(pentafluorethoxy)ethoxy]acetaat | ammonium difluoro[1,1,2,2-tetrafluoro-2-(pentafluoroethoxy)ethoxy]acetate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 32680-29-8 | 251-151-6 | ammonium koperarsenaat | ammonium copper arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 3825-26-1 | 223-320-4 | ammonium pentadecafluoroctaanzuur | ammonium pentadecafluorooctanoate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | |||
| 68259-10-9 | 269-513-7 | ammonium perfluorbutaansulfonaat | ammonium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 3108-42-7 | 221-470-5 | ammonium perfluordecaanzuur | ammonium nonadecafluorodecanoate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | 95 | |||
| 68259-08-5 | 269-511-6 | ammonium perfluorhexaan-1-sulfonaat | ammonium perfluorohexane-1-sulphonate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | ||||
| 21615-47-4 | 244-479-6 | ammonium undecafluorhexanoaat | ammonium undecafluorohexanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 7784-44-3 | 232-067-9 | ammoniumarsenaat | ammonium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 12124-97-9 | 235-183-8 | ammoniumbromide | ammonium bromide | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | |||||
| 7788-98-9 | 232-138-4 | ammoniumchromaat | ammonium chromate | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 12, 56 | ||||||
| 7789-09-5 | 232-143-1 | ammoniumdichromaat | ammonium dichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 27-6-2013 | |||||
| 13462-93-6 | 236-667-1 | ammoniumdiwaterstofarsenaat | ammonium dihydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 29081-56-9 | 249-415-0 | ammoniumheptadecafluoroctaansulfonaat | ammonium heptadecafluorooctanesulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||
| 10124-48-8 | 233-335-8 | ammonium-kwikchloride | aminomercuric chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 28-6-2016 | 42, 56 | |||||
| 14644-70-3 | ammoniummagnesiumarsenaat | ammonium magnesium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 6130-43-4 | 228-098-2 | ammoniumperfluorheptaanzuur | ammonium perfluoroheptanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 80, 95 | ||||
| 700-403-8 | ammoniumzouten van mono- en bis[3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl en/of poly(gesubstitueerd alkeen)]fosfaat | ammonium salts of mono- and bis[3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl and/or poly (substituted alkene)] phosphate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 4149-60-4 | ammoniumzouten van perfluornonaanzuur | ammonium salts of perfluorononan-1-oic-acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-2-2016 | 95 | ||||
| 955-817-3 | amorf bariumkoperzinkborobismutaat | amorphous barium copper zinc borobismuthate | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 56, 78 | |||||||
| 179-239-9 | amorf nikkelhydroxide uit verwerking van sulfaat-houdend bijproduct van roestvast staal beitsen | amorphous nickel hydroxide from processing of sulphate-containing by-product from stainless steel pickling | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125 | |||||||
| 12172-73-5 | amosiet | amosite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 56 | ||||||
| anorganische arseenverbindingen | inorganic arsenic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 91 | |||||||
| 189-802-0 | anorganische cadmiumverbindingen | inorganic cadmium compounds | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 148 | |||||||
| anorganische kwikverbindingen | inorganic mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||||
| anorganische loodverbindingen | inorganic lead compounds | MVP 1 | 0,05 mg/Nm3 | 31-05-2016 | |||||||||
| 77536-67-5 | anthofylliet | anthophyllite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 56 | ||||||
| 135821-74-8 | anti-dodecachloorpentacyclooctadecadieen | anti-dodecachloropentacyclooctadecadiene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-5-2019 | 56 | |||||
| 8007-18-9 | 232-353-3 | antimoon nikkel titanium oxide geel | antimony nickel titanium oxide yellow | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 64475-90-7 | 264-904-9 | antimoonarseenoxide | antimony arsenic oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 28980-47-4 | 249-347-1 | antimoonarsenaat | antimony arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 68951-38-2 | 273-156-2 | antimoonoxide (Sb2O3), gemengd met arseenoxide (As2O3) | antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 120-12-7 | 204-371-1 | antraceen | anthracene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 90640-80-5 | 292-602-7 | antraceenolie | anthracene oil | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 62 | ||||
| 90640-82-7 | 292-604-8 | antraceenolie, antraceen arm | anthracene oil, anthracene-low | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 60, 62 | ||||
| 91995-16-3 | 295-276-4 | antraceenolie, antraceenpasta, carbazoolfractie | anthracene oil, anthracene paste, carbazole fraction | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91995-17-4 | 295-278-5 | antraceenolie, antraceenpasta, lichte destillatiefracties | anthracene oil, anthracene paste, distn. lights | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 60, 62 | ||||
| 90640-81-6 | 292-603-2 | antraceenolie, fractie | anthracene oil, anthracene paste | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 60, 62 | ||||
| 91995-15-2 | 295-275-9 | antraceenolie, fractie | anthracene oil, anthracene paste, anthracene fraction | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 60, 62 | ||||
| 91995-14-1 | 295-274-3 | antraceenolie, zuur extract | anthracene oil, acid ext. | Ja | 2-12-2013 | 4, 62 | |||||||
| 84-65-1 | 201-549-0 | antrachinon | anthraquinone | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 431-89-0 | 207-079-2 | apafluraan | apaflurane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 101794-75-6 | 309-957-1 | aromatische koolwaterstoffen C20-28-, polycyclisch afkomstig uit de pyrolyse van gemengde koolteerpek en polyethyleen | aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived | Ja | 2-12-2013 | 4, 62 | |||||||
| 101794-76-7 | 309-958-7 | aromatische koolwaterstoffen C20-28-, polycyclisch afkomstig uit de pyrolyse van gemengde koolteerpek en polystyreen | aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived | Ja | 2-12-2013 | 4, 62 | |||||||
| 101794-74-5 | 309-956-6 | aromatische koolwaterstoffen C20-28-, polycyclisch afkomstig uit de pyrolyse van gemengde koolteerpek polyethyleen en polypropyleen | aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived | Ja | 2-12-2013 | 4, 62 | |||||||
| 68131-49-7 | 268-618-5 | aromatische koolwaterstoffen c6-10-, met zuur behandeld geneutraliseerd nafta met laag kookpunt - niet gespecifieerd | aromatic hydrocarbons, C6-10, acid-treated, neutralized, low boiling point naphtha - unspecified | Ja | 2-12-2013 | 4, 64 | |||||||
| 90989-41-6 | 292-697-5 | aromatische koolwaterstoffen c6-10, rijk aan c8, lichte olie, herdestillaat, laagkokende fractie | aromatic hydrocarbons, C6-10, C8-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68475-70-7 | 270-658-3 | aromatische koolwaterstoffen c6-8-, afkomstig van pyrolysaat van nafta-raffinaat | aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 93571-75-6 | 297-401-8 | aromatische koolwaterstoffen c7-12-, rijk aan c8 | aromatic hydrocarbons, C7-12, C8-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 90989-42-7 | 292-698-0 | aromatische koolwaterstoffen c7-8-, dealkyleringsproducten destillatieresiduen | aromatic hydrocarbons, C7-8, dealkylation products, distn. residues | Ja | 2-12-2013 | 4, 64 | |||||||
| 90989-38-1 | 292-694-9 | aromatische koolwaterstoffen c8- | aromatic hydrocarbons, C8 | Ja | 2-12-2013 | 4, 60 | |||||||
| 91995-18-5 | 295-279-0 | aromatische koolwaterstoffen c8-, afkomstig uit katalytische hervorming | aromatic hydrocarbons, C8, catalytic reforming-derived | Ja | 2-12-2013 | 4, 64 | |||||||
| 90989-39-2 | 292-695-4 | aromatische koolwaterstoffen c8-10 | aromatic hydrocarbons, C8-10 | Ja | 2-12-2013 | 4, 64 | |||||||
| 91995-20-9 | 295-281-1 | aromatische koolwaterstoffen c8-9, bijproduct koolwaterstofhars-polymerisatie | aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product, | Ja | 2-12-2013 | 4, 60 | |||||||
| 92062-36-7 | 295-551-9 | aromatische koolwaterstoffen C9-12, benzeendestillatie, lichte olie, herdestillaat, hoogkokende fractie | aromatic hydrocarbons, C9-12, benzene distn., light oil redistillate, high boiling | Ja | 2-12-2013 | 4, 60 | |||||||
| 98072-36-7 | 308-487-4 | aromatische koowaterstoffen, destillatie residue, rijk aan naftaleen | aromatic hydrocarbons, distn. residues, naphthalene-rich | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 79, 81 | ||||||
| 98-50-0 | 202-674-3 | arsanilzuur | arsanilic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7440-38-2 | 231-148-6 | arseen | arsenic | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 91 | |||||
| 1303-32-8 | 627-949-9 | arseen disulfide | arsenic disulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1303-33-9 | 215-117-4 | arseen sulfide | arsenic sulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1303-34-0 | 625-728-1 | arseen sulfide (As2S5) | arsenic sulfide (As2S5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 56320-22-0 | arseen sulfide (AsS2) | arsenic sulfide (AsS2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 87198-15-0 | arseen tetrachloride fluoride | arsenic tetrachloride fluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 56729-51-2 | arseen tetrasulfide | arsenic tetrasulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7784-45-4 | 232-068-4 | arseen trijodide | arsenic triiodide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12044-79-0 | arseen(II)sulfide | arsenic(II) sulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12044-50-7 | 629-626-8 | arseen(V)oxide hydraat | arsenic(V) oxide hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 7784-33-0 | 232-057-4 | arseenbromide | arsenicbromide | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 17522-78-0 | arseenchloride (AsCl) | arsenic chloride (AsCl) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 41996-37-6 | arseenchloride (AsCl2) | arsenic chloride (AsCl2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 85561-28-0 | arseenhoudend zuur, kobalt(2+) zout | arsenenous acid, cobalt(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 85561-29-1 | arseenhoudend zuur, mangaan(2+)zout | arsenenous acid, manganese(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 951-957-4 | arseenoxides, bismut-ijzer-antimoonoxides, natriumaluminiumfluoride, zinksulfaat, terugwinningsproducten uit koper- en zink-stof | arsenic oxides, bismuth iron antimony oxides, sodium aluminium fluoride, zinc sulphate, recovery products from copper and zinc dusts | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | ||||||
| 22441-45-8 | arseenpentachloride | arsenic pentachloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12626-31-2 | arseenselenide | arsenic selenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7784-34-1 | 232-059-5 | arseentrichloride | arsenic chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 1327-53-3 | 215-481-4 | arseentrioxide | diarsenic trioxide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | |||
| arseenverbindingen | arsenic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 91 | |||||||
| 7778-39-4 | 231-901-9 | arseenzuur | arsenic acid | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | |||
| 127795-79-3 | arseenzuur (H3AsO4), ammoniumzout (2:1) | arsenic acid (H3AsO4), ammonium salt (2:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13702-38-0 | arseenzuur (H3AsO4), bismutzout (1:1) | arsenic acid (H3AsO4), bismuth salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 30621-31-9 | arseenzuur (H3AsO4), calciumzout (2:3), dihydraat | arsenic acid (H3AsO4), calcium salt(2:3), dihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 89067-81-2 | arseenzuur (H3AsO4), calciumzout (4:5) | arsenic acid (H3AsO4), calcium salt (4:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 85949-61-7 | arseenzuur (H3AsO4), calciumzout (7:10) | arsenic acid (H3AsO4), calcium salt (7:10) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 21093-83-4 | arseenzuur (H3AsO4), dipotassiumzout | arsenic acid (H3AsO4), dipotassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7774-41-6 | arseenzuur (H3ASO4), hemihydraat | arsenic acid (H3ASO4), hemihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 29871-10-1 | arseenzuur (H3AsO4), kobalt(2+) zout | arsenic acid (H3AsO4), cobalt(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13464-31-8 | arseenzuur (H3AsO4), koper(2+)zout (1:1) | arsenic acid (H3AsO4), copper(2+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 76407-89-1 | arseenzuur (H3AsO4), koper(2+)zout (2:3) | arsenic acid (H3AsO4), copper(2+) salt (2:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13478-34-7 | arseenzuur (H3AsO4), koper(2+)zout (2:3), tetrahydraat | arsenic acid (H3AsO4), copper(2+) salt (2:3), tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 102525-64-4 | arseenzuur (H3AsO4), koper(2+)zout (4:1) | arsenic acid (H3AsO4), copper(2+) salt (4:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 89054-01-3 | arseenzuur (H3AsO4), koper(2+)zout (4:5) | arsenic acid (H3AsO4), copper(2+) salt (4:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 120119-64-4 | arseenzuur (H3AsO4), lood(2+)zout (2:3), tetrahydraat | arsenic acid (H3AsO4), lead(2+) salt (2:3), tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 89054-03-5 | arseenzuur (H3AsO4), lood(2+)zout (4:5) | arsenic acid (H3AsO4), lead(2+) salt (4:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 33940-95-3 | arseenzuur (H3AsO4), lood(4+)zout (2:1), monohydraat | arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 10102-48-4 | arseenzuur (H3AsO4), lood(4+)zout (3:2) | arsenic acid (H3AsO4), lead(4+) salt (3:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 21480-65-9 | arseenzuur (H3AsO4), magnesiumzout (2:3) | arsenic acid (H3AsO4), magnesium salt (2:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 102110-21-4 | 310-019-9 | arseenzuur (H3AsO4), magnesiumzout, mangaan-gedoteerd | arsenic acid (H3AsO4), magnesium salt, manganese-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 16331-85-4 | 677-899-7 | arseenzuur (H3AsO4), monocesiumzout | arsenic acid (H3AsO4), monocesium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 164170-84-7 | arseenzuur (H3AsO4), monokaliumzout, 1/5-hydraat | arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13464-33-0 | arseenzuur (H3AsO4), zinkzout (1:1) | arsenic acid (H3AsO4), zinc salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 53404-12-9 | arseenzuur, (H3-As-O4), lood(4+) zout (4:3) | arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 94854-78-1 | arseenzuur, ammoniumkoperzout | arsenenous acid, ammonium copper salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 94854-80-5 | arseenzuur, ammoniumzinkzout | arsenenous acid, ammonium zinc salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 76871-66-4 | arseenzuur, cadmium neodymium(3+) zout (5:1:1) | arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 84953-43-5 | arseenzuur, cadmiumzout | arsenenous acid, cadmium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 10103-62-5 | 233-287-8 | arseenzuur, calciumzout | arsenic acid, calcium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 13464-39-6 | arseenzuur, calciumzout (1:2) | arsenic acid, calcium salt (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 15194-98-6 | arseenzuur, calciumzout (2:1) | arsenenous acid, calcium salt (2:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13466-06-3 | arseenzuur, dinatriumzout | arsonic acid, disodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 24343-41-7 | arseenzuur, galliumzout (1:1) | arsenous acid, gallium salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 60168-33-4 | arseenzuur, ijzer(3+)zout (1:1) | arsenous acid, iron(3+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 29871-13-4 | 249-916-4 | arseenzuur, koper(2+)zout | arsenic acid, copper(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 73156-86-2 | arseenzuur, koper(2+)zout, hydraat, (2:3:3) | arsenous acid, copper(2+) salt, hydrate, (2:3:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 10103-61-4 | 233-286-2 | arseenzuur, koperzout | arsenic acid, copper salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 82980-40-3 | arseenzuur, kwik(2+) zout | arsenenous acid, mercury(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 76871-65-3 | arseenzuur, lutetium(3+)zout | arsenenous acid, lutetium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 6423-72-9 | arseenzuur, methyl-, calciumzout (1:1) | arsonic acid, methyl-, calcium salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 6585-53-1 | arseenzuur, methyl-, ijzer(3+)zout (3:2) | arsonic acid, methyl-, iron(3+) salt (3:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 33972-75-7 | arseenzuur, methyl-, ijzerzout (9CI) | arsonic acid, methyl-, iron salt (9CI) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 54058-01-4 | arseenzuur, monoammoniumzout | arsonic acid, monoammonium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 10103-60-3 | arseenzuur, mononatriumzout | arsenic acid, monosodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 33992-49-3 | arseenzuur, nikkel(2+) zout | arsenenous acid, nickel(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 86859-92-9 | arseenzuur, praseodymium(3+)zout | arsenenous acid, praseodymium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 93080-00-3 | arseenzuur, tinzout | arsonic acid, tin salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 92278-94-9 | arseenzuur, titaanzout | arsenous acid, titanium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 36267-15-9 | arseenzuur, trikaliumzout | arsenous acid, tripotassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 33382-64-8 | arseenzuur, trikoper(1+)zout | arsenous acid, tricopper(1+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 37337-11-4 | arseenzuur, trikoper(1+)zout, geammoniseerd | arsenous acid, tricopper(1+) salt, ammoniated | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 69507-43-3 | arseenzuur, zilver(1+) zout | arsenenous acid, silver(1+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 28837-97-0 | arseenzuur, zinkzout (2:3) | arsenous acid, zinc salt (2:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12344-68-2 | arsenaalsulfide (As2S4) | arsenic sulfide (As2S4) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12523-20-5 | arsenaalzuur, antimoon(3+)zout (1:1) | arsenous acid, antimony(3+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12005-86-6 | 624-772-9 | arsenaat(1-), hexafluoro-, natrium (1:1) | arsenate(1-), hexafluoro-, sodium (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 138608-19-2 | 630-782-4 | arsenazo III natrium | arsenazo III sodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 85906-44-1 | arseneenzuur, rubidiumzout | arsenenous acid, rubidium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 83877-96-7 | arsenenzuur, antimoon(3+)zout | arsenenous acid, antimony(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 16973-45-8 | arsenicum(5)hexafluoride | arsenic(5) hexafluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12777-38-7 | arsenicumoxide | arsenic oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13768-07-5 | arseniet | arsenenous acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13464-58-9 | arsenigzuur | arsenous acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 73688-85-4 | 620-678-7 | arsenigzuur, [4-[[4-(dimethylamino)fenyl]azo]fenyl]-, monohydrochloride | arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 88442-64-2 | arseninezuur (H3AsO4), koper(2+)zout (1:1), sesquihydraat | arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7645-25-2 | arseninezuur (H3AsO4), loodzout | arsenic acid (H3AsO4), lead salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 86859-93-0 | arseninezuur, cerium(3+)zout | arsenenous acid, cerium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 82005-78-5 | arseninezuur, cesiumzout | arsenenous acid, cesium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 72845-34-2 | arseninezuur, lithiumzout | arsenenous acid, lithium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 100822-74-0 | arseninezuur, lood(2+)zout (1:1) | arsenous acid, lead(2+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 76871-63-1 | arseninezuur, neodymium(3+) zout | arsenenous acid, neodymium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 10326-24-6 | arseninezuur, zinkzout | arsenenous acid, zinc salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 64436-13-1 | 634-697-3 | arsenobetaïne | arsenobetaine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12414-94-7 | arsenopyriet, kobalthoudend | arsenopyrite, cobaltoan | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7784-42-1 | 232-066-3 | arsine | arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 36465-76-6 | arsonaat | arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 109882-46-4 | arsonzuur, lood(2+)zout (1:1) | arsonic acid, lead(2+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 6379-37-9 | arsonzuur, methyl-, samengevoegd met 1-octanamine (1:1) | arsonic acid, methyl-, compd. with 1-octanamine (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12774-48-0 | arsoraan, pentahydroxy-, koper(2+)zout (1:2) | arsorane, pentahydroxy-, copper(2+) salt (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 119-96-0 | 204-361-7 | arsthinol | arsthinol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1332-21-4 | asbest | asbestos | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | |||||||
| asbest amfibolen | asbestos amphibole | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 56 | |||||||
| 12001-29-5 | 601-650-3 | asbest chrysotiel | asbestos, chrysotile | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 56 | |||||
| 3586-60-5 | 803-606-0 | asomaat | asomate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 3337-71-1 | 222-077-1 | asulam | asulam | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 112 | ||||||
| 2302-17-2 | 218-953-8 | asulam natrium | asulam sodium | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 112 | ||||||
| 68049-83-2 | 620-425-0 | azafenidin | azafenidin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 2879-60-9 | azijnzuur, 2,2,2-trichloro-, 2,3,4,5,6-pentachlorophenyl ester | acetic acid, 2,2,2-trichloro-, 2,3,4,5,6-pentachlorophenyl ester | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 56 | ||||||
| 19745-69-8 | azijnzuur, 2,2-dichloor-, 2,3,4,5,6-pentachloorfenylester | acetic acid, 2,2-dichloro-, 2,3,4,5,6-pentachlorophenyl ester | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 56 | ||||||
| 5743-04-4 | 611-525-5 | azijnzuur, cadmiumzout, dihydraat | acetic acid, cadmium salt, dihydrate | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 56, 85 | ||||||
| 6080-56-4 | 612-031-2 | azijnzuur, lood(2+) zout, trihydraat | acetic acid, lead(2+) salt, trihydrate | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 56 | ||||||
| 151-56-4 | 205-793-9 | aziridine | ethyleneimine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 103-33-3 | 203-102-5 | azobenzeen | azobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 41083-11-8 | 255-209-1 | azocyclotin | azocyclotin | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 123-77-3 | 204-650-8 | azodicarbonamide | diazene-1,2-dicarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| azokleurstoffen op basis van benzidine | benzidine based azo dyes | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| azokleurstoffen op basis van o-dianisidine | o-dianisidine based azo dyes | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| azokleurstoffen op basis van o-tolidine | o-tolidine based dyes | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 18115-48-5 | 689-447-6 | barium tetrafluornikkelaat(2-) | barium tetrafluoronickelate(2-) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 10294-40-3 | 233-660-5 | bariumchromaat | barium chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 56 | |||||
| 13701-59-2 | 237-222-4 | bariumdiboortetraoxide | barium diboron tetraoxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | ||||
| 51404-69-4 | 257-175-3 | basisch azijnzuur loodzout | acetic acid, lead salt, basic | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 73-48-3 | 200-800-1 | bendroflumethiazide | bendroflumethiazide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 1861-40-1 | 217-465-2 | benfluralin | benfluralin | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 17804-35-2 | 241-775-7 | benomyl | benomyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 413615-35-7 | 609-913-4 | benthiavalicarb | benthiavalicarb | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 113 | ||||||
| 177406-68-7 | 605-799-5 | benthiavalicarb-isopropyl | benthiavalicarb isopropyl | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 80 | |||||
| 225-11-6 | 205-929-7 | benz[a]acridine | benz[a]acridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 225-51-4 | 205-930-2 | benz[c]acridine | benz[c]acridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 71-43-2 | 200-753-7 | benzeen | benzene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 1195978-93-8 | benzeen, ethenyl-, polymeer met 1,3-butadieen, gebromeerd | benzene, ethenyl-, polymer with 1,3-butadiene, brominated (FR-122P) | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 56, 139 | ||||||
| 552-30-7 | 209-008-0 | benzeen-1,2,4-tricarbonzuur-1,2-anhydride | benzene-1,2,4-tricarboxylic acid 1,2 anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 24-4-2018 | ||||||
| 32602-97-4 | 694-638-2 | benzeen-13C6-d6 | benzene-13C6-d6 | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 56, 67 | ||||||
| 92-87-5 | 202-199-1 | benzidine | benzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 29 | |||||
| 36341-27-2 | 252-984-8 | benzidine acetaat | benzidine acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 531-85-1 | 208-519-6 | benzidine dihydrochloride | benzidine dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 41195-21-5 | benzidine diperchloraat | benzidine diperchlorate | MVP 1 | 0,05 mg/Nm3 | 2-2-2022 | 56, 68 | |||||||
| 14414-68-7 | benzidine hydrochloride | benzidine, hydrochloride | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 56, 68 | |||||||
| 21136-70-9 | 244-236-4 | benzidinesulfaat | benzidine sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 86290-81-5 | 289-220-8 | benzine | gasoline | Ja | 2-12-2013 | 4, 64 | |||||||
| 93572-29-3 | 297-458-9 | benzine, C5-11-, gestabiliseerde, gereformde, met hoog octaangehalte | gasoline, C5-11, high-octane stabilised reformed | Ja | 2-12-2013 | 4, 64 | |||||||
| 68514-15-8 | 271-025-4 | benzine, dampterugwinning | gasoline, vapor-recovery | Ja | 2-12-2013 | 4, 64 | |||||||
| 68606-11-1 | 271-727-0 | benzine, direct door fractionering verkregen aftopinrichting | gasoline, straight-run, topping-plant | 2-12-2013 | 4 | ||||||||
| 8006-61-9 | 232-349-1 | benzine, natuurlijke | gasoline, natural | Ja | 2-12-2013 | 4, 64 | |||||||
| 68606-10-0 | 271-726-5 | benzine, pyrolyse, butaanverwijdering bodemfracties | gasoline, pyrolysis, debutanizer bottoms | Ja | 2-12-2013 | 4, 64 | |||||||
| 94114-03-1 | 302-639-3 | benzine, pyrolyse, gehydrogeneerd, | gasoline, pyrolysis, hydrogenated | Ja | 2-12-2013 | 4, 64 | |||||||
| 56-55-3 | 200-280-6 | benzo[a]antraceen | benz[a]anthracene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 50-32-8 | 200-028-5 | benzo[a]pyreen | benzo[a]pyrene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 205-99-2 | 205-911-9 | benzo[b]fluoranteen | benzo[e]acephenanthrylene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 192-97-2 | 205-892-7 | benzo[e]pyreen | benzo[e]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 191-24-2 | 205-883-8 | benzo[g,h,i]peryleen | benzo[ghi]perylene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 205-82-3 | 205-910-3 | benzo[j]fluoranteen | benzo[j]fluoranthene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 207-08-9 | 205-916-6 | benzo[k]fluoranteen | benzo[k]fluoranthene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 119-61-9 | 204-337-6 | benzofenon | benzophenone | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | |||||
| 65996-88-5 | 266-023-5 | benzolvoorloop (kool) | benzol forerunnings (coal) | Ja | 2-12-2013 | 4, 60 | |||||||
| 98-07-7 | 202-634-5 | benzotrichloride | α,α,α-trichlorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 98-08-8 | 202-635-0 | benzotrifluoride | α,α,α-trifluorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 577705-90-9 | 479-100-5 | benzyl(diëthylamino) difenylfosfonium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyfenyl)propaan-2-yl] fenolaat | benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80, 95 | |||
| 85-68-7 | 201-622-7 | benzylbutylftalaat | benzyl butyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 100-44-7 | 202-853-6 | benzylchloride | α-chlorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 75768-65-9 | 278-305-5 | benzyltrifenylfosfonium, zout met 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]bis [fenol] (1:1) | benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80, 95 | |||
| 7440-41-7 | 231-150-7 | beryllium | beryllium | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10210-64-7 | 233-513-5 | beryllium acetylacetonaat | bis(pentane-2,4-dionato-O,O')beryllium | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 56, 68 | ||||||
| 506-66-1 | 208-050-7 | beryllium acetylide | beryllium acetylide | MVP 1 | 0,05 mg/Nm3 | 3-1-2022 | 56, 68 | ||||||
| 13106-47-3 | 236-030-8 | beryllium carbonaat | beryllium carbonate | MVP 1 | 0,05 mg/Nm3 | 3-1-2022 | 56, 68 | ||||||
| 7787-47-5 | 232-116-4 | beryllium chloride | beryllium chloride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 14874-86-3 | 238-948-4 | beryllium diammonium tetrafluoride | beryllium diammonium tetrafluoride | MVP 1 | 0,05 mg/Nm3 | 15-2-2022 | 56, 68 | ||||||
| 543-81-7 | 208-850-6 | beryllium diazijnzuur | Beryllium di(acetate) | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 12536-51-5 | 235-694-6 | beryllium diboride | beryllium diboride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 7787-46-4 | 232-115-9 | beryllium dibromide | beryllium dibromide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 7787-53-3 | 232-119-0 | beryllium dijodide | beryllium diiodide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 58127-61-0 | 261-137-1 | beryllium fosfide | beryllium phosphide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 12429-94-6 | 235-657-4 | beryllium hexaboride | beryllium hexaboride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 68 | ||||||
| 13327-32-7 | 236-368-6 | beryllium hydroxide | beryllium hydroxide | MVP 1 | 0,05 mg/Nm3 | 3-1-2022 | 56, 68 | ||||||
| 15191-85-2 | 239-251-8 | beryllium kiezelzuur | beryllium orthosilicate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 13597-99-4 | 237-062-5 | beryllium nitraat | beryllium nitrate | MVP 1 | 0,05 mg/Nm3 | 30-05-2016 | 68 | ||||||
| 1304-56-9 | 215-133-1 | beryllium oxide | beryllium oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 19049-40-2 | 242-785-4 | beryllium oxyazijnzuur | hexakis[μ-(acetato-O:O')]-μ4-oxotetraberyllium | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 56, 68 | ||||||
| 63990-88-5 | beryllium oxyfluoride | beryllium oxyfluoride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | |||||||
| 13510-49-1 | 236-842-2 | beryllium sulfaat | beryllium sulphate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 7787-56-6 | 629-461-1 | beryllium sulfaat tetrahydraat | beryllium sulfate tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 13598-22-6 | 237-064-6 | beryllium sulfide | beryllium sulphide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 12232-27-8 | 235-451-4 | beryllium telluride | beryllium telluride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 7787-55-5 | beryllium trihydraat | beryllium nitrate trihydrate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | |||||||
| 25638-88-4 | 247-151-0 | beryllium zink silicaat | beryllium zinc silicate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 56, 68 | ||||||
| 148896-39-3 | 890-452-2 | beryllium, bis(benzo[h]quinoline-10-olato-κN1,κO10)-, (T-4)- | beryllium, bis(benzo[h]quinolin-10-olato-κN1,κO10)-, (T-4)- | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 56, 68 | ||||||
| 220694-90-6 | 890-441-2 | beryllium; 2-pyridin-2-ylphenolaat | beryllium; 2-pyridin-2-ylphenolate | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 56, 68 | ||||||
| berylliumverbindingen | beryllium compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 3 | |||||||
| 1329995-45-0 | beta-cyclodextrin, verbinding met tridecafluorhexaansulfonzuur ion(1-) (1:1) | beta-cyclodextrin, compd. with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid ion(1-) (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 33213-65-9 | 625-635-6 | beta-endosulfan | beta-endosulfan | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 134237-51-7 | beta-hexabroomcyclododecaan | beta-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||
| 319-85-7 | 206-271-3 | beta-hexachloorcyclohexaan | beta-hexachlorocyclohexane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 64742-67-2 | 265-171-8 | bezinkselolie (aardolie) | foots oil (petroleum) | Ja | 2-12-2013 | 4, 61 | |||||||
| 97862-77-6 | 308-127-6 | bezinkselolie (aardolie), behandeld met kiezelzuur | foots oil (petroleum), silicic acid-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 97862-76-5 | 308-126-0 | bezinkselolie (aardolie), met koolstof behandeld | foots oil (petroleum), carbon-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 92045-12-0 | 295-394-6 | bezinkselolie (aardolie), met waterstof behandeld | foots oil (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 93924-31-3 | 300-225-7 | bezinkselolie (aardolie), zuurbehandeld | foots oil (petroleum), acid-treated | Ja | 2-12-2013 | 4, 59 | |||||||
| 93924-32-4 | 300-226-2 | bezinkselolie, met klei behandeld | foots oil (petroleum), clay-treated | Ja | 2-12-2013 | 4, 59 | |||||||
| 82657-04-3 | 617-373-6 | bifenthrin | bifenthrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 91-95-2 | 202-110-6 | bifenyl-3,3',4,4'-tetrayltetraamine | biphenyl-3,3',4,4'-tetrayltetraamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 485-31-4 | 207-612-9 | binapacryl | binapacryl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14949-69-0 | 239-028-5 | bis(1,1,1,5,5,5-hexafluorpentaan-2,4-dionato-O,O')nikkel | bis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-O,O')nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 95 | |||||
| 111532-88-8 | 631-201-7 | bis(1,2-benzeendiaminato-N,N')nikkel | bis(1,2-benzenediaminato-N,N')nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 1295-35-8 | 215-072-0 | bis(1,5-cyclooctadieen)nikkel | bis(1,5-cyclooctadiene)nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 21319-43-7 | 621-125-2 | bis(2,2,6,6-tetramethyl-3,5-heptaandionaat)lood(II) | bis(2,2,6,6-tetramethyl-3,5-heptanedionato)lead(II) | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 56 | ||||||
| 40334-69-8 | bis(2-chloorvinyl)chloorarsine | arsine, bis(2-chlorovinyl)chloro- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 26040-51-7 | 247-426-5 | bis(2-ethylhexyl) tetrabroomftalaat | bis(2-ethylhexyl) tetrabromophthalate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 56, 89 | |||||
| 117-81-7 | 204-211-0 | bis(2-ethylhexyl)ftalaat | bis(2-ethylhexyl) phthalate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||
| 117-82-8 | 204-212-6 | bis(2-methoxyethyl)ftalaat | bis(2-methoxyethyl) phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 678-41-1 | 211-649-6 | bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)waterstof fosfaat | bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) hydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 80-07-9 | 201-247-9 | bis(4-chloorfenyl)sulfon | bis(4-chlorophenyl) sulphone | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 80 | |||||
| 341548-85-4 | bis(4-methylfenyl)fenyl-sulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, bis(4-methylphenyl)phenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 194999-85-4 | 432-660-4 | bis(4-t-butylfenyl) iodonium perfluorbutaansulfonaat | bis(4-t-butylphenyl) iodonium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 3570-80-7 | 222-673-1 | bis(acetaat-O)[μ-(3',6'-dihydroxy-3-oxospiro[isobenzofuraan-1(3H),9'-[9H]xantheen]-2',7'-diyl)]dikwik | bis(acetato-O)[μ-(3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-2',7'-diyl)]dimercury | MVP 1 | 0,05 mg/Nm3 | 23-2-2022 | 42, 56 | ||||||
| 112-243-0 | bis(butylammonium) tris(methylammonium) tridecaiodotetraplumbaat | bis(butylammonium) tris(methylammonium) tridecaiodotetraplumbate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 126 | |||||||
| 542-88-1 | 208-832-8 | bis(chloormethyl)ether | bis(chloromethyl) ether | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 71957-07-8 | 276-205-6 | bis(D-gluconato-O.su.1.su.,O.su.2.su.)nikkel | bis(d-gluconato-O1,O2)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 17549-30-3 | 241-534-6 | bis(diethyldithiocarbamaat-S,S')lood | bis(diethyldithiocarbamato-S,S')lead | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 56 | ||||||
| 14267-17-5 | 238-157-4 | bis(diethyldithiocarbamato-S,S')nikkel | bis(diethyldithiocarbamato-S,S')nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 120045-16-1 | 631-453-8 | bis(N,N-dimethyl-N'-5H-pyrido[2,3-a]fenothiazin-5-ylideen-1,4-fenyleendiamine)nikkel(II)diperchloraat | bis(N,N-dimethyl-N'-5H-pyrido[2,3-a]phenothiazin-5-ylidene-1,4-phenylenediamine)nickel(II) diperchlorate | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 52299-25-9 | 700-183-3 | bis(nonafluorbutyl)fosfinezuur | bis(nonafluorobutyl)phosphinic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 207596-30-3 | 103-381-2 | bis(octaanzuur)hydraat nikkel | bis(octanoic acid) hydrate nickel | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 15282-88-9 | 239-323-9 | bis(pentaan-2,4-dionaat-O,O')lood | bis(pentane-2,4-dionato-O,O')lead | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 68892-01-3 | 272-591-5 | bis(pentaan-2,4-dionato-O,O')boor(1+) hexafluorarsenaat(1-) | bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 3264-82-2 | 221-875-7 | bis(pentaan-2,4-dionato-O,O')nikkel | bis(pentane-2,4-dionato-O,O')nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 1163-19-5 | 214-604-9 | bis(pentabroomfenyl)ether | bis(pentabromophenyl) ether | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 40143-79-1 | bis(perfluoroctyl)fosfinezuur | bis(perfluorooctyl)phosphinic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 18958-57-1 | 677-981-2 | bis(tetrabutylammonium) bis(maleonitrieldithiolato)nikkel(II) complex | bis(tetrabutylammonium) bis(maleonitriledithiolato)nickel(II) complex | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 19999-87-2 | 624-241-1 | bis(tricyclohexylfosfine)nikkel(II) dichloride | bis(tricyclohexylphosphine)nickel(II) dichloride | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 14264-16-5 | 238-154-8 | bis(trifenylfosfine)nikkel(II) chloride | bis(triphenylphosphine)nickel(II) chloride | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 27057-09-6 | 809-042-1 | bis(trifenylfosfino)(2-methylfenyl)chloornikkel(II) | bis(triphenylphosphino)(2-methylphenyl)chloronickel(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 1624-02-8 | 216-612-8 | bis(trifenylsilyl)chromaat | bis(triphenylsilyl) chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 80-43-3 | 201-279-3 | bis(α,α-dimethylbenzyl)peroxide | bis(α,α-dimethylbenzyl) peroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | |||||
| 1271-28-9 | 215-039-0 | bis(η5-2,4-cyclopentadieen-1-yl)nikkel | bis(η5-2,4-cyclopentadien-1-yl)nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 866621-50-3 | bis[(1,1-dimethylethyl)fenyl]-jodonium, zout met tridecafluorhexaansulfonzuur (1:1) (9CI) | iodonium, bis[(1,1-dimethylethyl)phenyl]-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) (9CI) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 23582-05-0 | 245-756-4 | bis[(2-difenylarsinoethyl)fenyl]fosfine | bis[(2-diphenylarsinoethyl)phenyl]phosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 38465-55-3 | 253-958-9 | bis[1-[4-(dimethylamino)fenyl]-2-fenylethyleen-1,2-dithiolato(2-)-S,S']nikkel | bis[1-[4-(dimethylamino)phenyl]-2-phenylethylene-1,2-dithiolato(2-)-S,S']nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 625080-35-5 | 684-861-3 | bis[2-(nitro-kO)-4-nitrofenolaat-kO]-lood | bis[2-(nitro-kO)-4-nitrophenolato-kO]-lead | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 1895-26-7 | 217-585-5 | bis[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecyl]waterstof fosfaat | bis[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl] hydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 213740-81-9 | bis[4-(1,1-dimethylethyl)fenyl]-jodonium, tridecafluorhexaansulfonaat (1:1) | iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 421555-74-0 | bis[4-(1,1-dimethylpropyl)fenyl]-jodonium, zout met tridecafluorhexaansulfonzuur | iodonium, bis[4-(1,1-dimethylpropyl)phenyl]-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 892154-91-5 | 693-595-7 | bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]fenylfosfine | bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]phenylphosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 38951-97-2 | 254-212-5 | bis[4,4'-dimethoxy-α,α'-stilbenedithiolato(2-)]nikkel | bis[4,4'-dimethoxy-α,α'-stilbenedithiolato(2-)]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 14426-25-6 | 238-398-5 | bis[p-(dimethylamino)fenyl][p-(dimethylammonio)fenyl]methylium | bis[p-(dimethylamino)phenyl][p-(dimethylammonio)phenyl]methylium | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 55, 56 | |||||
| 28984-20-5 | 249-353-4 | bis[stilbeen-α,β-dithiolato(2-)]nikkel | Bis[stilbene-α,β-dithiolato(2-)]nickel | MVP 1 | 20-8-2024 | 34, 56 | |||||||
| 326475-44-9 | 118-481-1 | bis[tris(4-(heptadecafluoroctyl)fenyl)fosfine | bis[tris(4-(heptadecafluorooctyl)phenyl)phosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 80-05-7 | 201-245-8 | bisfenol A | 4,4'-isopropylidenediphenol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 4-1-2017 | |||||
| 67874-71-9 | 267-499-7 | bismut tris(2-ethylhexanoaat) | bismuth tris(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 956-085-8 | bismutwolfraamloodtelluriet, amorf | amorphous bismuth tungsten lead tellurite | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 14, 56 | |||||||
| 13510-31-1 | boorarsenaat | boron arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12005-70-8 | boorarsenide (B6As) | boron arsenide (B6As) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12005-69-5 | boorarsenide (BAs) | boron arsenide (BAs) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 956-834-9 | boorlithiumzinktelluriet, amorf | amorphous boron lithium zinc tellurite | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 79, 81 | |||||||
| 10043-35-3 | 233-139-2 | boorzuur | boric acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 22454-04-2 | boorzuur (H3BO3), dinatrium zout | boric acid (H3BO3), disodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56 | ||||||
| 14890-53-0 | boorzuur (H3BO3), natriumzout (1:1) | boric acid (H3BO3), sodium salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56 | ||||||
| 25747-83-5 | boorzuur (H3BO3), natriumzout, hydraat | boric acid (H3BO3), sodium salt, hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56 | ||||||
| 12712-38-8 | 603-184-6 | boorzuur, kaliumzout | boric acid, potassium salt | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 1333-73-9 | 215-604-1 | boorzuur, natrium zout | boric acid, sodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56 | |||||
| 11130-12-4 | 601-071-6 | boorzuur, natriumzout, pentahydraat | boric acid, sodium salt, pentahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 90568-23-3 | boraat(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, natrium (1:2) | borate(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, sodium (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 125022-34-6 | boraat(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, natrium, hydraat (1:2:6) | borate(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, sodium, hydrate (1:2:6) | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 1303-96-4 | 603-411-9 | boraxdecahydraat | sodium tetraborate decahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 12179-04-3 | 601-808-1 | boraxpentahydraat | disodium tetraborate pentahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68334-30-5 | 269-822-7 | brandstoffen, diesel- | fuels, diesel | MVP 1 | 0,05 mg/Nm3 | 28-3-2022 | 79, 81 | ||||||
| 68476-26-6 | 270-667-2 | brandstofgassen | fuel gases | Ja | 2-12-2013 | 4, 59 | |||||||
| 68476-29-9 | 270-670-9 | brandstofgassen, destillaten van ruwe olie | fuel gases, crude oil of distillates | Ja | 2-12-2013 | 4, 59 | |||||||
