Totale ZZS-lijst Risico's van Stoffen
Totale lijst van Zeer Zorgwekkende Stoffen
- Versie
- 30-10-2025
- Bron
- website "Risico’s van stoffen": https://rvs.rivm.nl
Hieronder vindt u het overzicht van alle afzonderlijke Zeer Zorgwekkende Stoffen (ZZS) in het Risico's van stoffen zoeksysteem.
U kunt de lijst exporteren voor gebruik in een spreadsheet via de knop "Download als Excel bestand".
Lees meer over ZZS.
Vragen of opmerkingen over de lijst kunt u indienen via de Helpdesk "Risico’s van stoffen".
| CAS-nummer | EG-nummer | Nederlandse stofnaam | Engelse stofnaam | ZZS volgens EU gevaarsindeling | ZZS volgens REACH SVHC | ZZS volgens REACH Restricties | ZZS volgens KRW | ZZS volgens OSPAR | ZZS volgens EU-POP Verordening | Stofklasse voor luchtemissies | Emissiegrenswaarde | Datum toevoeging | Voetnoot |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1257737-04-4 | 693-959-5 | (~18~O)diarsoxaan-1,3-(~18~O_2_)dion | (~18~O)diarsoxane-1,3-(~18~O_2_)dione | Ja | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 57, 92 | |||||
| 14149-58-7 | 689-532-8 | (~2~H_3_)boorzuur | (~2~H_3_)boric acid | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 36861-47-9 | 253-242-6 | (±)-1,7,7-trimethyl-3-[(4-methylfenyl)methyleen]bicyclo[2.2.1]-2-heptanon (4-methylbenzylideenkamfer) | (±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one (4-Methylbenzylidenecamphor) | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | |||||
| (±)-1,7,7-trimethyl-3-[(4-methylfenyl)methyleen]bicyclo[2.2.1]-2-heptanon, omvattend elk van de individuele isomeren en/of combinaties daarvan | (±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one covering any of the individual isomers and/or combinations thereof (4-MBC) | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | |||||||
| 41766-73-8 | (1,1'-bifenyl)-4,4'-diamine, dihydrofluoride | (1,1'-biphenyl)-4,4'-diamine, dihydrofluoride | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 57, 69 | |||||||
| 52754-64-0 | (1,1'-bifenyl)-4,4'-diamine, monoazijnzuur | (1,1'-biphenyl)-4,4'-diamine, monoacetate | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 57, 69 | |||||||
| 66836-18-8 | (1,1'-bifenyl)-ar,ar',4,4'-tetramine | (1,1'-biphenyl)-ar,ar',4,4'-tetramine | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 57, 69 | |||||||
| 2230140-59-5 | 878-583-3 | (1,3-dimesitylimidazol-2-ylideen)nikkel(0) bis(di-tert-butylfumaraat) | (1,3-dimesitylimidazol-2-ylidene)nickel(0) bis(di-tert-butyl fumarate) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 32488-44-1 | 685-232-6 | (13C6)benzeen | (13C6)benzene | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 57, 68 | ||||||
| 80220-63-9 | 800-604-1 | (1H,1H,2H,2H-heptadecafluordec-1-yl)fosfonzuur | (1H,1H,2H,2H-Heptadecafluorodec-1-yl)phosphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 179055-21-1 | 621-950-8 | (1-methyl-1H-pyrazol-4-yl)tributylstannaan | (1-Methyl-1H-pyrazol-4-yl)tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 95342-41-9 | (1R,3E,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1R,3E,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | ||||||
| 852541-21-0 | (1R,3Z,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1R,3Z,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | ||||||
| 741687-98-9 | (1R,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1R,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | ||||||
| 2440-02-0 | (1R,4S,5S)-1,2,3,4,5,7,7-heptachloorbicyclo[2.2.1]hept-2-een | (1R,4S,5S)-1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hept-2-ene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 115850-69-6 | (1RS,2SR,5RS)-2-(4-chloorbenzyl)-5-isopropyl-1- (1H-1,2,4-triazool-1- ylmethyl)cyclopentanol | (1RS,2SR,5RS)-2-(4-chlorobenzyl)-5-isopropyl-1- (1H-1,2,4-triazol-1-ylmethyl)cyclopentanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | ||||||
| 115937-89-8 | (1RS,2SR,5SR)-2-(4-chloorbenzyl)-5-isopropyl-1- (1H-1,2,4-triazool-1- ylmethyl)cyclopentanol | (1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1- (1H-1,2,4-triazol-1-ylmethyl)cyclopentanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | ||||||
| 852541-30-1 | (1S,3E,4R)-1,7,7-trimethyl-3-(4- methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1S,3E,4R)-1,7,7-trimethyl-3-(4- methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | ||||||
| 852541-25-4 | (1S,3Z,4R)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (1S,3Z,4R)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | ||||||
| 46389-47-3 | 894-589-9 | (2,2'-bipyridine)nikkel(II)dibromide | (2,2'-Bipyridine)nickel(II) dibromide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 93776-15-9 | 297-941-4 | (2-carboxylatoethyl)(dimethyl)[[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl)pentadecyl]amino]propyl]ammonium | (2-carboxylatoethyl)(dimethyl)[[[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl]amino]propyl]ammonium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 93776-12-6 | 297-938-8 | (2-carboxylatoethyl)(dimethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluor-2-hydroxypentadecyl)amino]propyl]ammonium | (2-carboxylatoethyl)(dimethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl)amino]propyl]ammonium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 93776-13-7 | 297-939-3 | (2-carboxylatoethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluor-2-hydroxytridecyl)amino]propyl]dimethylammonium | (2-carboxylatoethyl)[3-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl)amino]propyl]dimethylammonium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 541-25-3 | (2-chloorethenyl)arseendichloride | (2-chloroethenyl)arsonous dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 40722-80-3 | 429-740-6 | (2-chloorethyl)(3-hydroxypropyl)ammoniumchloride | (2-chloroethyl)(3-hydroxypropyl)ammonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1239414-55-1 | (2E)-methyl 1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluorhept-2-een-4-yl ether | (2E)-methyl 1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluorohept-2-en-4-yl ether | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 84852-39-1 | 284-351-7 | (2-ethylhexanoato-O)(isodecanoato-O)nikkel | (2-ethylhexanoato-O)(isodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85508-45-8 | 287-470-2 | (2-ethylhexanoato-O)(isononanoato-O)nikkel | (2-ethylhexanoato-O)(isononanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85135-77-9 | 285-698-7 | (2-ethylhexanoato-O)(neodecanoato-O)nikkel | (2-ethylhexanoato-O)(neodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3757-88-8 | 628-194-8 | (2-fenyl-1-ethynyl)tributyltin | (2-Phenyl-1-ethynyl)tributyltin | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1664-98-8 | 216-775-5 | (2H)formaldehyde | (2H)formaldehyde | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 57, 68 | ||||||
| 62314-22-1 | 263-502-0 | (2-hydroxypropyl)trimethylammonium 2-ethylhexanoaat | (2-hydroxypropyl)trimethylammonium 2-ethylhexanoate | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 170682-50-5 | 688-548-2 | (2-methyl-2H-pyrazol-3-yl)tributyltin | (2-Methyl-2H-pyrazol-3-yl)tributyltin | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 143142-90-9 | 604-331-7 | (2R)-(+)-3,3,3-trifluor-1,2-propeenoxide | (2R)-(+)-3,3,3-trifluoro-1,2-propenoxide | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 130025-34-2 | 603-381-7 | (2S)-(-)-3,3,3-trifluor-1,2-propeenoxide | (2S)-(-)-3,3,3-trifluoro-1,2-propenoxide | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1448347-49-6 | 811-226-1 | (2S)-1-(4-cyano-2-pyridinyl)-5-oxo-L-prolyl-2-(2-chloorfenyl)-N-(3,3-difluorcyclobutyl)-N2-(5-fluor-3-pyridinyl)-glycinamide | (2S)-1-(4-cyano-2-pyridinyl)-5-oxo-L-prolyl-2-(2-chlorophenyl)-N-(3,3-difluorocyclobutyl)-N2-(5-fluoro-3-pyridinyl)-glycinamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 135312-20-8 | 155-849-0 | (2S)-2-[4-(trifluormethyl)fenyl]oxiraan | (2S)-2-[4-(trifluoromethyl)phenyl]oxirane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 1217486-61-7 | 806-598-7 | (2S)-N1-{4-methyl-5-[2-(1,1,1-trifluor-2-methylpropaan-2-yl)pyridine-4-yl]-1,3-thiazool-2-yl}pyrrolidine-1,2-dicarboxamide | (2S)-N1-{4-methyl-5-[2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridin-4-yl]-1,3-thiazol-2-yl}pyrrolidine-1,2-dicarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 56124-62-0 | 680-664-1 | (2Scis)-2-[1,2,3,4,6,11-hexahydro-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4[[2,3,6-trideoxy-3-[(trifluoracetyl)amino]-alfa-L-lyxo-hexopyranosyl]oxyl]-2-naftacenyl]-2-oxoethyl pentanoaat | (2Scis)-2-[1,2,3,4,6,11-hexahydro-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4[[2,3,6-trideoxy-3-[(trifluoroacetyl)amino]-alpha-L-lyxo-hexopyranosyl]oxyl]-2-naphtacenyl]-2-oxoethyl pentanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 692-49-9 | 700-651-7 | (2Z)-1,1,1,4,4,4-hexafluor-2-buteen | (2Z)-1,1,1,4,4,4-hexafluorobut-2-ene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 163451-81-8 | 642-273-4 | (2Z)-2-cyaan-3-hydroxy-N-[4-(trifluormethyl)fenyl]but-2-eenamide | (2Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]but-2-enamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaantriol | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) silanetriol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98 | |||||||
| (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaantriol en al zijn mono-, di- of tri-O-(alkyl)derivaten | (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silanetriol and any of its mono-, di- or tri-O-(alkyl) derivatives | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98, 100 | |||||||
| 1203709-76-5 | 694-755-9 | (3-broomfenyl)(mesityl)jodonium trifluormethaansulfonaat | (3-bromophenyl)(mesityl)iodonium trifluoromethanesulfonate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 207569-13-9 | 693-353-0 | (3E)-1,1,1,5,5,5-hexafluor-4-hydroxypent-3-en-2-on--nikkel--water (2/1/1) | (3E)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one--nickel--water (2/1/1) | Ja | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57, 96 | |||||
| 1782069-81-1 | 701-394-3 | (3E)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanon | (3E)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 81 | |||||
| 1239414-45-9 | (3E)-methyl-1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluorhept-4-een-3-yl ether | (3E)-methyl -1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluorohept-4-en-3-yl ether | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 1802323-89-2 | 840-627-4 | (3β)-17-(1,1,1-trifluormethaansulfonaat)-androsta-5,16-dieen-3,17-diol, 3-(2,2,2-trifluoracetaat) | (3β)-17-(1,1,1-trifluoromethanesulfonate)-androsta-5,16-diene-3,17-diol, 3-(2,2,2-trifluoroacetate) | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 3798-17-2 | 840-626-9 | (3β)-3-[(2,2,2-trifluoracetyl)oxy]-5-androsteen-17-one | (3β)-3-[(2,2,2-trifluoroacetyl)oxy]-androst-5-en-17-one | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 618-25-7 | (4-((2-Amino-2-oxoethyl)amino)fenyl)arsonzuur | (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 94232-26-5 | 303-952-8 | (4-aminofenyl)arsonzuur, verbinding met piperazine (1:1) | (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 164656-22-8 | 112-452-7 | (4aR,4bS,6aS,7S,9aS,9bS,11aR)-N-[2,5-bis(trifluormethyl)fenyl]hexadecahydro-4a,6a-dimethyl-2-oxo-1H-indeno[5,4-f]chinoline-7-carbonzuuramide (9CI, ACI) | (4aR,4bS,6aS,7S,9aS,9bS,11aR)- N-[2,5-Bis(trifluoromethyl)phenyl]hexadecahydro-4a,6a-dimethyl-2-oxo-1H-indeno[5,4-f]quinoline-7-carboxamide (9CI, ACI) | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 17151-48-3 | 106-286-4 | (4-chloorfenyl)tributylstannaan | (4-Chlorophenyl)tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 105024-66-6 | 405-020-7 | (4-ethoxyfenyl)(3-(3-fenoxy-4-fluorfenyl)propyl)dimethylsilaan | (4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 910606-39-2 | (4-methylfenyl)difenyl-sulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, (4-methylphenyl)diphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 154598-52-4 | 620-492-6 | (4S)-6-chloor-4-(2-cyclopropylethynyl)-4-(trifluormethyl)-2,4-dihydro-1H-3,1-benzoxazin-2-on | (4S)-6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazin-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 108225-03-2 | 402-060-7 | (6-(4-hydroxy-3-(2-methoxyfenylazo)-2-sulfonato-7-naftylamino)-1,3,5-triazine-2,4-diyl)bis[(amino-1-methylethyl)ammonium]-formaat | (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 153004-31-0 | 642-948-3 | (7.alpha.,17.beta.)- 7-[9-[(4,4,5,5,5-pentafluorpentyl)thio]nonyl]-estra-1,3,5(10)-trieen-3,17-diol | (7.alpha.,17.beta.)- 7-[9-[(4,4,5,5,5-pentafluoropentyl)thio]nonyl]-estra-1,3,5(10)-triene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 98008-06-1 | 670-947-8 | (7.alpha.,17.beta.)-7-[9-[(4,4,5,5,5-pentafluorpentyl)sulfonyl]nonyl]-estra-1,3,5(10)-trieen-3,17-diol | (7.alpha.,17.beta.)-7-[9-[(4,4,5,5,5-pentafluoropentyl)sulfonyl]nonyl]-estra-1,3,5(10)-triene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 935-958-7 | (7alfa,17beta)-7-[9-[(4,4,5,5,5-pentafluorpentyl)sulfinyl]nonyl]-estra-1,3,5(10)-trieen-6-one-3,17-diol | (7alpha,17beta)-7-[9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl]-estra-1,3,5(10)-triene-6-one-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 415927-29-6 | 642-947-8 | (7R,13S,17S)-13-methyl-3-oxo-7-(9-((4,4,5,5,5-pentafluorpentyl)thio)nonyl)-2,3,6,7,8,9,10,11,12,13,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]fenantreen-17-yl acetaat | (7R,13S,17S)-13-methyl-3-oxo-7-(9-((4,4,5,5,5-pentafluoropentyl)thio)nonyl)-2,3,6,7,8,9,10,11,12,13,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1107606-70-1 | 837-287-4 | (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluorpentylsulfanyl)nonyl]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]fenantreen-6-on | (7S,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1221256-46-7 | 807-171-8 | (7α,17β)-3-methoxy-7-[9-[(4,4,5,5,5-pentafluorpentyl)sulfinyl]nonyl]estra-1,3,5(10)-trieen-17-ol | (7α,17β)-3-methoxy-7-[9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl]estra-1,3,5(10)-trien-17-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 948-724-4 | (8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluorpentylsulfinyl)nonyl]-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]fenantreen-3,17-diol | (8R,9S,13S,14S,17S)-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 948-723-9 | (8R,9S,13S,14S,17S)-13-methyl-7-[9-[9-(4,4,5,5,5-pentafluorpentylsulfinyl)nonylsulfinyl]nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]fenantreen-3,17-diol | (8R,9S,13S,14S,17S)-13-methyl-7-[9-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonylsulfinyl]nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 14516-71-3 | 238-523-3 | (butylamine)[[2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)fenolato]](2-)-O,O',S]nikkel | (butylamine)[[2,2'-thiobis[4-(1,1,3,3-tetramethylbutyl)phenolato]](2-)-O,O',S]nickel | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 94113-53-8 | 302-587-1 | (difenylarsino)dimethylgallium | (diphenylarsino)dimethylgallium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 82413-20-5 | 428-010-4 | (E)-3-[1-[4-[2-(dimethylamino)ethoxy]fenyl]-2-fenylbut-1-enyl]fenol | (E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1563176-58-8 | 857-955-9 | (E)-isopropyl 7-((1R,2R,3R,5S)-2-((E)-3,3-difluor-4-fenoxy-1-buteen-1-yl)-3,5-dihydroxycyclopentyl)-5-heptenoaat | (E)-isopropyl 7-((1R,2R,3R,5S)-2-((E)-3,3-difluoro-4-phenoxybut-1-en-1-yl)-3,5-dihydroxycyclopentyl)hept-5-enoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 96-09-3 | 202-476-7 | (epoxyethyl)benzeen | styrene oxide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 186043-67-4 | 809-871-9 | (HP-2721)hexakis(1H,1H,9H-perfluornonyloxy)fosfazine | (HP-2721)HEXAKIS(1H,1H,9H-PERFLUORONONYLOXY)PHOSPHAZINE | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 84852-36-8 | 284-348-0 | (isodecanoato-O)(isononanoato-O)nikkel | (isodecanoato-O)(isononanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85166-19-4 | 285-909-2 | (isodecanoato-O)(isooctanoato-O)nikkel | (isodecanoato-O)(isooctanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85508-46-9 | 287-471-8 | (isononanoato-O)(isooctanoato-O)nikkel | (isononanoato-O)(isooctanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85551-28-6 | 287-592-6 | (isononanoato-O)(neodecanoato-O)nikkel | (isononanoato-O)(neodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84852-35-7 | 284-347-5 | (isooctanoato-O)(neodecanoato-O)nikkel | (isooctanoato-O)(neodecanoato-O)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12275-07-9 | 235-549-7 | (maleato)trioxotetralood | (maleato)trioxotetralead | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 57 | ||||||