| 68553-00-4 | 271-384-7 | brandstofolie, nr. 6 | fuel oil, No 6 | Ja | 2-12-2013 | 4 | |||||||
| 68476-33-5 | 270-675-6 | brandstofolie, residuaal | fuel oil, residual | Ja | 2-12-2013 | 4 | |||||||
| brandstofreservoir voor hydraulisch aggregaat voor vliegtuigen | fuel tank for aircraft hydraulic generator | Ja | Ja | MVP 2 | 1 mg/Nm3 | 29-11-2024 | 81, 105, 106 | ||||||
| 56073-10-0 | 259-980-5 | brodifacoum | brodifacoum | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 28772-56-7 | 249-205-9 | bromadiolon | bromadiolone | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 63468-73-5 | 264-254-6 | broom(hydroxytetraphenylarsoranato)magnesium | bromo(hydroxytetraphenylarsoranato)magnesium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 894102-11-5 | 679-543-6 | broom[(2,6-pyridinediyl)bis(3-methyl-1-imidazolyl-2-ylideen)]nikkel bromide | bromo[(2,6-pyridinediyl)bis(3-methyl-1-imidazolyl-2-ylidene)]nickel bromide | MVP 1 | 20-8-2024 | 34, 56 | |||||||
| 41141-89-3 | 621-229-8 | broomtriethyllood | plumbane, bromotriethyl- | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 3896-11-5 | 223-445-4 | bumetrizool | bumetrizole | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | |||||
| 34492-97-2 | bunseniet | bunsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 953030-84-7 | 858-581-9 | buprofezin | buprofezin | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 83, 132 | ||||||
| 106-97-8 | 203-448-7 | butaan | butane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 32 | |||||
| 1882109-60-5 | butaanzuur, 2,3,3,4,4,4-hexafluor-2-[2,2,2-trifluor-1,1-bis(trifluormethyl)ethyl]- | butanoic acid, 2,3,3,4,4,4-hexafluoro-2-[2,2,2-trifluoro-1,1-bis(trifluoromethyl)ethyl]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-61-6 | butaanzuur, 2,3,4,4,4-pentafluor-2-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]-3-(trifluormethyl)- | butanoic acid, 2,3,4,4,4-pentafluoro-2-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-58-1 | butaanzuur, 3,3,4,4,4-pentafluor-2,2-bis(1,1,2,2,2-pentafluorethyl)- | butanoic acid, 3,3,4,4,4-pentafluoro-2,2-bis(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-59-2 | butaanzuur, 3,3,4,4,4-pentafluor-2-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]-2-(trifluormethyl)- | butanoic acid, 3,3,4,4,4-pentafluoro-2-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-62-7 | butaanzuur, 4,4,4-trifluor-2,2,3,3-tetrakis(trifluormethyl)- | butanoic acid, 4,4,4-trifluoro-2,2,3,3-tetrakis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 96-29-7 | 202-496-6 | butanon oxime | 2-butanone oxime | Ja | MVP 2 | 1 mg/Nm3 | 24-3-2020 | ||||||
| 15546-16-4 | 239-596-4 | butyl (Z,Z)-6,6-dibutyl-4,8,11-trioxo-5,7,12-trioxa-6-stannahexadeca-2,9-dienoaat | butyl (Z,Z)-6,6-dibutyl-4,8,11-trioxo-5,7,12-trioxa-6-stannahexadeca-2,9-dienoate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 2273-43-0 | 218-880-1 | butylhydroxyoxostannaan | butylhydroxyoxostannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 94-26-8 | 202-318-7 | butylparabeen | butyl 4-hydroxybenzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-7-2020 | ||||||
| 23850-94-4 | 245-912-1 | butyltris[(2-ethyl-1-oxohexyl)oxy]stannaan | butyltris[(2-ethyl-1-oxohexyl)oxy]stannane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 2580-56-5 | 219-943-6 | C.I. basic blue 26 [met 0,1 procent of meer Michler's keton (EC nr. 202-027-5) of Michler's base (EC No. 202-959-2)] | C.I. basic blue 26 [with >0.1% of Michler's ketone (EC No. 202-027-5) or Michler's base (EC No. 202-959-2)] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 569-61-9 | 209-321-2 | C.I. basic red 9 | 4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 548-62-9 | 208-953-6 | C.I. basic violet 3 [met 0,1 procent of meer Michler's keton (EG-nr. 202-027-5)] | C.I. basic violet 3 with ≥ 0.1 % of Michler's ketone (EC no. 202-027-5) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 573-58-0 | 209-358-4 | C.I. direct red 28 | disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 6786-83-0 | 229-851-8 | C.I. solvent blue 4 [met 0,1 procent of meer Michler's keton (EG-nr. 202-027-5) of Michler's base (EG-nr. 202-959-2)] | α,α-bis[4-(dimethylamino)phenyl]-4 (phenylamino)naphthalene-1-methanol (C.I. solvent blue 4) [with >0.1% of Michler's ketone (EC No. 202-027-5) or Michler's base (EC No. 202-959-2)] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85535-84-8 | 287-476-5 | c10-13-chlooralkanen | chlorinated paraffins, C10-C13 | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||
| 85535-85-9 | 287-477-0 | C14-17-chlooralkanen | alkanes, C14-17, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | |||||
| 84776-07-8 | 283-931-7 | C16-27-chlooralkanen | alkanes, C16-27, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 85049-26-9 | 285-195-2 | C16-36-chlooralkanen | alkanes, C16-35, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 91079-47-9 | 293-435-2 | C9-11-fenolen | phenols, C9-11 | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 60, 62 | |||||
| 7440-43-9 | 231-152-8 | cadmium | cadmium | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||
| 35658-65-2 | 621-024-3 | cadmium (II) chloride monohydraat | cadmium (II) chloride monohydrate | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 56, 85 | ||||||
| 2420-98-6 | 219-346-0 | cadmium bis(2-ethylhexanoaat) | cadmium bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 14402-75-6 | 238-371-8 | cadmium di-kalium tetracyanide | cadmium dipotassium tetracyanide | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 69011-69-4 | 273-707-7 | cadmium, slakken | cadmium, dross | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 7789-42-6 | 232-165-1 | cadmiumbromide | cadmium bromide | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 513-78-0 | 208-168-9 | cadmiumcarbonaat | cadmium carbonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56 | ||||
| 10108-64-2 | 233-296-7 | cadmiumchloride | cadmium chloride | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||
| 654054-66-7 | 629-592-4 | cadmiumchloride hydraat | cadmium chloride hydrate | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 7790-78-5 | 640-998-0 | cadmiumchloride, hydraat (2:5) | cadmium chloride, hydrate (2:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56 | |||||
| 542-83-6 | 208-829-1 | cadmiumcyanide | Cadmium cyanide | MVP 1 | 0,05 mg/Nm3 | 30-8-2024 | 56, 85 | ||||||
| 543-90-8 | 208-853-2 | cadmiumdiazijnzuur | cadmium di(acetate) | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 4464-23-7 | 224-729-0 | cadmiumdiformiaat | cadmium diformate | MVP 1 | 0,05 mg/Nm3 | 30-8-2024 | 56, 85 | ||||||
| 7790-79-6 | 232-222-0 | cadmiumfluoride | cadmium fluoride | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 17010-21-8 | 241-084-0 | cadmiumhexafluorosilicaat(2-) | cadmium hexafluorosilicate(2-) | MVP 1 | 0,05 mg/Nm3 | 30-8-2024 | 56, 85 | ||||||
| 21041-95-2 | 244-168-5 | cadmiumhydroxide | cadmium hydroxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56 | ||||
| 7790-80-9 | 232-223-6 | cadmiumjodide | cadmium iodide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 85 | ||||||
| 10325-94-7 | 233-710-6 | cadmiumnitraat | cadmium nitrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56 | ||||
| 10022-68-1 | 638-751-7 | cadmiumnitraat tetrahydraat | cadmium nitrate tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 1306-19-0 | 215-146-2 | cadmiumoxide | cadmium oxide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||
| 10124-36-4 | 233-331-6 | cadmiumsulfaat | cadmium sulphate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 37, 56 | |||
| 15244-35-6 | 626-360-4 | cadmiumsulfaat hydraat | cadmium sulfate hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56 | |||||
| 7790-84-3 | 616-572-5 | cadmiumsulfaat hydraat (3:8) | cadmium sulphate hydrate (3:8) | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56 | |||||
| 1306-23-6 | 215-147-8 | cadmiumsulfide | cadmium sulphide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 68877-00-9 | 272-541-2 | cadmiumsulfide (CdS), gedoteerd met koperchloride | cadmium sulfide (CdS), copper chloride-doped | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 68512-49-2 | 270-977-8 | cadmiumsulfide (CdS), vaste oplossing met zinksulfide, gedoteerd met koperchloride | cadmium sulfide (CdS), solid soln. with zinc sulfide, copper chloride-doped | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| 68583-45-9 | 271-513-7 | cadmiumsulfide (CdS), vaste oplossing met zinksulfide, gedoteerd met zilverchloride | cadmium sulfide (CdS), solid soln. with zinc sulfide, silver chloride-doped | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 56, 85 | ||||||
| cadmiumverbindingen | cadmium compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 15195-00-3 | 672-782-7 | calcium arsenaat (CaHAsO4) (6CI,7CI) | calcium arsenate (CaHAsO4) (6CI,7CI) | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 136-51-6 | 205-249-0 | calcium bis(2-ethylhexaanzuur) | calcium bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 5785-43-3 | 227-311-6 | calcium bis(dimethylarsinaat) | calcium bis(dimethylarsinate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 5902-95-4 | 227-598-8 | calcium bis(methylarsonaat) | calcium bis(methylarsonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 701-251-5 | calcium, vertakt alkylfenaatsulfide | calcium branched alkyl phenate sulphide | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 79, 81 | |||||||
| 7778-44-1 | 231-904-5 | calciumarsenaat | calcium arsenate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | ||||
| 17068-86-9 | calciumarsenaatfluoride | calcium arsenate fluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 52740-16-6 | 258-147-3 | calciumarseniet | calcium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 20-12-2021 | 56, 91 | |||||
| 13765-19-0 | 237-366-8 | calciumchromaat | calcium chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 27-6-2013 | ||||||
| 14307-33-6 | 238-243-1 | calciumdichromaat | calcium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 12213-73-9 | 996-239-1 | calciumnikkel-legering (CaNi5) | calcium nickel alloy (CaNi5) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 2425-06-1 | 219-363-3 | captafol | captafol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6804-07-5 | 229-879-0 | carbadox | carbadox | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 95370-51-7 | 305-913-0 | carbaminezuur, [2-( sulfothio )ethyl]-, C-(γ-ω-perfluor-C6-9-alkyl)esters, mononatrium zouten | carbamic acid, [2-(sulfothio)ethyl]-, C-(γ-ω-perfluoro-C6-9-alkyl) esters, monosodium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 121-59-5 | 204-484-6 | carbarson | carbarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 10605-21-7 | 234-232-0 | carbendazim | carbendazim | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16118-49-3 | 240-286-6 | carbetamide | carbetamide | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 18942-25-1 | 677-958-7 | carbonzuur, 1,1-dimethylethyl pentachloorfenylester | carbonic acid, 1,1-dimethylethyl pentachlorophenyl ester | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 56 | |||||
| 72968-38-8 | 277-138-5 | carboxylzuren, C7-13, perfluor, ammonium zouten | carboxylic acids, C7-13, perfluoro, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 56, 93, 95 | ||||
| 120-80-9 | 204-427-5 | catechol | pyrocatechol | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | ||||||
| 440667-11-8 | 810-778-0 | cerium nikkel zirconiumoxide | cerium nickel zirconium oxide | MVP 1 | 20-8-2024 | 34, 56 | |||||||
| 56797-01-4 | 260-386-3 | cerium tris(2-ethylhexanoaat) | cerium tris(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 56320-90-2 | 620-910-7 | cesiumchromaat | cesium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 13530-67-1 | 236-879-4 | cesiumdichromaat | caesium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 18041-25-3 | 835-807-4 | cesiumlood tri-jodide (laag watergehalte) | cesium lead triiodide (low water content) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 15243-48-8 | 835-536-1 | cesiumloodtribromide (laag watergehalte) | cesium lead tribromide (low water content) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 91-22-5 | 202-051-6 | chinoline | quinoline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1501945-23-8 | 817-158-9 | chloor(2-methylfenyl)[1,1'-bis(difenylfosfino)ferroceen]nikkel(II) | chloro(2-methylphenyl)[1,1'-bis(diphenylphosphino)ferrocene]nickel (II) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 61788-76-9 | 263-004-3 | chlooralkanen | alkanes, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 108171-26-2 | chlooralkanen, C10-12 | chloroalkanes, C10-12 | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 55, 56 | ||||||
| 85681-73-8 | 288-211-6 | chlooralkanen, C10-14 | chloroalkanes, C10-14 | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 55, 56 | |||||
| 84082-38-2 | 281-985-6 | chlooralkanen, C10-21 | alkanes, C10-21, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 97659-46-6 | 307-451-5 | chlooralkanen, C10-26 | alkanes, C10-26, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 84776-06-7 | 283-930-1 | chlooralkanen, C10-32 | alkanes, C10-32, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 71011-12-6 | chlooralkanen, C12-13 | chloroalkanes, C12-13 | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 55, 56 | ||||||
| 85536-22-7 | 287-504-6 | chlooralkanen, C12-14 | alkanes, C12-14, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 68920-70-7 | 272-924-4 | chlooralkanen, C6-18 | alkanes, C6-18, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| chloorbenzotrifluoriden | chlorobenzotrifluorides | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 1419179-26-2 | 835-019-0 | chloorbis[dicyclohexyl(fenyl)fosfino](o-tolyl)nikkel(II) | chlorobis[dicyclohexyl(phenyl)phosphino](o-tolyl)nickel(II) | MVP 1 | 20-8-2024 | 34, 56 | |||||||
| 57-74-9 | 200-349-0 | chloordaan | chlordane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 143-50-0 | 205-601-3 | chloordecon | chlordecone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 107-30-2 | 203-480-1 | chloordimethylether | chloromethyl methyl ether | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 3691-35-8 | 223-003-0 | chloorfacinon | chlorophacinone | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 122453-73-0 | 602-782-4 | chloorfenapyr | chlorfenapyr | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 470-90-6 | 207-432-0 | chloorfenvinfos | chlorfenvinphos | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 71422-67-8 | 615-292-0 | chloorfluazuron | chlorfluazuron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| chloorfluorkoolstoffen | chlorofluorocarbons | Ja | - | 18-11-2024 | 100, 101 | ||||||||
| chloorfluorkoolwaterstoffen | chlorofluorohydrocarbons | Ja | - | 18-11-2024 | 100, 101 | ||||||||
| 115-09-3 | 204-064-2 | chloormethylkwik | chloromethylmercury | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 56 | |||||
| 3724-43-4 | 425-970-6 | chloor-N,N-dimethylformiminiumchloride | chloro-N,N-dimethylformiminium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 76-15-3 | 200-938-2 | chloorpentafluorethaan | chloropentafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 1067-14-7 | 213-925-1 | chloortriethyllood | chlorotriethylplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 1153-06-6 | 214-572-6 | chloortrifenyllood | chlorotriphenylplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 1257647-76-9 | 694-262-9 | chloor-tris(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)stannaan | chloro-tris(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)stannane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 56966-02-0 | 105-911-8 | chloortris(4-methoxyfenyl)lood | chlorotris(4-methoxyphenyl)lead | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 126 | ||||||
| 14973-92-3 | 239-051-0 | chloortris(trifenylarsine)rodium | chlorotris(triphenylarsine)rhodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 126-99-8 | 204-818-0 | chloropreen | chloroprene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 71701-12-7 | 275-861-0 | chromaat(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftaleen]acetamidaat(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftaleenolato(2-)]-, waterstof, verbinding met N-cyclohexylcyclohexanamine (1:1) | chromate(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthalenyl]acetamidato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-, hydrogen, compd. with N-cyclohexylcyclohexanamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 14977-61-8 | 239-056-8 | chromyldichloride | chromyl dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 18540-29-9 | 606-053-1 | chroom (VI) | chromium (VI) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 6 | |||||
| chroom (VI) verbindingen | chromium(VI) compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 6 | |||||||
| 68141-02-6 | 268-824-5 | chroom(3+)perfluoroctanoaat | chromium(3+) perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 12007-16-8 | 234-499-3 | chroomdiboride | chromium diboride | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 12, 56 | ||||||
| 1333-82-0 | 215-607-8 | chroomtrioxide | chromium trioxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 3444-17-5 | 222-357-3 | chroomtris(2-ethylhexaanzuur) | chromium tris(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 25-9-2023 | 68, 80 | ||||||
| 7738-94-5 | 231-801-5 | chroomzuur | chromic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 27-6-2013 | 24 | |||||
| 218-01-9 | 205-923-4 | chryseen | chrysene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 132207-32-0 | chrysotiel asbest | chrysotile asbestos | Ja | sA.1 | 0,05 mg/Nm3 | 10-5-2019 | 56 | ||||||
| 87818-31-3 | 402-410-9 | cinmethylin | cinmethylin | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 80, 137 | ||||||
| 13149-00-3 | 236-086-3 | cis-cyclohexaan-1,2-dicarbonzuuranhydride | cis-cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 18283-82-4 | 242-161-1 | citroenzuur ammoniumnikkelzout | citric acid, ammonium nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 22605-92-1 | 245-119-0 | citroenzuur nikkelzout | citric acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14450-60-3 | 238-432-9 | citroenzuur, loodzout | citric acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 74115-24-5 | 277-728-2 | clofentezine | 3,6-bis(o-chlorophenyl)-1,2,4,5-tetrazine | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 114 | ||||||
| 23593-75-1 | 245-764-8 | clotrimazol | clotrimazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3027149-78-3 | 197-042-6 | cobalt-lithium-mangaan-nikkeloxide, yttrium- en zirkonium-gedoteerd | cobalt lithium manganese nickel oxide, yttrium- and zirconium-doped | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125 | ||||||
| 64-86-8 | 200-598-5 | colchicine | colchicine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 67-97-0 | 200-673-2 | colecalciferol | cholecalciferol | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 80, 119 | ||||||
| 936-276-2 | concentraten van lood- en zinkverbindingen met zwavel afkomstig van hydrometallurgie (uitloging met heet zuur, uitloging met superheet zuur en flotatie) | concentrates of lead and zinc compounds with sulfur resulting from hydrometallurgy (hot acid leaching, super-hot acid leaching and flotation) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | |||||||
| 8001-58-9 | 232-287-5 | creosoot | creosote | Ja | 2-12-2013 | 4 | |||||||
| 8021-39-4 | 232-419-1 | creosoot, hout | creosote wood | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 47 | ||||||
| 61789-28-4 | 263-047-8 | creosootolie | creosote oil | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-85-0 | 292-606-9 | creosootolie, acenafteenfractie, acenafteenvrij | creosote oil, acenaphthene fraction, acenaphthene-free | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-84-9 | 292-605-3 | creosootolie, acenafteenfractie, wasolie | creosote oil, acenaphthene fraction | Ja | 2-12-2013 | 4, 62 | |||||||
| 70321-79-8 | 274-565-9 | creosootolie, hoogkokend destillaat | creosote oil, high-boiling distillate | Ja | 2-12-2013 | 4, 62 | |||||||
| 70321-80-1 | 274-566-4 | creosootolie, laagkokend destillaat | creosote oil, low-boiling distillate | Ja | 2-12-2013 | 4, 62 | |||||||
| 14464-46-1 | 238-455-4 | cristoballiet | cristobalite | sA.1 | 0,05 mg/Nm3 | 19-5-2021 | 44, 82 | ||||||
| 12001-28-4 | crocidoliet | crocidolite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 56 | ||||||
| 123-73-9 | 204-647-1 | crotonaldehyde | (E)-crotonaldehyde | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 5836-29-3 | 227-424-0 | cumatetralyl | coumatetralyl | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 98-82-8 | 202-704-5 | cumeen | cumene | Ja | gO.2 | 50 mg/Nm3 | 8-7-2022 | 44 | |||||
| 420-04-2 | 206-992-3 | cyanamide | cyanamide | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 115 | ||||||
| 5571-36-8 | 427-230-8 | cyclisch 3-(1,2-ethaandiylacetaal)oestra-5(10),9(11)-dieen-3,17-dion | cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 17976-43-1 | 241-894-4 | cyclo-di-μ-oxo(μ-ftalaat)trilood | cyclo-di-μ-oxo(μ-phthalato)trilead | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 294-62-2 | 206-033-9 | cyclododecaan | cyclododecane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 66-81-9 | 200-636-0 | cycloheximide | cycloheximide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 180409-60-3 | 605-896-2 | cyflufenamide | cyflufenamid | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 400882-07-7 | 642-974-5 | cyflumetofen | cyflumetofen | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 13121-70-5 | 236-049-1 | cyhexatin | cyhexatin | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 56 | ||||||
| 94361-06-5 | 619-020-1 | cyproconazool | cyproconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 121552-61-2 | 601-785-8 | cyprodinil | cyprodinil | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 83, 129 | ||||||
| 3424-82-6 | 222-318-0 | DDE, 2,4'-isomeer | 2,2,o,p'-tetrachlorovinylidenebisbenzene | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 789-02-6 | 212-332-5 | DDT, 2,4'-isomeer | 2,2,2,o,p'-pentachloroethylidenebisbenzene | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 50-29-3 | 200-024-3 | DDT, 4,4'-isomeer | 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27854-31-5 | decaanzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluor- | decanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 13654-09-6 | 237-137-2 | decabroombifenyl | decabromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 13, 56 | ||||||
| 84852-53-9 | 284-366-9 | decabroomdifenylethaan | decabromodiphenyl ethane | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 56 | |||||
| 541-02-6 | 208-764-9 | decamethylcyclopentasiloxaan | decamethylcyclopentasiloxane | Ja | MVP 2 | 1 mg/Nm3 | 6-7-2018 | ||||||
| 141-62-8 | 205-491-7 | decamethyltetrasiloxaan | decamethyltetrasiloxane | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 80 | |||||
| 13560-89-9 | 236-948-9 | dechloraan plus | 1,6,7,8,9,14,15,16,17,17,18,18-dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 22-1-2018 | 53 | ||||
| 319-86-8 | 206-272-9 | delta-hexachloorcyclohexaan | (1α,2α,3α,4β,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-07-2016 | 43 | |||||
| 90357-05-4 | 672-576-7 | desfluorbicalutamide | desfluoro bicalutamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 68955-27-1 | 273-263-4 | destillaten (aardolie), aardolieresiduen vacuüm- | distillates (petroleum), petroleum residues vacuum | Ja | 2-12-2013 | 4 | |||||||
| 91995-53-8 | 295-315-5 | destillaten (aardolie), afkomstig van nafta-stoomkraken oplosmiddelgeraffineerde lichte waterstofbehandelde | distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68425-29-6 | 270-344-6 | destillaten (aardolie), afkomstig van pyrolysaat van nafta-raffinaat, benzinemenging | distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-34-9 | 270-725-7 | destillaten (aardolie), C3-5, rijk aan 2-methyl-2-buteen | distillates (petroleum), C3-5, 2-methyl-2-butene-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-35-0 | 270-726-2 | destillaten (aardolie), C3-6, rijk aan piperyleen | distillates (petroleum), C3-6, piperylene-rich | Ja | 2-12-2013 | 4, 143 | |||||||
| 101316-56-7 | 309-862-5 | destillaten (aardolie), C7-9-, rijk aan C8, waterstofontzwaveld gedearomatiseerd | distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized | 2-12-2013 | 4 | ||||||||
| 64742-30-9 | 265-130-4 | destillaten (aardolie), chemisch geneutraliseerd middenfractie | distillates (petroleum), chemically neutralized middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-35-4 | 265-136-7 | destillaten (aardolie), chemisch geneutraliseerde lichte nafteenhoudende | distillates (petroleum), chemically neutralized light naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64742-28-5 | 265-128-3 | destillaten (aardolie), chemisch geneutraliseerde lichte paraffinehoudende | distillates (petroleum), chemically neutralized light paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 64742-34-3 | 265-135-1 | destillaten (aardolie), chemisch geneutraliseerde zware nafteenhoudende | distillates (petroleum), chemically neutralized heavy naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64742-27-4 | 265-127-8 | destillaten (aardolie), chemisch geneutraliseerde zware paraffinehoudende | distillates (petroleum), chemically neutralized heavy paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 90640-92-9 | 292-614-2 | destillaten (aardolie), complexe van was ontdane lichte paraffinische | distillates (petroleum), complex dewaxed light paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-91-8 | 292-613-7 | destillaten (aardolie), complexe van was ontdane zware paraffinehoudende | distillates (petroleum), complex dewaxed heavy paraffinci | Ja | 2-12-2013 | 4, 61 | |||||||
| 68477-40-7 | 270-729-9 | destillaten (aardolie), gekraakte gestripte stoomgekraakte aardoliedestillaten, C10-12-fractie | distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 79, 81 | ||||||
| 68477-38-3 | 270-727-8 | destillaten (aardolie), gekraakte stoomgekraakte aardoliedestillaten | distillates (petroleum), cracked steam-cracked petroleum distillates | Ja | 2-12-2013 | 4 | |||||||
| 68477-50-9 | 270-735-1 | destillaten (aardolie), gepolymeriseerde stoomgekraakte aardoliedestillaten C5-12-fractie | distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 91995-41-4 | 295-302-4 | destillaten (aardolie), hitteverzadigde stoomgekraakte nafta, rijk aan C5 | distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 90640-93-0 | 292-615-8 | destillaten (aardolie), hooggezuiverde midden- | distillates (petroleum), highly refined middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 92201-60-0 | 295-991-1 | destillaten (aardolie), katalytisch gekraakte lichte fracties, thermisch gedesintegreerd | distillates (petroleum), light catalytic cracked, thermally degraded | Ja | 2-12-2013 | 4 | |||||||
| 92201-59-7 | 295-990-6 | destillaten (aardolie), katalytisch gekraakte middenfracties, thermisch gedesintegreerd | distillates (petroleum), intermediate catalytic cracked, thermally degraded | Ja | 2-12-2013 | 4 | |||||||
| 68475-79-6 | 270-660-4 | destillaten (aardolie), katalytisch gereformde pentaanverwijdering- | distillates (petroleum), catalytic reformed depentanizer | Ja | 2-12-2013 | 4, 64 | |||||||
| 85116-58-1 | 285-509-8 | destillaten (aardolie), katalytisch gereformde, waterstofbehandelde, lichte fractie, C8-12- aromatische fractie | distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 91995-34-5 | 295-294-2 | destillaten (aardolie), katalytische reformator, concentraat van zware aromaten | distillates (petroleum) catalytic reformer, heavy arom. conc. | Ja | 2-12-2013 | 4, 63 | |||||||
| 68477-30-5 | 270-721-5 | destillaten (aardolie), katalytische reformator-fractioneerderresidu, bij middentemperaturen kokend | distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling | Ja | 2-12-2013 | 4, 63 | |||||||
| 68477-29-2 | 270-719-4 | destillaten (aardolie), katalytische reformator-fractioneerderresidu, hoogkokend | distillates (petroleum), catalytic reformer fractionator residue, high-boiling | Ja | 2-12-2013 | 4, 63 | |||||||
| 68477-31-6 | 270-722-0 | destillaten (aardolie), katalytische reformator-fractioneerderresidu, laagkokend | distillates (petroleum), catalytic reformer fractionator residue, low-boiling | Ja | 2-12-2013 | 4, 63 | |||||||
| 64741-59-9 | 265-060-4 | destillaten (aardolie), licht katalytisch gekraakte | distillates (petroleum), light catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 64741-82-8 | 265-084-5 | destillaten (aardolie), licht thermisch gekraakt | distillates (petroleum), light thermal cracked | Ja | 2-12-2013 | 4 | |||||||
| 67891-80-9 | 267-565-5 | destillaten (aardolie), lichte aromatische fractie | distillates (petroleum), light arom. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68921-08-4 | 272-931-2 | destillaten (aardolie), lichte direct door fractionering verkregen benzine, topproducten uit fractioneringsstabilisator | distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads | Ja | 2-12-2013 | 4, 64 | |||||||
| 68410-05-9 | 270-077-5 | destillaten (aardolie), lichte direct uit fractionering verkregen | distillates (petroleum), straight-run light | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-52-2 | 265-053-6 | destillaten (aardolie), lichte nafteenhoudende | distillates (petroleum), light naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64741-50-0 | 265-051-5 | destillaten (aardolie), lichte paraffinehoudende | distillates (petroleum), light paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 68475-80-9 | 270-662-5 | destillaten (aardolie), lichte stoomgekraakte nafta | distillates (petroleum), light steam-cracked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 68955-29-3 | 273-266-0 | destillaten (aardolie), lichte thermisch gekraakte, gedebutaniseerde aromatische | distillates (petroleum), light thermal cracked, debutanized arom. | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 70592-77-7 | 274-684-6 | destillaten (aardolie), lichte vacuüm- | distillates (petroleum), light vacuum | Ja | 2-12-2013 | 4 | |||||||
| 64742-44-5 | 265-146-1 | destillaten (aardolie), met klei behandeld zware nafteenhoudende fractie | distillates (petroleum), clay-treated heavy naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-45-6 | 265-147-7 | destillaten (aardolie), met klei behandelde lichte naftenische | distillates (petroleum), clay-treated light naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-37-6 | 265-138-8 | destillaten (aardolie), met klei behandelde lichte paraffinische | distillates (petroleum), clay-treated light paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-38-7 | 265-139-3 | destillaten (aardolie), met klei behandelde middenfractie | distillates (petroleum), clay-treated middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-36-5 | 265-137-2 | destillaten (aardolie), met klei behandelde zware paraffinische | distillates (petroleum), clay-treated paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 100683-97-4 | 309-667-5 | destillaten (aardolie), met koolstof behandelde lichte paraffine-houdende | distillates (petroleum), carbon-treated light paraffinic | Ja | 2-12-2013 | 4, 63 | |||||||
| 97488-74-9 | 307-011-2 | destillaten (aardolie), met oplosmiddel geraffineerde gehydrogeneerde zware | distillates (petroleum), solvent-refined hydrogenated heavy | Ja | 2-12-2013 | 4, 61 | |||||||
| 64741-89-5 | 265-091-3 | destillaten (aardolie), met oplosmiddel geraffineerde lichte paraffinehoudende | distillates (petroleum), solvent-refined light paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 94733-08-1 | 305-588-5 | destillaten (aardolie), met oplosmiddel geraffineerde met waterstof behandelde zware, gehydrogeneerd | distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated | Ja | 2-12-2013 | 4, 61 | |||||||
| 64741-96-4 | 265-097-6 | destillaten (aardolie), met oplosmiddel geraffineerde zware nafteenhoudende fractie | distillates (petroleum), solvent-refined heavy naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64741-88-4 | 265-090-8 | destillaten (aardolie), met oplosmiddel geraffineerde zware paraffinische | distillates (petroleum), solvent-refined heavy paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 94733-09-2 | 305-589-0 | destillaten (aardolie), met oplosmiddel gezuiverd met waterstof gekraakt lichte | distillates (petroleum), solvent-refined hydrocracked light | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-96-3 | 292-618-4 | destillaten (aardolie), met oplosmiddel van was ontdane lichte paraffinehoudende, met klei behandeld | distillates (petroleum), solvent dewaxed light paraffinic, clay-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-56-9 | 265-159-2 | destillaten (aardolie), met oplosmiddel van was ontdane lichte paraffinische | distillates (petroleum), solvent-dewaxed light paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-97-4 | 292-620-5 | destillaten (aardolie), met oplosmiddel van was ontdane lichte paraffinische, met waterstof behandeld | distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated, | 2-12-2013 | 4 | ||||||||
| 64742-65-0 | 265-169-7 | destillaten (aardolie), met oplosmiddel van was ontdane paraffinehoudende | distillates (petroleum), solvent-dewaxed heavy paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-94-1 | 292-616-3 | destillaten (aardolie), met oplosmiddel van was ontdane zware paraffinehoudende, met klei behandeld | distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-64-9 | 265-168-1 | destillaten (aardolie), met solvent van was ontdane lichte nafteenhoudende | distillates (petroleum), solvent-dewaxed light naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-63-8 | 265-167-6 | destillaten (aardolie), met solvent van was ontdane zware nafteenhoudende | distillates (petroleum), solvent-dewaxed heavy naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-47-8 | 265-149-8 | destillaten (aardolie), met waterstof behandelde lichte fractie | distillates (petroleum), hydrotreated light | MVP 1 | 0,05 mg/Nm3 | 10-11-2022 | 48, 79 | ||||||
| 64742-53-6 | 265-156-6 | destillaten (aardolie), met waterstof behandelde lichte naftenische | distillates (petroleum), hydrotreated light naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-55-8 | 265-158-7 | destillaten (aardolie), met waterstof behandelde lichte paraffinische | distillates (petroleum), hydrotreated light paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-46-7 | 265-148-2 | destillaten (aardolie), met waterstof behandelde middenfractie | distillates (petroleum), hydrotreated middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-52-5 | 265-155-0 | destillaten (aardolie), met waterstof behandelde zware naftenische | distillates (petroleum), hydrotreated heavy naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-54-7 | 265-157-1 | destillaten (aardolie), met waterstof behandelde zware paraffinische | distillates (petroleum), hydrotreated heavy paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-59-0 | 309-865-1 | destillaten (aardolie), met waterstof ontzwaveld middelste verkookser- | distillates (petroleum), hydrodesulfurized middle coker | Ja | 2-12-2013 | 4 | |||||||
| 68333-27-7 | 269-783-6 | destillaten (aardolie), met waterstof ontzwavelde katalytisch gekraakte tussenfractie | distillates (petroleum), hydrodesulfurized intermediate catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 64742-80-9 | 265-183-3 | destillaten (aardolie), met waterstof ontzwavelde middenfractie | distillates (petroleum), hydrodesulfurized middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 85116-53-6 | 285-505-6 | destillaten (aardolie), met waterstof ontzwavelde thermisch gekraakte middenfractie | distillates (petroleum), hydrodesulfurized thermal cracked middle | Ja | 2-12-2013 | 4 | |||||||
| 101316-57-8 | 309-863-0 | destillaten (aardolie), met waterstof ontzwavelde volledig bereik aan middelste | distillates (petroleum), hydrodesulfurized full-range middle | Ja | 2-12-2013 | 4 | |||||||
| 68333-28-8 | 269-784-1 | destillaten (aardolie), met waterstof ontzwavelde zware katalytisch gekraakte fractie | distillates (petroleum), hydrodesulfurized heavy catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64742-14-9 | 265-114-7 | destillaten (aardolie), met zuur behandelde lichte fractie | distillates (petroleum), acid-treated light | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-13-8 | 265-113-1 | destillaten (aardolie), met zuur behandelde middenfractie | distillates (petroleum), acid-treated middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-18-3 | 265-117-3 | destillaten (aardolie), met zuur behandelde zware nafteenhoudende fractie | distillates (petroleum), acid-treated heavy naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 100683-99-6 | 309-669-6 | destillaten (aardolie), middelste paraffine-houdende, behandeld met klei | distillates (petroleum), intermediate paraffinic, clay-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 100683-98-5 | 309-668-0 | destillaten (aardolie), middelste paraffine-houdende, behandeld met koolstof | distillates (petroleum), intermediate paraffinic, carbon-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 70592-76-6 | 274-683-0 | destillaten (aardolie), middelste vacuüm- | distillates (petroleum), intermediate vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-60-2 | 265-062-5 | destillaten (aardolie), middenfractie katalytisch gekraakt | distillates (petroleum), intermediate catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 68921-09-5 | 272-932-8 | destillaten (aardolie), nafta-unifiner-stripper | distillates (petroleum), naphtha unifiner stripper | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-97-5 | 265-098-1 | destillaten (aardolie), oplosmiddelgeraffineerde lichte naftenische | distillates (petroleum), solvent-refined light naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-54-9 | 295-316-0 | destillaten (aardolie), oplosmiddelgeraffineerde naftenische lichte, het waterstof behandeld | distillates (petroleum), solvent-refined light naphthenic, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 68477-89-4 | 270-771-8 | destillaten (aardolie), pentaanverwijdering, topproducten | distillates (petroleum), depentanizer overheads | Ja | 2-12-2013 | 4, 64 | |||||||
| 91995-31-2 | 295-292-1 | destillaten (aardolie), pyrolyseolie uit de alkeen-alkynproductie, gemengd met hoge-temperatuur-koolteer, indeenfractie | distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 93165-19-6 | 296-903-4 | destillaten (aardolie), rijk aan C6 | distillates (petroleum), C6-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-91-9 | 265-093-4 | destillaten (aardolie), solvent-geraffineerd middelste fractie | distillates (petroleum), solvent-refined middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 64741-86-2 | 265-088-7 | destillaten (aardolie), stankvrij gemaakt midden fractie | distillates (petroleum), sweetened middle | Ja | 2-12-2013 | 4, 63 | |||||||
| 68477-55-4 | 270-738-8 | destillaten (aardolie), stoomgekraakt, C5-10-fractie, gemengd met lichte stoomgekraakte aardolienafta-C5-fractie | distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-53-2 | 270-736-7 | destillaten (aardolie), stoomgekraakt, C5-12-fractie | distillates (petroleum), steam-cracked, C5-12 fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-54-3 | 270-737-2 | destillaten (aardolie), stoomgekraakt, C8-C12 fractie | distillates (petroleum), steam-cracked, C8-12 fraction | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 79, 81 | ||||||
| 95009-23-7 | 305-750-5 | destillaten (aardolie), stoomgekraakt, gepolymeriseerde C8-12-fractie, lichte destillatiefracties | distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights | Ja | 2-12-2013 | 4, 64 | |||||||
| 68603-00-9 | 271-631-9 | destillaten (aardolie), thermisch gekraakte nafta en gasolie | distillates (petroleum), thermal cracked naphtha and gas oil | Ja | 2-12-2013 | 4, 64 | |||||||
| 68603-01-0 | 271-632-4 | destillaten (aardolie), thermisch gekraakte nafta en gasolie, C5-dimeer bevattend | distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68603-03-2 | 271-634-5 | destillaten (aardolie), thermisch gekraakte nafta en gasolie, extractieve | distillates (petroleum), thermal cracked naphtha and gas oil, extractive | Ja | 2-12-2013 | 4, 64 | |||||||
| 68513-63-3 | 271-008-1 | destillaten (aardolie), topproducten van katalytisch gereformde, door directe fractionering verkregen nafta | distillates (petroleum), catalytic reformed straight-run naphtha overheads | Ja | 2-12-2013 | 4, 64 | |||||||
| 70592-78-8 | 274-685-1 | destillaten (aardolie), vacuüm- | distillates (petroleum), vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 91995-40-3 | 295-301-9 | destillaten (aardolie), van was ontdane paraffinehoudende lichte, met waterstof behandeld | distillates (petroleum), dewaxed light paraffinic, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-39-0 | 295-300-3 | destillaten (aardolie), van was ontdane zware paraffinehoudende, met waterstof behandeld | distillates (petroleum), dewaxed heavy paraffinic, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 68814-87-9 | 272-341-5 | destillaten (aardolie), volledig bereik door directe fractionering verkregen middenfractie | distillates (petroleum), full-range straight-run middle | MVP 1 | 0,05 mg/Nm3 | 19-5-2021 | 79, 81 | ||||||
| 91995-50-5 | 295-311-3 | destillaten (aardolie), waterstofbehandelde aromatische lichte, afkomstig van het stoomkraken van nafta | distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68410-97-9 | 270-093-2 | destillaten (aardolie), waterstofbehandelde lichte fracties, laagkokend | distillates (petroleum), light distillate hydrotreating process, low-boiling | Ja | 2-12-2013 | 4, 64 | |||||||
| 68410-96-8 | 270-092-7 | destillaten (aardolie), waterstofbehandelde middenfracties, tussenfracties | distillates (petroleum), hydrotreated middle, intermediate boiling | Ja | 2-12-2013 | 4, 64 | |||||||
| 68410-98-0 | 270-094-8 | destillaten (aardolie), waterstofbehandelde zware nafta, topproducten isohexaanverwijdering | distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads | Ja | 2-12-2013 | 4, 64 | |||||||
| 97488-73-8 | 307-010-7 | destillaten (aardolie), waterstofgekraakte met oplosmiddel geraffineerde lichte | distillates (petroleum), hydrocracked solvent-refined light | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-45-8 | 295-306-6 | destillaten (aardolie), waterstofgekraakte solventgeraffineerde, van was ontdaan | distillates (petroleum), hydrocracked solvent-refined, dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 68333-25-5 | 269-781-5 | destillaten (aardolie), waterstofontzwavelde lichte fractie katalytisch gekraakt | distillates (petroleum), hydrodesulfurized light catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 64742-19-4 | 265-118-9 | destillaten (aardolie), zuurbehandelde lichte nafteenhoudende | distillates (petroleum), acid-treated light naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64742-21-8 | 265-121-5 | destillaten (aardolie), zuurbehandelde lichte paraffinehoudende | distillates (petroleum), acid-treated light paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 64742-20-7 | 265-119-4 | destillaten (aardolie), zuurbehandelde zware paraffinehoudende | distillates (petroleum), acid-treated heavy paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 64741-61-3 | 265-063-0 | destillaten (aardolie), zwaar katalytisch gekraakt | distillates (petroleum), heavy catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-81-7 | 265-082-4 | destillaten (aardolie), zwaar thermisch gekraakt | distillates (petroleum), heavy thermal cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-76-0 | 265-077-7 | destillaten (aardolie), zwaar waterstofgekraakt | distillates (petroleum), heavy hydrocracked | Ja | 2-12-2013 | 4, 61 | |||||||
| 67891-79-6 | 267-563-4 | destillaten (aardolie), zware aromatische fractie | distillates (petroleum), heavy arom. | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-53-3 | 265-054-1 | destillaten (aardolie), zware nafteenhoudende | distillates (petroleum), heavy naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64741-51-1 | 265-052-0 | destillaten (aardolie), zware paraffinehoudende | distillates (petroleum), heavy paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 101631-14-5 | 309-939-3 | destillaten (aardolie), zware stoomgekraakte | distillates (petroleum), heavy steam-cracked | Ja | 2-12-2013 | 4 | |||||||
| 68915-96-8 | 272-817-2 | destillaten (aardolie), zware, directe destillatie | distillates (petroleum), heavy straight-run | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 79, 81 | ||||||
| 85029-51-2 | 285-076-5 | destillaten (kool), lichte olie uit de cokesoven naftaleenfractie | distillates (coal), coke-oven light oil, naphthalene cut | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 94114-53-1 | 302-689-6 | destillaten (kool), oplosmiddelextractie, waterstofgekraakt | distillates (coal), solvent extn., hydrocracked | Ja | 2-12-2013 | 4, 60 | |||||||
| 94114-57-5 | 302-693-8 | destillaten (kool), oplosmiddelextractie, waterstofgekraakte gehydrogeneerde middenfractie | distillates (coal), solvent extn., hydrocracked hydrogenated middle | Ja | 2-12-2013 | 4, 60 | |||||||
| 94114-56-4 | 302-692-2 | destillaten (kool), oplosmiddelextractie, waterstofgekraakte middenfractie | distillates (coal), solvent extn., hydrocracked middle | Ja | 2-12-2013 | 4, 60 | |||||||
| 94114-52-0 | 302-688-0 | destillaten (kool), primaire, vloeibaar-oplosmiddelextractie | distillates (coal), liq. solvent extn., primary | Ja | 2-12-2013 | 4, 60 | |||||||
| 91995-35-6 | 295-295-8 | destillaten (kool), residuele pyrolyseoliën uit koolteer, naftaleenoliën | distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils | Ja | 2-12-2013 | 4, 60 | |||||||
| 68188-48-7 | 269-159-3 | destillaten (kool-aardolie), gecondenseerde ringen-aromatisch | distillates (coal-petroleum), condensed-ring arom | Ja | 2-12-2013 | 4, 62 | |||||||
| 65996-92-1 | 266-027-7 | destillaten (koolteer) | distillates (coal tar) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 62 | |||||
| 84650-02-2 | 283-482-7 | destillaten (koolteer), benzolfractie | distillates (coal tar), benzole fraction | Ja | 2-12-2013 | 4 | |||||||
| 121620-46-0 | 310-165-3 | destillaten (koolteer), benzolfractie, destillatieresiduen | distillates (coal tar), benzole fraction, distn. residues | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 101896-26-8 | 309-984-9 | destillaten (koolteer), benzolfractie, rijk aan benzeen tolueen en xyleen | distillates (coal tar), benzole fraction, BTX-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 65996-91-0 | 266-026-1 | destillaten (koolteer), bovenste | distillates (coal tar), upper | Ja | 2-12-2013 | 4, 62 | |||||||
| 84989-10-6 | 284-899-7 | destillaten (koolteer), bovenste, fluoreenvrij | distillates (coal tar), upper, fluorene-free | Ja | 2-12-2013 | 4, 62 | |||||||
| 84989-11-7 | 284-900-0 | destillaten (koolteer), bovenste, rijk aan fluoreen | distillates (coal tar), upper, fluorene-rich | Ja | 2-12-2013 | 4, 62 | |||||||
| 84650-03-3 | 283-483-2 | destillaten (koolteer), lichte oliën | distillates (coal tar), light oils | Ja | 2-12-2013 | 4, 60 | |||||||
| 90640-88-3 | 292-610-0 | destillaten (koolteer), lichte oliën alkalische extracten | distillates (coal tar), light oils, alk. exts. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 101794-90-5 | 309-971-8 | destillaten (koolteer), lichte oliën neutrale fractie. lichte olie, extractieresidu, hoogkokende fractie | distillates (coal tar), light oils, neutral fraction, light oil extract residues, high boiling | Ja | 2-12-2013 | 4, 60 | |||||||
| 90640-87-2 | 292-609-5 | destillaten (koolteer), lichte oliën zuurextracten | distillates (coal tar), light oils, acid exts | Ja | 2-12-2013 | 4, 60 | |||||||
| 84650-04-4 | 283-484-8 | destillaten (koolteer), naftaleenoliën | distillates (coal tar), naphthalene oils | 2-12-2013 | 4 | ||||||||
| 101794-91-6 | 309-972-3 | destillaten (koolteer), naftaleenoliën indool-methylnaftaleenfractie | distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 101896-27-9 | 309-985-4 | destillaten (koolteer), naftaleenoliën methylnaftaleenfractie | distillates (coal tar), naphthalene oils, methylnaphthalene fraction | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 84989-09-3 | 284-898-1 | destillaten (koolteer), naftaleenoliën naftaleenarm | distillates (coal tar), naphthalene oils, naphthalene-low | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 90640-90-7 | 292-612-1 | destillaten (koolteer), naftaleenoliën naftaleenvrij, alkalische extracten | distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91995-48-1 | 295-309-2 | destillaten (koolteer), naftaleenoliën zuurextracten | distillates (coal tar), naphthalene oils, acid exts. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 101316-49-8 | 309-855-7 | destillaten (koolteer), pek | distillates (coal tar), pitch | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 62 | |||||
| 91995-52-7 | 295-313-4 | destillaten (koolteer), pek pyreenfractie | distillates (coal tar), pitch, pyrene fraction | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-51-6 | 295-312-9 | destillaten (koolteer), pek zware oliën | distillates (coal tar), pitch, heavy oils | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-86-1 | 292-607-4 | destillaten (koolteer), zware oliën | distillates (coal tar), heavy oils | Ja | 2-12-2013 | 4 | |||||||
| 91995-42-5 | 295-304-5 | destillaten (koolteer), zware oliën, pyreenfractie | distillates (coal tar), heavy oils, pyrene fraction | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-49-2 | 295-310-8 | destillatie (koolteer), moederloog uit naftaleenoliekristallisatie | distillates (coal tar), naphthalene oil crystn. mother liquor | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 950-299-5 | di-, tri- en tetrachloortetradecaan | di-, tri- and tetrachlorotetradecane | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||||
| 12004-35-2 | 234-454-8 | dialuminiumnikkeltetraoxide | dialuminium nickel tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25376-45-8 | 246-910-3 | diaminotolueen, isomerenmengsel van 2,4-tolueendiamine en 2,6-tolueendiamine | diaminotoluene | MVP 1 | 0,05 mg/Nm3 | 31-1-2023 | 73 | ||||||
| 93857-44-4 | 299-178-2 | diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylfosfaat | diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-45-0 | 303-523-5 | diammonium- 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluor-2-hydroxyundecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-46-1 | 303-524-0 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluor-2-hydroxytridecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-47-2 | 303-525-6 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluor-2-hydroxypentadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-48-3 | 303-526-1 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluor-2-hydroxyheptadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluoro-2-hydroxyheptadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-52-9 | 303-530-3 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluor-2-hydroxy-16-(trifluormethyl) heptadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluoro-2-hydroxy-16-(trifluoromethyl)heptadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-51-8 | 303-529-8 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl) pentadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 94200-50-7 | 303-528-2 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluor-2-hydroxy-12-( trifluormethyl) tridecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 15699-18-0 | 239-793-5 | diammoniumnikkelbis(sulfaat) | diammonium nickel bis(sulfate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 74195-78-1 | diammoniumnikkelhexacyanoferraat | diammonium nickel hexacyanoferrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 13510-89-9 | 236-845-9 | diantimoontrilood octaoxide | diantimony trilead octaoxide | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 14, 56 | ||||||
| 12044-54-1 | 234-955-1 | diarseen tritelluride | diarsenic tritelluride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1303-28-2 | 215-116-9 | diarseenpentaoxide | diarsenic pentaoxide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | |||
| 1303-36-2 | 215-119-5 | diarseentrielenide | diarsenic triselenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 13453-15-1 | diarseenzuur | diarsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13464-42-1 | diarseenzuur, tetranatriumzout | diarsenic acid, tetrasodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 334-88-3 | 206-382-7 | diazomethaan | diazomethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 1344-40-7 | dibasisch loodfosfiet | dibasic lead phosphite | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | |||||||
| 192-65-4 | 205-891-1 | dibenzo[a,e]pyreen | naphtho[1,2,3,4-def]chrysene | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 226-36-8 | 680-472-8 | dibenzo[a,h]acridine | dibenz[a,h]acridine | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 53-70-3 | 200-181-8 | dibenzo[a,h]antraceen | dibenz[a,h]anthracene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 189-64-0 | 205-878-0 | dibenzo[a,h]pyreen | dibenz[a,h]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 189-55-9 | 205-877-5 | dibenzo[a,i]pyreen | dibenz[a,i]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 224-42-0 | 635-000-5 | dibenzo[a,j]acridine | dibenz[a,j[acridine | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 191-30-0 | 205-886-4 | dibenzo[a,l]pyreen | dibenzo[def,p]chrysene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 85237-42-9 | 286-401-3 | dibismut-tris(methylarsonaat) | dibismuth tris(methylarsonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1303-86-2 | 215-125-8 | diboortrioxide | diboron trioxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 207569-11-7 | 688-199-6 | dibromonikkelhydraat | dibromonickel hydrate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 15242-92-9 | 621-434-2 | dibroombis(tributylfosfine)nikkel(II) | dibromobis(tributylphosphine)nickel(II) | MVP 1 | 20-8-2024 | 34, 56 | |||||||
| 10222-01-2 | 233-539-7 | dibroomnitrilopropiamide | 2,2-dibromo-2-cyanoacetamide | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 70 | ||||||
| 3349-36-8 | 222-103-1 | dibutoxydibutylstannaan | dibutoxydibutylstannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 1185-81-5 | 214-688-7 | dibutylbis(dodecylthio)stannaan | dibutylbis(dodecylthio)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 28660-67-5 | 249-134-3 | dibutylbis(myristoyloxy)stannaan | dibutylbis(myristoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 25955-19-5 | 247-367-5 | dibutylbis(nonanoyloxy)stannaan | dibutylbis(nonanoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 13323-62-1 | 236-359-7 | dibutylbis(octadec-9(Z)-enoyloxy)stannaan | dibutylbis(octadec-9(Z)-enoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 85391-79-3 | 286-834-8 | dibutylbis(octadeca-9(Z),12(Z)-dienoyloxy)stannaan | dibutylbis(octadeca-9(Z),12(Z)-dienoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 4731-77-5 | 225-236-3 | dibutylbis(octanoyloxy)stannaan | dibutylbis(octanoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 13323-63-2 | 236-360-2 | dibutylbis(palmitoyloxy)stannaan | dibutylbis(palmitoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 22673-19-4 | 245-152-0 | dibutylbis(pentaan-2,4-dionato-O,O”)tin | dibutylbis(pentane-2,4-dionato-O,O’)tin | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | 56 | ||||
| 5847-55-2 | 227-438-7 | dibutylbis(stearoyloxy)stannaan | dibutylbis(stearoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 25168-22-3 | 246-702-2 | dibutylbis[(1-oxoneodecyl)oxy]stannaan | dibutylbis[(1-oxoneodecyl)oxy]stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 1067-55-6 | 213-935-6 | dibutyldimethoxystannaan | dibutyldimethoxystannane | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 84-74-2 | 201-557-4 | dibutylftalaat | dibutyl phthalate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 4253-22-9 | 224-220-3 | dibutylthioxostannaan | dibutylthioxostannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 14488-53-0 | dibutyltin (kation) | tin(2+), dibutyl-, ion | Ja | MVP 1 | 0,05 mg/Nm3 | 6-9-2022 | 56 | ||||||
| 2781-10-4 | 220-481-2 | dibutyltin bis(2-ethylhexanoaat) | dibutyltin bis(2-ethylhexanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 56 | |||||
| 1067-33-0 | 213-928-8 | dibutyltindiazijnzuur | dibutyltin di(acetate) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 56 | |||||
| 683-18-1 | 211-670-0 | dibutyltindichloride | dibutyltin-dichloride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 77-58-7 | 201-039-8 | dibutyltindilauraat | dibutyltin dilaurate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 1002-53-5 | dibutyltinhydride | dibutyltin hydride | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 56 | |||||||
| 78-04-6 | 201-077-5 | dibutyltinmaleaat | dibutyltin maleate | Ja | MVP 1 | 0,05 mg/Nm3 | 6-9-2022 | 56 | |||||
| 818-08-6 | 212-449-1 | dibutyltinoxide | dibutyltin-oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 75113-37-0 | 401-040-5 | dibutyltinwaterstofboraat | dibutyltin hydrogen borate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13007-90-4 | 235-851-9 | dicarbonylbis(trifenylfosfine)nikkel | dicarbonylbis(triphenylphosphine)nickel | MVP 1 | 20-8-2024 | 34, 56 | |||||||
| 13454-78-9 | 236-640-4 | dicesiumchromaat | dicesium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 333-25-5 | dichloor(2-chloorovinyl)-arseenoxide | arsine oxide, dichloro(2-chlorovinyl)- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 696-28-6 | 211-791-9 | dichloor(fenyl)arsine | dichloro(phenyl)arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 19232-03-2 | 834-779-0 | dichloorbis(dicyclohexylfenylfosfine)nikkel(II) | dichlorobis(dicyclohexylphenylphosphine)nickel(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 15274-43-8 | 624-942-2 | dichloorbis(tributylfosfine)nikkel(II) | dichlorobis(tributylphosphine)nickel(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 13231-90-8 | 621-088-2 | dichloordiethyllood | plumbane dichlorodiethyl- | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 3542-36-7 | 222-583-2 | dichloordioctylstannaan | dichlorodioctylstannane | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 56 | |||||
| 593-89-5 | 695-189-5 | dichloormethylarsine | arsine, dichloromethyl- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 29046-78-4 | 627-461-6 | dichloornikkel-1,2-dimethoxyethaan | dichloronickel-1,2-dimethoxyethane | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 15683-37-1 | 198-809-8 | dichlorobis(methyldifenylfosfine)nikkel | dichlorobis(methyldiphenylphosphine)nickel | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125 | ||||||
| 12018-18-7 | 234-636-7 | dichroom nikkel tetraoxide | dichromium nickel tetraoxide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 12254-85-2 | 235-499-6 | dichroomarsenide | dichromium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 24613-89-6 | 246-356-2 | dichroomtris(chromaat) | dichromium tris(chromate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 13530-68-2 | 236-881-5 | dichroomzuur | dichromic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 24 | |||||
| 115-32-2 | 204-082-0 | dicofol | dicofol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 84-61-7 | 201-545-9 | dicyclohexylftalaat | dicyclohexyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||
| 60-57-1 | 200-484-5 | dieldrin | dieldrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64741-44-2 | 265-044-7 | dieselolie | distillates (petroleum), straight-run middle | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 79, 81 | ||||||
| 70225-14-8 | 274-460-8 | diethanolamineperfluoroctaansulfonaat | diethanolamine perfluorooctane sulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||
| 67-43-6 | 200-652-8 | di-ethyleentriaminepenta-azijnzuur | N-carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | |||||
| 42606-54-2 | 692-996-4 | diethyllooddibromide | diethyllead dibromide | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 126 | ||||||
| 64-67-5 | 200-589-6 | diethylsulfaat | diethyl sulphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 56073-07-5 | 259-978-4 | difenacum | difenacoum | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 58-36-6 | 200-377-3 | difenoxarsine-10-yl oxide | diphenoxarsin-10-yl oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 75980-60-8 | 278-355-8 | difenyl(2,4,6-trimethylbenzoyl) fosfineoxide | diphenyl(2,4,6-trimethylbenzoyl) phosphine oxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 80 | ||||
| 578-94-9 | 209-433-1 | difenylaminochloorarsine | diphenylaminechlorarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 829-83-4 | 212-589-3 | difenylarsine | diphenylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 23525-22-6 | 245-716-6 | difenylarsinecarbonitril | diphenylarsinecarbonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 712-48-1 | 211-921-4 | difenylchloorarsine | diphenylchloroarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 4519-32-8 | 224-845-1 | difenyldiarsenzuur | diphenyldiarsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 62613-15-4 | 263-638-0 | difenyljodonium hexafluoroarsenaat | diphenyliodonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 153443-35-7 | difenyljodonium, tridecafluorhexaansulfonaat (1:1) | iodonium, diphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 2117-69-3 | 218-325-3 | difenyllooddichloride | diphenyllead dichloride | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 3639-19-8 | 222-866-0 | difetarson | difetarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 515-76-4 | 208-209-0 | difetarson dinatrium | difetarsone disodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 104653-34-1 | difethialon | difethialone | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||||
| 83164-33-4 | 617-446-2 | diflufenican | diflufenican | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 19372-20-4 | difosforzuur nikkel(II)zout | diphosphoric acid, nickel(II) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 12044-20-1 | 234-948-3 | digalliumarsenidefosfide | digallium arsenide phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 111-96-6 | 203-924-4 | diglyme | bis(2-methoxyethyl) ether | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 84-75-3 | 201-559-5 | dihexylftalaat | dihexyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 6018-94-6 | 626-687-2 | dihydraat nikkel oxalaat | dihydrate nickel oxalate | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 13464-80-7 | 236-688-6 | dihydraziniumsulfaat | dihydrazinium sulphate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 12168-54-6 | 235-335-3 | diijzer nikkel tetraoxide | diiron nickel tetraoxide | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125 | ||||||
| 12005-88-8 | 234-474-7 | diijzerarsenide | diiron arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 6380-34-3 | 228-965-5 | diiodo(fenyl)arsine | diiodo(phenyl)arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 84-69-5 | 201-553-2 | diisobutylftalaat | diisobutyl phthalate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 71850-09-4 | 276-090-2 | diisohexylftalaat | diisohexyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | |||||
| 27554-26-3 | 248-523-5 | diisoöctylftalaat | diisooctyl phthalate | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | |||||
| 605-50-5 | 210-088-4 | di-isopentylftalaat | diisopentylphthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 356056-15-0 | 625-007-1 | diisopropyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)silaan | diisopropyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 13842-46-1 | 237-563-9 | dikaliumnikkelbis(sulfaat) | nickel dipotassium bis(sulfate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13826-95-4 | 621-083-5 | di-lithium tetrabroomnikkelaat(II) | di-lithium tetrabromonickelate(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 12031-75-3 | 663-306-9 | dilithium trimangaan nikkel octoxide | dilithium trimanganese nickel octoxide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 18454-12-1 | 242-339-9 | diloodchromaatoxide | dilead chromate oxide | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 12, 14, 56 | ||||||
| 110488-70-5 | 404-200-2 | dimethomorf | dimethomorph | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80, 141 | |||||
| 84750-88-9 | 977-405-2 | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluordodecaandioaat | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluorododecanedioate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 220133-51-7 | 452-310-4 | dimethyl(fenyl)sulfonium perfluorbutaansulfonaat | dimethyl(phenyl)sulfanium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 79-44-7 | 201-208-6 | dimethylcarbamoylchloride | dimethylcarbamoyl chloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 93983-68-7 | 301-323-2 | dimethylhexaanzuur nikkelzout | dimethylhexanoic acid nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 18755-43-6 | 242-555-3 | dimethylpropylfosfonaat | dimethyl propylphosphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | |||||
| 77-78-1 | 201-058-1 | dimethylsulfaat | dimethyl sulphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 13360-57-1 | 236-412-4 | dimethylsulfamoylchloride | dimethylsulfamoylchloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 753-73-1 | 212-039-2 | dimethyltin dichloride | dimethyltin dichloride | 6-9-2022 | 15 | ||||||||
| 3547-38-4 | 222-600-3 | dinatrium 3-[(o-fenylarsenigzuur)azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 84215-48-5 | 282-454-1 | dinatrium 3-[[2-[(dihydroxyarsino)oxy]fenyl]azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 425-060-9 | dinatrium 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]difenolaat | disodium 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenolate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 83, 95 | |||||
| 27336-24-9 | dinatrium 4,4'-diaminobifenyl-2,2'-disulfonaat | disodium 4,4'-diaminobiphenyl-2,2'-disulfonate | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 56, 68 | |||||||
| 3688-92-4 | 222-993-1 | dinatrium 4-[(o-fenylarsenigzuur)azo]-3-hydroxynaftaleen-2,7-disulfonaat | disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 4335-09-5 | 224-376-2 | dinatrium 4-amino-5-hydroxy-6-[[4'-[(4-hydroxyfenyl)azo][1,1'-bifenyl]-4-yl]azo]-3-[(4-nitrofenyl)azo]naftaleen-2,7-disulfonaat | disodium 4-amino-5-hydroxy-6-[[4'-[(4-hydroxyphenyl)azo][1,1'-biphenyl]-4-yl]azo]-3-[(4-nitrophenyl)azo]naphthalene-2,7-disulphonate | MVP 1 | 0,05 mg/Nm3 | 18-4-2023 | 56, 68 | ||||||
| 126-82-9 | 204-806-5 | dinatrium arseenazijnzuur | disodium arsonoacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 94313-58-3 | 304-956-2 | dinatrium p-tolylarsonaat | disodium p-tolylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 13871-27-7 | 237-630-2 | dinatrium tetrafluorberyllaat | disodium tetrafluoroberyllate | Ja | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 92 | |||||
| 3599-28-8 | 222-749-4 | dinatrium-[4-[(4,6-diamino-1,3,5-triazine-2-yl)amino]fenyl]arsonaat | disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 16071-86-6 | 240-221-1 | dinatrium-{5-[(4'-((2,6-dihydroxy-3-((2-hydroxy-5-sulfofenyl)azo)fenyl)azo)(1,1'-bifenyl)-4-yl)azo]salicylato(4-)}cupraat(2-) | disodium {5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}cuprate(2-) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 62337-00-2 | 263-516-7 | dinatrium-3,6-bis[(o-arsonofenyl)azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 84215-47-4 | 282-453-6 | dinatrium-3,6-bis[[2-[(dihydroxyarsino)oxy]fenyl]azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1937-37-7 | 217-710-3 | dinatrium-4-amino-3-[[4'-[(2,4-diaminofenyl)azo][1,1'-bifenyl]-4-yl]azo]-6-(fenylazo)-5-hydroxynaftaleen-2,7-disulfonaat | disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 22904-40-1 | 245-314-0 | dinatriumlood N,N'-ethyleenbis[N-(carboxylaatmethyl)aminoacetaat] | disodium lead N,N'-ethylenebis[N-(carboxylatomethyl)aminoacetate] | MVP 1 | 0,05 mg/Nm3 | 4-2-2022 | 14, 56 | ||||||
| 144-21-8 | 205-620-7 | dinatriummethylarsionaat | disodium methylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12280-03-4 | 602-894-3 | dinatriumoctaboraat tetrahydraat | disodium octaborate tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 12008-41-2 | 234-541-0 | dinatriumoctaboraat, watervrij | disodium octaborate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||
| 1330-43-4 | 215-540-4 | dinatriumtetraboraat, watervrij | disodium tetraborate, anhydrous | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 14674-83-0 | 238-715-7 | dinatriumwaterstof 2-[[7-[(2-arsonofenyl)azo]-1,8-dihydroxy-3,6-disulfonato-2-naftyl]azoaat | disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7778-43-0 | 231-902-4 | dinatriumwaterstofarsenaat | disodium hydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 12007-01-1 | 234-494-6 | dinikkelboride | dinickel boride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14448-18-1 | 238-426-6 | dinikkeldifosfaat | dinickel diphosphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-64-2 | 234-828-0 | dinikkelfosfide | dinickel phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14874-78-3 | 238-946-3 | dinikkelhexacyanoferraat | dinickel hexacyanoferrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13775-54-7 | 237-411-1 | dinikkelorthosilicaat | dinickel orthosilicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12059-14-2 | 235-033-1 | dinikkelsilicide | dinickel silicide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1314-06-3 | 215-217-8 | dinikkeltrioxide | dinickel trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25321-14-6 | 246-836-1 | dinitrotolueen | dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39300-45-3 | 254-408-0 | dinocap | dinocap | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 88-85-7 | 201-861-7 | dinoseb | dinoseb | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1420-07-1 | 215-813-8 | dinoterb | dinoterb | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 131-18-0 | 205-017-9 | di-n-pentylftalaat | di-n-pentyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| dioctyltin dilauraat, stannaan, dioctyl-, bis(kokos-acyloxy)derivaten | dioctyltin dilaurate, stannane, dioctyl-, bis(coco acyloxy) derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56 | |||||||
| 870-08-6 | 212-791-1 | dioctyltin oxide | dioctyltin oxide | 6-9-2022 | 15 | ||||||||
| 3648-18-8 | 222-883-3 | dioctyltindilauraat | dioctyltin dilaurate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 56 | ||||
| 799-973-9 | dioctyltindilauraat, stannaan, dioctyl-, bis(kokosacyloxy)derivaten en alle andere stannaan-, dioctyl-, bis(vetacyloxy)derivaten waarin C12 het overheersende koolstofgetal is van de vetzuuracyloxygroep | dioctyltin dilaurate, stannane, dioctyl-, bis(coco acyloxy) derivs., and any other stannane, dioctyl-, bis(fatty acyloxy) derivs. wherein C12 is the predominant carbon number of the fatty acyloxy moiety | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56 | ||||||
| 512-04-9 | 208-134-3 | diosgenin | diosgenin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| dioxinen en dioxineachtige verbindingen | dioxins and dioxin-like compounds | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 5 | |||||||
| dioxinen som | dioxine | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||||
| 12578-12-0 | 235-702-8 | dioxobis(stearaat)trilood | dioxobis(stearato)trilead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 70333-07-2 | 274-573-2 | disilverarsenide | disilver arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 10024-97-2 | 233-032-0 | distikstofmonoxide | dinitrogen oxide | Ja | - | 8-7-2025 | 149 | ||||||
| 330-54-1 | 206-354-4 | diuron | diuron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 110 | |||||
| 12170-92-2 | 235-339-5 | di-μ-carbonylbis(η5-2,4-cyclopentadieen-1-yl)dinikkel | di-μ-carbonylbis(η5-2,4-cyclopentadien-1-yl)dinickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 53826-13-4 | dodecaanzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluor- | dodecanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 540-97-6 | 208-762-8 | dodecamethylcyclohexasiloxaan | dodecamethylcyclohexasiloxane | Ja | MVP 1 | 0,05 mg/Nm3 | 6-7-2018 | ||||||
| 69029-47-6 | 273-793-6 | dore | dore | Ja | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 79, 81, 91 | |||||
| 53513-80-7 | 611-005-8 | D-valine, 3-mercapto-, lood complex | D-valine, 3-mercapto-, lead complex | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 56 | ||||||
| 12005-81-1 | 234-473-1 | dysprosiumarsenide | dysprosium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| e-glas microvezels met een representatieve samenstelling | e-glass microfibres of representative composition | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||||
| 852403-68-0 | 701-454-9 | E-metaflumizon | E-metaflumizone | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 115-29-7 | 204-079-4 | endosulfan | endosulfan | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 72-20-8 | 200-775-7 | endrin | endrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13838-16-9 | 237-553-4 | enfluraan | enflurane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 106-89-8 | 203-439-8 | epichloorhydrine | epichlorhydrin | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 133855-98-8 | 406-850-2 | epoxiconazool | epoxiconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12254-88-5 | 235-501-5 | erbiumarsenide | erbium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 66733-21-9 | 643-075-0 | erioniet | erionite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 129453-61-8 | 642-998-6 | estra-1,3,5(10)-trieen-3,17-diol, 7-(9-((4,4,5,5,5-pentafluorpentyl)sulfinyl)nonyl)-, (7alfa,17beta)- | estra-1,3,5(10)-triene-3,17-diol, 7-(9-((4,4,5,5,5-pentafluoropentyl)sulfinyl)nonyl)-, (7alpha,17beta)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 37894-46-5 | 253-704-7 | etacelasil | etacelasil | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6108-12-9 | eta-hexachloorcyclohexaan | eta-hexachlorocyclohexane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-07-2016 | 43 | ||||||
| 98241-25-9 | ethaanaminium, N,N,N- triethyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctanoaat (1:1) | ethanaminium, N,N,N-triethyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 32812-83-2 | 105-523-9 | ethaantiollood | ethanethiol lead | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 126 | ||||||
| 75-07-0 | 200-836-8 | ethanal | acetaldehyde | Ja | MVP 2 | 1 mg/Nm3 | 12-10-2018 | ||||||
| 97925-95-6 | 308-208-6 | ethanol, 2,2'-iminobis-, N- (C13-15-vertakt en lineair alkyl)-derivaten | ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | ||||||
| 91673-24-4 | 294-139-6 | ethanol, 2-[2-[2-[2-(4-nonylfenoxy)ethoxy]ethoxy]ethoxy]-, vertakt | ethanol, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, branched | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56, 68 | ||||||
| 51000-52-3 | 256-905-8 | ethenyl ester van neodecaanzuur | vinyl neodecanoate | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 181587-01-9 | 446-630-3 | ethiprole | ethiprole | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 80, 95, 134 | |||||
| 682-00-8 | 626-513-5 | ethoxytributylstannaan | ethoxytributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 103112-35-2 | 401-290-5 | ethyl-1-(2,4-dichloorfenyl)-5-(trichloormethyl)-1H-1,2,4-triazool-3-carboxylaat | ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 598-14-1 | 209-919-3 | ethyldichloorarsine | ethyldichloroarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 4431-24-7 | 224-629-7 | ethyleenbis(difenylarsine) | ethylenebis(diphenylarsine) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 107-15-3 | 203-468-6 | ethyleendiamine | ethylenediamine | Ja | MVP 2 | 1 mg/Nm3 | 6-7-2018 | ||||||
| 11079-07-5 | 679-904-8 | ethyleendiaminetetra-azijnzuur dinatrium nikkel(II)zout hydraat | ethylenediaminetetraacetic acid disodium nickel(II) salt hydrate | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 75-21-8 | 200-849-9 | ethyleenoxide | ethylene oxide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| ethyleenoxide en propyleenoxide, mengsel | ethylene oxide and propylene oxide, mixture | Ja | MVP 2 | 29-11-2024 | 81, 103 | ||||||||
| 96-45-7 | 202-506-9 | ethyleenthioureum | ethylene thiourea | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 3108-24-5 | 221-468-4 | ethylperfluoroctanoaat | ethyl perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 2104-64-5 | 218-276-8 | ethyl-p-nitrofenylthiobenzeenfosfenaat | O-ethyl O-4-nitrophenyl phenylphosphonothioate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 71720-48-4 | 275-897-7 | ethylwaterstofsulfaat, nikkel(II)zout | ethyl hydrogen sulfate, nickel(II) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 32775-46-5 | 251-206-4 | europiumarsenide | europium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 68477-61-2 | 270-741-4 | extracten (aardolie), koud zuur, C4-6 | extracts (petroleum), cold-acid, C4-6 | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-03-6 | 265-102-1 | extracten (aardolie), licht nafteenhoudend destillaat oplosmiddel | extracts (petroleum), light naphthenic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 100684-02-4 | 309-672-2 | extracten (aardolie), licht paraffinehoudend destillaat oplosmiddel, met koolstof behandeld | extracts (petroleum), light paraffinic distillate solvent, carbon-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-09-1 | 292-633-6 | extracten (aardolie), licht paraffinehoudend destillaat oplosmiddel, met waterstof behandeld | extracts (petroleum), light paraffinic distillate solvent, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-05-8 | 265-104-2 | extracten (aardolie), lichte paraffinehoudend destillaat oplosmiddel | extracts (petroleum), light paraffinic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 100684-03-5 | 309-673-8 | extracten (aardolie), lichte paraffinehoudend destillaat oplosmiddel, met klei behandeld | extracts (petroleum), light paraffinic distillate solvent, clay-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 100684-04-6 | 309-674-3 | extracten (aardolie), lichte vacuüm-, gasolieoplosmiddel, behandeld met koolstof | extracts (petroleum), light vacuum, gas oil solvent, carbon-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-78-7 | 295-341-7 | extracten (aardolie), lichte vacuümgasolieoplosmiddel | extracts (petroleum), light vacuum gas oil solvent | Ja | 2-12-2013 | 4 | |||||||
| 100684-05-7 | 309-675-9 | extracten (aardolie), lichte vacuümgasolieoplosmiddel, behandeld met klei | extracts (petroleum), light vacuum gas oil solvent, clay-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-79-8 | 295-342-2 | extracten (aardolie), lichte vacuümgasolieoplosmiddel, waterstofbehandeld | extracts (petroleum), light vacuum gas oil solvent, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 93763-11-2 | 297-829-5 | extracten (aardolie), met oplosmiddel van was ontdane zwaar paraffinisch zwaar destillaat-oplosmiddel-, met waterstof ontzwaveld | extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-75-4 | 295-338-0 | extracten (aardolie), nafteenhoudend licht destillaat oplosmiddel, waterstofontzwaveld | extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21, 61 | |||||
| 91995-68-5 | 295-331-2 | extracten (aardolie), oplosmiddel-, katalytisch gereformde lichte nafta | extracts (petroleum), catalytic reformed light naphtha solvent | Ja | 2-12-2013 | 4, 64 | |||||||
| 68783-04-0 | 272-180-0 | extracten (aardolie), oplosmiddlegeraffineerde zwaar paraffinehoudend destillaat oplosmiddel | extracts (petroleum), solvent-refined heavy paraffinic distillate solvent | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-77-6 | 295-340-1 | extracten (aardolie), paraffinehoudend licht destillaat oplosmiddel, waterstofontzwaveld | extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-76-5 | 295-339-6 | extracten (aardolie), paraffinehoudend licht destillaat oplosmiddel, zuurbehandeld | extracts (petroleum), light paraffinic distillate solvent, acid-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-73-2 | 295-335-4 | extracten (aardolie), waterstofbehandeld paraffinehoudend licht destillaat oplosmiddel | extracts (petroleum), hydrotreated light paraffinic distillate solvent | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-11-6 | 265-111-0 | extracten (aardolie), zwaar nafteenhoudend destillaat oplosmiddel | extracts (petroleum), heavy naphthenic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 90641-07-9 | 292-631-5 | extracten (aardolie), zwaar nafteenhoudend destillaat oplosmiddel, met waterstof behandeld | extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 93763-10-1 | 297-827-4 | extracten (aardolie), zwaar nafteenhoudend destillaat oplosmiddel, waterstofontzwaveld | extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized | Ja | 2-12-2013 | 4, 61 | |||||||
| 68783-00-6 | 272-175-3 | extracten (aardolie), zwaar nafteen-houdend destillaatoplosmiddel, aromaatconcentraat | extracts (petroleum), heavy naphthenic distillate solvent, arom. conc. | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-04-7 | 265-103-7 | extracten (aardolie), zwaar paraffinehoudend destillaat oplosmiddel | extracts (petroleum), heavy paraffinic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 92704-08-0 | 296-437-1 | extracten (aardolie), zwaar paraffinehoudend destillaat oplosmiddel, met klei behandeld | extracts (petroleum), heavy paraffinic distillate solvent, clay-treated | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21, 61 | |||||
| 90641-08-0 | 292-632-0 | extracten (aardolie), zwaar paraffinehoudend destillaat oplosmiddel, met waterstof behandeld | extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 97926-43-7 | 308-261-5 | extracten (aardolie), zware naftaoplosmiddel met klei behandeld | extracts (petroleum) heavy naphtha solvent, clay-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68814-89-1 | 272-342-0 | extracten (aardolie), zware paraffinehoudende destillaten oplosmiddel-gedeasfalteerd | extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted | Ja | 2-12-2013 | 4, 61 | |||||||
| 122070-80-8 | 310-171-6 | extractieoliën (kool), koolteer en pyrolyse-residuoliën naftaleenolie, destillatieresiduen | extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues | Ja | 2-12-2013 | 4, 60 | |||||||
| 122070-79-5 | 310-170-0 | extractie-oliën (kool), koolteer en pyrolyse-residuoliën naftaleenoliën | extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils | Ja | 2-12-2013 | 4, 60 | |||||||
| 90640-99-6 | 292-622-6 | extractieoliën (kool), lichte olie | extract oils (coal), light oil | Ja | 2-12-2013 | 4, 60 | |||||||
| 91995-66-3 | 295-329-1 | extractieoliën (kool), residuele pyrolyseoliën uit koolteer, naftaleenolie, herdestillaat | extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate | Ja | 2-12-2013 | 4, 60 | |||||||
| 68937-63-3 | 273-077-3 | extractieoliën (kool), teerbase, collidinefractie | extract oils (coal), tar base, collidine fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 65996-86-3 | 266-020-9 | extractieoliën (kool), teerbasen | extract oils (coal), tar base | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 84989-12-8 | 284-901-6 | extractieoliën (kool), zuur, vrij van teerbasen | extract oils (coal), acidic, tar-base free | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91995-61-8 | 295-323-9 | extractieresiduen (kool), benzolfractie alkalisch zuurextract | extract residues (coal), benzole fraction alk., acid ext. | Ja | 2-12-2013 | 4, 60 | |||||||
| 93821-38-6 | 298-725-2 | extractieresiduen (kool), benzolfractie zuur | extract residues (coal), benzole fraction acid | Ja | 2-12-2013 | 4, 60 | |||||||
| 122384-77-4 | 310-189-4 | extractieresiduen (kool), creosootolie, zure | extract residues (coal), creosote oil acid | Ja | 2-12-2013 | 4, 62 | |||||||
| 90641-02-4 | 292-625-2 | extractieresiduen (kool), lichte olie alkalisch destillatietopproducten | extract residues (coal), light oil alk., distn. overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 90641-03-5 | 292-626-8 | extractieresiduen (kool), lichte olie alkalisch indeen-naftafractie | extract residues (coal), light oil alk., indene naphtha fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 90641-01-3 | 292-624-7 | extractieresiduen (kool), lichte olie alkalisch zuurextract | extract residues (coal), light oil alk., acid ext. | Ja | 2-12-2013 | 4, 60 | |||||||
| 101316-62-5 | 309-867-2 | extractieresiduen (kool), lichte olie alkalisch zuurextract, indeenfractie | extract residues (coal), light oil alk., acid ext., indene fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 90641-05-7 | 292-628-9 | extractieresiduen (kool), naftaleenolie alkalisch destillatieresiduen | extract residues (coal), naphthalene oil alk., distn. residues | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 121620-47-1 | 310-166-9 | extractieresiduen (kool), naftaleenolie, alkalisch | extract residues (coal), naphthalene oil, alk. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 90641-04-6 | 292-627-3 | extractieresiduen (kool), naftaleenolie, alkalisch destillatietopproducten | extract residues (coal), naphthalene oil alk., distn. overheads | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 121620-48-2 | 310-167-4 | extractieresiduen (kool), naftaleenolie, alkalisch naftaleenarm | extract residues (coal), naphthalene oil, alk., naphthalene-low | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 65996-87-4 | 266-021-4 | extractieresiduen (kool), teerolie alkalisch | extract residues (coal), tar oil alk. | Ja | 2-12-2013 | 4, 60 | |||||||
| 90641-06-8 | 292-629-4 | extractieresiduen (kool), teerolie alkalisch gecarboneerd met ongebluste kalk behandeld | extract residues (coal), tar oil alk., carbonated, limed | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 73665-18-6 | 277-567-8 | extractieresiduen (kool), teerolie, alkalische, naftaleendestillatieresiduen | extract residues (coal), tar oil alk., naphthalene distn. residues | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 60, 62 | |||||
| 101316-63-6 | 309-868-8 | extractieresiduen (koolteer), benzolfractie alkalisch zuurextract | extract residues (coal tar), benzole fraction alk., acid ext. | Ja | 2-12-2013 | 4, 60 | |||||||
| 90641-00-2 | 292-623-1 | extract-oliën (kool), naftaleenoliën | extract oils (coal), naphthalene oils | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91697-23-3 | 294-285-0 | extractresiduen (kool), bruin | extract residues (coal), brown | Ja | 2-12-2013 | 4, 62 | |||||||
| 85-01-8 | 201-581-5 | fenantreen | phenanthrene | Ja | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | ||||||
| 122070-78-4 | 310-169-5 | fenantreen destillatieresiduen | phenanthrene, distn. residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 229-87-8 | 205-934-4 | fenantridine | phenanthridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 13356-08-6 | 236-407-7 | fenbutatin | bis(tris(2-methyl-2-phenylpropyl)tin) oxide | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 56 | ||||||
| 13684-63-4 | 237-199-0 | fenmedifam | phenmedipham | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 80, 136 | ||||||
| 74499-35-7 | fenol, (tetrapropenyl)-derivaten | phenol, (tetrapropenyl) derivs. | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 1801269-80-6 | 701-105-0 | fenol, 2-dodecyl-, vertakt | phenol, 2-dodecyl-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 1801269-77-1 | 701-107-1 | fenol, 3-dodecyl-, vertakt | phenol, 3-dodecyl-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 210555-94-5 | fenol, 4-dodecyl-, vertakt | phenol, 4-dodecyl-, branched | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 3050-88-2 | 608-492-4 | fenol, 4-nonyl-, fosfiet (3:1) | phenol, 4-nonyl-, phosphite (3:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 56 | |||||
| 121158-58-5 | 310-154-3 | fenol, dodecyl-, vertakt | phenol, dodecyl-, branched | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||
| 72624-02-3 | 276-743-1 | fenol, heptyl derivaten | phenol, heptyl derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 56 | |||||
| 68512-30-1 | 270-966-8 | fenol, methylstyrenaat | phenol, methylstyrenated | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | |||||
| 685-154-2 | fenol,4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]bis-, ion(1-), tributyl 2-methoxypropyl fosfonium | phenol,4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis-, ion(1-), tributyl 2-methoxypropyl phosphonium | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | ||||||
| 84988-93-2 | 284-881-9 | fenolen ammoniakprocesvochtextract | phenols, ammonia liquor ext. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 77-09-8 | 201-004-7 | fenolftaleïne | phenolphthalein | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 113158-40-0 | 601-237-8 | fenoxaprop-P | fenoxaprop-P | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 83, 130 | ||||||
| 98-05-5 | 202-631-9 | fenylarsenigzuur | phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 637-03-6 | 211-275-3 | fenylarsine oxide | phenylarsine oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 100-63-0 | 202-873-5 | fenylhydrazine | phenylhydrazine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 59-88-1 | 200-444-7 | fenylhydrazinechloride | phenylhydrazinium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27140-08-5 | 248-259-0 | fenylhydrazinehydrochloride | phenylhydrazine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 52033-74-6 | 257-622-2 | fenylhydrazinesulfaat | phenylhydrazinium sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13302-00-6 | 236-326-7 | fenylkwik-2-ethylhexanoaat | phenylmercury 2-ethylhexanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 62-38-4 | 200-532-5 | fenylkwikacetaat | phenylmercury acetate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 100-57-2 | 202-866-7 | fenylkwikhydroxide | phenylmercury hydroxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 26545-49-3 | 247-783-7 | fenylkwikneodecanoaat | phenylmercury neodecanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 55-68-5 | 200-242-9 | fenylkwiknitraat | phenylmercury nitrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 13864-38-5 | fenylkwikoctanoaat | phenylmercury octanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 103-27-5 | 203-094-3 | fenylkwikpropionaat | phenylmercury propionate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| fenylkwikverbindingen | phenylmercury compounds | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||||