| 118658-99-4 | 401-500-5 | (methyleenbis(4,1-fenyleenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridiniumdichloridedihydrochloride | (methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 59447-55-1 | 261-767-7 | (pentabroomfenyl)methylacrylaat | (pentabromophenyl)methyl acrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1539314-06-1 | 855-390-2 | (R)-1-(1-(methylsulfonyl)-2-propanyl)-4-(trifluormethyl)-1H-indool-5-carbonitriel | (R)-1-(1-(methylsulfonyl)propan-2-yl)-4-(trifluoromethyl)-1H-indole-5-carbonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 71411-66-0 | 275-370-1 | (R)-12-hydroxyoliezuur, barium cadmium zout | (R)-12-hydroxyoleic acid, barium cadmium salt | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 86 | ||||||
| 51594-55-9 | 424-280-2 | (R)-1-chloor-2,3-epoxypropaan | R-1-chloro-2,3-epoxypropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 5543-58-8 | 226-908-9 | (R)-3-(1-fenyl-3-oxobutyl)-4-hydroxy-2-benzopyron | (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 834153-87-6 | 824-769-4 | (R)-4-((2-(5-(2-fluor-3-methoxyfenyl)-3-(2-fluor-6-(trifluormethyl)benzyl)-4-methyl-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)-1-fenylethyl)amino)butanoaat | (R)-4-((2-(5-(2-fluoro-3-methoxyphenyl)-3-(2-fluoro-6-(trifluoromethyl)benzyl)-4-methyl-2,6-dioxo-2,3-dihydropyrimidin-1(6H)-yl)-1-phenylethyl)amino)butanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 2408840-26-4 | 959-399-3 | (R)-5-(4-(3-(fluormethyl)azetidin-1-yl)ethoxy)fenyl)-8-(trifluormethyl)-5H-chromeno[4,3-c]chinolin-2-ol | (R)-5-(4-(2-(3-(fluoromethyl)azetidin-1-yl)ethoxy)phenyl)-8-(trifluoromethyl)-5H-chromeno[4,3-c]quinolin-2-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 5543-57-7 | 226-907-3 | (S)-3-(1-fenyl-3-oxobutyl)-4-hydroxy-2-benzopyron | (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64681-08-9 | 265-010-1 | (S)-dichloor[2-[[(2,3-dihydroxypropoxy)hydroxyfosfinyl]oxy]triethylmethylammoniumaat]cadmium | (S)-dichloro[2-[[(2,3-dihydroxypropoxy)hydroxyphosphinyl]oxy]triethylmethylammoniumato]cadmium | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 57, 86 | ||||||
| 70987-78-9 | 417-210-7 | (S)-oxiraanmethanol 4-methylbenzeensulfonaat | (S)-oxiranemethanol, 4-methylbenzene-sulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 421555-73-9 | (thiodi-4,1-fenyleen)bis[difenyl-sulfonium, zout met tridecafluorhexaansulfonzuur | sulfonium, (thiodi-4,1-phenylene)bis[diphenyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 27490-33-1 | 631-062-2 | (tributylstannyl)methanol | (tributylstannyl)methanol | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 75166-31-3 | (αR)-4-(1,1-dimethylethyl)-α-methylbenzeenpropanal | (αR)-4-(1,1-dimethylethyl)-α-methylbenzenepropanal | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||||
| 75166-30-2 | (αS)-4-(1,1-dimethylethyl)-α-methylbenzeenpropanal | (αS)-4-(1,1-dimethylethyl)-α-methylbenzenepropanal | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||||
| 1557288-04-6 | 809-158-2 | [(2-aminoethoxy)methyl]tributylstannaan | [(2-aminoethoxy)methyl]tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 115375-60-5 | 806-821-8 | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(trifluormethylsulfonyloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]fenantreen-3-yl]acetaat | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-(trifluoromethylsulfonyloxy)-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1853279-29-4 | 866-802-5 | [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluorpentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]fenantreen-3-yl]boorzuur | [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]boronic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 100045-83-8 | 808-345-6 | [(methoxymethoxy)methyl]tributylstannaan | [(Methoxymethoxy)methyl]tributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 29977-13-7 | 249-987-1 | [[N,N'-ethyleenbis[glycinaat]](2-)-N,N',O,O']cadmium | [[N,N'-ethylenebis[glycinato]](2-)-N,N',O,O']cadmium | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 86 | ||||||
| 65405-96-1 | 265-748-4 | [µ-[carbonato(2-)-O:O’]] dihydroxytrinikkel | [µ-[carbonato(2-)-O:O’]] dihydroxy trinickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 77253-67-9 | 278-649-6 | [1,1-2H2]-2,2,2-trifluorethaan-1-[2H]ol | [1,1-2H2]-2,2,2-trifluoroetane-1-[2H]ol | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 38668-12-1 | [1,1'-bifenyl]-4,4'-diamine, perchloraat | [1,1'-biphenyl]-4,4'-diamine, perchlorate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 57, 69 | |||||||
| 67292-34-6 | 625-604-7 | [1,1'-bis(difenylfosfino)ferroceen]dichloornikkel(II) | [1,1'-bis(diphenylphosphino)ferrocene]dichloronickel(II) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 14647-21-3 | 112-189-8 | [1,2-bis(difenylfosfino)ethaan]dibromonikkel(II) | [1,2-Bis(diphenylphosphino)ethane]dibromonickel(II) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 903592-98-3 | 679-532-6 | [1,3-bis(2,6-diisopropylfenyl)imidazool-2-ylideen]trifenylfosfine nikkel(II)dichloride | [1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]triphenylphosphine nickel(II) dichloride | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 15629-93-3 | 112-188-2 | [1,3-bis(difenylfosfino)propaan]dibromonikkel | [1,3-Bis(diphenylphosphino)propane]dibromonickel | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 13813-79-1 | 237-478-7 | [10B]orthoboorzuur | [10B]orthoboric acid | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 13813-78-0 | 627-827-5 | [11B]orthoboorzuur | [11B]orthoboric acid | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 23582-06-1 | 245-758-5 | [2-(difenylarsino)ethyl]difenylfosfine | [2-(diphenylarsino)ethyl]diphenylphosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 14055-02-8 | 237-893-3 | [29H,31H-ftalocyaninato(2-)-N29,N30,N31,N32]nikkel | [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 462996-04-9 | 103-340-9 | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]difenylfosfine | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl] diphenylphosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 911027-68-4 | [4-[(2-methyl-1-oxo-2-propen-1-yl)oxy]fenyl]difenyl-sulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, [4-[(2-methyl-1-oxo-2-propen-1-yl)oxy]phenyl]diphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 911027-69-5 | [4-[(2-methyl-1-oxo-2-propenyl)oxy]fenyl]difenyl-sulfonium, zout met tridecafluorhexaansulfonzuur (1:1) | sulfonium, [4-[(2-methyl-1-oxo-2-propenyl)oxy]phenyl]diphenyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 5806-89-3 | 227-365-0 | [4-[(4,6-diamino-1,3,5-triazine-2-yl)amino]fenyl]arsonzuur | [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12607-70-4 | 235-715-9 | [carbonato(2-)] tetrahydroxytrinikkel | [carbonato(2-)] tetrahydroxytrinickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 69011-06-9 | 273-688-5 | [ftalato(2-)]dioxotrilood | [phthalato(2-)]dioxotrilead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 264921-97-3 | 678-456-0 | [N-[1-[2-(2-pyridylcarboxamido)fenyl]ethylideen]glycinato]nikkel | [N-[1-[2-(2-pyridylcarboxamido)phenyl]ethylidene]glycinato]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 847654-16-4 | 679-701-4 | [N-[alfa-[2-(dibutylglycinamido)fenyl]benzylideen]glycinato]nikkel | [N-[alpha-[2-(dibutylglycinamido)phenyl]benzylidene]glycinato]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 847654-17-5 | 678-458-1 | [N-[alfa-[2-(piperidinoacetamido)fenyl]benzylideen]glycinato]nikkel | [N-[alpha-[2-(piperidinoacetamido)phenyl]benzylidene]glycinato]nickel | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 961-481-9 | 1-(1-nitrosopiperidine-2-yl)methanamine; trifluorazijnzuur | 1-(1-nitrosopiperidin-2-yl)methanamine; trifluoroacetic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 214353-17-0 | 433-580-2 | 1-(2-amino-5-chloorfenyl)-2,2,2-trifluor-1,1-ethaandiol hydrochloride [met 0,1 procent of meer 4-chlooraniline (EC-nr. 203-401-0)] | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride, [containing ≥ 0.1 % 4-chloroaniline (EC No 203-401-0)] | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 244235-47-0 | 627-083-1 | 1-(2-hydroxy-5-nonyl(vertakt)-fenyl)ethanon oxime | 1-(2-hydroxy-5-nonyl(branched)-phenyl)ethanone oxime | MVP 1 | 0,05 mg/Nm3 | 16-7-2020 | 57, 74 | ||||||
| 544418-04-4 | 620-596-1 | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyl)-3,1-benzoxazine-2,4(1H)-dion | 1-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)-3,1-benzoxazine-2,4(1H)-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 468-770-4 | 1-(4-butoxy-1-naftalenyl)tetrahydrothiofenium 1,1,2,2,3,3,4,4,4-nonafluor-1-butaansulfonaat | 1-(4-butoxy-1-naphthalenyl)tetrahydrothiophenium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | |||||
| 475207-59-1 | 641-758-8 | 1-(4-chloor-3-(trifluormethyl)fenyl)-3-(4-((2-(methylcarbamoyl)-4-pyridinyl)oxy)fenyl)urea mono(4-methylbenzeensulfonaat) | 1-(4-chloro-3-(trifluoromethyl)phenyl)-3-(4-((2-(methylcarbamoyl)pyridin-4-yl)oxy)phenyl)urea mono(4-methylbenzenesulfonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 865758-37-8 | 624-005-8 | 1-(4-methoxyfenyl)-1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]-1-fenylmethylchloride | 1-(4-Methoxyphenyl)-1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl]-1-phenylmethyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 71356-38-2 | 275-354-4 | 1-(carboxylatomethyl)-1-(2-hydroxyethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluor-1-oxodecyl)piperazinium | 1-(carboxylatomethyl)-1-(2-hydroxyethyl)-4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro-1-oxodecyl)piperazinium | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1462414-59-0 | 1-(carboxymethyl)-4-[2-[4-[4-(2,2-difenylethenyl)fenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]ethenyl]-chinolinium, tridecafluorhexaansulfonaat (1:1) | quinolinium, 1-(carboxymethyl)-4-[2-[4-[4-(2,2-diphenylethenyl)phenyl]-1,2,3,3a,4,8b-hexahydrocyclopent[b]indol-7-yl]ethenyl]-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 882186-02-9 | 118-456-5 | 1-(diacetooxyjodo)-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzeen | 1-(DIACETOXYIODO)-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-HEPTADECAFLUORODECYL)BENZENE | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 76733-77-2 | 1,1'-(2,2,2-trichloorethylideen)bis[2-methoxy-benzeen] | 1,1'-(2,2,2-trichloroethylidene)bis[2-methoxy-benzene] | Ja | MVP 1 | 0,05 mg/Nm3 | 57 | |||||||
| 97416-84-7 | 306-832-3 | 1,1'-(isopropylideen)bis[3,5-dibroom-4-(2,3-dibroom-2-methylpropoxy)benzeen] | 1,1'-(isopropylidene)bis[3,5-dibromo-4-(2,3-dibromo-2-methylpropoxy)benzene] | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 57 | ||||||