| 14402-61-0 | 604-391-4 | ferraat(4-), hexakis(cyaan-κC)-, lood(2+) (1:2), (OC-6-11)- | ferrate(4-), hexakis(cyano-κC)-, lead(2+) (1:2), (OC-6-11)- | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 56 | ||||||
| 948-083-0 | filterkoek van koperprecipitatieresidu, zuivering van looddinitraatoplossing, lood- en bismutverbindingen | filter cake of copper precipitation residue, lead dinitrate solution purification, lead and bismuth compounds | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 56 | |||||||
| 120068-37-3 | 424-610-5 | fipronil | fipronil | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 104040-78-0 | 600-514-0 | flazasulfuron | flazasulfuron | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 90035-08-8 | 421-960-0 | flocumafen | flocoumafen | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | 95 | ||||
| 158062-67-0 | 605-127-0 | flonicamid | flonicamid | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 69335-91-7 | 614-949-9 | fluazifop | fluazifop | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 69806-50-4 | 274-125-6 | fluazifop-butyl | fluazifop-butyl | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 83066-88-0 | 617-435-2 | fluazifop-p | fluazifop-p | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 79241-46-6 | 616-669-2 | fluazifop-P-butyl | fluazifop-P-butyl | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 79622-59-6 | 616-712-5 | fluazinam | fluazinam | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 272451-65-7 | 608-064-7 | flubendiamide | flubendiamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 37893-02-0 | 253-703-1 | flubenzimine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | ||||||
| 33245-39-5 | 251-426-0 | fluchloralin | fluchloralin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 70124-77-5 | 274-322-7 | flucythrinaat | flucythrinate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 131341-86-1 | 603-476-3 | fludioxonil | fludioxonil | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 80, 95, 128 | |||||
| 142459-58-3 | 604-290-5 | flufenacet | flufenacet | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97, 140 | |||||
| 5002-47-1 | 225-672-4 | flufenazine o-decanoaat | fluphenazine o-decanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 101463-69-8 | 417-680-3 | flufenoxuron | 1-(4-(2-cloro-α,α,α-p-trifluorotolyloxy)-2-fluorophenyl)-3-(2,6-difluorobenzolyl)urea | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 2164-17-2 | 218-500-4 | fluometuron | fluometuron | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 239110-15-7 | 607-285-6 | fluopicolide | fluopicolide | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 658066-35-4 | 619-797-7 | fluopyram | fluopyram | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 68958-61-2 | 614-861-0 | fluoralkylalkoxylaat | fluoralkylalkoxylat | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 206-44-0 | 205-912-4 | fluoranteen | fluoranthene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 86-73-7 | 201-695-5 | fluoreen | fluorene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 77501-90-7 | 616-467-4 | fluorglycofen-ethyl | fluorglycofen-ethyl | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| fluorkoolwaterstoffen | fluorohydrocarbons | Ja | - | 18-11-2024 | 100, 101 | ||||||||
| 146-56-5 | 205-674-1 | fluphenazine dihydrochloride | fluphenazine dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 144740-54-5 | 604-441-5 | flupyrsulfuron-methyl | flupyrsulfuron-methyl-sodium | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 61213-25-0 | 262-661-3 | flurochloridone | flurochloridon | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80, 95 | ||||
| 96525-23-4 | 619-224-0 | flurtamone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | ||||||
| 85509-19-9 | 617-717-5 | flusilazool | flusilazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13311-84-7 | 236-341-9 | flutamide | flutamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 66332-96-5 | 613-921-3 | flutolanil | flutolanil | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 69409-94-5 | 805-993-1 | fluvalinaat | fluvalinate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 50-00-0 | 200-001-8 | formaldehyde | formaldehyde | Ja | MVP 2 | 1 mg/Nm3 | 3-2-2015 | ||||||
| 25214-70-4 | 500-036-1 | formaldehyde, oligomere reactieproducten met aniline | formaldehyde, oligomeric reaction products with aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 93925-00-9 | 300-298-5 | formaldehyde, reactie producten met vertakt en lineair heptylfenol, koolstof disulfide en hydrazine | formaldehyde, reaction products with branched and linear heptylphenol, carbon disulfide and hydrazine | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 56 | |||||
| 3228-27-1 | 687-203-3 | formaldehyde-13C | formaldehyde-13C | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 56, 67 | ||||||
| 63101-50-8 | 694-347-0 | formaldehyde-d2-13C | formaldehyde-d2-13C | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 56, 67 | ||||||
| 75-12-7 | 200-842-0 | formamide | formamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 325459-92-5 | fosfine, tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]- | phosphine, tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 68412-69-1 | 270-206-5 | fosfinezuur, bis(perfluor-C6-12-alkyl) derivaten | phosphinic acid, bis(perfluoro-C6-12-alkyl) derivs. | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 93062-53-4 | 296-807-2 | fosfinezuur, bis(perfluor-C6-12-alkyl) derivaten, aluminium zouten | phosphinic acid, bis(perfluoro-C6-12-alkyl) derivs., aluminum salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 17169-61-8 | fosforzuur calciumnikkelzout | phosphoric acid, calcium nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 92203-02-6 | 875-679-7 | fosforzuur, reactieproducten met aluminumhydroxide en chroomoxide (CrO3) | phosphoric acid, reaction products with aluminum hydroxide and chromium oxide (CrO3) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 12, 56 | ||||||
| 65997-18-4 | 266-047-6 | frits, chemicaliën | frits, chemicals | MVP 1 | 0,05 mg/Nm3 | 13-4-2023 | 14, 56 | ||||||
| 110-00-9 | 203-727-3 | furaan | furan | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 12005-89-9 | 234-475-2 | gadoliniumarsenide | gadolinium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 60953-19-7 | galliumarseenfosfide | gallium arsenic phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 1303-00-0 | 215-114-8 | galliumarsenide | gallium arsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | ||||
| 106097-61-4 | galliumarsenidefosfide | gallium arsenide phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 98106-56-0 | 308-577-3 | galliumzinktriarsenide | gallium zinc triarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1329995-69-8 | gamma-cyclodextrin, verbinding met tridecafluorhexaansulfonzuur ion(1-) (1:1) | gamma-cyclodextrin, compd. with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid ion(1-) (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 134237-52-8 | gamma-hexabroomcyclododecaan | gamma-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 58-89-9 | 200-401-2 | gamma-hexachloorcyclohexaan | gamma-hexachlorocyclohexane | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 94114-55-3 | 302-691-7 | gasolie, kool solventextractie, met waterstof gekraakte nafta | gasoline, coal solvent extn., hydrocracked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 64742-29-6 | 265-129-9 | gasoliën (aardolie), chemisch geneutraliseerd | gas oils (petroleum), chemically neutralized | Ja | 2-12-2013 | 4, 63 | |||||||
| 97926-59-5 | 308-278-8 | gasoliën (aardolie), lichte vacuüm-, thermisch gekraakt met waterstof ontzwaveld | gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized | Ja | 2-12-2013 | 4 | |||||||
| 64742-59-2 | 265-162-9 | gasoliën (aardolie), met waterstof behandelde vacuümdestillatiefractie | gas oils (petroleum), hydrotreated vacuum | Ja | 2-12-2013 | 4 | |||||||
| 64742-79-6 | 265-182-8 | gasoliën (aardolie), met waterstof ontzwaveld | gas oils (petroleum), hydrodesulfurized | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-86-5 | 265-189-6 | gasoliën (aardolie), met waterstof ontzwaveld zwaar vacuümdestillatiefractie | gas oils (petroleum), hydrodesulfurized heavy vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 85117-03-9 | 285-555-9 | gasoliën (aardolie), met waterstof ontzwavelde verkookser zware vacuümdestillatiefractie | gas oils (petroleum), hydrodesulfurized coker heavy vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64742-12-7 | 265-112-6 | gasoliën (aardolie), met zuur behandeld | gas oils (petroleum), acid-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 64741-90-8 | 265-092-9 | gasoliën (aardolie), solvent-geraffineerd | gas oils (petroleum), solvent-refined | Ja | 2-12-2013 | 4, 63 | |||||||
| 68527-18-4 | 271-260-2 | gasoliën (aardolie), stoomgekraakt | gas oils (petroleum), steam-cracked | Ja | 2-12-2013 | 4 | |||||||
| 92045-29-9 | 295-411-7 | gasoliën (aardolie), thermisch gekraakt, met water ontzwaveld | gas oils (petroleum), thermal-cracked, hydrodesulfurized | Ja | 2-12-2013 | 4 | |||||||
| 68783-08-4 | 272-184-2 | gasoliën (aardolie), zwaar atmosferische destillatie | gas oils (petroleum), heavy atmospheric | Ja | 2-12-2013 | 4 | |||||||
| 64741-57-7 | 265-058-3 | gasoliën (aardolie), zware vacuümdestillatiefractie | gas oils (petroleum), heavy vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 93924-33-5 | 300-227-8 | gasoliën paraffinehoudend | gas oils, paraffinic | Ja | 2-12-2013 | 4, 63 | |||||||
| 97862-78-7 | 308-128-1 | gasoliën waterstofbehandeld | gas oils, hydrotreated | Ja | 2-12-2013 | 4, 63 | |||||||
| 68606-27-9 | 271-737-5 | gassen (aardolie), alkyleringsinvoer | gases (petroleum), alkylation feed | Ja | 2-12-2013 | 4, 59 | |||||||
| 68602-82-4 | 271-623-5 | gassen (aardolie), benzeeninstallatie, waterstofbehandelaar, pentaanverwijdering-topproducten | gases (petroleum), benzene unit hydrotreater depentanizer overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68602-83-5 | 271-624-0 | gassen (aardolie), C1-5, nat | gases (petroleum), C1-5, wet | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-70-3 | 270-751-9 | gassen (aardolie), C2-3 | gases (petroleum), C2-3- | Ja | 2-12-2013 | 4, 59 | |||||||
| 68783-65-3 | 272-205-5 | gassen (aardolie), C2-4-, stankvrij gemaakt | gases (petroleum), C2-4, sweetened | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-84-9 | 270-766-0 | gassen (aardolie), C2-terugstroom | gases (petroleum), C2-return stream | Ja | 2-12-2013 | 4, 59 | |||||||
| 68131-75-9 | 268-629-5 | gassen (aardolie), C3-4 | gases (petroleum), C3-4 | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-33-8 | 270-724-1 | gassen (aardolie), C3-4, rijk aan isobutaan | gases (petroleum), C3-4, isobutane-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-83-8 | 270-765-5 | gassen (aardolie), C3-5 olefine-paraffine-alkyleringsreagens | gases (petroleum), C3-5 olefinic-paraffinic alkylation feed | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-85-0 | 270-767-6 | gassen (aardolie), C4-rijk | gases (petroleum), C4-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-81-6 | 270-762-9 | gassen (aardolie), C6-8-katalytische reformer | gases (petroleum), C6-8 catalytic reformer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-01-7 | 272-873-8 | gassen (aardolie), destillaat, unifiner-ontzwaveling, stripperuitstoot | gases (petroleum), distillate unifiner desulfurization stripper off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-93-0 | 270-776-5 | gassen (aardolie), destillatie gasconcentratie-herabsorbeerder | gases (petroleum), gas concn. reabsorber distn. | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-05-1 | 272-878-5 | gassen (aardolie), direct door fractionering verkregen lichte benzine, stabilisatoruitstoot | gases (petroleum), light straight run gasoline fractionation stabilizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68955-34-0 | 273-270-2 | gassen (aardolie), direct door fractionering verkregen nafta, katalytische reformer, stabilisator-topproducten | gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-09-5 | 272-882-7 | gassen (aardolie), direct door fractionering verkregen nafta, katalytische reforming, uitstoot | gases (petroleum), straight-run naphtha catalytic reforming off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-10-8 | 272-883-2 | gassen (aardolie), directe fractionering, stabilisatoruitstoot | gases (petroleum), straight-run stabilizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-92-9 | 270-774-4 | gassen (aardolie), droog zwavelhoudend uitstoot gasconcentratie-installatie | gases (petroleum), dry sour, gas-concn.-unit-off | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-17-5 | 295-399-3 | gassen (aardolie), gasolie, ontgassing waterstofontzwaveling | gases (petroleum), gas oil hydrodesulfurization purge | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-15-3 | 295-397-2 | gassen (aardolie), gasolie, uitstoot diethanolamine-gaswasser | rases (petroleum), gas oil diethanolamine scrubber off | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-16-4 | 295-398-8 | gassen (aardolie), gasolie, uitstroom waterstofontzwaveling | gases (petroleum), gas oil hydrodesulfurization effluent | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-94-1 | 270-777-0 | gassen (aardolie), gasterugwinning-installatie, topproducten van propaanverwijdering | gases (petroleum), gas recovery plant depropanizer overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-99-6 | 270-782-8 | gassen (aardolie), geïsomeriseerde naftafractionator, rijk aan C4, vrij van waterstofsulfide | gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-95-2 | 270-778-6 | gassen (aardolie), grondstof Girbatol-installatie | gases (petroleum), Girbotol unit feed | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-00-6 | 272-872-2 | gassen (aardolie), hexaanverwijdering-uitstoot | gases (petroleum), dehexanizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-18-6 | 295-400-7 | gassen (aardolie), hydogenatoruitstroom uitstoot afdampvat | gases (petroleum), hydrogenator effluent flash drum off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-71-4 | 270-752-4 | gassen (aardolie), katalytisch gekraakte gasolie, bodemfracties uit propaanverwijdering, C4-rijk zuurvrij | gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68952-76-1 | 273-169-3 | gassen (aardolie), katalytisch gekraakte nafta, butaanverwijdering | gases (petroleum), catalytic cracked naphtha debutanizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-72-5 | 270-754-5 | gassen (aardolie), katalytisch gekraakte nafta, butaanverwijdering-bodemfracties, C3-5-rijk | gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-73-6 | 270-755-0 | gassen (aardolie), katalytisch gekraakte nafta, propaanverwijdering-topproducten C3-rijke zuurvrije | gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68409-99-4 | 270-071-2 | gassen (aardolie), katalytisch gekraakte topfracties | gases (petroleum), catalytic cracked overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-76-9 | 270-758-7 | gassen (aardolie), katalytisch gepolymeriseerde nafta, stabilisator-topfractie, C2-4-rijk | gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-77-0 | 270-759-2 | gassen (aardolie), katalytisch gereformde nafta, stripper-topproducten | gases (petroleum), catalytic reformed naphtha stripper overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68783-64-2 | 272-203-4 | gassen (aardolie), katalytisch kraken | gases (petroleum), catalytic cracking | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-74-7 | 270-756-6 | gassen (aardolie), katalytische kraker | gases (petroleum), catalytic cracker | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-02-8 | 272-874-3 | gassen (aardolie), katalytische kraker met wervelbed fractioneringsuitstoot | gases (petroleum), fluidized catalytic cracker fractionation off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-20-0 | 272-893-7 | gassen (aardolie), katalytische kraker met wervelbed splitter-topproducten | gases (petroleum), fluidized catalytic cracker splitter overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-03-9 | 272-875-9 | gassen (aardolie), katalytische kraker met wervelbed wassing uitstoot secundair absorptievat | gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-75-8 | 270-757-1 | gassen (aardolie), katalytische kraker, C1-5-rijk | gases (petroleum), catalytic cracker, C1-5-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-79-2 | 270-760-8 | gassen (aardolie), katalytische reformer, C1-4-rijk | gases (petroleum), catalytic reformer, C1-4-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68513-14-4 | 270-999-8 | gassen (aardolie), katalytische reforming van door directe fractionering verkregen nafta, stabilisator-topproducten | gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68513-17-7 | 271-002-9 | gassen (aardolie), lichte door directe fractionering verkregen nafta, stabilisatoruitstoot | gases (petroleum), light straight-run naphtha stabilizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68955-28-2 | 273-265-5 | gassen (aardolie), lichte stoomgekraakte, butadieenconcentraat | gases (petroleum, light steam-cracked, butadiene conc. | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 20, 59 | |||||
| 68477-68-9 | 270-749-8 | gassen (aardolie), mengolie, rijk aan waterstof en stikstof | gases (petroleum), blend oil, hydrogen-nitrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-06-2 | 272-879-0 | gassen (aardolie), nafta-unifiner-ontzwaveling stripperuitstoot | gases (petroleum), naphtha unifiner desulfurization stripper off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68527-15-1 | 271-258-1 | gassen (aardolie), olieraffinage, uitstoot gasdestillatie | gases (petroleum), oil refinery gas distn. off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-07-3 | 272-880-6 | gassen (aardolie), platforming, stabilisatoruitstoot, fractionering van lichte eindfracties | gases (petroleum), platformer stabilizer off, light ends fractionation | Ja | 2-12-2013 | 4, 59 | |||||||
| 68814-90-4 | 272-343-6 | gassen (aardolie), platformingproducten afscheideruitstoot | gases (petroleum), platformer products separator off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-90-7 | 270-772-3 | gassen (aardolie), propaanverwijdering droog, rijk aan propeen | gases (petroleum), depropanizer dry, propene-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68606-34-8 | 271-742-2 | gassen (aardolie), propaanverwijdering-bodemfracties, fractioneringsuitstoot | gases (petroleum), depropanizer bottoms fractionation off | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 20, 59 | |||||
| 68814-67-5 | 272-338-9 | gassen (aardolie), raffinage | gases (petroleum), refinery | Ja | 2-12-2013 | 4, 59 | |||||||
| 68783-07-3 | 272-183-7 | gassen (aardolie), raffinage-meng- | gases (petroleum), refinery blend | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-02-4 | 270-785-4 | gassen (aardolie), reformende waterstofbehandelaar | gases (petroleum), reforming hydrotreater | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-04-6 | 270-788-0 | gassen (aardolie), reformende waterstofbehandelaar aanvullings-, waterstof-rijk | gases (petroleum), reforming hydrotreater make-up, hydrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-03-5 | 270-787-5 | gassen (aardolie), reformende waterstofbehandelaar, rijk aan waterstof en methaan | gases (petroleum), reforming hydrotreater, hydrogen-methane-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68513-18-8 | 271-003-4 | gassen (aardolie), reformeruitstroom uitstoot hogedruk-afdampvat | gases (petroleum), reformer effluent high-pressure flash drum off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68513-19-9 | 271-005-5 | gassen (aardolie), reformeruitstroom uitstoot lagedruk-afdampvat | gases (petroleum), reformer effluent low-pressure flash drum off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-01-3 | 270-784-9 | gassen (aardolie), reformer-verzamel-, waterstof-rijk | gases (petroleum), reformer make-up, hydrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-20-0 | 295-402-8 | gassen (aardolie), residu visbreaking uitstoot | gases (petroleum), residue visbaking off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68989-88-8 | 273-563-5 | gassen (aardolie), ruwe destillatie en katalytisch kraken | gases (petroleum), crude distn. and catalytic cracking | Ja | 2-12-2013 | 4, 59 | |||||||
| 68918-99-0 | 272-871-7 | gassen (aardolie), ruwe olie, fractioneringsuitstoot, | gases (petroleum), crude oil fractionation off | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-19-7 | 295-401-2 | gassen (aardolie), stoomkraken van nafta, hogedruk-restgassen | gases (petroleum), naphtha steam cracking high-pressure residual | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-22-2 | 295-404-9 | gassen (aardolie), stoomkraker, rijk aan C3 | gases (petroleum), steam-cracker C3-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-67-8 | 270-748-2 | gassen (aardolie), terugvoer benzeeninstallatie, rijk aan waterstof | gases (petroleum), benzene unit recycle, hydrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-82-7 | 270-763-4 | gassen (aardolie), terugvoer C6-8 katalytische reformer, rijk aan waterstof | gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-80-5 | 270-761-3 | gassen (aardolie), terugvoer C6-8-katalytische reformer | gases (petroleum), C6-8 catalytic reformer recycle | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-00-2 | 270-783-3 | gassen (aardolie), terugvoer-, waterstof-rijk | gases (petroleum), recycle, hydrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-05-7 | 270-789-6 | gassen (aardolie), thermisch kraken-destillatie- | gases (petroleum), thermal cracking distn. | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-65-6 | 270-746-1 | gassen (aardolie), toevoer aminesysteem | gases (petroleum), amine system feed | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-69-0 | 270-750-3 | gassen (aardolie), topproducten butaansplitter | gases (petroleum), butane splitter overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-86-1 | 270-768-1 | gassen (aardolie), topproducten van ethaanverwijdering | gases (petroleum), deethanizer overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-87-2 | 270-769-7 | gassen (aardolie), topproducten van isobutaanverwijdering-toren | gases (petroleum), deisobutanizer tower overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-91-8 | 270-773-9 | gassen (aardolie), topproducten van propaanverwijdering | gases (petroleum), depropanizer overheads | Ja | 2-12-2013 | 4, 59 | |||||||
| 68513-15-5 | 271-000-8 | gassen (aardolie), totaalfractie door directe fractionering verkregen nafta, uitstoot van hexaanverwijdering | gases (petroleum), full-range straight-run naphtha dehexanizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-66-7 | 270-747-7 | gassen (aardolie), uitstoot benzeeninstallatie, waterstofontzwavelaar | gases (petroleum), benzene unit hydrodesulfurizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68602-84-6 | 271-625-6 | gassen (aardolie), uitstoot secundaire absorbeerder, fractionering van topproducten uit katalytische kraker wervelbed | gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator | Ja | 2-12-2013 | 4, 59 | |||||||
| 68955-33-9 | 273-269-7 | gassen (aardolie), uitstoot sponsabsorptievat, katalytische kraker met wervelbed en gasolieontzwavelaar, fractionering topproducten | gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-11-9 | 272-884-8 | gassen (aardolie), uitstoot teerstripper | gases (petroleum), tar stripper off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-12-0 | 272-885-3 | gassen (aardolie), uitstoot unifiner-stripper | gases (petroleum), unifiner stripper off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-08-4 | 272-881-1 | gassen (aardolie), uitstoot voor-afdampingstoren ruwe destillatie | gases (petroleum), preflash tower off, crude distn. | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-96-3 | 270-779-1 | gassen (aardolie), uitstoot waterstofabsorbeerder | gases (petroleum), hydrogen absorber off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-98-5 | 270-781-2 | gassen (aardolie), waterstofbehandelaar-mengolie-terugvoer-, rijk aan waterstof en stikstof | gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68911-59-1 | 272-776-0 | gassen (aardolie), waterstofbehandelde zwavelhoudende kerosine, afdampvat | gases (petroleum), hydrotreated sour kerosine flash drum | Ja | 2-12-2013 | 4, 59 | |||||||
| 68911-58-0 | 272-775-5 | gassen (aardolie), waterstofbehandelde zwavelhoudende kerosine, uitstoot pentaanverwijdering-stabilisatie | gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off | Ja | 2-12-2013 | 4, 59 | |||||||
| 68783-06-2 | 272-182-1 | gassen (aardolie), waterstofkraken lagedruk-afscheider | gases (petroleum), hydrocracking low-pressure separator | Ja | 2-12-2013 | 4, 59 | |||||||
| 68513-16-6 | 271-001-3 | gassen (aardolie), waterstofkraken uitstoot van propaanverwijdering, koolwaterstofrijk | gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68477-97-4 | 270-780-7 | gassen (aardolie), waterstof-rijk | gases (petroleum), hydrogen-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68919-04-0 | 272-876-4 | gassen (aardolie), zwaar destillaat, waterstofontzwaveling, stripper-uitstoot | gases (petroleum), heavy distillate hydrotreater desulfurization stripper off | Ja | 2-12-2013 | 4, 59 | |||||||
| gebromeerde brandvertragers | brominated flame retardants | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| gebromeerde difenylethers | brominated diphenyl ethers | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 2, 35, 122 | |||||
| 97553-43-0 | 307-202-0 | gechloreerde aardolie paraffines, normaal C>10 | paraffins (petroleum), normal C>10, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 55, 56 | |||||
| 1372804-76-6 | gechloreerde alkanen, C14-C16 | alkanes, C14-16, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||||
| 85422-92-0 | 287-196-3 | gechloreerde paraffine-oliën | paraffin oils, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-07-2021 | 55, 80 | |||||
| 799-971-8 | gechloreerde paraffines van middellange keten | medium-chain chlorinated paraffins | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80 | ||||||
| 936-076-5 | gedisulfoneerd nikkel(II)ftalocyanine | disulfonated nickel(II) phtalocyanine | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34 | |||||||
| geëthoxyleerd 4-(1,1,3,3-tetramethylbutyl)fenol | 4-(1,1,3,3-tetramethylbutyl)phenol, ethoxylated | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 26027-38-3 | 500-045-0 | geëthoxyleerd 4-nonylfenol | ethoxylated 4-nonylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 56 | |||||
| 37205-87-1 | geëthoxyleerd isononylfenol | ethoxylated isononylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 799-990-1 | geëthoxyleerd lineair en vertakt 4-nonylfenol | 4-Nonylphenol, branched and linear, ethoxylated | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 939-993-9 | geëthoxyleerd nonylfenol (EO = 10) | nonylphenol, ethoxylated (EO = 10) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 939-975-0 | geëthoxyleerd nonylfenol (EO = 4) | nonylphenol, ethoxylated (EO = 4) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 938-618-6 | geëthoxyleerd nonylfenol (polymeer) | nonylphenol, ethoxylated (polymer) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 94551-62-9 | 305-411-1 | gegloeid lood-zinkerts concentraat | calcines, lead-zinc ore conc. | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 61788-32-7 | 262-967-7 | gehydrogeneerd terfenyl | terphenyl hydrogenated | Ja | MVP 1 | 0,05 mg/Nm3 | 6-7-2018 | ||||||
| 64741-62-4 | 265-064-6 | geklaarde oliën (aardolie), katalytisch gekraakt | clarified oils (petroleum), catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 68333-26-6 | 269-782-0 | geklaarde oliën (aardolie), met waterstof ontzwavelde katalytisch gekraakte | clarified oils (petroleum), hydrodesulfurized catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 95058-81-4 | 619-100-6 | gemcitabine | gemcitabine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 122111-03-9 | 601-823-3 | gemcitabine hydrochloride | gemcitabine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 12271-72-6 | 235-547-6 | germaniumarsenide | germanium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 77182-82-2 | 278-636-5 | glufosinaat-ammonium | ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 111-30-8 | 203-856-5 | glutaaraldehyde | glutaraldehyde | Ja | MVP 2 | 1 mg/Nm3 | 13-7-2021 | 80 | |||||
| 556-52-5 | 209-128-3 | glycidol | 2,3-epoxypropan-1-ol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 125370-60-7 | 118-476-4 | glycidyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonylether, 96% | glycidyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl ether, 96% | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 116-49-4 | 204-143-1 | glycobiarsol | glycobiarsol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| halonen | partially halogenated chlorofluorohydrocarbon | Ja | - | 18-11-2024 | 100, 101 | ||||||||
| 100784-20-1 | 600-130-3 | halosulfuronmethyl | halosulfuron-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | ||||||
| 151-67-7 | 205-796-5 | halothaan | halothane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 69806-34-4 | 615-015-3 | haloxyfop | haloxyfop | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 87237-48-7 | 402-560-5 | haloxyfop-ethoxyethyl | haloxyfop-etotyl | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 95, 97 | |||||
| 69806-40-2 | 634-735-9 | haloxyfop-methylester | haloxyfop-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 72619-32-0 | 406-250-0 | haloxyfop-P-methyl | haloxyfop-P-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 12035-71-1 | heazlewoodiet | heazlewoodite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 423-62-1 | 207-030-5 | henicosafluor-10-jooddecaan | henicosafluoro-10-iododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 15166-06-0 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)- | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 15715-47-6 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, aluminium zout (3:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, aluminum salt (3:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 19742-57-5 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, ammoniumzout (1:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, ammonium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 15739-82-9 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, chroomzout (1:x) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, chromium salt (1:x) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 61436-04-2 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, ijzerzout (1:x) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, iron salt (1:x) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 29457-73-6 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, kalium zout (1:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, potassium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 18017-22-6 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, natrium zout (1:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)- , sodium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 909009-42-3 | heptaanzuur, 2,2,3,3,4,4,5,6,6,7,7,7-dodecafluor-5-(trifluormethyl)- | heptanoic acid, 2,2,3,3,4,4,5,6,6,7,7,7-dodecafluoro-5-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1144512-18-4 | heptaanzuur, 2,2,3,3,4,5,5,6,6,7,7,7-dodecafluor-4-(trifluormethyl)- | heptanoic acid, 2,2,3,3,4,5,5,6,6,7,7,7-dodecafluoro-4-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 705240-04-6 | heptaanzuur, 2,2,3,4,4,5,5,6,6,7,7,7-dodecafluor-3-(trifluormethyl)- | heptanoic acid, 2,2,3,4,4,5,5,6,6,7,7,7-dodecafluoro-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 207678-51-1 | heptaanzuur, 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluor-2-(trifluormethyl)- | heptanoic acid, 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 68928-80-3 | 273-031-2 | heptabroomdifenylether | heptabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 12-8-2014 | 35 | |||
| 446255-22-7 | heptabroomdifenylether | heptabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 76-44-8 | 200-962-3 | heptachloor | heptachlor | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1024-57-3 | 213-831-0 | heptachloorepoxide | heptachlor epoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 32241-08-0 | 250-969-0 | heptachloornaftaleen | heptachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 28680-45-7 | 249-153-7 | heptachloornorborneen | heptachlorobicyclo[2.2.1]hept-2-ene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84029-60-7 | 281-728-8 | heptadecafluor-1-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctyl)oxy]noneen | heptadecafluoro-1-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)oxy]nonene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 507-63-1 | 208-079-5 | heptadecafluor-1-joodoctaan | heptadecafluoro-1-iodooctane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 423-60-9 | 624-359-3 | heptadecafluor-1-octaansulfonylchloride | heptadecafluoro-1-octanesulfonyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 24448-09-7 | 246-262-1 | heptadecafluor-N-(2-hydroxyethyl)-N-methyloctaansulfonamide | heptadecafluoro-N-(2-hydroxyethyl)-N-methyloctanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 52447-23-1 | 623-759-5 | heptadecafluornonanoylchloride | heptadecafluorononanoyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 754-91-6 | 212-046-0 | heptadecafluoroctaansulfonamide | heptadecafluorooctanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 9-5-2019 | 56, 95 | ||||
| 307-35-7 | 206-200-6 | heptadecafluoroctaansulfonyl fluoride | heptadecafluorooctanesulphonyl fluoride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 2252-84-8 | 811-906-8 | heptafluorpropaan | heptafluoropropane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 3330-15-2 | 671-353-1 | heptafluorpropyl 1,2,2,2-tetrafluorethylether | 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2,2-tetrafluoroethoxy)propane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 13601-55-3 | 624-520-8 | hexaaminenikkel(II) bromide | hexaaminenickel(II) bromide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 13859-68-2 | 625-736-5 | hexaaminenikkel(II) jodide | hexaaminenickel(II) iodide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 56 | ||||||
| 10534-88-0 | 620-832-3 | hexaamminenikkel(II) chloride | hexaamminenikkel(II) chloride | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 1144512-34-4 | hexaanzuur, 2,2,3,3,4,4,6,6,6-nonafluor-5,5-bis(trifluormethyl)- | hexanoic acid, 2,2,3,3,4,4,6,6,6-nonafluoro-5,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-79-6 | hexaanzuur, 2,2,3,3,4,5,5,6,6,6-decafluor-4-(1,1,2,2,2-pentafluorethyl)- | hexanoic acid, 2,2,3,3,4,5,5,6,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1144512-36-6 | hexaanzuur, 2,2,3,3,4,5,6,6,6-nonafluor-4,5-bis(trifluormethyl)- | hexanoic acid, 2,2,3,3,4,5,6,6,6-nonafluoro-4,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1192593-79-5 | hexaanzuur, 2,2,3,3,5,5,6,6,6-nonafluor-4,4-bis(trifluormethyl)- | hexanoic acid, 2,2,3,3,5,5,6,6,6-nonafluoro-4,4-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-78-5 | hexaanzuur, 2,2,3,4,4,5,5,6,6,6-decafluor-3-(1,1,2,2,2-pentafluorethyl)- | hexanoic acid, 2,2,3,4,4,5,5,6,6,6-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1144512-35-5 | hexaanzuur, 2,2,3,4,4,5,6,6,6-nonafluor-3,5-bis(trifluormethyl)- | hexanoic acid, 2,2,3,4,4,5,6,6,6-nonafluoro-3,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-81-0 | hexaanzuur, 2,2,3,4,5,5,6,6,6-nonafluor-3,4-bis(trifluormethyl)- | hexanoic acid, 2,2,3,4,5,5,6,6,6-nonafluoro-3,4-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1812247-20-3 | hexaanzuur, 2,2,4,4,5,5,6,6,6-nonafluor-3,3-bis(trifluormethyl)- | hexanoic acid, 2,2,4,4,5,5,6,6,6-nonafluoro-3,3-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 35605-76-6 | hexaanzuur, 2,3,3,4,4,5,5,6,6,6-decafluor-2-(1,1,2,2,2-pentafluorethyl)- | hexanoic acid, 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 13058-06-5 | hexaanzuur, 2,3,3,4,4,5,5,6,6,6-decafluor-2-(1,1,2,2,2-pentafluorethyl)-, ammoniumzout (1:1) | hexanoic acid, 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2- pentafluoroethyl)-, ammonium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1195164-59-0 | hexaanzuur, 2,3,3,4,4,5,5,6,6,6-decafluor-2-(1,1,2,2,2-pentafluorethyl)-, natrium zout (1:1) | hexanoic acid, 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)-, sodium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-80-9 | hexaanzuur, 2,3,3,4,4,5,6,6,6-nonafluor-2,5-bis(trifluormethyl)- | hexanoic acid, 2,3,3,4,4,5,6,6,6-nonafluoro-2,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1812247-19-0 | hexaanzuur, 2,3,3,4,5,5,6,6,6-nonafluor-2,4-bis(trifluormethyl)- | hexanoic acid, 2,3,3,4,5,5,6,6,6-nonafluoro-2,4-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1812247-18-9 | hexaanzuur, 2,3,4,4,5,5,6,6,6-nonafluor-2,3-bis(trifluormethyl)- | hexanoic acid, 2,3,4,4,5,5,6,6,6-nonafluoro-2,3-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1812247-17-8 | hexaanzuur, 3,3,4,4,5,5,6,6,6-nonafluor-2,2-bis(trifluormethyl)- | hexanoic acid, 3,3,4,4,5,5,6,6,6-nonafluoro-2,2-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 36355-01-8 | 252-994-2 | hexabroombifenyl | hexabromo-1,1'-biphenyl | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 36483-60-0 | 253-058-6 | hexabroomdifenylether | hexabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 12-8-2014 | 35 | |||
| 813-19-4 | 212-383-3 | hexabutyldistannaan | hexabutyldistannane | 6-9-2022 | 15 | ||||||||
| 4808-30-4 | 225-369-7 | hexabutyldistannathiaan | hexabutyldistannathiane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 118-74-1 | 204-273-9 | hexachloorbenzeen | hexachlorobenzene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 31 | |||
| 87-68-3 | 201-765-5 | hexachloorbutadieen | hexachlorobuta-1,3-diene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 608-73-1 | 210-168-9 | hexachloorcyclohexaan | hexachlorocyclohexane (technical) | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 77-47-4 | 201-029-3 | hexachloorcyclopentadieen | hexachlorocyclopentadiene | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 55684-94-1 | hexachloordibenzofuranen | hexachlorodibenzofurans | ERS | 0,05 ng TEQ/Nm3 | 24-1-2020 | 56, 68 | |||||||
| 1335-87-1 | 215-641-3 | hexachloornaftaleen | hexachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 335-57-9 | 206-392-1 | hexadecafluorheptaan | hexadecafluoroheptane | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 95, 121 | |||||
| 3124-01-4 | 221-505-4 | hexafenyldilood | hexaphenyldiplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 86 | ||||||
| 86479-06-3 | 401-400-1 | hexaflumuron | hexaflumuron | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 80, 95, 127 | |||||
| 72301-81-6 | 695-459-2 | hexafluor-2-propaanon--(~2~H_2_)water (1/1) | hexafluoropropan-2-one--(~2~H_2_)water (1/1) | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 684-16-2 | 211-676-3 | hexafluoraceton | hexafluoro acetone | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 677-71-4 | 211-644-9 | hexafluoraceton-hydraat | hexafluoroacetone hydrate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 76-16-4 | 200-939-8 | hexafluorethaan | hexafluoroethane | Ja | gO.2 | 50 mg/Nm3 | 15-11-2024 | 44, 95 | |||||
| 116-15-4 | 204-127-4 | hexafluorpropeen | hexafluoropropene | Ja | gO.1 | 20 mg/Nm3 | 15-11-2024 | 44, 95 | |||||
| 48122-14-1 | 256-356-4 | hexahydro-1-methylftaalzuur-anhydride | hexahydro-1-methylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 57110-29-9 | 260-566-1 | hexahydro-3-methylftaalzuur-anhydride | hexahydro-3-methylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85-42-7 | 201-604-9 | hexahydroftaalzuur-anhydride | cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14166-21-3 | 238-009-9 | hexahydroftaalzuur-anhydride (trans-isomeer) | trans-cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 186406-49-5 | 110-668-6 | hexakis(1H,1H,8H-tetradecafluoroctyloxy)fosfazijn | hexakis(1H,1H,8H-tetradecafluorooctyloxy)phosphazi | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 680-31-9 | 211-653-8 | hexamethylfosforamide | hexamethylphosphoric triamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12005-92-4 | 234-476-8 | holmium arsenide | holmium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7803-57-8 | 616-584-0 | hydraten van hydrazine | hydrates of hydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 302-01-2 | 206-114-9 | hydrazine | hydrazine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 13255-48-6 | 629-465-3 | hydrazine acetaat | hydrazine acetate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | |||||
| 13537-45-6 | hydrazine difluoride | hydrazine difluoride | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | ||||||
| 23268-00-0 | 245-543-6 | hydrazine dihydrobromide | hydrazine dihydrobromide | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | |||||
| 5341-61-7 | 226-283-2 | hydrazine dihydrochloride | hydrazine dihydrochloride | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | |||||
| 13464-98-7 | hydrazine dinitraat | hydrazine, dinitrate | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 68 | |||||||
| 23488-13-3 | hydrazine fosfaat | hydrazine phosphate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | ||||||
| 102096-80-0 | 694-328-7 | hydrazine hydraat-D6 | hydrazine hydrate-D6 | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 10217-52-4 | 600-285-7 | hydrazine monohydraat | hydrazine monohydrate | Ja | MVP 2 | 1 mg/Nm3 | 17-1-2022 | 56, 106 | |||||
| 27978-54-7 | hydrazine perchloraat | hydrazine perchlorate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | ||||||
| 73506-32-8 | hydrazine selenaat | hydrazine selenate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | ||||||
| 1184-66-3 | hydrazine sulfaat | hydrazine sulfate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | ||||||
| 88491-70-7 | 685-833-3 | hydrazine sulfaat-15N2 | hydrazine sulfate-15N2 | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 634-62-8 | 211-211-4 | hydrazine tartraat | hydrazine tartrate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 56, 111 | |||||
| 287488-18-0 | 687-243-1 | hydrazine-15N2 di-waterstofchloride | hydrazine-15N2 dihydrochloride | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 145571-73-9 | 685-220-0 | hydrazine-15N2 monohydraat | hydrazine-15N2 monohydrate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 148434-03-1 | 405-030-1 | hydrazinebis(3-carboxy-4-hydroxybenzeensulfonaat) | hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 312623-95-3 | 685-231-0 | hydrazine-D4 di-deuteriumchloride | hydrazine-D4 dideuteriochloride | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 4682-01-3 | 414-850-9 | hydrazine-tri-nitromethaan | hydrazine-tri-nitromethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 7335-65-1 | 230-845-2 | hydrazinium acetaat | hydrazinium acetate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 13775-80-9 | 237-412-7 | hydrazinium bromide | hydrazinium bromide | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 2644-70-4 | 220-154-4 | hydrazinium chloride | hydrazinium chloride | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 13464-97-6 | 236-690-7 | hydrazinium nitraat | hydrazinium nitrate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 10034-93-2 | 233-110-4 | hydrazinium(2+)sulfaat | hydrazinium(2+) sulphate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 56 | |||||
| 122-66-7 | 204-563-5 | hydrazobenzeen | hydrazobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 86676-91-7 | 626-171-7 | hydrogen peroxide--nikkel--water (1/1/1) | hydrogen peroxide--nickel--water (1/1/1) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 52806-53-8 | 641-868-6 | hydroxyflutamide | hydroxyflutamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 677-93-0 | 211-645-4 | icosafluor-10-jood-2-(trifluormethyl)decaan | icosafluoro-10-iodo-2-(trifluoromethyl)decane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 7321-53-1 | 230-794-6 | ijzer tris(2-ethylhexaanzuur) | iron tris(2-ethylhexanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-5-2024 | 83 | |||||
| 10102-50-8 | 233-275-2 | ijzer(II)arsenaat | iron bis(arsenate) | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 10102-49-5 | 233-274-7 | ijzer(III)arsenaat | ferric arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 63989-69-5 | ijzer(III)arseniet | ferric arsenite, basic | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | ||||||
| 12044-16-5 | 234-947-8 | ijzerarsenide | iron arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 93981-08-9 | 301-090-7 | ijzerbis(2-ethylhexanoaat) | iron bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 80, 144 | ||||||
| 12006-21-2 | 234-485-7 | ijzerdiarsenide | iron diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 5968-84-3 | 227-759-2 | ijzertris(dimethylarsinaat) | iron tris(dimethylarsinate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 109201-26-5 | 625-386-3 | imidazoliumdichromaat | imidazolium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 288-32-4 | 206-019-2 | imidazool | imidazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-9-2015 | ||||||
| in water onoplosbare zouten van arseenzuur | water-insoluble salts of arsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 91 | |||||||
| in water oplosbare zouten van arseenzuur | water-soluble salts of arsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 91 | |||||||
| 95-13-6 | 202-393-6 | indeen | indene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 193-39-5 | 205-893-2 | indeno[1,2,3-cd]pyreen | indeno[1,2,3-cd]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1303-11-3 | 215-115-3 | indium arsenide | indium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 56, 91 | |||||
| 22398-80-7 | 244-959-5 | indium fosfide | indium phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 173584-44-6 | 605-683-4 | indoxacarb | indoxacarb | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 125225-28-7 | 603-038-1 | ipconazool | ipconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | |||||
| 75-28-5 | 200-857-2 | isobutaan | isobutane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 32 | |||||
| 59571-08-3 | 261-812-0 | isobutyl (Z,Z)-10,10-dibutyl-2-methyl-5,8,12-trioxo-4,9,11-trioxa-10-stannapentadeca-6,13-dieen-15-oaat | isobutyl (Z,Z)-10,10-dibutyl-2-methyl-5,8,12-trioxo-4,9,11-trioxa-10-stannapentadeca-6,13-dien-15-oate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 4247-02-3 | 224-208-8 | isobutyl 4-hydroxybenzoaat | isobutyl 4-hydroxybenzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 80 | |||||
| 542-56-3 | 208-819-7 | isobutylnitriet | isobutyl nitrite | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| isocyanatobenzotrifluoriden | isocyanato benzotrifluorides | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 465-73-6 | 207-366-2 | isodrin | isodrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 26675-46-7 | 247-897-7 | isofluraan | isoflurane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 27253-41-4 | 248-376-7 | isononaanzuur, loodzout | isononanoic acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 14, 56 | ||||||
| 11066-49-2 | 234-284-4 | isononylfenol | isononylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 56 | |||||
| 123116-17-6 | isooctaanzuur, pentadecafluor - | isooctanoic acid, pentadecafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| iso-octyl/nonyl-fenyl-polyglycolether (met 5 ethyleenoxide-eenheden) | Iso-octyl/nonyl-phenyl-polyglycol ether (with 5 ethylene oxide units) | gO.2 | 50 mg/Nm3 | 19-8-2024 | 44, 68 | ||||||||
| 78-79-5 | 201-143-3 | isopreen | isoprene (stabilised) | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 881685-58-1 | 632-619-2 | isopyrazam | isopyrazam | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | |||||
| 119-65-3 | 204-341-8 | isoquinoline | isoquinoline | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 141112-29-0 | 604-222-4 | isoxaflutool | isoxaflutole | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 127421-77-6 | 105-908-1 | jodotris(mesityl)lood | iodotris(mesityl)lead | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 126 | ||||||
| 676-75-5 | 211-630-2 | joodimethylarsine | iododimethylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 75-60-5 | 200-883-4 | kakodylzuur | cacodylic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 29420-49-3 | 249-616-3 | kalium 1,1,2,2,3,3,4,4,4-nonafluorbutaan-1-sulfonaat | potassium 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 444-340-1 | kalium 2-(3-trifluormethoxy-1,1,2,2,3,3-hexafluorpropoxy)-2,3,3,3-tetrafluorpropionaat | potassium 2-(3-trifluoromethoxy-1,1,2,2,3,3-hexafluoropropoxy)-2,3,3,3-tetrafluoropropionate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 67118-55-2 | 266-578-3 | kalium 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propanoaat | potassium 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 95 | ||||
| 83310-58-1 | 280-373-6 | kalium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecanoaat | potassium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 17218-47-2 | 625-130-0 | kalium hexafluornikkelaat(IV) | potassium hexafluoronickelate(IV) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 21049-36-5 | kalium perfluorheptanoaat | potassium perfluoroheptanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 80, 95 | |||||
| 3871-99-6 | 223-393-2 | kalium perfluorhexaan-1-sulfonaat | potassium perfluorohexane-1-sulphonate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | ||||
| 183196-57-8 | 418-260-2 | kalium-1-methyl-3-morfolinocarbonyl-4-[3-(1-methyl-3-morfolinocarbonyl-5-oxo-2-pyrazoline-4-ylideen)-1-propenyl]pyrazool-5-olaat [met 0,5 procent of meer N,N-dimethylformamide (EC Nr 200-679-5)] | potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate, [containing ≥ 0.5 % N,N-dimethylformamide (EC No 200-679-5)] | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 10124-50-2 | 233-337-9 | kaliumarsenaat | potassium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 13464-35-2 | 236-680-2 | kaliumarseniet | potassium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 20-12-2021 | 56, 91 | |||||
| 7758-01-2 | 231-829-8 | kaliumbromaat | potassium bromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16037-50-6 | 240-174-7 | kaliumchloortrioxochromaat | potassium chlorotrioxochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 7789-00-6 | 232-140-5 | kaliumchromaat | potassium chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 7778-50-9 | 231-906-6 | kaliumdichromaat | potassium dichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 7784-41-0 | 232-065-8 | kaliumdihydroarsenaat | potassium dihydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 21416-85-3 | 881-273-0 | kaliumdimethylarsinaat | potassium dimethylarsinate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 2795-39-3 | 220-527-1 | kaliumheptadecafluoroctaan-1-sulfonaat | potassium heptadecafluorooctane-1-sulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||
| 17029-22-0 | 241-102-7 | kaliumhexafluorarsenaat | potassium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 591-89-9 | 209-735-3 | kalium-kwikcyanide | mercury potassium cyanide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 7783-33-7 | 231-990-4 | kalium-kwikjodide | potassium mercuric iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 13355-00-5 | 236-405-6 | kaliummelarsonyl | melarsonyl potassium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7778-73-6 | 231-911-3 | kaliumpentachloorfenolaat | potassium pentachlorophenolate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 56 | |||||
| 2395-00-8 | 219-248-8 | kaliumperfluoroctanoaat | potassium perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 8008-20-6 | 232-366-4 | kerosine | kerosene | 24-4-2023 | 4, 79 | ||||||||
| 64742-81-0 | 265-184-9 | kerosine (aardolie), met waterstof ontzwaveld | kerosine (petroleum), hydrodesulfurized | 19-5-2021 | 4, 79 | ||||||||
| 92045-37-9 | 295-418-5 | kerosine (aardolie), uit directe fractionering verkregen ruime fractie | kerosine (petroleum), straight-run wide-cut | 24-4-2023 | 4, 79 | ||||||||
| 65277-42-1 | 265-667-4 | ketoconazool | ketoconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68784-75-8 | 272-271-5 | kiezelzuur (H2Si2O5), bariumzout (1:1), gedoteerd met lood | silicic acid (H2Si2O5), barium salt (1:1), lead-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 68784-76-9 | kiezelzuur (H4SiO4), magnesium-mangaan(2+) zinkzout, arseen- en loodgedoopt | silicic acid (H4SiO4), magnesium manganese(2+) zinc salt, arsenic and lead-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 68957-75-5 | kiezelzuur (H4SiO4), tetraethylester, polymeer met arseenoxide (As2O3) | silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 93925-42-9 | 300-344-4 | kiezelzuur (H4SiO4), tetraethylester, reactieproducten met bis(acetyloxy)dibutylstannaan | silicic acid (H4SiO4), tetraethyl ester, reaction products with bis(acetyloxy)dibutylstannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 68611-46-1 | 271-895-5 | kiezelzuur (H4SiO4), zinkzout (1:2), arseen- en mangaan-gedoteerd | silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 11120-22-2 | 234-363-3 | kiezelzuur loodzout | silicic acid, lead salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 37321-15-6 | 253-461-7 | kiezelzuur nikkelzout | silicic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11113-70-5 | 234-347-6 | kiezelzuur, chroom loodzout | silicic acid, chromium lead salt | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 68130-19-8 | kiezelzuur, loodnikkelzout | silicic acid, lead nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||||
| 102184-95-2 | 310-077-5 | kiezelzuur, zirkoniumzout, ingekapseld cadmiumpigment | silicic acid, zirconium salt, cadmium pigment-encapsulated | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 85 | ||||||
| 7440-48-4 | 231-158-0 | kobalt | cobalt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | 51 | |||||
| 136-52-7 | 205-250-6 | kobalt bis(2-ethylhexanoaat) | cobalt bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 60459-08-7 | 628-130-9 | kobalt(II)sulfaat, hydraat | cobalt (II) sulfate, hydrate | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 56, 68 | ||||||
| 91782-60-4 | 295-032-7 | kobalt, boraat 2-ethylhexanoaat complexen | cobalt, borate 2-ethylhexanoate complexes | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 71-48-7 | 200-755-8 | kobaltacetaat | cobalt(II) diacetate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 66 | ||||
| 27016-73-5 | 248-168-6 | kobaltarsenide | cobalt arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12044-42-7 | kobaltarsenide (CoAs2) | cobalt arsenide (CoAs2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12256-04-1 | kobaltarsenide (CoAs3) | cobalt arsenide (CoAs3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 513-79-1 | 208-169-4 | kobaltcarbonaat | cobalt(II) carbonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 66 | ||||
| 7646-79-9 | 231-589-4 | kobaltdichloride | cobalt dichloride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 66 | ||||
| 72861-19-9 | kobaltdichloride decahydraat | cobalt dichloride decahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 16544-92-6 | kobaltdichloride dihydraat | cobalt chloride (CoCl2), dihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 7791-13-1 | 616-574-6 | kobaltdichloride hexahydraat | cobalt(II) chloride hexahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | |||||
| 69098-14-2 | 628-677-3 | kobaltdichloride hydraat | cobalt dichloride hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | |||||
| 146998-10-9 | kobaltdichloride hydraat (3:22) | cobalt dichloride hydrate (3:22) | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 18201-52-0 | kobaltdichloride monohydraat | cobalt chloride (CoCl2), monohydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 20579-56-0 | kobaltdichloride pentahydraat | cobalt dichloride pentahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 16890-89-4 | kobaltdichloride tetrahydraat | cobalt dichloride tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 65374-82-5 | kobaltdichloride trihydraat | cobalt dichloride trihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 55, 56 | ||||||
| 21041-93-0 | 244-166-4 | kobaltdihydroxide | cobalt dihydroxide | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 56, 138 | ||||||
| 68016-03-5 | 268-169-5 | kobaltdimolybdeennikkeloctaoxide | cobalt dimolybdenum nickel octaoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 182442-95-1 | 695-690-9 | kobalt-lithium-mangaan-nikkeloxide | cobalt lithium manganese nickel oxide | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 34, 56, 125 | ||||||
| 131344-56-4 | 442-750-5 | kobaltlithiumnikkeloxide | cobalt lithium nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68186-89-0 | 269-051-6 | kobaltnikkel grijze periklaas | cobalt nickel gray periclase | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 58591-45-0 | 261-346-8 | kobaltnikkeldioxide | cobalt nickel dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 37348-84-8 | 951-904-5 | kobalt-nikkel-mangaanoxide | cobalt nickel manganese oxide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 12737-30-3 | 620-395-9 | kobaltnikkeloxide | cobalt nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10141-05-6 | 233-402-1 | kobaltnitraat | cobalt nitrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 66 | ||||
| 10124-43-3 | 233-334-2 | kobaltsulfaat | cobalt sulphate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 66 | ||||
| koelgas | refrigerant gas | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97, 102 | |||||||
| 630-08-0 | 211-128-3 | koolmonoxide | carbon monoxide | Ja | 2-12-2013 | 17 | |||||||
| 94114-48-4 | 302-683-3 | koolvloeistoffen, vloeibaar solvent-extracten | coal liquids, liq. solvent extn. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 62 | |||||
| 94114-47-3 | 302-682-8 | koolvloeistoffen, vloeibaar solventextractie oplossing | Coal liquids, liq. solvent extn. soln. | Ja | 2-12-2013 | 4, 62 | |||||||
| 919-284-0 | koolwaterstoffen C10, aromatisch, >1% naftaleen | hydrocarbons, C10, aromatics, >1% naphthalene | MVP 1 | 0,05 mg/Nm3 | 19-5-2021 | 79, 81 | |||||||
| 97722-08-2 | 307-757-9 | koolwaterstoffen C11-17-, solvent-geëxtraheerde lichte naftenische | hydrocarbons, C11-17, solvent-extd. light naphthenic | Ja | 2-12-2013 | 4, 63 | |||||||
| 97675-86-0 | 307-660-1 | koolwaterstoffen C12-20-, waterstofbehandelde parafinische, lichte destillatiefracties | hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights | Ja | 2-12-2013 | 4, 63 | |||||||
| 68527-16-2 | 271-259-7 | koolwaterstoffen C1-3 | hydrocarbons, C1-3 | Ja | 2-12-2013 | 4, 59 | |||||||
| 95371-04-3 | 305-971-7 | koolwaterstoffen C13-30-, rijk aan aromaten met solvent geëxtraheerd naftenisch destillaat | hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate | Ja | 2-12-2013 | 4, 61 | |||||||
| 68514-31-8 | 271-032-2 | koolwaterstoffen C1-4 | hydrocarbons, C1-4 | Ja | 2-12-2013 | 4, 59 | |||||||
| 68527-19-5 | 271-261-8 | koolwaterstoffen C1-4, butaanverwijdering-fractie | hydrocarbons, C1-4, debutanizer fraction | Ja | 2-12-2013 | 4, 59 | |||||||
| 68514-36-3 | 271-038-5 | koolwaterstoffen C1-4-, stankvrij gemaakt | hydrocarbons, C1-4, sweetened | Ja | 2-12-2013 | 4, 59 | |||||||
| 97722-10-6 | 307-760-5 | koolwaterstoffen C14-19-, met oplosmiddel geëxtraheerde lichte naftenische | hydrocarbons, C14-29, solvent-extd. light naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 97675-85-9 | 307-659-6 | koolwaterstoffen C16-20-waterstofbehandeld middendestillaat, lichte destillatiefracties | hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights | Ja | 2-12-2013 | 4, 63 | |||||||
| 95371-05-4 | 305-972-2 | koolwaterstoffen C16-32-, rijk aan aromaten met solvent geëxtraheerd naftenisch destillaat | hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate | Ja | 2-12-2013 | 4, 61 | |||||||
| 97862-82-3 | 308-132-3 | koolwaterstoffen C17-30-, met waterstof behandelde destillaten lichte destillatiefracties | hydrocarbons, C17-30, hydrotreated distillates, distn. lights | Ja | 2-12-2013 | 4, 61 | |||||||
| 97675-87-1 | 307-661-7 | koolwaterstoffen C17-30-, waterstofbehandeld met oplosmiddel gedeasfalteerd residu van de atmosferische destillatie, lichte destillatiefracties | hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights, | Ja | 2-12-2013 | 4, 61 | |||||||
| 97722-06-0 | 307-755-8 | koolwaterstoffen C17-40-, met waterstofbehandeld met oplosmiddel gedeasfalteerd destillatieresidu, lichte vacuümdestillatiefracties | hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-95-2 | 292-617-9 | koolwaterstoffen C20-50-, met oplosmiddel van was ontdane zware paraffinische, met waterstof behandeld | hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 93924-61-9 | 300-257-1 | koolwaterstoffen C20-50-, residuolie hydrogenering vacuümdestillaat | hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate | Ja | 2-12-2013 | 4, 61 | |||||||
| 97926-70-0 | 308-289-8 | koolwaterstoffen C20-58-, met waterstof behandeld | hydrocarbons, C20-58, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 68606-25-7 | 271-734-9 | koolwaterstoffen C2-4- | hydrocarbons, C2-4 | Ja | 2-12-2013 | 4, 59 | |||||||
| 68476-49-3 | 270-689-2 | koolwaterstoffen C2-4, rijk aan C3 | hydrocarbons, C2-4, C3-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 97722-04-8 | 307-753-7 | koolwaterstoffen C26-55, rijk aan aromaten | hydrocarbons C26-55, arom-rich | Ja | 2-12-2013 | 4 | |||||||
| 97862-81-2 | 308-131-8 | koolwaterstoffen C27-42-, gedearomatiseerd | hydrocarbons, C27-42, dearomatized | Ja | 2-12-2013 | 4, 61 | |||||||
| 97926-71-1 | 308-290-3 | koolwaterstoffen C27-42-, naftenisch | hydrocarbons, C27-42, naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 97926-68-6 | 308-287-7 | koolwaterstoffen C27-45-, gedearomatiseerd | hydrocarbons, C27-45, dearomatized | Ja | 2-12-2013 | 4, 61 | |||||||
| 97862-83-4 | 308-133-9 | koolwaterstoffen C27-45-, naftenische vacuümdestillatie | hydrocarbons, C27-45, naphthenic vacuum distn. | Ja | 2-12-2013 | 4, 61 | |||||||
| 68606-26-8 | 271-735-4 | koolwaterstoffen C3- | hydrocarbons, C3 | Ja | 2-12-2013 | 4, 59 | |||||||
| 68476-46-0 | 270-686-6 | koolwaterstoffen C3-11, destillaten uit katalytische kraker | hydrocarbons, C3-11, catalytic cracker distillates | Ja | 2-12-2013 | 4, 64 | |||||||
| 68476-40-4 | 270-681-9 | koolwaterstoffen C3-4 | hydrocarbons, C3-4 | Ja | 2-12-2013 | 4, 59 | |||||||
| 68512-91-4 | 270-990-9 | koolwaterstoffen C3-4-rijk aardoliedestillaat | hydrocarbons, C3-4-rich, petroleum distillate | Ja | 2-12-2013 | 4, 59 | |||||||
| 102110-14-5 | 310-012-0 | koolwaterstoffen C3-6-, rijk aan C5, stoomgekraakte nafta | hydrocarbons, C3-6, C5-rich, steam-cracked naphtha | Ja | 2-12-2013 | 4, 64 | |||||||
| 95371-08-7 | 305-975-9 | koolwaterstoffen C37-65-, met waterstof behandelde van asfalt ontdane vacuümdestillatieresiduen | hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues | Ja | 2-12-2013 | 4, 61 | |||||||
| 95371-07-6 | 305-974-3 | koolwaterstoffen C37-68-, van was en asfalt ontdane met waterstof behandelde vacuümdestillatieresiduen | hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues | Ja | 2-12-2013 | 4, 61 | |||||||
| 87741-01-3 | 289-339-5 | koolwaterstoffen C4- | hydrocarbons, C4 | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-23-3 | 295-405-4 | koolwaterstoffen C4-, stoomkrakerdestillaat | hydrocarbons, C4, steam-cracker distillate | Ja | 2-12-2013 | 4, 59 | |||||||
| 95465-89-7 | 306-004-1 | koolwaterstoffen C4-, vrij van 1,3-butadieen en isobuteen | hydrocarbons, C4, 1,3-butadiene- and isobutene-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 92045-63-1 | 295-445-2 | koolwaterstoffen C4-11-, naftakraken aromaatvrij | hydrocarbons, C4-11, naphtha-cracking, arom.-free | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-61-9 | 295-443-1 | koolwaterstoffen C4-12-, naftakraken waterstofbehandeld | hydrocarbons, C4-12, naphtha-cracking, hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68476-42-6 | 270-682-4 | koolwaterstoffen C4-5- | hydrocarbons, C4-5 | Ja | 2-12-2013 | 4, 59 | |||||||
| 91995-38-9 | 295-298-4 | koolwaterstoffen C4-6-, lichte fracties pentaanverwijdering, aromatische waterstofbehandelaar | hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater | Ja | 2-12-2013 | 4, 64 | |||||||
| 93572-36-2 | 297-466-2 | koolwaterstoffen C5-11-, rijk aan niet-aromaten lichte fractie uit reforming | hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 93763-33-8 | 297-852-0 | koolwaterstoffen C6-11-, waterstofbehandeld gedearomatiseerd | hydrocarbons, C6-11, hydrotreated, dearomatized | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-64-2 | 295-446-8 | koolwaterstoffen C6-7, naftakraken oplosmiddelgeraffineerd | hydrocarbons, C6-7, naphtha-cracking, solvent-refined | Ja | 2-12-2013 | 4, 64 | |||||||
| 101316-66-9 | 309-870-9 | koolwaterstoffen C6-8-, gehydrogeneerde, door sorptie gedearomatiseerde, tolueenraffinage | hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination | Ja | 2-12-2013 | 4, 64 | |||||||
| 93572-35-1 | 297-465-7 | koolwaterstoffen C7-12-, rijk aan C groter dan 9aromaten zware fractie uit reforming | hydrocarbons, C7-12, C≥9-arom.-rich, reforming heavy fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-62-0 | 295-444-7 | koolwaterstoffen C8-11-, naftakraken tolueenfractie | hydrocarbons, C8-11, naphtha-cracking, toluene cut | Ja | 2-12-2013 | 4, 64 | |||||||
| 101794-97-2 | 309-974-4 | koolwaterstoffen C8-12-, destillaten uit katalytische kraker | hydrocarbons, C8-12, catalytic cracker distillates | Ja | 2-12-2013 | 4, 64 | |||||||
| 92128-94-4 | 295-794-0 | koolwaterstoffen C8-12-, katalytisch gekraakte, chemisch geneutraliseerde | hydrocarbons, C8-12, catalytic-cracking, chem. neutralized | Ja | 2-12-2013 | 4, 64 | |||||||
| 93763-34-9 | 297-853-6 | koolwaterstoffen C9-12-, waterstofbehandeld gedearomatiseerd | hydrocarbons, C9-12, hydrotreated, dearomatized | Ja | 2-12-2013 | 4, 64 | |||||||
| 93763-38-3 | 297-857-8 | koolwaterstoffen met waterstof gekraakte paraffine-houdende destillatieresiduen met solvent van was ontdaan | hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 68476-55-1 | 270-695-5 | koolwaterstoffen rijk aan C5 | hydrocarbons, C5-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 102110-15-6 | 310-013-6 | koolwaterstoffen rijk aan C5, dicyclopentadieen bevattend | hydrocarbons, C5-rich, dicyclopentadiene-contg. | Ja | 2-12-2013 | 4, 64 | |||||||
| 101316-67-0 | 309-871-4 | koolwaterstoffen rijk aan C6, waterstofbehandelde lichte naftadestillaten oplosmiddelgeraffineerd | hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-55-1 | 295-436-3 | koolwaterstoffen waterstofbehandelde lichte naftadestillaten oplosmiddelgeraffineerd | hydrocarbons, hydrotreated light naphtha distillates, solvent-refined | Ja | 2-12-2013 | 4, 64 | |||||||
| 68476-50-6 | 270-690-8 | koolwaterstoffen, C≥5, rijk aan C5-6 | hydrocarbons, C≥5, C5-6-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 1189173-42-9 | 918-811-1 | koolwaterstoffen, C10, aromaten, <1% naftaleen | hydrocarbons, C10, aromatics, <1% naphthalene | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 71, 81 | ||||||
| 922-153-0 | koolwaterstoffen, C10-C13, aromaten, <1% naftaleen | hydrocarbons, C10-C13, aromatics, <1% naphthalene | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 71, 81 | |||||||
| 97722-09-3 | 307-758-4 | koolwaterstoffen, C13-27-, met oplosmiddel geëxtraheerde lichte naftenische | hydrocarbons, C13-27, solvent-extd. light naphthenic | Ja | 2-12-2013 | 4, 61 | |||||||
| 68476-47-1 | 270-687-1 | koolwaterstoffen, C2-6-, katalytische reformer C6-8 | hydrocarbons, C2-6, C6-8 catalytic reformer | Ja | 2-12-2013 | 4, 64 | |||||||
| 101896-28-0 | 309-987-5 | koolwaterstoffen, C8-12-, katalytisch gekraakte, chemisch geneutraliseerde, stankvrij gemaakte | hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 100801-65-8 | 309-748-5 | koolwaterstofoliën aromatisch gemengd met polyethyleen gepyrolyseerd lichte oliefractie | hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 60, 62 | |||||
| 100801-66-9 | 309-749-0 | koolwaterstofoliën aromatisch gemengd met polystyreen gepyrolyseerd lichte oliefractie | hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 60, 62 | |||||
| 100801-63-6 | 309-745-9 | koolwaterstofoliën, aromatisch, gemengd met polyethyleen en polypropyleen gepyrolyseerd lichte oliefractie | hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 60, 62 | |||||
| 16337-84-1 | 240-408-8 | koolzuur nikkelzout | carbonic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16509-22-1 | 240-574-1 | koper diarseniet | copper diarsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 68411-07-4 | 942-164-4 | koper lood resorcylzuur salicylzuur complex | copper lead resorcylate salicylate complex | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||
| 12002-03-8 | 601-658-7 | koperacetoarseniet | copper acetoarsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 10290-12-7 | 233-644-8 | koperarseniet | copper arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 13548-42-0 | 236-922-7 | koperchromaat | copper chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 932-902-3 | koper-nikkel-mangaanoxide | copper-nickel-manganese-oxide | MVP 1 | 20-8-2024 | 34, 56 | ||||||||
| 14808-60-7 | 238-878-4 | kwarts | quartz (SiO2) | sA.2 | 0,5 mg/Nm3 | 19-5-2021 | 44, 82 | ||||||
| 7439-97-6 | 231-106-7 | kwik | mercury | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 10415-75-5 | 233-886-4 | kwik(I)nitraat | mercury(I) nitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 7784-37-4 | 232-062-1 | kwik(II)arsenaat | mercury(II)arsenate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 56, 91 | ||||
| 7487-94-7 | 231-299-8 | kwik(II)chloride | mercury(II) chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 10045-94-0 | 233-152-3 | kwik(II)nitraat | mercury(II) nitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 7783-35-9 | 231-992-5 | kwik(II)sulfaat | mercury(II) sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 1600-27-7 | 216-491-1 | kwikacetaat | mercury acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 583-15-3 | 209-499-1 | kwikbenzoaat | mercury benzoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| kwikbromiden | mercury bromides | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||||
| 592-04-1 | 209-741-6 | kwikcyanide | mercury dicyanide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 628-86-4 | 211-057-8 | kwikfulminaat | mercury fulminate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 63937-14-4 | kwikgluconate | mercury gluconate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 7783-30-4 | 231-988-3 | kwikjodide | mercury iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 12002-19-6 | kwiknucleaat | mercury nucleate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 1191-80-6 | 214-741-4 | kwikoleaat | mercury oleate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 21908-53-2 | 244-654-7 | kwikoxide | mercury oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 1335-31-5 | 215-629-8 | kwikoxycyanide | mercury cyanide oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 5970-32-1 | 227-760-8 | kwiksalicylaat | mercury salicylate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | ||||
| 592-85-8 | 209-773-0 | kwikthiocyanaat | mercury(II) thiocyanate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| kwikverbindingen | mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 122384-78-5 | 310-191-5 | lagetemperatuurkoolteerolie, alkalische | low temperature tar oil, alkaline | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91465-08-6 | 415-130-7 | lambda-cyhalothrin | lambda-cyhalothrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 103577-45-3 | 627-144-2 | lansoprazool | lansoprazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 12255-04-8 | 235-502-0 | lanthaanarsenide | lanthanum arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 75706-12-6 | 616-254-6 | leflunomide | leflunomide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 93841-79-3 | 299-051-1 | leucomycine V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyraan-2-yl]-, [9(5S,6R)]-, [1,2-ethaandiylbis(imino-4,1-fenyleen)]bis[arsonaat] (1:1) (zout) | leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 65996-78-3 | 266-012-5 | lichte olie (kool), cokesoven | light oil (coal), coke-oven | Ja | 2-12-2013 | 4, 60 | |||||||
| 90641-11-5 | 292-635-7 | lichte olie (kool), semi-verkooksingsproces | light oil (coal), semi-coking process | Ja | 2-12-2013 | 4, 60 | |||||||
| 8032-32-4 | 232-453-7 | ligroïne | ligroine | Ja | 2-12-2013 | 4, 64 | |||||||
| lineaire en vertakte perfluorcarbonzuren met de formule CnF2n+1-C(= O)OH, waarbij n = 8, 9, 10, 11, 12 of 13 (C9-C14-PFCA’s), met inbegrip van zouten daarvan en alle combinaties van deze producten. Aan C9-C14-PFCA verwante stoffen die een rechtstreeks met een ander koolstofatoom verbonden perfluorgroep met de formule CnF2n+1 hebben, waarbij n = 8, 9, 10, 11, 12 of 13, met inbegrip van de zouten en alle combinaties daarvan. Aan C9-C14-PFCA verwante stoffen die geen rechtstreeks met een ander koolstofatoom verbonden perfluorgroep met de formule CnF2n+1 hebben, waarbij n = 9, 10, 11, 12, 13 of 14, als een van de structurele elementen, met inbegrip van de zouten en alle combinaties daarvan. De volgende stoffen zijn van deze omschrijving uitgesloten: — CnF2n+1-X, waarbij X = F, Cl, of Br waarbij n = 9, 10, 11, 12, 13 of 14, met inbegrip van combinaties daarvan, — CnF2n+1-C(= O)OX' waarbij n> 13 en X' = elke groep, met inbegrip van zouten. | linear and branched perfluorocarboxylic acids of the formula CnF2n +1-C(= O)OH where n = 8, 9, 10, 11, 12, or 13 (C9-C14 PFCAs), including their salts, and any combinations thereof. Any C9-C14 PFCA-related substance having a perfluoro group with the formula CnF2n +1- directly attached to another carbon atom, where n = 8, 9, 10, 11, 12, or 13, including their salts and any combinations thereof. Any C9-C14 PFCA-related substance having a perfluoro group with the formula CnF2n +1- that it is not directly attached to another carbon atom, where n = 9, 10, 11, 12, 13 or 14 as one of the structural elements, including their salts and any combinations thereof. The following substances are excluded from this designation — CnF2n +1-X, where X = F, Cl, or Br where n = 9, 10, 11, 12, 13 or 14, including any combinations thereof, — CnF2n +1-C(= O)OX' where n> 13 and X'=any group, including salts. | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 330-55-2 | 206-356-5 | linuron | linuron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 29935-35-1 | 249-963-0 | lithium hexafluorarsenaat | lithium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-1-2023 | 56, 91 | |||||
| 193214-24-3 | 803-110-4 | lithium nikkel kobalt aluminium oxide | lithium nickel cobalt aluminium oxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 113066-89-0 | 802-308-8 | lithium nikkel kobaltoxide | Lithium nickel cobaltoxide | MVP 1 | 0,05 mg/Nm3 | 18-1-2023 | 34, 56 | ||||||
| 346417-97-8 | 620-032-4 | lithium nikkel mangaan kobaltoxide | lithium nickel manganese cobalt oxide | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 13977-83-8 | 881-474-3 | lithium nikkel(II) fosfaat | lithium nickel(II) phosphate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 131651-65-5 | 671-827-8 | lithium perfluorbutaansulfonaat | lithium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 14307-35-8 | 238-244-7 | lithiumchromaat | lithium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 52478-50-9 | 630-438-3 | lithiumdichromaat hydraat | lithium dichromate hydrate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 29457-72-5 | 249-644-6 | lithiumheptadecafluoroctaansulfonaat | lithium heptadecafluorooctanesulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||
| 178-915-0 | lithium-mangaan-nikkel-kobaltoxide (NMC85:05:10) | lithium manganese nickel cobalt oxide (NMC85:05:10) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | |||||||
| 12031-65-1 | 620-400-4 | lithiumnikkeldioxide | lithium nickel dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 210352-95-7 | 842-029-9 | lithium-nikkel-kaliumoxide | lithium nickel potassium oxide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 935-842-6 | lithium-nikkel-mangaan-kobalt-oxide | lithium-nickel-manganese-cobalt-oxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 193215-96-2 | 881-347-2 | lithiumnikkel-mangaan-kobaltoxide (LiNi0,4Mn0,4Co0,2O2) | lithium nickel manganese cobalt oxide (LiNi0.4Mn0.4Co0.2O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 179802-95-0 | 878-728-0 | lithiumnikkel-mangaan-kobaltoxide (LiNi0,8Mn0,1Co0,1O2) | lithium nickel manganese cobalt oxide (LiNi0.8Mn0.1Co0.1O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 7439-92-1 | 231-100-4 | lood | lead | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 941-184-0 | lood - goud gravimetrisch concentraat | lead - gold gravimetric concentrate | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 56 | |||||||
| 19183-30-3 | 687-870-0 | lood (IV) propionaat | lead (IV) propionat | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 56 | ||||||
| 20936-32-7 | 244-118-2 | lood 2,4-dihydroxybenzoaat | lead 2,4-dihydroxybenzoate | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | ||||||
| 933-268-0 | lood 4,6-dinitro-2-aminofenolaat | lead 4,6-dinitro-2-aminophenolate | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | |||||||
| 41453-50-3 | 255-375-5 | lood bis(2,4-dihydroxybenzoaat) | lead bis(2,4-dihydroxybenzoate) | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | ||||||
| 301-08-6 | 206-107-0 | lood bis(2-ethylhexanoaat) | lead bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | ||||||
| 62637-99-4 | 263-663-7 | lood bis(4-cyclohexylbutyraat) | lead bis(4-cyclohexylbutyrate) | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | ||||||
| 10101-63-0 | 233-256-9 | lood di-jodide | lead diiodide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 12034-88-7 | 234-814-4 | lood diniobium hexaoxide | lead diniobium hexaoxide | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 56 | ||||||
| 12060-01-4 | 235-039-4 | lood zirkonium trioxide | lead zirconium trioxide | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 2101242-86-6 | 836-029-8 | lood(1-), tri-jood-, waterstof, verbinding met N,N-dimethylformamide en methaanamine (1:1:1:1) | plumbate(1-), triiodo-, hydrogen, compd. with N,N-dimethylformamide and methanamine (1:1:1:1) | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 56 | ||||||
| 13406-89-8 | 236-498-3 | lood(2+) 2,4-dinitroresorcinolaat | lead(2+) 2,4-dinitroresorcinolate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 65121-76-8 | 265-460-9 | lood(2+) 4,6-dinitro-o-cresolaat | lead(2+) 4,6-dinitro-o-cresolate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 13845-35-7 | 237-573-3 | lood(2+) tellurium tetraoxide | lead(2+) tellurium tetraoxide | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 13453-65-1 | 603-832-8 | lood(2+)fosfonaat | lead(2+) phosphonate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 7488-51-9 | 231-300-1 | lood(2+)seleniet | lead(2+) selenite | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 4146-73-0 | 620-612-7 | lood(II) 2,2,2-trifluoracetaat | lead(II) 2,2,2-trifluoroacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56, 95 | |||||
| 100929-97-3 | 631-307-3 | lood(II) 2-hydroxy-2-methylpropionaat | lead(II) 2-hydroxy-2-methylpropionate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 605-758-1 | lood(II) methaansulfonaat | lead(II) methanesulfonate | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 56 | |||||||
| 17570-76-2 | 401-750-5 | lood(II)methaansulfonaat | lead(II) methanesulphonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 79120-33-5 | 634-758-4 | lood(II)oxide rood | lead(II) oxide red | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 207500-00-3 | 682-758-8 | lood(II)perchloraat hydraat | lead(II) perchlorate hydrate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 13453-62-8 | 638-754-3 | lood(II)perchloraat trihydraat | lead(II) perchlorate trihydrate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 69029-51-2 | 273-795-7 | lood, antimoon, slakken | lead, antimonial, dross | Ja | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 56, 91 | |||||
| 97808-88-3 | 308-011-5 | lood, edelmetaal | lead, bullion | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 56 | ||||||
| 84929-97-5 | 284-577-6 | lood, isononanoaat naftenaatcomplexen | lead, isononanoate naphthenate complexes | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 90431-40-6 | 291-563-3 | lood, isononanoaat naftenaatcomplexen, basisch | lead, isononanoate naphthenate complexes, basic | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 69029-52-3 | 273-796-2 | lood, slakken | lead, dross | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 56 | ||||||
| 69029-45-4 | 273-791-5 | lood, slakken, antimoonrijk | lead, dross, antimony-rich | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 56 | ||||||
| 69029-46-5 | 273-792-0 | lood, slakken, bismutrijk | lead, dross, bismuth-rich | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 56 | ||||||
| 69227-11-8 | 273-925-2 | lood, slakken, koperrijk | lead, dross, copper-rich | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 56 | ||||||
| 15347-57-6 | 239-379-4 | loodacetaat | lead acetate | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56, 68 | ||||||
| 1335-32-6 | 215-630-3 | loodacetaat, basisch | lead, bis(acetato-O)tetrahydroxytri- | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14466-01-4 | 238-458-0 | loodacrylaat | lead acrylate | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 14, 56 | ||||||
| loodalkylen | lead alkyls | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 7784-40-9 | 232-064-2 | loodarsenaat | lead hydrogen arsenate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | |||
| loodarsenaten | lead arsenates | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56, 91 | |||||||
| 10031-13-7 | 233-083-9 | loodarseniet | lead arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 19-12-2021 | 56, 91 | |||||
| loodarsenieten | lead arsenites | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | |||||||
| 69985-35-9 | loodazide | lead azide | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 55, 56 | ||||||
| 91053-49-5 | 293-314-4 | loodbevattende uitloogresten van zinkerts | leach residues, zinc ore, lead-contg. | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 56 | ||||||
| 13814-96-5 | 237-486-0 | loodbis(tetrafluorboraat) | lead bis(tetrafluoroborate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 598-63-0 | 209-943-4 | loodcarbonaat | lead carbonate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | ||||||
| 931-722-2 | loodcarbonaat intermediair | lead carbonate intermediate | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | |||||||
| loodcarbonaten | lead carbonates | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | ||||||||
| 12612-47-4 | loodchloride | lead chloride | MVP 1 | 0,05 mg/Nm3 | 9-1-2022 | 14, 56 | |||||||
| 947-517-6 | loodchloride hydroxiden, terugwinningsproducten van de productie van lood- en bismutchemicaliën | lead chloride hydroxides, recovery products from lead and bismuth chemicals manufacturing | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | |||||||
| 7758-97-6 | 231-846-0 | loodchromaat | lead chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 12656-85-8 | 235-759-9 | loodchromaatmolybdaatsulfaat | lead chromate molybdate sulfate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 934-253-1 | loodconcentraat | lead concentrate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | |||||||
| 20837-86-9 | 244-073-9 | loodcyanamidaat | lead cyanamidate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 592-05-2 | 209-742-1 | loodcyanide | lead cyanide | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | ||||||
| 301-04-2 | 206-104-4 | looddiacetaat | lead di(acetate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 13424-46-9 | 236-542-1 | looddiazide | lead diazide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 10031-22-8 | 233-084-4 | looddibromide | lead dibromide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 7758-95-4 | 231-845-5 | looddichloride | lead dichloride | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 7783-46-2 | 231-998-8 | looddifluoride | lead difluoride | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 25659-31-8 | 247-168-3 | looddijodide | lead diiodate | MVP 1 | 0,05 mg/Nm3 | 9-1-2022 | 14, 56 | ||||||
| 15773-55-4 | 239-869-8 | looddilauraat | lead dilaurate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 1309-60-0 | 215-174-5 | looddioxide | lead dioxide | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | ||||||
| 6477-64-1 | 229-335-2 | looddipicraat | lead dipicrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 15748-73-9 | 239-839-4 | looddisalicylaat | lead disalicylate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 1072-35-1 | 214-005-2 | looddistearaat | lead distearate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 12065-68-8 | 235-065-6 | loodditantalum hexaoxide | lead ditantalum hexaoxide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 592-87-0 | 209-774-6 | looddithiocyanaat | lead dithiocyanate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 10099-79-3 | 233-248-5 | looddivanadium hexaoxide | lead divanadium hexaoxide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 934-416-7 | looderst, concentraten | lead ores, concentrates | MVP 1 | 0,05 mg/Nm3 | 28-2-2022 | 14, 56 | |||||||
| 942-155-5 | looderts concentraat | lead ore concentrate | MVP 1 | 0,05 mg/Nm3 | 28-2-2022 | 14, 56 | |||||||
| 15187-16-3 | 628-401-1 | loodftalocyanine | lead phthalocyanine | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 13698-55-0 | 237-220-3 | loodfumeraat | lead fumarate | MVP 1 | 0,05 mg/Nm3 | 9-1-2022 | 14, 56 | ||||||
| 25808-74-6 | 247-278-1 | loodhexafluorsilikaat | lead hexafluorosilicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 19783-14-3 | 243-310-3 | loodhydroxide | lead hydroxide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 943-147-4 | lood-ijzer-titanium-bismut-kaliumoxide | lead-iron-titanium-bismuth-potassium oxide | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | |||||||
| 84195-61-9 | 282-366-3 | loodlegering | speiss, lead | Ja | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56, 91 | |||||
| 69011-60-5 | 273-701-4 | loodlegering, base, Pb,Sn, slakken | lead alloy, base, Pb,Sn, dross | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 56 | ||||||
| 69011-59-2 | 273-700-9 | loodlegering, base, slakken | lead alloy, base, dross | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 10190-55-3 | 233-459-2 | loodmolybdaat | lead molybdate | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 1317-36-8 | 215-267-0 | loodmonoxide | lead monoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 98246-91-4 | 308-765-5 | lood-nikkel legering | speiss, lead, nickel-contg. | Ja | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 34, 56, 91 | |||||
| 10099-74-8 | 233-245-9 | loodnitraat | lead dinitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 1314-41-6 | 215-235-6 | loodoranje | orange lead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 1335-25-7 | 215-626-1 | loodoxide | lead oxide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 12036-76-9 | 234-853-7 | loodoxidesulfaat | lead oxide sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 13637-76-8 | loodperchloraat | lead perchlorate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | |||||||
| 25721-38-4 | 684-862-9 | loodpicraat (droog) | lead picrate (dry) | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 37240-96-3 | 253-421-9 | loodrhodiumoxide | dilead dirhodium heptaoxide | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 12069-00-0 | 235-109-4 | loodselenide | lead selenide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 12412-93-0 | 802-730-2 | loodselenide-telluride (PbSe0.5Te0.5) | lead selenide telluride (PbSe0.5Te0.5) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 126 | ||||||
| 22569-74-0 | 245-090-4 | loodsilicaat | lead silicate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 69029-58-9 | 273-800-2 | loodsmeltovenslakken | slags, lead reverbatory smelting | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 69029-84-1 | 273-825-9 | loodsmeltslakken | slags, lead smelting | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 15245-44-0 | 239-290-0 | loodstyfnaat | lead styphnate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 7446-14-2 | 231-198-9 | loodsulfaat | lead sulphate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 56 | ||||||
| 951-962-1 | loodsulfaat, terugwinningsproduct uit koper- en zinkstof | lead sulphate, recovery product from copper and zinc dusts | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | |||||||
| loodsulfaten | lead sulphates | MVP 1 | 0,05 mg/Nm3 | 31-05-2016 | 14, 56 | ||||||||