| 65510-55-6 | 265-800-6 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-nonacosafluor-16-joodhexadecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14-nonacosafluoro-16-iodohexadecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 307-60-8 | 206-205-3 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluor-12-jooddodecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 30046-31-2 | 250-014-8 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluor-14-joodtetradecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-14-iodotetradecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 2043-54-1 | 218-054-0 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluor-12-jooddodecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluoro-12-iodododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 65510-56-7 | 265-801-1 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluor-11-joodoundecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluoro-11-iodoundecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 142010-50-2 | 625-442-7 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluor-10-isocyanaatdecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-10-isocyanatodecane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 2043-53-0 | 218-053-5 | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluor-10-jooddecaan | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-10-iododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 484-450-7 | 1,1,1,2,2,3,3-heptafluor-3-methoxypropaan | 1,1,1,2,2,3,3-heptafluoro-3-methoxypropane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 3248-61-1 | 221-829-6 | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-tetracosafluor-12-jood-2-(trifluormethyl)dodecaan | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-tetracosafluoro-12-iodo-2-(trifluoromethyl)dodecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 811-97-2 | 212-377-0 | 1,1,1,2-tetrafluorethaan | norflurane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 28523-86-6 | 643-089-7 | 1,1,1,3,3,3-hexafluor-2-(fluormethoxy)propaan | 1,1,1,3,3,3-hexafluoro-2-(fluoromethoxy)propane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 690-39-1 | 425-320-1 | 1,1,1,3,3,3-hexafluorpropaan | 1,1,1,3,3,3-hexafluoropropane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 382-26-3 | 609-534-4 | 1,1,1,3,3-pentafluor-3-methoxy-2-(trifluormethyl)-propaan | propane, 1,1,1,3,3-pentafluoro-3-methoxy-2-(trifluoromethyl)- | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 406-58-6 | 430-250-1 | 1,1,1,3,3-pentafluorbutaan | 1,1,1,3,3-pentafluorobutane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 17928-28-8 | 241-867-7 | 1,1,1,3,5,5,5-heptamethyl-3-[(trimethylsilyl)oxy]trisiloxaan | 1,1,1,3,5,5,5-heptamethyl-3-[(trimethylsilyl)oxy]trisiloxane | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 420-46-2 | 206-996-5 | 1,1,1-trifluorethaan | 1,1,1-trifluorethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 3288-80-0 | 628-240-7 | 1,1,1-trimethylhydrazinium jodide | 1,1,1-trimethylhydrazinium iodide | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 971-662-4 | 1,1,2,2,2-pentafluorethaansulfonzuur | 1,1,2,2,2-pentafluoroethanesulfonic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 375-72-4 | 206-792-6 | 1,1,2,2,3,3,4,4,4-nonafluorbutaan-1-sulfonyl fluoride | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonyl fluoride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 69, 96 | ||||
| 34454-97-2 | 252-043-1 | 1,1,2,2,3,3,4,4,4-nonafluor-N-(2-hydroxyethyl)-N-methylbutaan-1-sulfonamide | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(2-hydroxyethyl)-N-methylbutane-1-sulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 69, 96 | ||||
| 1265205-95-5 | 996-023-7 | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluor-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-N-(trideuteriomethyl)octaan-1-sulfonamide | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)-N-(trideuteriomethyl)octane-1-sulfonamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 679-86-7 | 633-257-8 | 1,1,2,2,3-pentafluorpropaan | 1,1,2,2,3-pentafluoropropane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 37853-59-1 | 253-692-3 | 1,1'-[ethaan-1,2-diylbisoxy]bis[2,4,6-tribroombenzeen] | 1,1'-[ethane-1,2-diylbisoxy]bis[2,4,6-tribromobenzene] | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 81 | |||||
| 93776-00-2 | 297-925-7 | 1,1'-[oxybis[(1-methylethyleen)oxy]]bis[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluorpentadecaan-2-ol] | 1,1'-[oxybis[(1-methylethylene)oxy]]bis[4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-ol] | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 29806-76-6 | 1,1'-bipifenyl-4,4'-diamine, monoperchloraat | 1,1'-biphenyl-4,4'-diamine, monoperchlorate | MVP 1 | 0,05 mg/Nm3 | 2-1-2022 | 57, 69 | |||||||
| 865758-47-0 | 622-052-9 | 1,1-di-(4-methoxyfenyl)-1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]methanol | 1,1-Di-(4-methoxyphenyl)-1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl]methanol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 865758-36-7 | 623-168-2 | 1,1-di-(4-methoxyfenyl)-1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]methylchloride | 1,1-Di-(4-methoxyphenyl)-1-[4-(1H,1H,2H,2H-perfluorodecyl)phenyl]methyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 75-35-4 | 200-864-0 | 1,1-dichlooretheen | 1,1-dichloroethylene | Ja | gO.1 | 20 mg/Nm3 | 8-7-2025 | 44 | |||||
| 132248-58-9 | 680-430-9 | 1,1-dideuterio-2,2,2-trifluorethanol | 1,1-Dideuterio-2,2,2-trifluoroethanol | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 2356-62-9 | 1,2,2,2-tetrafluorethyl (trifluormethyl)ether | 1,1,1,2-tetrafluoro-2-(trifluoromethoxy)ethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 337513-72-1 | 881-746-1 | 1,2,3,4,5-pentabroom-6-(2,4,5-tribromofenoxy)benzeen | 1,2,3,4,5-pentabromo-6-(2,4,5-tribromophenoxy)benzene | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 13, 57 | ||||||