| 1314-87-0 | 215-246-6 | loodsulfide | lead sulphide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 1344-37-2 | 215-693-7 | loodsulfochromaat | lead sulfochromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 815-84-9 | 212-426-6 | loodtartraat | lead tartrate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 1314-91-6 | 215-247-1 | loodtelluur | lead telluride | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 546-67-8 | 208-908-0 | loodtetraacetaat | lead tetraacetate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 13478-50-7 | 236-780-6 | loodthiosulfaat | Lead thiosulphate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 12036-31-6 | 234-844-8 | loodtintrioxide | lead tin trioxide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 12060-00-3 | 235-038-9 | loodtitaniumtrioxide | lead titanium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 12626-81-2 | 235-727-4 | loodtitaniumzirconiumoxide | lead titanium zirconium oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 85536-79-4 | 287-565-9 | looduranaatpigment | lead uranate pigment | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| loodverbindingen | lead compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 18 | |||||||
| 15845-52-0 | 239-952-9 | loodwaterstoforthofosfaat | lead hydrogenorthophosphate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 56 | ||||||
| 7759-01-5 | 231-849-7 | loodwolfraamtetraoxide | lead tungsten tetraoxide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 56 | ||||||
| 103055-07-8 | 410-690-9 | lufenuron | lufenuron | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 12005-94-6 | 234-477-3 | lutetium arsenide | lutetium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 507453-86-3 | 671-826-2 | magnesium perfluorbutaansulfonaat | magnesium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 10103-50-1 | 233-285-7 | magnesiumarsenaat | magnesium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 117746-50-6 | magnesiumarsenaat, decahydraat | magnesium arsenate, decahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 13423-61-5 | 236-540-0 | magnesiumchromaat | magnesium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 23371-94-0 | 621-186-5 | magnesiumchromaat hydraat | magnesium chromate hydrate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 14104-85-9 | 237-959-1 | magnesiumdichromaat | magnesium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 8018-01-7 | 616-995-5 | mancozeb | mancozeb | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 80, 142 | |||||
| 13434-24-7 | 236-562-0 | mangaan bis(2-ethylhexanoaat) | manganese bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 27526-45-0 | mangaanarsenaat | manganese arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 12005-95-7 | 234-478-9 | mangaanarsenide | manganese arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 12005-96-8 | mangaanarsenide (Mn2As) | manganese arsenide (Mn2As) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7784-38-5 | 232-063-7 | mangaanwaterstofarsenaat | manganese hydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 84195-51-7 | 282-356-9 | mat, lood | matte, lead | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 126 | ||||||
| 101-90-6 | 202-987-5 | m-bis(2,3-epoxypropoxy)benzeen | m-bis(2,3-epoxypropoxy)benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | |||||
| 86347-14-0 | 811-718-6 | medetomidine | medetomidine | MVP 1 | 0,05 mg/Nm3 | 14-7-2025 | 80, 120 | ||||||
| meerwandige koolstofbuizen (synthetisch grafiet in buisvorm) met een geometrische buisdiameter ≥ 30 nm tot < 3 μm en een lengte ≥ 5 μm en een dimensieverhouding > 3:1, met inbegrip van meerwandige koolstofnanobuizen | multi-walled carbon tubes (synthetic graphite in tubular shape) with a geometric tube diameter range ≥ 30 nm to < 3 μm and a length ≥ 5 μm and aspect ratio > 3:1, including multi-walled carbon nanotubes | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 80 | |||||||
| 1417782-03-6 | 822-682-6 | mefentrifluconazool | mefentrifluconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 108-78-1 | 203-615-4 | melamine | melamine | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 80 | |||||
| 494-79-1 | 207-793-4 | melarsoprol | melarsoprol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 700-161-3 | mengsel van (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)fosfaten, ammoniumzout | reaction mass of mixed (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) phosphates, ammonium salt | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 700-755-2 | mengsel van (3E)-1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluor-5-methoxyhept-3-een en (2E)-1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluor-4-methoxyhept-2-een en (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluor-3-methoxyhept-3-een | reaction mass of (3E)-1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluoro-5-methoxyhept-3-ene and (2E)-1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluoro-4-methoxyhept-2-ene and (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluoro-3-methoxyhept-3-ene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 95, 97 | ||||||
| 701-135-4 | mengsel van 1-(2,3-epoxypropoxy)-2,2-bis((2,3-epoxypropoxy)methyl)butaan en 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy) methyl)-2-hydroxymethylbutaan | reaction mass of 1-(2,3-epoxypropoxy)-2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy)methyl)-2-hydroxymethyl butane | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | ||||||
| 422-270-2 | mengsel van 1,1,2,3,3,3-hexafluor-1-methoxy-2-(trifluormethyl)propaan en 1,1,2,2,3,3,4,4,4-nonafluor-1-methoxybutaan | reaction mass of 1,1,2,3,3,3-hexafluoro-1-methoxy-2-(trifluoromethyl)propane and 1,1,2,2,3,3,4,4,4-nonafluoro-1-methoxybutane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 421-550-1 | mengsel van 1,3,5-tris(3-aminomethylfenyl)-1,3,5-(1H3H5H)-triazine-2,4,6-trion, mengsel van oligomeren van 3,5-bis(3-aminomethylfenyl)-1-poly[3,5-bis(3-aminomethylfenyl)-2,4,6-trioxo-1,3,5-(1H3H5H)-triazin-1-yl]-1,3,5-(1H3H5H)-triazine-2,4,6-trion | reaction mass of 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione, reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 911-694-8 | mengsel van 1,3-dioxaan-5-ol en 1,3-dioxolaan-4-ylmethanol | reaction mass of 1,3-dioxan-5-ol and 1,3-dioxolan-4-ylmethanol | Ja | MVP 2 | 1 mg/Nm3 | 10-1-2025 | 80 | ||||||
| 949-379-2 | mengsel van 1-methylpyrrolidine-2-one en poly(vinylideenfluoride) | reaction mass of 1-methylpyrrolidin-2-one and poly(vinylidene fluoride) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | ||||||
| 473-390-7 | mengsel van 2,2,3,3,5,5,6,6-octafluor-4-(1,1,1,2,3,3,3-heptafluorpropaan-2-yl)morfoline en 2,2,3,3,5,5,6,6-octafluor-4-(heptafluorpropyl)morfoline | reaction mass of 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)morpholine and 2,2,3,3,5,5,6,6-octafluoro-4-(heptafluoropropyl)morpholine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 19-1-2023 | 80, 95 | |||||
| 947-368-7 | mengsel van 4,4'- [2,2,2-trifluor-1-(trifluormethyl) ethylideen]difenol en benzyltrifenylfosfonium, zout met 4,4'-[2,2,2-trifluor- 1-(trifluormethyl)ethylideen] difenol (1:1) | reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl) ethylidene]bis[phenol] (1:1) | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80, 95 | ||||
| 943-265-6 | mengsel van 4,4'-[2,2,2-trifluor-1-(trifluormethyl) ethylideen]difenol en benzyl (diëthylamino)difenylfosfonium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyfenyl)propaan-2-yl] fenolaat (1:1) | reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate (1:1) | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80, 95 | ||||
| 403-250-2 | mengsel van 4-[[bis-(4-fluorfenyl)methylsilyl]methyl]-4H-1,2,4-triazool en 1-[[bis-(4-fluorfenyl)methylsilyl]methyl]-1H-1,2,4-triazool | reaction mass of 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole and 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 700-927-7 | mengsel van 5-[(2R)-butaan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2R)-butaan-2-yl]-2-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2S)-butaan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2S)-butaan-2-yl]-2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2S)-butaan-2-yl]-2-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan | reaction mass of 5-[(2R)-butan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2R)-butan-2-yl]-2-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2S)-butan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2S)-butan-2-yl]-2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2S)-butan-2-yl]-2-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2023 | 56 | ||||||
| 413-720-9 | mengsel van 5-sec-butyl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxaan en 5-sec-butyl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxaan | reaction mass of 5-sec-butyl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane and 5-sec-butyl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 56 | ||||||
| 939-191-9 | mengsel van amines, C10-14-vertakt en lineair alkyl, [1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) en amines, C10-14-vertakt en lineair alkyl, bis[1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) en amines, C10-14-vertakt en lineair alkyl, bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | reaction mass of Amines, C10-14-branched and linear alkyl, [1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) and Amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) and Amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | |||||||
| 701-287-1 | mengsel van bariumchromaat, koperdichroomtetraoxide en koperoxide | reaction mass of barium chromate, copper dichromium tetraoxide and copper oxide | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | |||||||
| 957-225-0 | mengsel van benzeen en isopropylbenzeen | reaction mass of benzene and isopropylbenzene | MVP 2 | 1 mg/Nm3 | 22-9-2023 | 79, 81 | |||||||
| 935-119-5 | mengsel van cadmium sulfide (CdS), vaste oplossing met zinksulfide, gedoteerd met koperchloride en zinksulfide (ZnS), gedoteerd met zilverchloride en yttriumoxidesulfide (Y2O2S), gedoteerd met europium | blend of cadmium sulfide (CdS), solid soln. with zinc sulfide, copper chloride-doped and zinc sulfide (ZnS), silver chloride-doped and yttrium oxide sulfide (Y2O2S), europium-doped | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 56, 85 | |||||||
| mengsel van chloordifluormethaan en chloorpentafluorethaan | mixture of chlorodifluoromethane and chloropentafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 935-120-0 | mengsel van digadolinium-dioxidesulfide en cadmium-zinksulfide | blend of digadolinium dioxide sulphide and cadmium zinc sulphide | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 56, 85 | |||||||
| 909-880-9 | mengsel van di-ijzer trioxide en divanadium pentaoxide en nikkelmonoxide | reaction mass of diiron trioxide and divanadium pentaoxide and nickel monoxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 435-960-3 | mengsel van dimethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat, diethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat, methylethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat | reaction mass of dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate, diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate, methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 402-660-9 | mengsel van dinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatofenyl)pyrazool-4-yl)penta-2,4-dienylideen)-4,5-dihydro-5-oxopyrazool-1-yl)benzeensulfonaat en trinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatofenyl)pyrazool-4-yl)penta-2,4-dienylideen)-4,5-dihydro-5-oxopyrazool-1-yl)benzeensulfonaat | reaction mass of disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate and trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 915-270-3 | mengsel van DOTE en MOTE | reaction mass of 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate and 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-octyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate (reaction mass of DOTE and MOTE) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 90 | ||||||
| mengsel van ethyleenoxide en chloortetrafluorethaan | mixture of ethylene oxide and tetrafluoro chloroethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 28-11-2024 | 81, 103, 104 | ||||||
| mengsel van ethyleenoxide en dichloordifluormethaan | mixture of ethylene oxide and dichlorodifluoromethane | Ja | MVP 2 | 1 mg/Nm3 | 29-11-2024 | 81, 103 | |||||||
| mengsel van ethyleenoxide en kooldioxide | mixture of ethylene oxide and carbondioxide | Ja | MVP 2 | 1 mg/Nm3 | 29-11-2024 | 81, 103 | |||||||
| mengsel van ethyleenoxide en pentafluorethaan | mixture of ethylene oxide and pentafluoro ethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 81, 95, 103 | ||||||
| mengsel van ethyleenoxide en tetrafluorethaan | mixture of ethylene oxide and tetrafluoroethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 28-11-2024 | 81, 95, 103 | ||||||
| 936-862-8 | mengsel van ijzerdichloride en mangaandichloride en natriumchromaat | reaction mass of iron dichloride and manganese dichloride and sodium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | |||||||
| 937-062-1 | mengsel van ijzertrichloride en natriumdichromaat | reaction mass of iron trichloride and sodium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | |||||||
| 948-775-2 | mengsel van karayagom, dinatriumsulfaat, water, boraxdecahydraat, quarternaire ammoniumverbindingen, ethyl(gehydrogeneerde talk), geëthoxyleerd alkyl bis(hydroxyethyl) en sulfaten (zouten) | reaction mass of karaya gum and disodium sulfate and water and borax decahydrated and quaternary ammonium compounds, ethyl(hydrogenated tallow alkyl)bis(hydroxyethyl), ethoxylated, et sulfates (salts) | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 73, 81 | |||||||
| 907-631-9 | mengsel van koolmonoxide en kooldioxide en waterstof | reaction mass of carbon monoxide and carbon dioxide and hydrogen | - | 28-05-2026 | 145, 146 | ||||||||
| 935-757-4 | mengsel van lanthanum carbonaat, cercium carbonaae, neodymium carbonaat en nikkel carbonaat | reaction mass of lanthanum carbonate, cercium carbonate, neodymium carbonate and nickel carbonate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 700-557-6 | mengsel van lithiumcarbonaat en nikkelhydroxide en kobalthydroxide en mangaanhydroxide en zuurstof | reaction product of lithium carbonate and nickel hydroxide and cobalt hydroxide and manganese hydroxide and oxygen | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 936-200-8 | mengsel van lood di(acetaat) en [ftalaat(2-)]oxodilood | reaction mass of lead di(acetate) and [phthalato(2-)]oxodilead | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | |||||||
| 934-478-5 | mengsel van lood, nikkel, thallium, cadmium en koper | reaction mass of lead and nickel and thallium and cadmium and copper | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 34, 56, 85 | |||||||
| 936-005-8 | mengsel van loodcarbonaat en kwarts (SiO2) | reaction mass of lead carbonate and Quartz (SiO2) | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | |||||||
| 412-790-8 | mengsel van N-[3-hydroxy-2-(2-methyl-acryloylamino-methoxy)-propoxymethyl]-2-methyl-acrylamide, N-[2,3-bis-(2-methyl-acryloylamino-methoxy)propoxymethyl]-2-methylacrylamide, methacrylamide, 2-methyl-N-(2-methyl-acryloylamino-methoxy-methyl)-acrylamide en N-(2,3-dihydroxy-propoxymethyl)-2-methyl-acrylamide | reaction mass of N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide, N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide, methacrylamide, 2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide and N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 910-417-8 | mengsel van nikkelmonoxide en siliciumdioxide | reaction mass of nickel monoxide and silicon dioxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 910-663-6 | mengsel van of kobalt sulfide en nikkel sulfide en trinikkel disulfide | reaction mass of cobalt sulphide and nickel sulphide and trinickel disulphide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 957-183-3 | mengsel van tert-butylacetaat en strontium chromaat en 2-heptanon en oxosilanediol en dioxotitanium en m-xyleen en 2-methoxy-1-methylethylacetaat en nafta oplosmiddel (petroleum), licht aromatisch en ethylbenzeen | reaction mass of tert-butyl acetate and strontium chromate and heptan-2-one and oxosilanediol and dioxotitanium and m-xylene and 2-methoxy-1-methylethyl acetate and solvent naphtha (petroleum), light arom. and ethylbenzene | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 79, 81 | |||||||
| 916-865-0 | mengsel van chromaat(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftaleen]acetamide(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]-, waterstof, verbinding met N-cyclohexylcyclohexaanamine (1:1) en waterstof bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalato(2-)]chromaat(1-), verbinding met dicyclohexylamine (1:1) waterstof bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftyl]acetamide(2-)]chromaat(1-), verbinding met dicyclohexylamine (1:1) | reaction mass of Chromate(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthalenyl]acetamidato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-, hydrogen, compd. with N-cyclohexylcyclohexanamine (1:1) and hydrogen bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphtholato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) and hydrogen bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthyl]acetamidato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | |||||||
| 118685-33-9 | 405-665-4 | mengsel van: dinatrium (6-(4-anisidino)-3-sulfonaat-2-(3,5-dinitro-2-oxidofenylazo)-1-naftalaat)(1-(5-chloor-2-oxidofenylazo)-2-naftalaat)chromaat(1-), trinatrium bis(6-(4-anisidine)-3-sulfonaat-2-(3,5-dinitro-2-oxidofenylazo)-1-naftalaat)chromaat(1-) | a mixture of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-), trisodium bis(6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 192268-65-8 | 421-820-9 | mengsel van: trifenylthiofosfaat en tertiar gebutyleerde fenylderivaten | reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 80 | |||||
| 117527-94-3 | 403-720-7 | mengsel van: tert-alkyl(C12-C14)ammonium-bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]-chromaat(1-), tert-alkyl(C12-C14)ammonium-bis[1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)]-chromaat(1-), tert-alkyl(C12-C14)ammonium-bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrofenyl]azo]-2-naftalenolato(2-)]-chromaat(1-), tert-alkyl(C12-C14)ammonium-[[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]-[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]]-chromaat(1-), tert-alkyl(C12-C14)ammonium-[[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrofenyl]azo]-2-naftalenolato(2-)]-[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]]-chromaat(1-), C12-14-tert-alkylammonium((1-(4(of 5)-nitro-2-oxidofenylazo)-2-naftolato)(1-(3-nitro-2-oxido-5-pentylfenylazo)-2-naftolato))chromaat(1-) | a mixture of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-), tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-), tert-alkyl(C12-C14)ammonium bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-chromate(1-), tert-alkyl(C12-C14)ammonium [[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-), tert-alkyl(C12-C14)ammonium [[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-), tert-alkyl(C12-C14)ammonium ((1-(4(or 5)-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-pentylphenylazo)-2-naphtholato))chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 110235-47-7 | 600-951-7 | mepanipyrim | mepanipyrim | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 116 | ||||||
| messingstaaf (met lood) | brass ingot (with Lead) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 56 | ||||||||
| 10102-53-1 | meta-arseenzuur | arsenenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 139968-49-3 | 604-167-6 | metaflumizon | metaflumizone | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 625-45-6 | 210-894-6 | methoxyazijnzuur | methoxyacetic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 72-43-5 | 200-779-9 | methoxychloor | methoxychlor | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1239414-43-7 | methyl (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluorhept-3-een-3-yl ether | methyl (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluorohept-3-en-3-yl ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| 15546-11-9 | 239-594-3 | methyl (Z,Z)-8,8-dibutyl-3,6,10-trioxo-2,7,9-trioxa-8-stannatrideca-4,11-dieen-13-oaat | methyl (Z,Z)-8,8-dibutyl-3,6,10-trioxo-2,7,9-trioxa-8-stannatrideca-4,11-dien-13-oate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 900-77-6 | 212-983-5 | methyl 1,2,5,6-tetrahydro-1-methylnicotinaat, mono[(3-acetamido-4-hydroxyfenyl)arsonaat] | methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 80925-03-7 | 279-628-4 | methyl 17α-hydroxyyohimban-16α-carboxylaat, methylarsonaat (1:1) | methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 956136-97-3 | 808-237-9 | methyl 2-((1r,4r)-4-(4-(5-((6-(trifluormethyl)pyridin-3-yl)amino)pyridin-2-yl)fenyl)cyclohexyl)acetaat | methyl 2-((1r,4r)-4-(4-(5-((6-(trifluoromethyl)pyridin-3-yl)amino)pyridin-2-yl)phenyl)cyclohexyl)acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | |||||
| 56554-52-0 | 670-445-9 | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluordodecanoaat | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 953-348-9 | methyl(4s)-4-(2-broom-4-cyanofenyl)-2-{[(ethoxycarbonyl)amino]amino}-6-methyl-1-[3-(trifluormethyl)fenyl]-1,4-dihydropyrimidine-5-carboxylaat | methyl(4s)‐4‐(2‐bromo‐4‐cyanophenyl)‐2‐{[(ethoxycarbonyl)amino]amino}‐6‐methyl‐1‐[3‐(trifluoromethyl)phenyl]‐1,4‐dihydropyrimidine‐5‐carboxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | ||||||
| 819-35-2 | 982-540-5 | methyl(nitroso)(2,2,2-trifluorethyl)amine | methyl(nitroso)(2,2,2-trifluoroethyl)amine | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 56296-78-7 | 260-101-2 | methyl[3-fenyl-3-[4-(trifluormethyl)fenoxy]propyl]ammoniumchloride | methyl[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]ammonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 77402-05-2 | 403-230-3 | methylacrylamidoglycolaat [met 0,1 procent of meer acrylamide] | methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 77402-03-0 | 401-890-7 | methylacrylamidomethoxyacetaat [met 0,1 procent of meer acrylamide] | methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 124-58-3 | 204-705-6 | methylarsonzuur | methylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 19438-60-9 | 243-072-0 | methylcyclohexyl-1,6-dicarbonzuur-anhydride | hexahydro-4-methylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 945-48-2 | 213-414-3 | methyldifenylarsine | methyldiphenylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 21892-63-7 | 244-639-5 | methyleenbis(difenylarsine) | methylenebis(diphenylarsine) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| methylfenyleendiamine | methyl-phenylene diamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 25550-51-0 | 247-094-1 | methylhexahydroftaalzuur anhydride | hexahydromethylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 60-34-4 | 200-471-4 | methylhydrazine | methylhydrazine | Ja | MVP 2 | 1 mg/Nm3 | 30-05-2017 | ||||||
| 22967-92-6 | methylkwik | methylmercury | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 56 | |||||
| 163702-07-6 | 605-339-3 | methylnonafluorbutylether | methyl perfluorobutyl ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 163702-08-7 | 605-340-9 | methylnonafluorisobutylether | methyl perfluoroisobutyl ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 592-62-1 | 209-765-7 | methyl-ONN-azoxymethylacetaat | methyl-ONN-azoxymethyl acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 593-58-8 | 209-799-2 | methyloxoarsine | methyloxoarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 376-27-2 | 206-808-1 | methylperfluoroctanoaat | methyl perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1499-33-8 | 216-108-8 | methyltrifenylarsoniumjodide | methyltriphenylarsonium iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 9006-42-2 | 618-430-8 | metiram | metiram | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 117 | ||||||
| 21087-64-9 | 244-209-7 | metribuzin | metribuzin | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 80, 118 | ||||||
| 90-94-8 | 202-027-5 | Michler's keton | Michler's ketone | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 15843-02-4 | 239-946-6 | mierenzuur nikkelzout | formic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68134-59-8 | 268-755-0 | mierenzuur, kopernikkelzout | formic acid, copper nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1314-04-1 | milleriet | millerite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 74869-21-9 | 278-011-7 | mineraal vet | lubricating greases | Ja | 2-12-2013 | 4, 63 | |||||||
| 2385-85-5 | 219-196-6 | mirex | mirex | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68130-36-9 | 268-585-7 | molybdeennikkelhydroxideoxidefosfaat | molybdenum nickel hydroxide oxide phosphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12673-58-4 | molybdeennikkeloxide | molybdenum nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 14177-55-0 | 238-034-5 | molybdeennikkeltetraoxide | molybdenum nickel tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| mono-, di- of tri-O-(alkyl)-derivaten van (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaantriol | any of the mono-, di- or tri-O- (alkyl) derivatives of (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) silanetriol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 95, 97, 99 | |||||||
| 99688-47-8 | 402-210-1 | monomethyldibroomdifenylmethaan | monomethyl-dibromo-diphenyl methane bromobenzylbromotoluene, mixture of isomers | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 46 | ||||||
| monomethyldichloordifenylmethaan | monomethyl-dichloro-diphenyl methane | MVP 1 | 0,05 mg/Nm3 | 30-5-2017 | 46 | ||||||||
| 76253-60-6 | 278-404-3 | monomethyltetrachloordifenylmethaan | monomethyl-tetrachlorodiphenyl methane. Trade name: Ugilec 141 | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 46 | ||||||
| 12139-21-8 | monteponiet | monteponite | Ja | MVP 1 | 0,05 mg/Nm3 | 26-1-2024 | 56 | ||||||
| 503155-89-3 | 671-830-4 | morfolinium perfluorbutaansulfonaat | morpholinium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 81-15-2 | 201-329-4 | musk xyleen | musk xylene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 24280-93-1 | 246-119-3 | mycofenolinezuur | mycophenolic acid | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 72 | ||||||
| 793-24-8 | 212-344-0 | N-(1,3-dimethylbutyl)-N'-fenyl-1,4-benzeendiamine | N-1,3-dimethylbutyl-N'-phenyl-p-phenylenediamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 202914-84-9 | 692-734-9 | N-(2,2,2-trifluorethyl)-9-[4-[4-[[[4'-(trifluormethyl)[1,1'-bifenyl]2-yl]carbonyl]amino]-1-piperidinyl]butyl]-9H-fluoreen-9-carboxamde | N-(2,2,2-trifluoroethyl)-9-[4-[4-[[[4'-(trifluoromethyl)[1,1'-biphenyl]2-yl]carbonyl]amino]-1-piperidinyl]butyl]9H-fluoren-9-carboxamde | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 618070-26-1 | 123-833-2 | n-(2-aminocyclohexyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-octaanamide | n-(2-aminocyclohexyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | |||||
| 874819-71-3 | 477-690-9 | N-(2-nitrofenyl) fosforzuurtriamide | N-(2-nitrophenyl)phosphoric triamide | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | |||||
| 85938-56-3 | 288-891-4 | N-(3-aminopropyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaanamide | N-(3-aminopropyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 852527-48-1 | 632-942-9 | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)jodoacetamide | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)iodoacetamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 852527-40-3 | 632-939-2 | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyl)maleimide | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)maleimide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 21840-08-4 | 244-612-8 | N-(p-arsenosofenyl)-1,3,5-triazine-2,4,6-triamine | N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 54143-56-5 | 258-997-5 | N-(piperidine-2-ylmethyl)-2,5-bis(2,2,2-trifluorethoxy)benzamide monoazijnzuur | N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide monoacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 27366-72-9 | 435-470-1 | N,N-(dimethylamino)thioaceetamide hydrochloride | N,N-(dimethylamino)thioacetamide hydrochloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 603-48-5 | 210-043-9 | n,n,n',n',n'',n''-hexamethyl-4,4',4''-methylidynetrianiline | N,N,N',N',N'',N''-hexamethyl-4,4',4''-methylidynetrianiline | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 55, 56 | |||||
| 101-61-1 | 202-959-2 | N,N,N',N'-tetramethyl-4,4'-methyleendianiline | N,N,N',N'-tetramethyl-4,4'-methylenedianiline | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 108427-54-9 | N,N,N-tributyl-1-butylamine, zout met tridecafluorhexaansulfonzuur | 1-butanaminium, N,N,N-tributyl-, salt with1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 108427-55-0 | N,N,N-triethyl-ethylamine, zout met tridecafluorhexaansulfonzuur (1:1) | ethanaminium, N,N,N-triethyl-, salt with1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 189274-31-5 | N,N,N-trimethyl-methylamine, zout met tridecafluorhexaansulfonzuur (1:1) | methanaminium, N,N,N-trimethyl-, salt with1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 110-26-9 | 203-750-9 | N,N’-methyleendiacrylamide | N,N'-methylenebisacrylamide | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 80 | |||||
| 5625-90-1 | 227-062-3 | N,N′-methyleendimorfoline | N,N′-methylenedimorpholine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 65 | |||||
| 14167-20-5 | 624-036-7 | N,N'-bis(salicylideen)ethyleendiaminonikkel(II) | N,N'-bis(salicylidene)ethylenediaminonickel(II) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 119-325-5 | N,N'-bis[3-tert-butyl-5-(heptadecafluoroctyl)salicylideen]-trans-1,2-cyclohexandiamino-kobalt(II) | N,N'-bis[3-tert-butyl-5-(heptadecafluorooctyl)salicylidene)-trans-1,2-cyclohexanediamino-cobalt(II). | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | ||||||
| 613-35-4 | 210-338-2 | N,N'-diacetylbenzidine | N,N'-diacetylbenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 443-330-4 | N,N-dibutyl-N-methylbutaan-1-aminium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyfenyl)propaan-2-yl]fenolaat | N,N-dibutyl-N-methylbutan-1-aminium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 83 | ||||||
| 3028445-99-7 | 196-575-1 | n,n-dimethyl-6-(tributylstannyl)pyridine-3-carboxamide | n,n-dimethyl-6-(tributylstannyl)pyridine-3-carboxamide | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 15, 56 | ||||||
| 127-19-5 | 204-826-4 | N,N-dimethylaceetamide | N,N-dimethylacetamide | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||
| 68-12-2 | 200-679-5 | N,N-dimethylformamide | N,N-dimethylformamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 57-14-7 | 200-316-0 | N,N-dimethylhydrazine | N,N-dimethylhydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 99-97-8 | 202-805-4 | N,N-dimethyl-p-toluïdine | N,N-dimethyl-p-toluidine | Ja | MVP 2 | 1 mg/Nm3 | 25-1-2024 | 80 | |||||
| 32588-76-4 | 251-118-6 | N,N'-ethyleenbis(3,4,5,6-tetrabroomftalimide) | N,N'-ethylenebis(3,4,5,6-tetrabromophthalimide) | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 56, 139 | |||||
| 956-988-7 | N-[1-(3-fluorpropyl)-3-azetidinyl]-6-[(6R,8S)-8-methyl-7-(2,2,2-trifluorethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinoline-6-yl]-3-pyridinamine | N-[1-(3-fluoropropyl)-3-azetidinyl]-6-[(6R,8S)-8-methyl-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinamine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | ||||||
| 956-989-2 | N-[1-(3-fluorpropyl)-3-azetidinyl]-6-[(6S,8S)-8-methyl-7-(2,2,2-trifluorethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinoline-6-yl]-3-pyridinamine | N-[1-(3-fluoropropyl)-3-azetidinyl]-6-[(6S,8S)-8-methyl-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinamine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | ||||||
| 41358-63-8 | 255-327-3 | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaanamide | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 556050-49-8 | 622-942-7 | N-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzyloxycarbonyloxy]succinimide | N-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) benzyloxycarbonyloxy]succinimide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 1310480-24-0 | N-[4-[[4-(diethylamino)fenyl][4-(ethylamino)-1-naftalenyl]methyleen]-2,5-cyclohexadieen-1-ylideen]-N-ethyl-ethylamine, tridecafluorhexaansulfonaat (1:1) | ethanaminium, N-[4-[[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 1310480-27-3 | N-[4-[[4-(dimethylamino)fenyl][4-(ethylamino)-1-naftalenyl]methyleen]-2,5-cyclohexadieen-1-ylideen]-N-methyl-methylamine, tridecafluorhexaansulfonaat (1:1) | methanaminium, N-[4-[[4-(dimethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 1310480-28-4 | N-[4-[[4-(dimethylamino)fenyl][4-(fenylamino)-1-naftalenyl]methyleen]-2,5-cyclohexadieen-1-ylideen]-N-methyl-methylamine, tridecafluorhexaansulfonaat (1:1) | methanaminium, N-[4-[[4-(dimethylamino)phenyl][4-(phenylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 56, 95 | |||||
| 939-450-6 | n-[4-broom-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)sulfonyl]-2-hydroxy-2-methylpropaanamide | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | ||||||
| 131549-75-2 | 875-967-2 | n'-[4-chloor-2-(trifluormethyl)fenyl]-2-propoxyethanimidamide | n'-[4-chloro-2-(trifluoromethyl)phenyl]-2-propoxyethanimidamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 90357-51-0 | 618-536-4 | N-[4-cyaan-3-(trifluormethyl)fenyl]-2-methyloxiraan-2-carboxamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyloxirane-2-carboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 113299-40-4 | 692-949-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-(4-fluorfenyl)sulfonyl-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1159977-36-2 | 680-871-7 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(2-fluorfenyl)sulfonyl]-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(2-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 1166228-30-3 | 672-578-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(3-fluorfenyl)sulfonyl]-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(3-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 90357-06-5 | 618-534-3 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)sulfonyl]-2-hydroxy-2-methylpropaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 906008-94-4 | 680-656-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)sulfonyl]-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 90356-78-8 | 618-533-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)thio]-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)thio]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 84245-12-5 | 424-550-1 | N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]aceetamide | N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6596-96-9 | 694-740-7 | N-[bis(dimethylamino)arsanyl]-N-methylmethanamine | N-[bis(dimethylamino)arsanyl]-N-methylmethanamine | Ja | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 56, 91 | |||||
| 37793-53-6 | 624-434-0 | N-10-(trifluoracetyl)pteroïnezuur | N-10-(trifluoroacetyl)pteroic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 439588-75-7 | 639-444-0 | N2-[(1S)-1-carboxy-3-fenylpropyl]-N6-(trifluoracetyl)-L-lysyl-L-proline | N2-[(1S)-1-carboxy-3-phenylpropyl]-N6-(trifluoroacetyl)-L-lysyl-L-proline | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 8030-30-6 | 232-443-2 | nafta | naphtha | Ja | 2-12-2013 | 4, 64 | |||||||
| 68603-08-7 | 271-635-0 | nafta (aardolie), aromaathoudend | naphtha (petroleum), arom.-contg. | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-49-3 | 295-430-0 | nafta (aardolie), C4-12-butaanalkylaat, rijk aan isooctaan | naphtha (petroleum), C4-12, butane-alkylate, isooctane-rich | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-23-0 | 265-123-6 | nafta (aardolie), chemisch geneutraliseerde lichte | naphtha (petroleum), chemically neutralized light | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-22-9 | 265-122-0 | nafta (aardolie), chemisch geneutraliseerde zware | naphtha (petroleum), chemically neutralized heavy | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-70-4 | 265-073-5 | nafta (aardolie), isomerisatie- | naphtha (petroleum), isomerization | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-58-4 | 295-440-5 | nafta (aardolie), isomerisatie-, C6-fractie | naphtha (petroleum), isomerization, C6-fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 68783-09-5 | 272-185-8 | nafta (aardolie), katalytisch gekraakte lichte destillaten | naphtha (petroleum), catalytic cracked light distd. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68955-35-1 | 273-271-8 | nafta (aardolie), katalytisch gereformde | naphtha (petroleum), catalytic reformed | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 85116-59-2 | 285-510-3 | nafta (aardolie), katalytisch gereformde lichte, aromaatvrije fractie | naphtha (petroleum), catalytic reformed light, arom.-free fraction | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-66-1 | 265-170-2 | nafta (aardolie), katalytisch van was ontdaan | naphtha (petroleum), catalytic dewaxed | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-66-8 | 265-068-8 | nafta (aardolie), licht, gealkyleerd | naphtha (petroleum), light alkylate | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-46-4 | 265-046-8 | nafta (aardolie), lichte direct uit fractionering verkregen | naphtha (petroleum), light straight-run | Ja | 2-12-2013 | 4, 64 | |||||||
| 92201-97-3 | 296-028-8 | nafta (aardolie), lichte hitteverzadigde, stoomgekraakt | naphtha (petroleum), light heat-soaked, steam-cracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-55-5 | 265-056-2 | nafta (aardolie), lichte katalytisch gekraakte | naphtha (petroleum), light catalytic cracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-59-5 | 295-441-0 | nafta (aardolie), lichte katalytisch gekraakte, stankvrij gemaakt | naphtha (petroleum), light catalytic cracked sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-63-5 | 265-065-1 | nafta (aardolie), lichte katalytisch gereformde | naphtha (petroleum), light catalytic reformed | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 68513-03-1 | 270-993-5 | nafta (aardolie), lichte katalytisch gereformde, vrij van aromaten | naphtha (petroleum), light catalytic reformed, arom.-free | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-83-2 | 265-187-5 | nafta (aardolie), lichte stoomgekraakte | naphtha (petroleum), light steam-cracked | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 68527-23-1 | 271-264-4 | nafta (aardolie), lichte stoomgekraakte aromatische | naphtha (petroleum), light steam-cracked arom. | Ja | 2-12-2013 | 4, 64 | |||||||
| 98219-47-7 | 308-714-7 | nafta (aardolie), lichte stoomgekraakte, thermisch behandeld | naphtha (petroleum), light steam-cracked, thermally treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68527-26-4 | 271-266-5 | nafta (aardolie), lichte stoomgekraakte, van benzeen ontdaan | naphtha (petroleum), light steam-cracked, debenzenized | Ja | 2-12-2013 | 4, 64 | |||||||
| 98219-46-6 | 308-713-1 | nafta (aardolie), lichte stoomgekraakte, van benzeen ontdaan thermisch behandeld | naphtha (petroleum), light steam-cracked, debenzenized, thermally treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-74-8 | 265-075-6 | nafta (aardolie), lichte thermisch gekraakte | naphtha (petroleum), light thermal cracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-65-3 | 295-447-3 | nafta (aardolie), lichte thermisch gekraakte, stankvrij gemaakt | naphtha (petroleum), light thermal cracked, sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-69-1 | 265-071-4 | nafta (aardolie), lichte waterstofgekraakte | naphtha (petroleum), light hydrocracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-60-8 | 295-442-6 | nafta (aardolie), lichte, rijk aan C5, stankvrij gemaakt | naphtha (petroleum), light, C5-rich, sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 68783-66-4 | 272-206-0 | nafta (aardolie), lichte, stankvrij gemaakt | naphtha (petroleum), light, sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 101795-01-1 | 309-976-5 | nafta (aardolie), lichte, stankvrij gemaakt | naphtha (petroleum), sweetened light | Ja | 2-12-2013 | 4, 64 | |||||||
| 68527-22-0 | 271-263-9 | nafta (aardolie), met klei behandelde lichte direct door fractionering verkregen | naphtha (petroleum), clay-treated light straight-run | Ja | 2-12-2013 | 4, 64 | |||||||
| 68527-21-9 | 271-262-3 | nafta (aardolie), met klei behandelde totaalfractie direct door fractionering verkregen | naphtha (petroleum), clay-treated full-range straight-run | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-57-3 | 295-438-4 | nafta (aardolie), met stoom gekraakte lichte fractie, waterstofbehandeld | naphtha (petroleum), hydrotreated light steam-cracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-51-7 | 295-432-1 | nafta (aardolie), met stoom gekraakte zware fractie, gehydrogeneerd | naphtha (petroleum), heavy steam-cracked, hydrogenated | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-15-0 | 265-115-2 | nafta (aardolie), met zuur behandeld | naphtha (petroleum), acid-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68783-12-0 | 272-186-3 | nafta (aardolie), niet stankvrij gemaakt | naphtha (petroleum), unsweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-84-0 | 265-086-6 | nafta (aardolie), oplosmiddelgeraffineerde lichte | naphtha (petroleum), solvent-refined light | Ja | 2-12-2013 | 4, 64 | |||||||
| 97488-96-5 | 307-035-3 | nafta (aardolie), solvent-geraffineerd met waterstof ontzwaveld zwaar | naphtha (petroleum), solvent-refined hydrodesulfurized heavy | Ja | 2-12-2013 | 4, 63 | |||||||
| 64741-87-3 | 265-089-2 | nafta (aardolie), stankvrij gemaakt | naphtha (petroleum), sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 68516-20-1 | 271-138-9 | nafta (aardolie), stoomgekraakte aromatische middenfracties | naphtha (petroleum), steam-cracked middle arom. | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-42-0 | 265-042-6 | nafta (aardolie), totaalfractie direct uit fractionering verkregen | naphtha (petroleum), full-range straight-run | Ja | 2-12-2013 | 4, 64 | |||||||
| 68527-27-5 | 271-267-0 | nafta (aardolie), totaalfractie gealkyleerd butaan bevattend | naphtha (petroleum), full-range alkylate, butane-contg. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68919-37-9 | 272-895-8 | nafta (aardolie), totaalfractie gereformde | naphtha (petroleum), full-range reformed | Ja | 2-12-2013 | 4, 64 | |||||||
| 68513-02-0 | 270-991-4 | nafta (aardolie), totaalfractie verkookser | naphtha (petroleum), full-range coker | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-64-6 | 265-066-7 | nafta (aardolie), totaalfractie, gealkyleerd | naphtha (petroleum), full-range alkylate | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-49-0 | 265-151-9 | nafta (aardolie), waterstofbehandelde lichte | naphtha (petroleum), hydrotreated light | Ja | 2-12-2013 | 4, 64 | |||||||
| 85116-61-6 | 285-512-4 | nafta (aardolie), waterstofbehandelde lichte fractie, cycloalkaan bevattend | naphtha (petroleum), hydrotreated light, cycloalkane-contg. | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-48-9 | 265-150-3 | nafta (aardolie), waterstofbehandelde zware | naphtha (petroleum), hydrotreated heavy | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 92045-52-8 | 295-433-7 | nafta (aardolie), waterstofontzwaveld totaalfractie | naphtha (petroleum), hydrodesulfurized full-range | Ja | 2-12-2013 | 4, 64 | |||||||
| 101316-76-1 | 309-879-8 | nafta (aardolie), waterstofontzwaveld totaalfractie uit verkookser | naphtha (petroleum), hydrodesulfurised full-range coker | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-73-0 | 265-178-6 | nafta (aardolie), waterstofontzwavelde lichte | naphtha (petroleum), hydrodesulfurized light | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-53-9 | 295-434-2 | nafta (aardolie), waterstofontzwavelde lichte, gedearomatiseerd | naphtha (petroleum), hydrodesulfurized light, dearomatized | Ja | 2-12-2013 | 4, 64 | |||||||
| 85116-60-5 | 285-511-9 | nafta (aardolie), waterstofontzwavelde thermisch gekraakte lichte fractie | naphtha (petroleum), hydrodesulfurized thermal cracked light | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-82-1 | 265-185-4 | nafta (aardolie), waterstofontzwavelde zware | naphtha (petroleum), hydrodesulfurized heavy | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-65-7 | 265-067-2 | nafta (aardolie), zwaar, gealkyleerd | naphtha (petroleum), heavy alkylate | Ja | 2-12-2013 | 4, 64 | |||||||
| 101631-20-3 | 309-945-6 | nafta (aardolie), zware direct door fractionering verkregen aromaathoudend | naphtha (petroleum), heavy straight run, arom.-contg. | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-41-9 | 265-041-0 | nafta (aardolie), zware direct uit fractionering verkregen | naphtha (petroleum), heavy straight-run | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-54-4 | 265-055-7 | nafta (aardolie), zware katalytisch gekraakte | naphtha (petroleum), heavy catalytic cracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-50-6 | 295-431-6 | nafta (aardolie), zware katalytisch gekraakte, stankvrij gemaakt | naphtha (petroleum), heavy catalytic cracked, sweetened | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-68-0 | 265-070-9 | nafta (aardolie), zware katalytisch gereformde | naphtha (petroleum), heavy catalytic reformed | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-83-9 | 265-085-0 | nafta (aardolie), zware thermisch gekraakte | naphtha (petroleum), heavy thermal cracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-78-2 | 265-079-8 | nafta (aardolie), zware waterstofgekraakte | naphtha (petroleum), heavy hydrocracked | Ja | 2-12-2013 | 4, 64 | |||||||