| 39001-02-0 | 694-806-5 | 1,2,3,4,6,7,8,9-octachloordibenzofuraan | 1,2,3,4,6,7,8,9-octachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 3268-87-9 | 694-813-3 | 1,2,3,4,6,7,8,9-octachlorodibenzodioxine | 1,2,3,4,6,7,8,9-octachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 35822-46-9 | 694-835-3 | 1,2,3,4,6,7,8-heptachloordibenzodioxine | 1,2,3,4,6,7,8-heptachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 67562-39-4 | 694-815-4 | 1,2,3,4,6,7,8-heptachloordibenzofuraan | 1,2,3,4,6,7,8-heptachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 55673-89-7 | 694-836-9 | 1,2,3,4,7,8,9-heptachloordibenzofuraan | 1,2,3,4,7,8,9-heptachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 39227-28-6 | 694-767-4 | 1,2,3,4,7,8-hexachloordibenzodioxine | 1,2,3,4,7,8-hexachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 70648-26-9 | 1,2,3,4,7,8-hexachloordibenzofuraan | 1,2,3,4,7,8-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57117-44-9 | 694-837-4 | 1,2,3,6,7,8-hexachloordibenzofuraan | 1,2,3,6,7,8-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 57653-85-7 | 694-811-2 | 1,2,3,6,7,8-hexachloordibenzo-p-dioxine | 1,2,3,6,7,8-Hexachlorodibenzo-p-dioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 19408-74-3 | 694-810-7 | 1,2,3,7,8,9-hexachloordibenzodioxine | 1,2,3,7,8,9-hexachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 72918-21-9 | 694-765-3 | 1,2,3,7,8,9-hexachloordibenzofuraan | 1,2,3,7,8,9-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 40321-76-4 | 1,2,3,7,8-pentachloordibenzodioxine | 1,2,3,7,8-pentachlorodibenzodioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57117-41-6 | 1,2,3,7,8-pentachloordibenzofuraan | 1,2,3,7,8-pentachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 87-61-6 | 201-757-1 | 1,2,3-trichloorbenzeen | 1,2,3-trichlorobenzene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 96-18-4 | 202-486-1 | 1,2,3-trichloorpropaan | 1,2,3-trichloropropane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 288-88-0 | 206-022-9 | 1,2,4-triazool | 1,2,4-triazole | Ja | MVP 2 | 1 mg/Nm3 | 13-7-2021 | 81 | |||||
| 120-82-1 | 204-428-0 | 1,2,4-trichloorbenzeen | 1,2,4-trichlorobenzene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 3194-55-6 | 221-695-9 | 1,2,5,6,9,10-hexabroomcyclododecaan | 1,2,5,6,9,10-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||
| 68515-51-5 | 271-094-0 | 1,2-benzeendicarbonzuur, di-C6-10-alkyl esters | 1,2-benzenedicarboxylic acid, di-C6-10-alkyl esters | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||
| 1,2-benzeendicarbonzuur, di-C6-10-alkylesters of gemengde decyl- en hexyl- en octyl-diësters met ≥ 0,3% dihexylftalaat (EC No. 201-559-5) | 1,2-benzenedicarboxylic acid, di-C6-10-alkyl esters or mixed decyl and hexyl and octyl diesters with ≥ 0.3% of dihexyl phthalate (EC No. 201-559-5) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | |||||||
| 71888-89-6 | 276-158-1 | 1,2-benzeendicarbonzuur, di-C6-8-vertakte alkylesters, C7-rijk | 1,2-benzenedicarboxylic acid, di-C6-8-branched alkyl esters, C7-rich | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68515-42-4 | 271-084-6 | 1,2-benzeendicarbonzuur, di-C7-11 vertakte en lineaire alkylesters | 1,2-benzenedicarboxylic acid, di-C7-11-branched and linear alkyl esters | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68515-50-4 | 271-093-5 | 1,2-benzeendicarbonzuur, dihexyl ester, vertakte en lineaire alkylesters | 1,2-benzenedicarboxylic acid, dihexyl ester, branched and linear | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | |||||
| 84777-06-0 | 284-032-2 | 1,2-benzeendicarbonzuur, dipentylester, vertakt en lineair | 1,2-benzenedicarboxylic acid, dipentylester, branched and linear | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68648-93-1 | 272-013-1 | 1,2-benzeendicarbonzuur, mengsel van decyl en hexyl en octyl diesters | 1,2-benzenedicarboxylic acid, mixed decyl and hexyl and octyl diesters | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||
| 14647-23-5 | 629-489-4 | 1,2-bis(difenylfosfino)ethaan nikkel(II) chloride | 1,2-bis(diphenylphosphino)ethane nickel(II) chloride | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 22581-63-1 | 245-102-8 | 1,2-dibroom-[1,1,2,2-2H4]ethaan | 1,2-dibromo-[1,1,2,2-2H4]ethane | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 96-12-8 | 202-479-3 | 1,2-dibroom-3-chloorpropaan | 1,2-dibromo-3-chloropropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 189084-61-5 | 621-543-5 | 1,2-dibroom-4-(2,4-dibroomfenoxy)benzeen | 1,2-dibromo-4-(2,4-dibromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 57 | |||||
| 189084-62-6 | 620-888-9 | 1,2-dibroom-4-(2,6-dibroomfenoxy)benzeen | 1,2-dibromo-4-(2,6-dibromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 57 | |||||
| 93703-48-1 | 621-837-3 | 1,2-dibroom-4-(3,4-dibroomfenoxy)benzeen | 1,2-dibromo-4-(3,4-dibromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 57 | |||||
| 106-93-4 | 203-444-5 | 1,2-dibroomethaan | 1,2-dibromoethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 33458-49-0 | 686-127-8 | 1,2-dibroomethaan-13C2 | 1,2-dibromoethane-13C2 | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 107-06-2 | 203-458-1 | 1,2-dichloorethaan | 1,2-dichloroethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 78-87-5 | 201-152-2 | 1,2-dichloorpropaan | 1,2-dichloropropane | Ja | MVP 2 | 1 mg/Nm3 | 4-1-2017 | ||||||