| 90641-12-6 | 292-636-2 | nafta (kool), destillatieresiduen | naphtha (coal), distn. residues | Ja | 2-12-2013 | 4, 60 | |||||||
| 94114-54-2 | 302-690-1 | nafta (kool), oplosmiddelextractie, waterstofgekraakt | naphtha (coal), solvent extn., hydrocracked | Ja | 2-12-2013 | 4, 60 | |||||||
| 93165-55-0 | 296-942-7 | nafta (petroleum), licht stoomgekraakt, gehydrogeneerd | naphtha (petroleum), light steam-cracked, hydrogenated | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 64741-92-0 | 265-095-5 | nafta (petroleum), oplosmiddelgeraffineerde zware | naphtha (petroleum), solvent-refined heavy | Ja | 2-12-2013 | 4, 64 | |||||||
| 91-20-3 | 202-049-5 | naftaleen | naphthalene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 54806-25-6 | 803-986-8 | naftaleen-1-ylbis(trifenylfosforanyl)nikkel(IV) chloride | naphthalen-1-ylbis(triphenylphosphoranyl)nickel(IV) chloride | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 64742-75-2 | 265-179-1 | nafteenhoudende oliën (aardolie), complexe van was ontdane zware | naphthenic oils (petroleum), complex dewaxed heavy | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-69-4 | 265-173-9 | nafteenhoudende oliën (aardolie), katalytisch van was ontdane lichte | naphthenic oils (petroleum), catalytic dewaxed light | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-68-3 | 265-172-3 | nafteenhoudende oliën (aardolie), katalytisch van was ontdane zware | naphthenic oils (petroleum), catalytic dewaxed heavy | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-76-3 | 265-180-7 | nafteenoliën (aardolie), complexe van was ontdane lichte | naphthenic oils (petroleum), complex dewaxed light | Ja | 2-12-2013 | 4, 61 | |||||||
| 61790-14-5 | 263-109-4 | nafteenzuren, loodzouten | naphthenic acids, lead salts | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 61788-71-4 | 263-000-1 | nafteenzuren, nikkelzouten | naphthenic acids, nickel salts | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 420-87-1 | 206-998-6 | natrium 2,2,2-trifluorethanolaat | sodium 2,2,2-trifluoroethanolate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 52556-42-0 | 258-004-5 | natrium 3-(allyloxy)-2-hydroxypropaansulfonaat | sodium 3-(allyloxy)-2-hydroxypropanesulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 80 | |||||
| 7681-83-6 | 231-680-9 | natrium 4-(glycolloylamino)fenylarsonaat | sodium 4-(glycolloylamino)phenylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 57206-83-4 | 260-617-8 | natrium bis[1-[[2-hydroxy-3-nitro-5-tert-pentylfenyl]azo]-2-naftolato(2-)]chromaat(1-) | sodium bis[1-[[2-hydroxy-3-nitro-5-tert-pentylphenyl]azo]-2-naphtholato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 6131-99-3 | 682-793-9 | natrium cacodylaat trihydraat | sodium cacodylate trihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7789-12-0 | 616-541-6 | natrium dichromaat dihydraat | sodium dichromate dihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11110-52-4 | 680-624-3 | natrium kwik amalgaam | sodium mercury amalgam | MVP 1 | 0,05 mg/Nm3 | 23-2-2022 | 42, 56 | ||||||
| 7775-19-1 | 231-891-6 | natrium metaboraat, anhydraat | sodium metaborate, anhydrous | MVP 1 | 0,05 mg/Nm3 | 15-9-2022 | 78, 80 | ||||||
| 1772-02-7 | 217-197-6 | natrium p-[[4-[3-(2-arsono-4-nitrofenyl)triazen-1-yl]fenyl]azo]benzeensulfonaat | sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 6634-88-4 | 229-632-7 | natrium p-arsonobenzeensulfonaat | sodium p-arsonobenzenesulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 335-95-5 | 206-404-5 | natrium pentadecafluoroctanoaat | sodium pentadecafluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 3830-45-3 | natrium perfluordecaanzuur | sodium perfluorodecanoate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | 95 | ||||
| 20109-59-5 | 243-518-4 | natrium perfluorheptanoaat | sodium perfluoroheptanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 56, 95 | ||||
| 2923-18-4 | 220-879-6 | natrium trifluorazijnzuur | sodium trifluoroacetate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 2923-26-4 | 220-881-7 | natrium undecafluorhexanoaat | sodium undecafluorohexanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 3016286-99-7 | 987-901-0 | natrium, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluorundecaan-1-sulfonzuur | sodium, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecane-1-sulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 55588-51-7 | 259-714-8 | natriumacetarsol | acetarsol sodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 127-85-5 | 204-869-9 | natriumarsanilaat | sodium arsanilate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7631-89-2 | 231-547-5 | natriumarsenaat | sodium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 10048-95-0 | 677-900-0 | natriumarsenaat dibasisch heptahydraat | sodium arsenate dibasic heptahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 13510-46-8 | natriumarsenaat dodecahydraat | sodium arsenate dodecahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 15120-17-9 | 239-171-3 | natriumarseniet | sodium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 16940-66-2 | 241-004-4 | natriumboorhydride | sodium borohydride | MVP 1 | 0,05 mg/Nm3 | 17-5-2021 | 78, 80 | ||||||
| 7775-11-3 | 231-889-5 | natriumchromaat | sodium chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 10588-01-9 | 234-190-3 | natriumdichromaat | sodium dichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 938-917-1 | natriumdichromaat oplossing | sodium dichromate solution | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | |||||||
| 7784-46-5 | 232-070-5 | natriumdioxoarseniet | sodium dioxoarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 20-12-2021 | 56, 91 | |||||
| 124-65-2 | 204-708-2 | natriumkakodylaat | sodium cacodylate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | |||||
| 2163-80-6 | 218-495-9 | natriummethylarsonaat | sodium methylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 70161-44-3 | 274-357-8 | natrium-N-(hydroxymethyl)glycinaat | sodium N-(hydroxymethyl)glycinate | Ja | MVP 2 | 1 mg/Nm3 | 11-9-2020 | 80 | |||||
| 60189-99-3 | natriumoxidearseenzuur | sodium oxidoarsonous acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 131-52-2 | 205-025-2 | natriumpentachloorfenolaat | sodium pentachlorophenate | MVP 1 | 0,05 mg/Nm3 | 16-7-2019 | 56, 68 | ||||||
| 15120-21-5 | 239-172-9 | natriumperboraat | sodium perborate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| natriumperoxoboraat | sodium peroxoborate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 56 | |||||||
| natriumperoxoboraat, hexahydraat | sodium peroxoborate, hexahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 56 | |||||||
| 7632-04-4 | 231-556-4 | natriumperoxometaboraat | sodium peroxometaborate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 585-54-6 | 209-558-1 | natriumwaterstof [4-(acetamido)fenyl]arsonaat | sodium hydrogen [4-(acetamido)phenyl]arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 5892-48-8 | 227-573-1 | natriumwaterstof(3-acetamido-4-hydroxyfenyl)arsonaat | sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 140-45-4 | 205-415-2 | natriumwaterstof-[4-[(hydroxyacetyl)amino]fenyl]arsonaat | sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 94278-22-5 | 304-710-4 | natriumwaterstofallylarsonaat | sodium hydrogen allylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 21049-39-8 | natriumzouten van perfluornonaanzuur | sodium salts of perfluorononan-1-oic-acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-2-2016 | 95 | ||||
| 11113-50-1 | 234-343-4 | natuurlijk ruw boorzuur met een gehalte aan H3BO3 van niet meer dan 85 gewichtsprocenten berekend op de droge stof | boric acid, crude natural, containing not more than 85 per cent of H3BO3 calculated on the dry weight | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 37696-83-6 | 119-340-7 | N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaanamide | N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 1118-46-3 | 214-263-6 | n-butyltin trichloride | n-butyltin trichloride | 6-9-2022 | 15 | ||||||||
| 570429-20-8 | 121-039-0 | n-cyclopropyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluornonaanamide | n-cyclopropyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 123, 124 | |||||
| 457-60-3 | 207-273-7 | neoarfenamine | neoarsphenamine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 51818-56-5 | 257-447-1 | neodecaanzuur, nikkelzout | neodecanoic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12255-09-3 | 235-504-1 | neodymiumarsenide | neodymium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 2687-91-4 | 220-250-6 | N-ethyl-2-pyrrolidon | N-ethyl-2-pyrrolidone | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 1691-99-2 | 216-887-4 | n-ethylheptadecafluor-n-(2-hydroxyethyl)octaansulfonamide | N-ethylheptadecafluoro-N-(2-hydroxyethyl)octanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 56, 95 | ||||
| 4151-50-2 | 223-980-3 | N-ethylperfluoroctaan-sulfonamide | N-ethylheptadecafluorooctanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 56, 95 | ||||
| 2991-50-6 | 221-061-1 | N-ethylperfluoroctaan-sulfonamidoazijnzuur | N-ethylperfluorooctanesulfonamidoacetic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 56, 68, 95 | |||||
| 110-54-3 | 203-777-6 | n-hexaan | n-hexane | Ja | MVP 2 | 1 mg/Nm3 | 10-3-2026 | 83 | |||||
| 7440-02-0 | 231-111-4 | nikkel | nickel | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 33 | ||||||
| 7785-20-8 | 680-452-9 | nikkel ammonium sulfaat hexahydraat | nickel ammonium sulfate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 13927-77-0 | 237-696-2 | nikkel bis(dibutyldithiocarbamaat) | nickel bis(dibutyldithiocarbamate) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 39430-27-8 | 641-002-7 | nikkel carbonaat hydroxide tetrahydraat | nickel carbonate hydroxide tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 7791-20-0 | 616-576-7 | nikkel chloride (NiCl2), hexahydraat | nickel chloride (NiCl2), hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 13940-83-5 | 604-130-4 | nikkel fluoride (NiF2), tetrahydraat | nickel fluoride (NiF2), tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 343630-64-8 | 684-201-4 | nikkel ionofoor I | nickel ionophore I | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 69012-50-6 | 273-749-6 | nikkel mat | nickel matte | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 932-422-4 | nikkel p-toluidine-2-sulfonaat | nickel p-toluidine-2-sulfonate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 207569-15-1 | 622-645-2 | nikkel(II) 2,9,16,23-tetrafenoxy-29H,31H-ftalocyanine | nickel(II) 2,9,16,23-tetraphenoxy-29H,31H-phthalocyanine | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 375387-13-6 | 806-937-9 | nikkel(II) 2-amino-5-methylbenzeensulfonaat | nickel(II) 2-amino-5-methylbenzenesulfonate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 14481-08-4 | 624-509-8 | nikkel(II) bis(2,2,6,6-tetramethyl-3,5-heptaandionaat) | nickel(II) bis(2,2,6,6-tetramethyl-3,5-heptanedionate) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 312696-09-6 | 626-117-2 | nikkel(II) bromide 2-methoxyethyl ether complex | nickel(II) bromide 2-methoxyethyl ether complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 28923-39-9 | 628-228-1 | nikkel(II) bromide ethyleen glycol dimethyl ether complex | nickel(II) bromide ethylene glycol dimethyl ether complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 7789-49-3 | 677-463-6 | nikkel(II) bromide trihydraat | nickel(II) bromide trihydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 12244-51-8 | 683-010-3 | nikkel(II) carbonaat hydroxide tetrahydraat | nickel(II) carbonate hydroxide tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 60871-84-3 | 663-776-5 | nikkel(II) trifluormethaansulfonaat | nickel(II) trifluormethanesulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 29-11-2022 | 34, 56, 95 | |||||
| 6018-89-9 | 611-946-4 | nikkel(II)acetaat tetrahydraat | acetic acid nickel(II) salt | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 34, 56 | ||||||
| 13477-70-8 | 236-771-7 | nikkel(II)arsenaat | trinickel bis(arsenate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | ||||
| 944-674-2 | nikkel(II)bis(ethoxyacetaat) | nickel(II)bis(ethoxyacetate) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 69098-15-3 | 677-901-6 | nikkel(II)chloride hydraat | nickel(II) chloride hydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 85508-43-6 | 287-468-1 | nikkel(II)isodecanoaat | nickel(II) isodecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 29317-63-3 | 249-555-2 | nikkel(II)isooctanoaat | nickel(II) isooctanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85508-44-7 | 287-469-7 | nikkel(II)neodecanoaat | nickel(II) neodecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 93920-10-6 | 300-094-6 | nikkel(II)neononanoaat | nickel(II) neononanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 93920-09-3 | 300-093-0 | nikkel(II)neoündecanoaat | nickel(II) neoundecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13478-00-7 | 603-868-4 | nikkel(II)nitraathexahydraat | nickel(II) nitrate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 28-5-2019 | 56, 68 | ||||||
| 2223-95-2 | 218-744-1 | nikkel(II)octadecanoaat | nickel(II) stearate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 4995-91-9 | 225-656-7 | nikkel(II)octanoaat | nickel(II) octanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13654-40-5 | 237-138-8 | nikkel(II)palmitaat | nickel(II) palmitate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3349-08-4 | 222-102-6 | nikkel(II)propionaat | nickel(II) propionate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6944-05-4 | 678-499-5 | nikkel(II)p-tolueensulfonaat hexahydraat | nickel(II) p-toluenesulfonate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 10101-96-9 | 233-263-7 | nikkel(II)seleniet | nickel(II) selenite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 21784-78-1 | 244-578-4 | nikkel(II)silicaat | nickel(II) silicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15244-37-8 | 630-456-1 | nikkel(II)sulfaat hexa-/ heptahydraat | nickel(II) sulfate hexa-/ heptahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 10101-97-0 | 600-152-3 | nikkel(II)sulfaat hexahydraat | nickel (II)sulphate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 27-5-2019 | 56, 68 | ||||||
| 16812-54-7 | 240-841-2 | nikkel(II)sulfide | nickel sulphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 7757-95-1 | 231-827-7 | nikkel(II)sulfiet | nickel(II) sulfite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15684-36-3 | 671-251-7 | nikkel(II)tetrafluorboraat hexahydraat | nickel(II) tetrafluoroborate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 16083-14-0 | 240-235-8 | nikkel(II)trifluoracetaat | nickel(II) trifluoroacetate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 18721-51-2 | 242-533-3 | nikkel(II)waterstofcitraat | nickel(II) hydrogen citrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 933-670-6 | nikkel-(III) oxy gehydroxyleerd | nickel -(III) oxy hydroxyd | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 700-710-7 | nikkel(III)oxy hydroxide | nickel(III) oxy hydroxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 68511-62-6 | 270-944-8 | nikkel, 5,5'-azobis-2,4,6(1H,3H,5H)-pyrimidinetrion complexen | nickel, 5,5'-azobis-2,4,6(1H,3H,5H)-pyrimidinetrione complexes | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 1012368-96-5 | 196-936-3 | nikkel, diaquabis(2,2'-bipyridine-κn1,κn1')di-μ-chloordichloordi-, stereoisomeer | nickel, diaquabis(2,2'-bipyridine-κn1,κn1')di-μ-chlorodichlorodi-, stereoisomer | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125 | ||||||
| 15629-92-2 | 605-052-3 | nikkel, dichloor[1,1'-(1,3-propaandiyl)bis[1,1-difenylfosfine-κP]]- | nickel, dichloro[1,1'-(1,3-propanediyl)bis[1,1-diphenylphosphine-κP]]- | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 52625-25-9 | 258-051-1 | nikkel-3,5-bis(tert-butyl)-4-hydroxybenzoaat | nickel 3,5-bis(tert-butyl)-4-hydroxybenzoate (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 72152-45-5 | 276-399-2 | nikkelaat(6-), [22-[[[3-[[4,5-dihydro-3-methyl-5-oxo-1-[3-sulfo-4-[2-[2-sulfo-4-[(2,5,6-trichloor-4-pyrimidinyl)amino]fenyl]ethenyl]fenyl]-1H-pyrazol-4-yl]azo]-4-sulfofenyl]amino]sulfonyl]-29H,31H-ftalocyanine-1,8,15-trisulfonato(8-)-N29,N30,N31,N32]-, hexanatrium, (SP-4-2)- | nickelate(6-), [22-[[[3-[[4,5-dihydro-3-methyl-5-oxo-1-[3-sulfo-4-[2-[2-sulfo-4-[(2,5,6-trichloro-4-pyrimidinyl)amino]phenyl]ethenyl]phenyl]-1H-pyrazol-4-yl]azo]-4-sulfophenyl]amino]sulfonyl]-29H,31H-phthalocyanine-1,8,15-trisulfonato(8-)-N29,N30,N31,N32]-, hexasodium, (SP-4-2)- | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 14998-37-9 | 239-086-1 | nikkelacetaat | nickel acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27016-75-7 | 248-169-1 | nikkelarsenide | nickel arsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | ||||
| 68610-24-2 | 271-853-6 | nikkelbariumtitanium lichtgeel prideriet | nickel barium titanium primrose priderite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 4454-16-4 | 224-699-9 | nikkelbis(2-ethylhexanoaat) | nickel bis(2-ethylhexanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3906-55-6 | 223-463-2 | nikkelbis(4-cyclohexylbutyraat) | nickel bis(4-cyclohexylbutyrate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39819-65-3 | 254-642-3 | nikkelbis(benzeensulfonaat) | nickel bis(benzenesulfonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 18718-11-1 | 242-522-3 | nikkelbis(diwaterstoffosfaat) | nickel bis(dihydrogen phosphate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14507-36-9 | 238-511-8 | nikkelbis(fosfinaat) | nickel bis(phosphinate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84852-37-9 | 284-349-6 | nikkelbis(isononanoaat) | nickel bis(isononanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13770-89-3 | 237-396-1 | nikkelbis(sulfamidaat) | nickel bis(sulfamidate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14708-14-6 | 238-753-4 | nikkelbis(tetrafluorboraat) | nickel bis(tetrafluoroborate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 65229-23-4 | nikkelboorfosfide | nickel boron phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 12007-00-0 | 234-493-0 | nikkelboride | nickel boride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3333-67-3 | 222-068-2 | nikkelcarbonaat | nickel carbonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 958638-02-3 | 110-971-3 | nikkelcarbonaathydroxide, hydraat | nickel carbonate hydroxide,hydrate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 56, 125 | ||||||
| 14721-18-7 | 238-766-5 | nikkelchromaat | nickel chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 373-02-4 | 206-761-7 | nikkeldiacetaat | nickel di(acetate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12068-61-0 | 235-103-1 | nikkeldiarsenide | nickel diarsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56, 91 | ||||
| 553-71-9 | 209-046-8 | nikkeldibenzoaat | nickel dibenzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14550-87-9 | 238-596-1 | nikkeldibromaat | nickel dibromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13462-88-9 | 236-665-0 | nikkeldibromide | nickel dibromide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 67952-43-6 | 267-897-0 | nikkeldichloraat | nickel dichlorate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 7718-54-9 | 231-743-0 | nikkeldichloride | nickel dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15586-38-6 | 239-646-5 | nikkeldichromaat | nickel dichromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 557-19-7 | 209-160-8 | nikkeldicyanide | nickel dicyanide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10028-18-9 | 233-071-3 | nikkeldifluoride | nickel difluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3349-06-2 | 222-101-0 | nikkeldiformiaat | nickel diformate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12054-48-7 | 235-008-5 | nikkeldihydroxide | nickel dihydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13462-90-3 | 236-666-6 | nikkeldijodide | nickel diiodide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16039-61-5 | nikkeldilactaat | nickel dilactate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 13138-45-9 | 236-068-5 | nikkeldinitraat | nickel dinitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-36-8 | 234-823-3 | nikkeldioxide | nickel dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13637-71-3 | 237-124-1 | nikkeldiperchloraat | nickel diperchlorate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12201-89-7 | 235-379-3 | nikkeldisilicide | nickel disilicide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13689-92-4 | 237-205-1 | nikkeldithiocyanaat | nickel dithiocyanate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 52502-12-2 | 257-970-5 | nikkeldivanadiumhexaoxide | nickel divanadium hexaoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 36026-88-7 | 252-840-4 | nikkelfosfinaat | nickel phosphinate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 26043-11-8 | 247-430-7 | nikkelhexafluorsilicaat | nickel hexafluorosilicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11113-74-9 | 234-348-1 | nikkelhydroxide | nickel hydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27637-46-3 | 248-585-3 | nikkelisooctanoaat | nickel isooctanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11132-10-8 | nikkelkaliumfluoride | nickel potassium fluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 189139-63-7 | 839-353-8 | nikkel-kobalt-mangaanhydroxide | nickel cobalt manganese hydroxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56, 125 | ||||||
| 193215-05-3 | 878-730-1 | nikkellithium-mangaan-kobaltoxide (LiNi0,6Mn0,2Co0,2O2) | lithium nickel manganese cobalt oxide (LiNi0.6Mn0.2Co0.2O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 193215-53-1 | 878-731-7 | nikkellithium-mangaan-kobaltoxide (LiNi0.5Mn0.3Co0.2O2) | lithium nickel manganese cobalt oxide (LiNi0.5Mn0.3Co0.2O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 56 | ||||||
| 11099-02-8 | 234-323-5 | nikkelmonoxide | nickel monoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1313-99-1 | 215-215-7 | nikkelmonoxide | nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 17861-62-0 | nikkelnitriet | nickel dinitrite | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 34, 56 | |||||||
| 547-67-1 | 208-933-7 | nikkeloxalaat | nickel oxalate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 934-643-1 | nikkeloxide volledig gestabiliseerd zircornium | nickel oxide full stablized zircornium | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 15060-62-5 | 239-125-2 | nikkelselenaat | nickel selenate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1314-05-2 | 215-216-2 | nikkelselenide | nickel selenide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 31748-25-1 | 250-788-7 | nikkelsilicaat | nickel silicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-38-0 | 234-824-9 | nikkelstannaat | nickel tin trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-72-2 | 234-829-6 | nikkelsubsulfide | trinickel disulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 7786-81-4 | 232-104-9 | nikkelsulfaat | nickel sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10101-98-1 | 600-153-9 | nikkelsulfaat heptahydraat | nickel sulfate heptahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 124594-15-6 | 682-895-3 | nikkelsulfamaat tetrahydraat | nickel sulfamate tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 11113-75-0 | 234-349-7 | nikkelsulfide | nickel sulphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-51-7 | 683-050-1 | nikkelsulfide (NiS2) | nickel sulfide (NiS2) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 12142-88-0 | 235-260-6 | nikkeltelluride | nickel telluride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15852-21-8 | 239-974-9 | nikkeltelluurtetraoxide | nickel tellurium tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15851-52-2 | 239-967-0 | nikkeltelluurtrioxide | nickel tellurium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13463-39-3 | 236-669-2 | nikkeltetracarbonyl | tetracarbonylnickel | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 12653-76-8 | 235-752-0 | nikkeltitaniumoxide | nickel titanium oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-39-1 | 234-825-4 | nikkeltitaniumtrioxide | nickel titanium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15780-33-3 | 239-876-6 | nikkeltriuraandecaoxide | nickel triuranium decaoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| nikkelverbindingen | nickel compounds | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 33 | ||||||||
| 14332-34-4 | 238-278-2 | nikkelwaterstoffosfaat | nickel hydrogen phosphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14177-51-6 | 238-032-4 | nikkelwolfraamtetraoxide | nickel tungsten tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 70692-93-2 | 274-755-1 | nikkelzirkoniumtrioxide | nickel zirkonium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12255-08-2 | 235-503-6 | niobiumarsenide | niobium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 98-72-6 | 202-695-8 | nitarson | nitarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 13510-48-0 | 690-699-4 | nitraatzuur, beryllium zout, tetrahydraat | nitric acid, beryllium salt, tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 56, 68 | ||||||
| 98-95-3 | 202-716-0 | nitrobenzeen | nitrobenzene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| nitrobenzotrifluoriden | nitrobenzo trifluorides | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 1836-75-5 | 217-406-0 | nitrofeen | nitrofen | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 621-64-7 | 210-698-0 | nitrosodipropylamine | nitrosodipropylamine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 872-50-4 | 212-828-1 | N-methyl-2-pyrrolidon | N-methyl-2-pyrrolidone | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 79-16-3 | 201-182-6 | N-methylacetamide | N-methylacetamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 123-39-7 | 204-624-6 | N-methylformamide | N-methylformamide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 924-42-5 | 213-103-2 | N-methylolacrylamide | N-(hydroxymethyl)acrylamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | |||||
| 31506-32-8 | 250-665-8 | N-methylperfluorooctaan-sulfonamide | N-methylperfluorooctanesulfonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 56, 95 | ||||
| 2355-31-9 | N-methylperfluorooctaan-sulfonamidoazijnzuur | N-methylperfluorooctanesulfonamidoacetic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 56, 68, 95 | ||||||
| 62-75-9 | 200-549-8 | N-nitrosodimethylamine | dimethylnitrosoamine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 27753-52-2 | 248-637-5 | nonabroom-1,1'-bifenyl | nonabromo-1,1'-biphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 56 | ||||||
| 307-63-1 | 206-207-4 | nonacosafluor-1-joodtetradecaan | nonacosafluoro-1-iodotetradecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 558-97-4 | 209-199-0 | nonadecafluor-9-joodnonaan | nonadecafluoro-9-iodononane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 25154-52-3 | 246-672-0 | nonylfenol | nonylphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| nonylfenol en nonylfenolethoxylaten | nonylphenol and nonylphenolethoxylates | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 68412-54-4 | 500-209-1 | nonylfenol, vertakt, geëthoxyleerd | nonylphenol, branched, ethoxylated | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 56 | |||||
| nonylfenolen | nonylphenols | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| nonylfenolethoxylaat met >8 ethoxymonomeren (NPEO>8) | nonylphenolethoxylate with >8 ethoxymonomers (NPEO>8) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| nonylfenolethoxylaat met 1-2 ethoxymonomeren (NPEO1+2) | nonylphenolethoxylate with 1-2 ethoxymonomers (NPEO1+2) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| nonylfenolethoxylaat met 1-2 ethoxymonomeren gecarboxyleerd (NPE1+2C) | nonylphenolethoxylate with 1-2 ethoxymonomers carboxylated (NPEO1+2C) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| nonylfenolethoxylaat met 3-8 ethoxymonomeren (NPEO3-8) | nonylphenolethoxylate with 3-8 ethoxymonomers (NPEO3-8) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| 9016-45-9 | 500-024-6 | nonylfenolethoxylaten | nonylphenolethoxylates and related substances | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 932-998-7 | nonylfenolpolyglycolether | nonylphenolpolyglycolether | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | ||||||
| 116714-46-6 | 601-443-8 | novaluron | novaluron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 776297-69-9 | N-pentyl-isopentylftalaat | N-pentyl-isopentylphthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 52 | |||||
| 852527-45-8 | 632-946-0 | N-succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecanoaat | N-succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 123, 124 | |||||
| 597-82-0 | 209-909-9 | O,O,O-trifenylfosforthioaat | O,O,O-triphenyl phosphorothioate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 80 | |||||
| 97-56-3 | 202-591-2 | o-aminoazotolueen | o-aminoazotoluene, 4-amino-2',3-dimethylazobenzene, 4-o-tolylazo-o-toluidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 90-04-0 | 201-963-1 | o-anisidine | o-anisidine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 90480-55-0 | 291-790-8 | octaanzuur, pentadecafluor-, vertakt | octanoic acid, pentadecafluoro-, branched | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 90480-56-1 | 291-791-3 | octaanzuur, pentadecafluor-, vertakt, ammoniumzout | octanoic acid, pentadecafluoro-, branched, ammonium salt | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 32536-52-0 | 251-087-9 | octabroomdifenylether | diphenyl ether, octabromo derivative | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | ||||
| 2234-13-1 | 218-778-7 | octachloornaftaleen | octachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 3248-63-3 | 221-830-1 | octacosafluor-14-jood-2-(trifluormethyl)tetradecaan | octacosafluoro-14-iodo-2-(trifluoromethyl)tetradecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 99955-83-6 | octadecaanzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylester | octadecanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 7428-48-0 | 231-068-1 | octadecanoaat, loodzout | stearic acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 360-89-4 | 206-640-9 | octafluor-2-buteen | octafluoro-2-butene | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 115-25-3 | 204-075-2 | octafluorcyclobutaan | cyclooctafluorobutane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 76-19-7 | 200-941-9 | octafluorpropaan | perflutren | Ja | gO.2 | 50 mg/Nm3 | 15-11-2024 | 44, 95 | |||||
| 556-67-2 | 209-136-7 | octamethyltetrasiloxaan | octamethylcyclotetrasiloxane | Ja | MVP 2 | 1 mg/Nm3 | 6-7-2018 | ||||||
| 107-51-7 | 203-497-4 | octamethyltrisiloxaan | octamethyltrisiloxane | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 80 | |||||
| 13246-32-7 | 236-227-9 | O-fenyleenbis(dimethylarsine) | o-phenylenebis(dimethylarsine) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 1758-48-1 | 217-154-1 | o-fenyleendiarsonzuur | o-phenylenediarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 109202-58-6 | 432-750-3 | O-hexyl-N-ethoxycarbonylthiocarbamaat | O-hexyl-N-ethoxycarbonylthiocarbamate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 103122-66-3 | 434-350-4 | O-isobutyl-N-ethoxycarbonylthiocarbamaat | O-isobutyl-N-ethoxy carbonylthiocarbamate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92062-09-4 | 295-523-6 | olierijke paraffine (aardolie), met waterstof behandeld | slack wax (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 63 | |||||||
| 92062-10-7 | 295-524-1 | olierijke paraffine (aardolie), smeltend bij lage temperaturen | slack wax (petroleum), low-melting | Ja | 2-12-2013 | 4, 63 | |||||||
| 92062-11-8 | 295-525-7 | olierijke paraffine (aardolie), smeltend bij lage temperatuur, met waterstof behandeld | slack wax (petroleum), low-melting, hydrotreated | Ja | 2-12-2013 | 4, 63 | |||||||
| 64742-61-6 | 265-165-5 | olierijke paraffinewas (aardolie) | slack wax (petroleum) | Ja | 2-12-2013 | 4, 63 | |||||||
| 100684-49-9 | 309-723-9 | olierijke paraffinewas (aardolie), behandeld met koolstof | slack wax (petroleum), carbon-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97863-06-4 | 308-158-5 | olierijke paraffinewas (aardolie), laag-smeltend behandeld met kiezelzuur | slack wax (petroleum), low-melting, silicic acid-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97863-05-3 | 308-156-4 | olierijke paraffinewas (aardolie), laagsmeltend behandeld met klei | slack wax (petroleum), low-melting, clay-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97863-04-2 | 308-155-9 | olierijke paraffinewas (aardolie), laagsmeltend behandeld met kool | slack wax (petroleum), low-melting, carbon-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 90669-78-6 | 292-660-3 | olierijke paraffinewas (aardolie), met klei behandeld | alack wax (petroleum), clay-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 90669-77-5 | 292-659-8 | olierijke paraffinewas (aardolie), zuur-behandeld | slack wax (petroleum), acid-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| oligomeren van chroomzuur en dichroomzuur | oligomers of chromic acid and dichromic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56 | |||||||
| 700-960-7 | oligomerisatie- en alkyleringsreactieproducten van 2-fenylpropeen en fenol | oligomerisation and alkylation reaction products of 2-phenylpropene and phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 80 | ||||||
| 68515-84-4 | 271-112-7 | olivijn nikkelgroen | olivine, nickel green | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64742-89-8 | 265-192-2 | oplosmiddelnafta (aardolie), lichte alifatische | solvent naphtha (petroleum), light aliph. | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-95-6 | 265-199-0 | oplosmiddelnafta (aardolie), lichte aromatische | solvent naphtha (petroleum), light arom. | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 64 | |||||
| 68512-78-7 | 270-988-8 | oplosmiddelnafta (aardolie), lichte aromatische, waterstofbehandeld | solvent naphtha (petroleum), light arom., hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 92062-15-2 | 295-529-9 | oplosmiddelnafta (aardolie), waterstofbehandelde lichte, nafteenhoudend | solvent naphtha (petroleum), hydrotreated light naphthenic | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-94-5 | 265-198-5 | oplosmiddelnafta (aardolie), zwaar aromatisch | solvent naphtha (petroleum), heavy arom. | MVP 1 | 0,05 mg/Nm3 | 19-5-2021 | 79, 81 | ||||||
| 85536-19-2 | 287-500-4 | oplosmiddelnafta (kool), cumaroon -styreen bevattend | solvent naphtha (coal), coumarone-styrene contg. | Ja | 2-12-2013 | 4, 60 | |||||||
| 85536-17-0 | 287-498-5 | oplosmiddelnafta (kool), licht | solvent naphtha (coal), light | Ja | 2-12-2013 | 4, 60 | |||||||
| 85536-20-5 | 287-502-5 | oplosmiddelnafta (kool), xyleen-styreenfractie, herdestillaat, lichte olie, middenfractie | solvent naphtha (coal), xylene-styrene cut | Ja | 2-12-2013 | 4, 60 | |||||||
| organische arseenverbindingen | organic arsenic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 91 | |||||||
| organische kwikverbindingen | organic mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||||
| organische tinverbindingen | organostannic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| organoloodverbindingen | organic lead compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 13840-56-7 | 237-560-2 | orthoboorzuur natriumzout | orthoboric acid, sodium salt | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 20786-60-1 | 244-038-8 | orthoboorzuur, kaliumzout | orthoboric acid, potassium salt | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 35498-15-8 | 252-594-8 | orthoboorzuur, lood(2+)zout | orthoboric acid, lead(2+) salt | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 26038-87-9 | 247-421-8 | orthoboorzuur, verbinding met 2-aminoethanol | orthoboric acid, compound with 2-aminoethanol | MVP 1 | 0,05 mg/Nm3 | 19-11-2019 | 56, 68 | ||||||
| 84-15-1 | 201-517-6 | o-terfenyl | o-terphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 24-7-2020 | 75 | |||||
| 304671-77-0 | 621-165-0 | o-tolidine dihydrochloride hydraat | o-Tolidine dihydrochloride hydrate | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 56, 68 | ||||||
| 95-53-4 | 202-429-0 | o-toluidine | o-toluidine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 20543-06-0 | 243-867-2 | oxaalzuur nikkelzout | oxalic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1003318-67-9 | 801-263-1 | oxathiapiproline | oxathiapiprolin | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 183146-60-3 | oxiraan, methyl-, polymeer met oxiraan, mono[2-hydroxy-3-[(γ-ω-perfluor-C8-20-alkyl) thio] propyl] ethers | oxirane, methyl-, polymer with oxirane, mono[2-hydroxy-3-[( γ-ω-perfluoro-C8-20-alkyl)thio]propyl] ethers | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 306-12-7 | 206-178-8 | oxofenarsenaat | oxophenarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 538-03-4 | 208-682-3 | oxofenarsine hydrochloride | oxophenarsine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 30784-30-6 | 250-339-5 | p-(1,1-dimethylheptyl)fenol | p-(1,1-dimethylheptyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 80-46-6 | 201-280-9 | p-(1,1-dimethylpropyl)fenol | p-(1,1-dimethylpropyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||
| 17404-66-9 | 241-427-4 | p-(1-methyloctyl)fenol | p-(1-methyloctyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 326475-46-1 | palladium, dichloorbis[tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]fosfine-κP ]- | palladium, dichlorobis[tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]phosphine-κP]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 64742-70-7 | 265-174-4 | paraffinehoudende oliën (aardolie), katalytisch van was ontdane zware | paraffin oils (petroleum), catalytic dewaxed heavy | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-71-8 | 265-176-5 | paraffineoliën (aardolie), katalytisch van was ontdane lichte | paraffin oils (petroleum), catalytic dewaxed light | Ja | 2-12-2013 | 4, 61 | |||||||
| 92129-09-4 | 295-810-6 | paraffineoliën (aardolie), solvent-geraffineerde van was ontdane zware | paraffin oils (petroleum), solvent-refined dewaxed heavy | Ja | 2-12-2013 | 4, 61 | |||||||
| 92045-71-1 | 295-454-1 | paraffinewassen (kool), bruinkool hoge temperatuur teer | paraffin waxes (coal), brown-coal-high-temp. tar | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-78-8 | 308-298-7 | paraffinewassen (kool), bruinkool hoge temperatuur teer, behandeld met kiezelzuur | paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-77-7 | 308-297-1 | paraffinewassen (kool), bruinkool hoge temperatuur teer, behandeld met klei | paraffin waxes (coal), brown-coal high-temp tar, clay-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-76-6 | 308-296-6 | paraffinewassen (kool), bruinkool hoge temperatuur teer, behandeld met kool | paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 92045-72-2 | 295-455-7 | paraffinewassen (kool), bruinkool hoge temperatuur teer, waterstofbehandeld | paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 140-66-9 | 205-426-2 | para-tert-octylfenol | octylphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 37680-73-2 | PCB 101 | 2,4,5,2',5'-Pentachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 32598-14-4 | PCB 105 | 2,3,3',4,4'-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 74472-37-0 | PCB 114 | 2,3,4,4',5-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 31508-00-6 | PCB 118 | 2,3',4,4',5-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 65510-44-3 | PCB 123 | 2,3',4,4',5'-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57465-28-8 | PCB 126 | 3,3',4,4',5-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 35065-28-2 | PCB 138 | 2,2',3,4,4',5'-hexachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 35065-27-1 | 621-381-5 | PCB 153 | 2,2',4,4',5,5'-hexachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | ||||||
| 38380-08-4 | PCB 156 | 2,3,3',4,4',5-Hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 69782-90-7 | PCB 157 | 2,3,3',4,4',5'-hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 52663-72-6 | PCB 167 | 2,3',4,4',5,5'-hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 32774-16-6 | PCB 169 | 3,3',4,4',5,5'-hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 35065-29-3 | PCB 180 | 2,2',3,4,4',5,5'-heptachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 39635-31-9 | PCB 189 | 2,3,3',4,4',5,5'-heptachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 7012-37-5 | 230-293-2 | PCB 28 | 2,4,4'-trichlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | ||||||
| 35693-99-3 | PCB 52 | 2,2',5,5'-tetrachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 32598-13-3 | PCB 77 | 3,3',4,4'-tetrachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 70362-50-4 | PCB 81 | 3,4,4',5-tetrachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 5216-25-1 | 226-009-1 | p-chloorbenzotrichloride | p-chlorobenzotrichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 61789-60-4 | 263-072-4 | pek | pitch | Ja | 2-12-2013 | 4, 62 | |||||||
| 65996-93-2 | 266-028-2 | pek koolteer, hoge temperatuur | pitch, coal tar, high-temp. | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 90669-57-1 | 292-651-4 | pek koolteer, lage temperatuur | pitch, coal tar, low-temp | Ja | 2-12-2013 | 4, 62 | |||||||
| 90669-59-3 | 292-654-0 | pek koolteer, lage temperatuur, geoxideerd | pitch, coal tar, low-temp., oxidized | Ja | 2-12-2013 | 4, 62 | |||||||
| 90669-58-2 | 292-653-5 | pek koolteer, lage temperatuur, met warmte behandeld | pitch, coal tar, low-temp., heat-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 68187-57-5 | 269-109-0 | pek koolteer-aardolie | pitch, coal tar-petroleum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 62 | |||||
| 94114-13-3 | 302-650-3 | pek, koolteer, hoge temperatuur, secundair | pitch, coal tar, high-temp., secondary | Ja | 2-12-2013 | 4, 62 | |||||||
| 121575-60-8 | 310-162-7 | pek, koolteer, hoge temperatuur, warmte-behandeld | pitch, coal tar, high-temp., heat-treated | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 62 | |||||
| 187-762-9 | pek, steenkoolteer, hoge temperatuur, aardolie, verhit, flashdistillatie, voornamelijk aromaten met 5 of meer ringen | pitch, coal tar, high-temp., petroleum, heat-treated flash distillation, mainly aromatics with 5 and more rings | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 48, 147 | |||||||
| 302911-86-0 | pentaandizuur, 3-[2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)oxy]-2-oxoethyl]-3-hydroxy-, 1,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl) ester | pentanedioic acid, 3-[2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)oxy]-2-oxoethyl]-3-hydroxy-, 1,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) ester | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-68-3 | pentaanzuur, 2,2,3,4,5,5,5-heptafluor-3-(1,1,2,2,2-pentafluorethyl)-4-(trifluormethyl)- | pentanoic acid, 2,2,3,4,5,5,5-heptafluoro-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-75-2 | pentaanzuur, 2,2,3,5,5,5-hexafluor-3,4,4-tris(trifluormethyl)- | pentanoic acid, 2,2,3,5,5,5-hexafluoro-3,4,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-67-2 | pentaanzuur, 2,2,4,4,5,5,5-heptafluor-3-(1,1,2,2,2-pentafluorethyl)-3-(trifluormethyl)- | pentanoic acid, 2,2,4,4,5,5,5-heptafluoro-3-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-74-1 | pentaanzuur, 2,2,4,5,5,5-hexafluor-3,3,4-tris(trifluormethyl)- | pentanoic acid, 2,2,4,5,5,5-hexafluoro-3,3,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-77-4 | pentaanzuur, 2,3,3,4,4,5,5,5-octafluor-2-(1,1,2,2,3,3,3-heptafluorpropyl)- | pentanoic acid, 2,3,3,4,4,5,5,5-octafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-76-3 | pentaanzuur, 2,3,3,4,4,5,5,5-octafluor-2-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]- | pentanoic acid, 2,3,3,4,4,5,5,5-octafluoro-2-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-65-0 | pentaanzuur, 2,3,3,4,5,5,5-heptafluor-2-(1,1,2,2,2-pentafluorethyl)-4-(trifluormethyl)- | pentanoic acid, 2,3,3,4,5,5,5-heptafluoro-2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-73-0 | pentaanzuur, 2,3,3,5,5,5-hexafluor-2,4,4-tris(trifluormethyl)- | pentanoic acid, 2,3,3,5,5,5-hexafluoro-2,4,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-64-9 | pentaanzuur, 2,3,4,4,5,5,5-heptafluor-2-(1,1,2,2,2-pentafluorethyl)-3-(trifluormethyl)- | pentanoic acid, 2,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-66-1 | pentaanzuur, 2,3,4,4,5,5,5-heptafluor-3-(1,1,2,2,2-pentafluorethyl)-2-(trifluormethyl)- | pentanoic acid, 2,3,4,4,5,5,5-heptafluoro-3-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-72-9 | pentaanzuur, 2,3,4,5,5,5-hexafluor-2,3,4-tris(trifluormethyl)- | pentanoic acid, 2,3,4,5,5,5-hexafluoro-2,3,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-71-8 | pentaanzuur, 2,4,4,5,5,5-hexafluor-2,3,3-tris(trifluormethyl)- | pentanoic acid, 2,4,4,5,5,5-hexafluoro-2,3,3-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-63-8 | pentaanzuur, 3,3,4,4,5,5,5-heptafluor-2-(1,1,2,2,2-pentafluorethyl)-2-(trifluormethyl)- | pentanoic acid, 3,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-70-7 | pentaanzuur, 3,3,4,5,5,5-hexafluor-2,2,4-tris(trifluormethyl)- | pentanoic acid, 3,3,4,5,5,5-hexafluoro-2,2,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 1882109-69-4 | pentaanzuur, 3,4,4,5,5,5-hexafluor-2,2,3-(trifluormethyl)- | pentanoic acid, 3,4,4,5,5,5-hexafluoro-2,2,3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 71608-61-2 | pentaanzuur, 4,4-bis[(γ-ω-perfluor-C8-20-alkyl) thio] derivaten, verbindingen met diethanolamine | pentanoic acid, 4,4-bis[(γ-ω-perfluoro-C8-20-alkyl)thio]derivs., compds. with diethanolamine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 32534-81-9 | 251-084-2 | pentabroomdifenylether | diphenyl ether, pentabromo derivative pentabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||
| 85-22-3 | 201-593-0 | pentabroomethylbenzeen | 2,3,4,5,6-pentabromoethylbenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1825-21-4 | pentachlooranisol | pentachloro-anisole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 608-93-5 | 210-172-0 | pentachloorbenzeen | pentachlorobenzene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 133-49-3 | 205-107-8 | pentachloorbenzeenthiol | pentachlorobenzenethiol | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 49 | ||||||
| 76-01-7 | 200-925-1 | pentachloorethaan | pentachloroethane | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 87-86-5 | 201-778-6 | pentachloorfenol | pentachlorophenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 77 | ||||
| 3772-94-9 | 223-220-0 | pentachloorfenyl lauraat | pentachlorophenyl laurate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 56 | |||||
| 1321-64-8 | 215-320-8 | pentachloornaftaleen | pentachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 335-79-5 | pentadecaan, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12, 12,13,13,14,14,15,15-hentriacontafluor-15-jood- | pentadecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15-hentriacontafluoro-15-iodo- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 335-66-0 | 206-396-3 | pentadecafluoroctylfluoride | pentadecafluorooctyl fluoride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 7784-36-3 | 232-061-6 | pentafluorarsenaat | pentafluoroarsorane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 354-33-6 | 206-557-8 | pentafluorethaan | pentafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 7786-36-9 | 232-096-7 | pentahydroxyarseen | pentahydroxyarsorane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 7216-95-7 | 404-290-3 | pentakalium 2,2',2'',2''',2''''-(ethaan-1,2-diylnitrilo) penta-acetaat | pentapotassium 2,2’,2’’,2’’’,2’’’’-(ethane-1,2-diylnitrilo)pentaacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 80 | |||||
| 12065-90-6 | 235-067-7 | pentaloodtetraoxidesulfaat | pentalead tetraoxide sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 140-01-2 | 205-391-3 | pentanatrium diethyleen-triaminepenta-azijnzuur | pentasodium pentetate | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | ||||||
| 49663-84-5 | 256-418-0 | pentazinkchromaatoctahydroxide | pentazinc chromate octahydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 183675-82-3 | 606-001-8 | penthiopyrad | (RS)-N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 95, 97 | |||||
| per- en polyfluoralkylstoffen | per- and polyfluoroalkyl substances | Ja | zie voetnoot | 14-11-2024 | 96, 98 | ||||||||
| 13517-20-9 | 603-902-8 | perboorzuur (H3BO2(O2)) mononatriumzout trihydraat | perboric acid (H3BO2(O2)), monosodium salt trihydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 10332-33-9 | 600-419-4 | perboorzuur (HBO(O2)) natriumzout monohydraat | perboric acid (HBO(O2)), sodium salt, monohydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 10486-00-7 | 600-611-8 | perboorzuur (HBO(O2)) natriumzout tetrahydraat | perboric acid (HBO(O2)), sodium salt, tetrahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 11138-47-9 | 234-390-0 | perboorzuur natriumzout | perboric acid, sodium salt | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 12040-72-1 | perboorzuur natriumzout monohydraat | perboric acid, sodium salt, monohydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 37244-98-7 | perboorzuur natriumzout tetrahydraat | perboric acid, sodium salt, tetrahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13520-61-1 | 677-691-6 | perchloorzuur, nikkel(2+)zout, hexahydraat | perchloric acid, nickel(2+) salt, hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | ||||||
| 338-83-0 | 206-420-2 | perfluamine | perfluamine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||
| 10493-43-3 | 234-018-7 | perfluor(ethylvilyl)ether | perfluoro(ethyl vinyl)ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 1187-93-5 | 214-703-7 | perfluor(methylvinyl)ether | perfluoro(methyl vinyl ether) | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 355-25-9 | 206-580-3 | perfluorbutaan | perflubutane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 375-73-5 | 206-793-1 | perfluorbutaansulfonzuur | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 95 | ||||
| 799-977-0 | perfluorbutaansulfonzuur en zijn zouten | perfluorobutane sulfonic acid and its salts | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 95 | |||||
| 375-22-4 | 206-786-3 | perfluorbutaanzuur en zijn zouten en precursoren | perfluorobutanoic acid and its salts and precursors | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97, 99 | |||||
| 335-77-3 | 206-401-9 | perfluordecaansulfonaat | henicosafluorodecanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 335-76-2 | 206-400-3 | perfluordecaanzuur | nonadecafluorodecanoic acid | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | 95 | |||
| 307-55-1 | 206-203-2 | perfluordodecanoaat | tricosafluorododecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 375-92-8 | 206-800-8 | perfluorheptaansulfonaat | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 375-85-9 | 206-798-9 | perfluorheptaanzuur | perfluoroheptanoic acid | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 29-3-2021 | 87, 88, 95 | |||
| 355-42-0 | 206-585-0 | perfluorhexaan | perflexane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 355-46-4 | 206-587-1 | Perfluorhexaan-1-sulfonzuur | perfluorohexane-1-sulphonic acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 24-8-2017 | 50, 95 | |||
| 67905-19-5 | 267-638-1 | perfluorhexadecanoaat | perfluoropalmitic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 610800-34-5 | perfluorhexylperfluoroctyl fosfinaat | perfluorohexylperfluorooctyl phosphinate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | |||||
| 382-21-8 | perfluorisobuteen | perfluoroisobutylene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 8, 95 | ||||||
| perfluorkoolwaterstoffen (C1-C6) | perfluorohydrocarbons | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||||
| 375-95-1 | 206-801-3 | perfluornonaanzuur | perfluorononan-1-oic acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-2-2016 | 95 | |||
| 1763-23-1 | 217-179-8 | perfluoroctaansulfonzuur | heptadecafluorooctane-1-sulphonic acid | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 30, 95 | ||
| 335-67-1 | 206-397-9 | perfluoroctaanzuur | pentadecafluorooctanoic acid | Ja | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 74, 95 | ||
| 33496-48-9 | 251-543-7 | perfluoroctaanzuuranhydride | perfluorooctanoic anhydride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 16517-11-6 | 240-582-5 | perfluoroctadecanoaat | perfluorostearic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 3102-79-2 | 671-486-5 | perfluoroctylethyldichloormethyl silaan | perfluorooctylethyldichloromethyl silane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 74612-30-9 | 633-334-6 | perfluoroctylethyldimethylchloorsilaan | perfluorooctylethyldimethylchlorosilane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 78560-44-8 | 616-629-4 | perfluoroctylethyltrichloorsilaan | perfluorooctylethyltrichlorosilane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 83048-65-1 | 617-434-7 | perfluoroctylethyltrimethoxysilaan | perfluorooctylethyltrimethoxysilane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 678-26-2 | 211-647-5 | perfluorpentaan | perflenapent | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 2706-91-4 | 220-301-2 | perfluorpentaansulfonaat | perfluoropentane-1-sulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 2706-90-3 | 220-300-7 | perfluorpentanoaat | perfluorovaleric acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 376-06-7 | 206-803-4 | perfluortetradecaanzuur | heptacosafluorotetradecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 72629-94-8 | 276-745-2 | perfluortridecanoaat | pentacosafluorotridecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 2058-94-8 | 218-165-4 | perfluorundecanoaat | henicosafluoroundecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 95 | ||||
| 81-33-4 | 201-344-6 | peryleen-3,4:9,10-tetracarboxydiimide | perylene-3,4:9,10-tetracarboxydiimide | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 10, 48 | ||||||
| pesticide, arseenverbinding | pesticide, arsenic compound | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||||
| pesticide, kwikverbinding | mercury based pesticide | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 42, 56 | ||||||||
| 8009-03-8 | 232-373-2 | petrolatum | petrolatum | Ja | 2-12-2013 | 4, 63 | |||||||
| 97862-98-1 | 308-150-1 | petrolatum (aardolie), behandeld met kiezelzuur | petrolatum (petroleum), silicic acid-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 100684-33-1 | 309-706-6 | petrolatum (aardolie), behandeld met klei | petrolatum (petroleum), clay-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97862-97-0 | 308-149-6 | petrolatum (aardolie), behandeld met kool | petrolatum (petroleum), carbon-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 64743-01-7 | 265-206-7 | petrolatum (aardolie), geoxideerd | petrolatum (petroleum), oxidized | Ja | 2-12-2013 | 4, 63 | |||||||
| 85029-74-9 | 285-098-5 | petrolatum (aardolie), met alumina behandeld | petrolatum (petroleum), alumina-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 92045-77-7 | 295-459-9 | petrolatum (aardolie), met waterstof behandeld | petrolatum (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97722-19-5 | 307-769-4 | petroleumgas, raffinaten (aardolie), stoomgekraakte c4-fractie, cuproammoniumacetaatextractie, c3-5- en c3-5-onverzadigd vrij van butadieen | raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68476-85-7 | 270-704-2 | petroleumgassen vloeibaar gemaakt | petroleum gases, liquefied | Ja | 2-12-2013 | 4, 59 | |||||||
| 68476-86-8 | 270-705-8 | petroleumgassen vloeibaar gemaakt, stankvrij gemaakt | petroleum gases, liquefied, sweetened | Ja | 2-12-2013 | 4, 59 | |||||||
| 137641-05-5 | 639-953-8 | picolinafen | picolinafen | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 117428-22-5 | 601-478-9 | picoxystrobin | picoxystrobin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 95, 97 | |||||
| 26543-97-5 | 247-770-6 | p-isononylfenol | p-isononylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 56 | |||||
| 31631-13-7 | p-isononyl-fenol, fosfiet (3:1) | phenol, p-isononyl-, phosphite (3:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 20-1-2022 | 56 | ||||||
| 12044-52-9 | platina arsenide (PtAs2) | platinum arsenide (PtAs2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 104-40-5 | 203-199-4 | p-nonylfenol | p-nonylphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 931-562-3 | poly(oxy-1,2-ethaandiyl), a-(nonylfenyl)-w-hydroxy- | poly(oxy-1,2-ethanediyl), a-(nonylphenyl)-w-hydroxy- (CAS 9016-45-9) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-5-2024 | 56 | ||||||
| 932-688-1 | poly(oxy-1,2-ethaandiyl), α-(nonylfenyl)-ω-hydroxy-, vertakt | poly(oxy-1,2-ethanediyl), α-(nonylphenyl)-ω-hydroxy-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 17-5-2024 | 56 | ||||||
| 59536-65-1 | polybroombifenylen | polybromobiphenyls | MVP 1 | 0,05 mg/Nm3 | 24-04-2017 | 13, 56 | |||||||
| polybroomdibenzodioxines | polybrominated dibenzo-p-dioxins | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| polybroomdibenzofuranen | polybrominated dibenzo furans | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| 1336-36-3 | 215-648-1 | polychloorbifenylen | polychlorinated biphenyls | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 39 | |||
| polychloordibenzofuranen | polychlorinated dibenzofurans | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | ||||||
| polychloordibenzo-p-dioxinen | polychlorinated dibenzo-p-dioxins | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | ||||||
| 70776-03-3 | 274-864-4 | polychloornaftalenen | polychlorinated naphthalenes | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 61788-33-8 | 262-968-2 | polychloorterfenylen | polychlorinated terphenyls | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 45 | ||||||
| polycyclische aromatische koolwaterstoffen | polycyclic aromatic hydrocarbons | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 37486-69-4 | polyfluor-5,8,11,14-tetrakis(polyfluoralkyl)polyoxaalkaan | polyfluoro-5,8,11,14-tetrakis(polyfluoralkyl)-polyoxaalkane | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | ||||||
| polyhalogeendibenzodioxines | polyhalogen dibenzo dioxins | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| polyhalogeendibenzofuranen | polyhalogen dibenzo furans | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| 9002-84-0 | 618-337-2 | polytetrafluorethyleen | polytetrafluoroethylene | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 24937-79-9 | 607-458-6 | polyvinylideenfluoride | polyvinylidene fluoride | Ja | S | 3 mg/Nm3 | 15-11-2024 | 44, 95 | |||||
| 12044-28-9 | 234-953-0 | praseodymium arsenide | praseodymium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 157283-68-6 | 682-028-9 | propaan-2-yl (5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluormethyl)fenoxy]-1-buteen-1-yl]cyclopentyl]-5-heptenoaat | propan-2-yl (5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-en-1-yl]cyclopentyl]hept-5-enoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 95, 97 | |||||
| 68187-42-8 | 269-095-6 | propaanamide, 3-[(γ-ω-perfluor-C4-10-alkyl) thio]-derivaten | propanamide, 3-[(γ-ω-perfluoro-C4-10-alkyl)thio] derivs. | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 56, 94, 95 | ||||
| 1623-05-8 | 216-600-2 | propaanperfluorpropyl vinyl ether | 1,1,1,2,2,3,3-heptafluoro-3-[(trifluorovinyl)oxy]propane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 95, 97 | |||||
| 75579-40-7 | propaanzuur, 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)-, (-)- | propanoic acid, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-, (-)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 56, 95 | |||||
| 75579-39-4 | propaanzuur, 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)-, (+)- | propanoic acid, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-, (+)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 56, 95 | |||||
| 60207-90-1 | 262-104-4 | propiconazool | propiconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | ||||||
| 107-34-6 | 203-482-2 | propylarsonzuur | propylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 75-56-9 | 200-879-2 | propyleenoxide | propylene oxide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 94125-34-5 | 619-000-2 | prosulfuron | prosulfuron | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 15122-58-4 | 239-179-7 | proustiet (Ag3(AsS3)) | proustite (Ag3(AsS3)) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 106599-06-8 | p-sec-nonyl-fenol, fosfiet | phenol, p-sec-nonyl-, phosphite | Ja | MVP 1 | 0,05 mg/Nm3 | 20-1-2022 | 56 | ||||||
| 3969-54-8 | 223-588-2 | p-tolylarseenzuur | p-tolylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 129-00-0 | 204-927-3 | pyreen | pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | ||||||
| 179101-81-6 | 605-845-4 | pyridalyl | pyridalyl | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 68391-11-7 | 269-929-9 | pyridine, alkylderivaten | pyridine, alkyl derivs. | Ja | 2-12-2013 | 4, 60 | |||||||
| 26299-14-9 | 247-595-5 | pyridiniumchloorchromaat | pyridinium chlorochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 20039-37-6 | 243-478-8 | pyridiniumdichromaat | pyridinium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 83042-08-4 | 625-358-0 | pyridiniumfluorchromaat | pyridinium fluorochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 13463-41-7 | 236-671-3 | pyrithionzink | pyrithione zinc | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | |||||
| 8012-00-8 | 232-382-1 | pyrochlore, antimoonlood geel | pyrochlore, antimony lead yellow | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | |||||
| 422556-08-9 | pyroxsulam | pyroxsulam | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | ||||||
| 148-24-3 | 205-711-1 | quinolin-8-ol | quinolin-8-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 56549-24-7 | 621-797-7 | quinoliniumdichromaat | quinolinium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 56 | ||||||
| 124495-18-7 | 602-997-3 | quinoxyfen | quinoxyfen | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68410-71-9 | 270-088-5 | raffinaten (aardolie), katalytische reformer, ethyleenglycol-water-tegenstroomextractie | raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68425-35-4 | 270-349-3 | raffinaten (aardolie), reformer, Lurgi-afscheider | raffinates (petroleum), reformer, Lurgi unit-sepd. | Ja | 2-12-2013 | 4, 64 | |||||||
| 1303-22-6 | rammelsbergiet (NiAs2) | rammelsbergite (NiAs2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 1471311-26-8 | 939-460-0 | reactieproduct van 1,3,4-thiadiazolidin-2,5-dithion, formaldehyde en fenol, heptyl derivaten | reaction product of 1,3,4-thiadiazolidine-2,5-dithione, formaldehyde and phenol, heptyl derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2022 | 56 | |||||
| reactieproducten van 1,3,4-thiadiazolidin-2,5-dithion, formaldehyde en vertakt en lineair 4-heptylfenol | reaction products of 1,3,4-thiadiazolidine-2,5-dithione, formaldehyde and 4-heptylphenol, branched and linear | Ja | MVP 1 | 0,05 mg/Nm3 | 22-1-2018 | 54 | |||||||
| 921213-47-0 | 469-080-6 | reactieproducten van benzeen, chloor en zwavelchloride (S2Cl2) met 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]difenol | reaction products of benzene, chlorine and sulfur chloride (S2Cl2) with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 80, 95 | ||||
| reactieproducten van paraformaldehyde en 2-hydroxypropylamine (ratio 3:2) | reaction products from paraformaldehyde and 2-hydroxypropylamine (ratio 3:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 30-5-2017 | 57, 65 | |||||||
| 954-309-9 | reactieproducten van paraformaldehyde en 2-hydroxypropylamine (ratio 3:2) [MBO] | reaction products of paraformaldehyde and 2-hydroxypropylamine (ratio 3:2) [MBO] | MVP 1 | 0,05 mg/Nm3 | 10-3-2026 | 56, 68 | |||||||
| reactieproducten van paraformaldehyde met 2-hydroxypropylamine (ratio 1:1) | reaction products of paraformaldehyde with 2-hydroxypropylamine (ratio 1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 65 | |||||||
| 701-179-4 | reactieproducten van vetzuren, C18 (onverzadigd) alkyl met zwaveltrioxide, kaliumzouten | reaction products of fatty acids, C18 (unsaturated) alkyl with sulfur trioxide, potassium salts | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 80 | ||||||
| 927-629-1 | residue, uitloging van nikkel mat | residue, nickel matte leaching | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 56 | |||||||
| 68607-30-7 | 271-763-7 | residuen (aardolie), aftopinrichting, laag zwavelgehalte | residues (petroleum), topping plant, low-sulfur | Ja | 2-12-2013 | 4 | |||||||
| 68513-66-6 | 271-010-2 | residuen (aardolie), alkyleringssplitter, C4-rijk | residues (petroleum), alkylation splitter, C4-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68333-22-2 | 269-777-3 | residuen (aardolie), atmosferische destillatie | residues (petroleum), atmospheric | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-45-3 | 265-045-2 | residuen (aardolie), atmosferische destillatietoren | residues (petroleum), atm. tower | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 68478-12-6 | 270-791-7 | residuen (aardolie), butaansplitter-bodemfracties | residues (petroleum), butane splitter bottoms | Ja | 2-12-2013 | 4, 64 | |||||||
| 92062-00-5 | 295-514-7 | residuen (aardolie), gehydrogeneerde met stoom gekraakte nafta- | residues (petroleum), hydrogenated steam-cracked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 92061-97-7 | 295-511-0 | residuen (aardolie), katalytische kraak- | residues (petroleum), catalytic cracking | Ja | 2-12-2013 | 4 | |||||||
| 64741-67-9 | 265-069-3 | residuen (aardolie), katalytische reformator-fractioneerder | residues (petroleum), catalytic reformer fractionator | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 68478-13-7 | 270-792-2 | residuen (aardolie), katalytische reformator-fractioneerder-residu destillatie- | residues (petroleum), catalytic reformer fractionator residue distn. | Ja | 2-12-2013 | 4 | |||||||
| 68478-15-9 | 270-794-3 | residuen (aardolie), katalytische reformer C6-8 | residues (petroleum), C6-8 catalytic reformer | Ja | 2-12-2013 | 4, 64 | |||||||
| 68512-62-9 | 270-984-6 | residuen (aardolie), lichte vacuüm- | residues (petroleum), light vacuum | Ja | 2-12-2013 | 4 | |||||||
| 64742-78-5 | 265-181-2 | residuen (aardolie), met waterstof ontzwaveld atmosferische destillatietoren | residues (petroleum), hydrodesulfurized atmospheric tower | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64742-90-1 | 265-193-8 | residuen (aardolie), stoomgekraakt | residues (petroleum), steam-cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 90669-75-3 | 292-657-7 | residuen (aardolie), stoomgekraakt, destillaten | residues (petroleum), steam-cracked, distillates | Ja | 2-12-2013 | 4 | |||||||
| 68955-36-2 | 273-272-3 | residuen (aardolie), stoomgekraakt, harsachtig | residues (petroleum), steam-cracked, resinous | Ja | 2-12-2013 | 4 | |||||||
| 68513-69-9 | 271-013-9 | residuen (aardolie), stoomgekraakte lichte | residues (petroleum), steam-cracked light | Ja | 2-12-2013 | 4 | |||||||
| 102110-55-4 | 310-057-6 | residuen (aardolie), stoomgekraakte lichte, aromatisch | residues (petroleum), steam-cracked light, arom. | Ja | 2-12-2013 | 4, 64 | |||||||
| 92062-04-9 | 295-517-3 | residuen (aardolie), stoomgekraakte naftadestillatie | residues (petroleum), steam-cracked naphtha distn. | Ja | 2-12-2013 | 4 | |||||||
| 93763-85-0 | 297-905-8 | residuen (aardolie), stoomgekraakte uitputtend verhitte nafta | residues (petroleum), steam-cracked heat-soaked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 64741-80-6 | 265-081-9 | residuen (aardolie), thermisch gekraakt | residues (petroleum), thermal cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 90669-76-4 | 292-658-2 | residuen (aardolie), vacuüm-, lichte | residues (petroleum), vacuum, light | Ja | 2-12-2013 | 4 | |||||||
| 68783-13-1 | 272-187-9 | residuen (aardolie), verkookser-gasreiniger, bevat aromaten met gecondenseerde ringen | residues (petroleum), coker scrubber, condensed-ring-arom.-contg. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-75-9 | 265-076-1 | residuen (aardolie), waterstofgekraakt | residues (petroleum), hydrocracked | Ja | 2-12-2013 | 4 | |||||||
| 68478-17-1 | 270-796-4 | residuen (aardolie), zware uit verkookser afkomstige gasolie- en vacuümgasolie- | residues (petroleum), heavy coker gas oil and vacuum gas oil | Ja | 2-12-2013 | 4 | |||||||
| 68512-61-8 | 270-983-0 | residuen (aardolie), zware verkookser- en lichte vacuüm- | residues (petroleum), heavy coker and light vacuum | Ja | 2-12-2013 | 4 | |||||||
| 94114-46-2 | 302-681-2 | residuen (kool), vloeibaar solvent extracten | residues (coal), liq. solvent extn. | Ja | 2-12-2013 | 4, 62 | |||||||
| 92061-92-2 | 295-505-8 | residuen (koolteer), antraceenolie, destillatie- | residues (coal tar), anthracene oil distn. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 92061-93-3 | 295-506-3 | residuen (koolteer), creosootolie-destillatie | residues (coal tar), creosote oil distn. | Ja | 2-12-2013 | 4, 62 | |||||||
| 92061-94-4 | 295-507-9 | residuen (koolteer), pekdestillatie- | residues (coal tar), pitch distn. | Ja | 2-12-2013 | 4, 62 | |||||||
| 98219-64-8 | 308-733-0 | residuen stoomgekraakt, thermisch behandeld | residues, steam cracked, thermally treated | Ja | 2-12-2013 | 4 | |||||||
| 102110-49-6 | 310-050-8 | residuen van koper-ijzer-lood-nikkel mat, onoplosbaar in in zwavelzuur | residues, copper-iron-lead-nickel matte, sulfuric acid-insol. | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 34, 56 | ||||||
| 90669-74-2 | 292-656-1 | residue-oliën (aardolie), met water behandeld en met oplosmiddel van was ontdaan | residual oils (petroleum), hydrotreated solvent dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 93821-66-0 | 298-754-0 | residu-oliën (aardolie) | residual oils (petroleum) | Ja | 2-12-2013 | 4 | |||||||
| 100684-38-6 | 309-711-3 | residu-oliën (aardolie), behandeld met klei en met oplosmiddel van was ontdaan | residual oils (petroleum), clay-treated solvent-dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 100684-37-5 | 309-710-8 | residu-oliën (aardolie), behandeld met koolstof en met oplosmiddel van was ontdaan | residual oils (petroleum), carbon-treated solvent-dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 68478-16-0 | 270-795-9 | residu-oliën (aardolie), butaanverwijderingstoren | residual oils (petroleum), deisobutanizer tower | Ja | 2-12-2013 | 4, 64 | |||||||
| 91770-57-9 | 294-843-3 | residu-oliën (aardolie), katalytisch van was ontdaan | residual oils (petroleum), catalytic dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-41-2 | 265-143-5 | residu-oliën (aardolie), met klei behandeld | residual oils (petroleum), clay-treated | Ja | 2-12-2013 | 4, 61 | |||||||
| 64741-95-3 | 265-096-0 | residuoliën (aardolie), met oplosmiddel gedeasfalteerde | residual oils (petroleum), solvent deasphalted | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-01-4 | 265-101-6 | residu-oliën (aardolie), met oplosmiddel geraffineerde | residual oils (petroleum,) solvent-refined | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-62-7 | 265-166-0 | residu-oliën (aardolie), met oplosmiddel van was ontdaan | residual oils (petroleum), solvent-dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 64742-57-0 | 265-160-8 | residu-oliën (aardolie), met waterstof behandeld | residual oils (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 92061-86-4 | 295-499-7 | residu-oliën (aardolie), waterstof gekraakte met zuur behandelde met oplosmiddel van was ontdane | residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| respirabel kristallijn silicastof | respirable crystalline silica dust | 19-5-2021 | 44, 82 | ||||||||||
| 68952-80-7 | 273-174-0 | restgas (aardolie), direct door fractionering verkregen nafta, waterstofontzwavelaar | tail gas (petroleum), straight-run naphtha hydrodesulfurizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-10-1 | 269-630-3 | restgas (aardolie), direct uit fractionering verkregen destillaat, waterstofontzwavelaar, waterstofsulfide-vrij | tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-24-0 | 270-804-6 | restgas (aardolie), fractionator van gecombineerde producten uit katalytische kraker, katalytische reformer en waterstofontzwavelaar | tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-06-5 | 269-626-1 | restgas (aardolie), fractionator van waterstofontzwaveld destillaat en waterstofontzwavelde nafta, zuurvrij | tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-04-3 | 269-624-0 | restgas (aardolie), gasterugwinning-installatie | tail gas (petroleum), gas recovery plant | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-05-4 | 269-625-6 | restgas (aardolie), gasterugwinning-installatie, ethaanverwijdering | tail gas (petroleum), gas recovery plant deethanizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-08-7 | 269-628-2 | restgas (aardolie), geïsomeriseerde nafta, fractioneringsstabilisator | tail gas (petroleum), isomerized naphtha fractionation stabilizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-29-5 | 270-809-3 | restgas (aardolie), gekraakt destillaat, waterstofbehandelaar, afscheider | tail gas (petroleum), cracked distillate hydrotreater separator | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-01-0 | 269-620-9 | restgas (aardolie), gekraakt destillaat, waterstofbehandelingsstripper | tail gas (petroleum), cracked distillate hydrotreater stripper | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-32-0 | 270-813-5 | restgas (aardolie), gemengde stroom uit de verzadigd-gasinstallatie, rijk aan C4 | tail gas (petroleum), saturate gas plant mixed stream, C4-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68307-98-2 | 269-617-2 | restgas (aardolie), katalytisch gekraakt destillaat en katalytisch gekraakte nafta, fractioneringsabsorptievat | tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber | Ja | 2-12-2013 | 4, 59 | |||||||
| 68952-77-2 | 273-170-9 | restgas (aardolie), katalytisch gekraakt destillaat, naftastabilisator | tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-21-7 | 270-802-5 | restgas (aardolie), katalytisch gekraakte geklaarde olie en thermisch gekraakt vacuümresidu, fractioneringsterugloopvat | tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-22-8 | 270-803-0 | restgas (aardolie), katalytisch gekraakte nafta, stabilisatie-absorbeerder | tail gas (petroleum), catalytic cracked naphtha stabilization absorber | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-26-2 | 270-806-7 | restgas (aardolie), katalytisch gereformde nafta, fractioneringsstabilisator | tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-00-9 | 269-619-3 | restgas (aardolie), katalytisch gereformde nafta, fractioneringsstabilisator, waterstofsulfide-vrij | tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-28-4 | 270-808-8 | restgas (aardolie), katalytisch gereformde nafta-stabilisator | tail gas (petroleum), catalytic reformed naphtha stabilizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-27-3 | 270-807-2 | restgas (aardolie), katalytisch gereformde, nafta-afscheider | tail gas (petroleum), catalytic reformed naphtha separator | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-03-2 | 269-623-5 | restgas (aardolie), katalytisch kraken van gasolie, absorptievat | tail gas (petroleum), gas oil catalytic cracking absorber | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-25-1 | 270-805-1 | restgas (aardolie), katalytisch krakenrefractioneringsabsorbeerder | tail gas (petroleum), catalytic cracker refractionation absorber | Ja | 2-12-2013 | 4, 59 | |||||||
| 68952-79-4 | 273-173-5 | restgas (aardolie), katalytisch waterstof-ontzwavelde nafta, afscheider | tail gas (petroleum), catalytic hydrodesulfurized naphtha separator | Ja | 2-12-2013 | 4, 59 | |||||||
| 68307-99-3 | 269-618-8 | restgas (aardolie), katalytische polymerisatie van nafta, fractioneringsstabilisator | tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-11-2 | 269-631-9 | restgas (aardolie), propaan-propyleenalkyleringstoevoer, preparatieve ethaanverwijdering | tail gas (petroleum), propane-propylene alkylation feed prep deethanizer | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-09-8 | 269-629-8 | restgas (aardolie), stabilisator van lichte direct uit fractionering verkregen nafta, vrij van waterstofsulfide | tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-07-6 | 269-627-7 | restgas (aardolie), stripper van waterstofontzwavelde gasolie uit vacuümdestillatie, vrij van waterstofsulfide | tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68952-81-8 | 273-175-6 | restgas (aardolie), thermisch gekraakt destillaat, gasolie en nafta-absorptievat | tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber | Ja | 2-12-2013 | 4, 59 | |||||||
| 68952-82-9 | 273-176-1 | restgas (aardolie), thermisch gekraakte koolwaterstof, fractioneringsstabilisator, aardolieverkooksing | tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-34-2 | 270-815-6 | restgas (aardolie), thermische vacuümresiduenkraker | tail gas (petroleum), vacuum residues thermal cracker | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-33-1 | 270-814-0 | restgas (aardolie), verzadigd- gasterugwinningsinstallatie, rijk aan C1-2 | tail gas (petroleum), saturate gas recovery plant, C1-2-rich | Ja | 2-12-2013 | 4, 59 | |||||||
| 68308-12-3 | 269-632-4 | restgas (aardolie), waterstofontzwavelaar van gasolie uit vacuümdestillatie, vrij van waterstofsulfide | tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 59 | |||||||
| 68478-30-8 | 270-810-9 | restgas (aardolie), waterstofontzwaveling van door directe fractionering verkregen nafta, afscheider | tail gas (petroleum), hydrodesulfurized straight-run naphtha separator | Ja | 2-12-2013 | 4, 59 | |||||||
| 121-19-7 | 204-453-7 | roxarsone | roxarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 13446-72-5 | 236-601-1 | rubidium chromaat | rubidium chromate | MVP 1 | 0,05 mg/Nm3 | 7-12-2022 | 12, 56 | ||||||
| 13464-57-8 | 630-763-0 | rubidium diwaterstofarsenaat | rubidium dihydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 56, 91 | |||||
| 255881-94-8 | 401-850-9 | S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(of 9)-yl O-(isopropyl of isobutyl of 2-ethylhexyl) O-(isopropyl of isobutyl of 2-ethylhexyl) fosfordithioaat | S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 80 | |||||
| S-(tricyclo[5.2.1.0'2,6]deca-3-en-8(of 9)-yl) O-isopropyl O’-isopropyl fosfordithioaat | S-(tricyclo[5.2.1.0'2,6]deca-3-en- 8(or 9)-yl) O-isopropyl O’-isopropyl phosphorodithioate | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 55, 80 | |||||||
| 8006-80-2 | 616-892-5 | safrool | safrole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14216-75-2 | 238-076-4 | salpeterzuur nikkelzout | nitric acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12255-39-9 | 235-506-2 | samariumarsenide | samarium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| silicavezels, met name cristoballiet en tridymiet | silica fibers, in particular cristoballite and tridymite | sA.1 | 0,05 mg/Nm3 | 31-10-2023 | 44, 82 | ||||||||
| 409-21-2 | 206-991-8 | siliciumcarbide (vezelvormig) | silicon carbide | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 80 | |||||
| 102110-60-1 | 310-061-8 | slijm en slib, batterijschroot, antimoon- en loodrijk | slimes and Sludges, battery scrap, antimony- and lead-rich | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | ||||||
| 948-652-3 | slijm en slib, elektrolytische raffinage van tin-, lood- en zilverhoudende legeringen | slimes and sludges, electrolytic refining of tin, lead and silver containing alloy | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 56 | |||||||
| 98072-61-8 | 308-516-0 | slimes en sludges, edelmetaalraffinage | slimes and sludges, precious metal refining | MVP 1 | 0,05 mg/Nm3 | 28-05-2026 | 56, 125, 126 | ||||||
| 74869-22-0 | 278-012-2 | smeeroliën | lubricating oils | Ja | 2-12-2013 | 4, 61 | |||||||
| 93572-43-1 | 297-474-6 | smeeroliën (aardolie), basisoliën, paraffine-houdende | lubricating oils (petroleum), base oils, paraffinic | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-69-2 | 309-874-0 | smeeroliën (aardolie), C groter dan 25, solventgeëxtraheerd gedeasfalteerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 61 | |||||||
| 72623-86-0 | 276-737-9 | smeeroliën (aardolie), C15-30-, met waterstof behandelde uit neutrale olie verkregen | lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-70-5 | 309-875-6 | smeeroliën (aardolie), C17-32-, solventgeëxtraheerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 61 | |||||||
| 92045-42-6 | 295-423-2 | smeeroliën (aardolie), C17-35-, solvent-geëxtraheerd van was ontdaan met water behandeld | lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated | Ja | 2-12-2013 | 4, 61 | |||||||
| 97488-95-4 | 307-034-8 | smeeroliën (aardolie), C18-27-, waterstofgekraakt met solvent van was ontdaan | lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed | Ja | 2-12-2013 | 4, 61 | |||||||
| 94733-16-1 | 305-595-3 | smeeroliën (aardolie), C18-40-, met oplosmiddel van was ontdaan verkregen uit gehydrogeneerd raffinaat | lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based | Ja | 2-12-2013 | 4, 61 | |||||||
| 94733-15-0 | 305-594-8 | smeeroliën (aardolie), C18-40, met oplosmiddel van was ontdane waterstofgekraakte uit destillaat verkregen | lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-71-6 | 309-876-1 | smeeroliën (aardolie), C20-35,- solventgeëxtraheerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 61 | |||||||
| 72623-85-9 | 276-736-3 | smeeroliën (aardolie), C20-50-, met waterstof behandelde uit neutrale olie verkregen hoge viscositeit | lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity | Ja | 2-12-2013 | 4, 61 | |||||||
| 72623-87-1 | 276-738-4 | smeeroliën (aardolie), C20-50-, uit met waterstof behandelde neutrale olie verkregen | lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-72-7 | 309-877-7 | smeeroliën (aardolie), C24-50, solvent-geëxtraheerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 61 | |||||||
| 92045-43-7 | 295-424-8 | smeeroliën (aardolie), met waterstof gekraakte niet-aromatische met solvent gedeparaffineerde | lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined | Ja | 2-12-2013 | 4, 61 | |||||||
| 65996-79-4 | 266-013-0 | solventnafta (kool) | solvent naphtha (coal) | Ja | 2-12-2013 | 4, 60 | |||||||
| 148477-71-8 | 604-636-5 | spirodiclofen | spirodiclofen | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | ||||||
| 85508-00-5 | 287-424-1 | stannaan, dibutyl-, bis(C8-18 en C18-onverzadigd vetacyloxy) derivaten | stannane, dibutyl-, bis(C8-18 and C18-unsatd. fatty acyloxy) derivs. | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 56 | ||||||
| 91648-39-4 | 293-901-5 | stannaan, dioctyl-, bis (kokos-acyloxy)derivaten | stannane, dioctyl-, bis (coco acyloxy) derivs. | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 56 | ||||
| 97674-02-7 | 641-308-0 | stannaan, tributyl(1-ethoxyethenyl)- | stannane, tributyl(1-ethoxyethenyl)- | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 100073-15-2 | 873-088-9 | stannaan, tributyl(1-methylethenyl)- | stannane, tributyl(1-methylethenyl)- | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 56, 68 | ||||||
| 20420-43-3 | 891-892-8 | stannaan, tributyl(2-ethoxyethenyl)-, (Z)- | stannane, tributyl(2-ethoxyethenyl)-, (Z)- | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 15, 56 | ||||||
| 19411-60-0 | 694-756-4 | stannaan, tributylethyl- | stannane, tributylethyl- | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 56 | ||||||
| 8052-41-3 | 232-489-3 | stoddard-oplosmiddel | stoddard solvent | Ja | 2-12-2013 | 4, 64 | |||||||
| 68476-32-4 | 270-674-0 | stookolie, zware stookolie, gasoliën verkregen uit residuen van direkte destillatie, hoog zwavelgehalte | fuel oil, residues-straight-run gas oils, high-sulfur | Ja | 2-12-2013 | 4 | |||||||
| 2457-02-5 | 219-536-3 | strontium bis(2-ethylhexanoaat) | strontium bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 68, 80 | ||||||
| 61462-16-6 | strontiumarsenide (SrAs3) | strontium arsenide (SrAs3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 15195-06-9 | strontiumarseniet | strontium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 56, 91 | ||||||
| 91724-16-2 | strontiumarseniet (Sr(As2O4)) | strontium arsenite (Sr(As2O4)) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | ||||||
| 7789-06-2 | 232-142-6 | strontiumchromaat | strontium chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 56 | ||||
| 100258-44-4 | 309-388-9 | strychnidin-10-één, arseniet (1:1) | strychnidin-10-one, arsenite (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 80879-64-7 | 279-614-8 | strychnidin-10-one, verbinding met methylarsonaat (1:1) | strychnidin-10-one, compd. with methylarsonate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 10476-82-1 | 233-970-0 | strychnine arsenaat | strychnine arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 10476-87-6 | 233-973-7 | strychnine dimethylarsinaat | strychnine dimethylarsinate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 95-06-7 | 202-388-9 | sulfallaat | sulfallate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 618-82-6 | 210-564-1 | sulfarfenamine | sulfarsphenamine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 56, 91 | |||||
| 946578-00-3 | 807-366-8 | sulfoxaflor | sulfoxaflor | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 95, 97 | |||||
| 135821-03-3 | syn-dodecachloorpentacyclooctadecadieen | syn-dodecachloropentacyclooctadecadiene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-5-2019 | 56 | |||||
| 101316-83-0 | 309-885-0 | teer, bruinkool | tar brown-coal | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22 | |||||
| 101316-84-1 | 309-886-6 | teer, bruinkool lage temperatuur | tar, brown-coal, low-temp. | Ja | 2-12-2013 | 4 | |||||||
| 92062-20-9 | 295-535-1 | teer, kool hoge temperatuur, destillatie- en opslagresiduen | tar, coal, high-temp., distn. and storage residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 100684-51-3 | 309-726-5 | teer, kool hoge temperatuur, residuen | tar, coal, high-temp., residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 65996-90-9 | 266-025-6 | teer, kool lage temperatuur | tar, coal, low-temp. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22 | |||||
| 101316-85-2 | 309-887-1 | teer, kool lage temperatuur, destillatieresiduen | tar, coal, low-temp., distn. residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 65996-89-6 | 266-024-0 | teer, kool, hoge temperatuur | tar, coal, high-temp. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22 | |||||
| 68990-61-4 | 273-615-7 | teer, kool-, hoge temperatuur, hoge gehaltes aan vaste stof | tar, coal, high-temp., high-solids | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 62 | |||||
| 91082-50-7 | 293-764-1 | teer, kool, opslagresiduen | tar, coal, storage residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 8007-45-2 | 232-361-7 | teer, steenkool | tar, coal | Ja | 2-12-2013 | 4 | |||||||
| 92062-27-6 | 295-541-4 | teerbasen kool anilinefractie | tar bases, coal, aniline fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 92062-28-7 | 295-543-5 | teerbasen kool collidinefractie | tar bases, coal, collidine fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 92062-29-8 | 295-544-0 | teerbasen kool destillatieresiduen | tar bases, coal, distn. residues | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 68513-87-1 | 271-020-7 | teerbasen, chinolinederivaten | tar bases, quinoline derivs. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 70321-67-4 | 274-560-1 | teerbasen, kool, fractie van chinolinederivaten | tar bases, coal, quinoline derivs. fraction | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91082-52-9 | 293-766-2 | teerbasen, kool, lutidinefractie | tar bases, coal, lutidine fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 92062-33-4 | 295-548-2 | teerbasen, kool, picolinefractie | tar bases, coal, picoline fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 65996-84-1 | 266-018-8 | teerbasen, kool, ruw | tar bases, coal, crude | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 91082-53-0 | 293-767-8 | teerbasen, kool, toluïdinefractie | tar bases, coal, toluidine fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 101316-87-4 | 309-889-2 | teeroliën kool lage temperatuur | tar oils, coal, low-temp. | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 94114-40-6 | 302-674-4 | teeroliën, bruinkool | tar oils, brown-coal | Ja | 2-12-2013 | 4, 60 | |||||||
| 65996-82-9 | 266-016-7 | teeroliën, kool | tar oils, coal | Ja | 2-12-2013 | 4, 60 | |||||||
| 84989-07-1 | 284-896-0 | teerzuren 3,5-xylenolfractie | tar acids, 3,5-xylenol fraction | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 92062-22-1 | 295-536-7 | teerzuren bruinkoolvergassing | tar acids, brown-coal gasification | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 96690-55-0 | 306-251-5 | teerzuren destillatieresiduen | tar acids, distn. residues | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 84989-03-7 | 284-891-3 | teerzuren ethylfenolfractie | tar acids, ethylphenol fraction | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 92062-26-5 | 295-540-9 | teerzuren kresylhoudend | tar acids, cresylic | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 68555-24-8 | 271-418-0 | teerzuren kresylhoudend residuen | tar acids, cresylic, residues | Ja | 2-12-2013 | 4, 60, 62 | |||||||
| 84989-04-8 | 284-892-9 | teerzuren methylfenolfractie | tar acids, methylphenol fraction | Ja | 2-12-2013 |