| 629-14-1 | 211-076-1 | 1,2-diethoxyethaan | 1,2-diethoxyethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 110-71-4 | 203-794-9 | 1,2-dimethoxyethaan | 1,2-dimethoxyethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 86051-75-4 | 107-205-5 | 1,2-dimethyl-5-(tributylstannyl)imidazool | 1,2-Dimethyl-5-(tributylstannyl)imidazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 540-73-8 | 1,2-dimethylhydrazine | 1,2-dimethylhydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||||
| 122-60-1 | 204-557-2 | 1,2-epoxy-3-fenoxypropaan | phenyl glycidyl ether | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25637-99-4 | 247-148-4 | 1,3,5,7,9,11-hexabroomcyclododecaan | 1,3,5,7,9,11-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||
| 36065-30-2 | 252-859-8 | 1,3,5-tribroom-2-(2,3-dibroom-2-methylpropoxy)benzeen | 1,3,5-tribromo-2-(2,3-dibromo-2-methylpropoxy)benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 189084-63-7 | 621-541-4 | 1,3,5-tribroom-2-(4-broomfenoxy)benzeen | 1,3,5-tribromo-2-(4-bromophenoxy)benzene | Ja | ERS | 0,05 ng TEQ/Nm3 | 23-8-2024 | 57 | |||||
| 108-70-3 | 203-608-6 | 1,3,5-trichloorbenzeen | 1,3,5-trichlorobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 59653-74-6 | 423-400-0 | 1,3,5-tris-[(2S en 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H3H5H)-trion | 1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 6426-67-1 | 613-540-2 | 1,3,6-naftaleentrisulfonzuur, 8-hydroxy-7-((4'-((2-hydroxy-1-naftaleen)azo)-(1,1'-bifenyl)-4-yl)-azo)-, trinatriumzout | 1,3,6-Naphthalenetrisulfonic acid, 8-hydroxy-7-((4'-((2-hydroxy-1-naphthalenyl)azo)-(1,1'-biphenyl)-4-yl)-azo)-, trisodium salt | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 57, 69 | ||||||
| 24344-61-4 | 693-893-7 | 1,3-bis(tributylstannyl)benzeen | 1,3-Bis(tributylstannyl)benzene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 106-99-0 | 203-450-8 | 1,3-butadieen | 1,3-butadiene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 96-23-1 | 202-491-9 | 1,3-dichloor-2-propanol | 1,3-dichloro-2-propanol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 148240-89-5 | 1,3-propaandiol, 2,2-bis[[(γ-ω-perfluor-C10-20-alkyl) thio]methyl] -derivaten, fosfaten, ammoniumzouten | 1,3-propanediol, 2,2-bis[[(γ-ω-perfluoro-C10-20-alkyl)thio]methyl] derivs., phosphates, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 148240-85-1 | 1,3-propaandiol, 2,2-bis[[(γ-ω-perfluor-C4–10-alkyl) thio]methyl] derivaten, fosfaten, ammoniumzouten | 1,3-propanediol, 2,2-bis[[(γ-ω-perfluoro-C4–10-alkyl)thio]methyl] derivatives, phosphates, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 148240-87-3 | 1,3-propaandiol, 2,2-bis[[(γ-ω-perfluor-C6–12-alkyl) thio]methyl] derivaten, fosfaten, ammoniumzouten | 1,3-propanediol, 2,2-bis[[(γ-ω-perfluoro-C6–12-alkyl)thio]methyl] derivatives, phosphates, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1120-71-4 | 214-317-9 | 1,3-propaansulton | 1,3-propanesultone | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 57-57-8 | 200-340-1 | 1,3-propiolacton | 3-propanolide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 2475-45-8 | 219-603-7 | 1,4,5,8-tetraaminoantrachinon | 1,4,5,8-tetraaminoanthraquinone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68953-84-4 | 273-227-8 | 1,4-benzeendiamine, N,N'-gemengde fenyl- en tolylderivaten | 1,4-benzenediamine, N,N'-mixed Ph and tolyl derivatives | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | |||||
| 17151-51-8 | 803-078-1 | 1,4-bis(tributylstannyl)benzeen | 1,4-Bis(tributylstannyl)benzene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 764-41-0 | 212-121-8 | 1,4-dichloorbut-2-een | 1,4-dichlorobut-2-ene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 123-91-1 | 204-661-8 | 1,4-dioxaan | 1,4-dioxane | Ja | Ja | gO.1 | 20 mg/Nm3 | 12-7-2021 | 44 | ||||
| 4904-61-4 | 225-533-8 | 1,5,9-cyclododecatrieen | 1,5,9 cyclododecatriene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1258836-72-4 | 868-354-6 | 1,5-dimethyl-6-thioxo-3-[2,2,7-trifluor-3,4-dihydro-3-oxo-4-(prop-2-ynyl)-2H-1,4-benzoxazin-6-yl]-1,3,5-triazinaaan-2,4-dion | 1,5-dimethyl-6-thioxo-3-[2,2,7-trifluoro-3,4-dihydro-3-oxo-4-(prop-2-ynyl)-2H-1,4-benzoxazin-6-yl]-1,3,5-triazinane-2,4-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 42397-64-8 | 636-984-9 | 1,6-dinitropyreen | 1,6-dinitropyrene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 42397-65-9 | 636-985-4 | 1,8-dinitropyreen | 1,8-dinitropyrene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 94159-80-5 | 303-261-1 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluortridecan-2-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluorotridecan-2-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94159-79-2 | 303-260-6 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluorpentadecaan-2-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoropentadecan-2-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94159-82-7 | 303-263-2 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-14-(trifluormethyl)pentadecaan-2-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-14-(trifluoromethyl)pentadecan-2-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94159-83-8 | 303-264-8 | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluor-12-(trifluormethyl)tridecan-1-ol | 1-[[3-(dimethylamino)propyl]amino]-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-12-(trifluoromethyl)tridecan-1-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 649561-66-0 | 623-147-8 | 1-[4-(1H,1H,2H,2H-perfluordecyl)fenyl]-1,1-difenylmethanol | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 955946-56-2 | 815-094-6 | 1-{[3-(4-{[(2R)-4-[5-fluor-2-(methyloxy)fenyl]-2-hydroxy-4-methyl-2-(trifluormethyl)pentyl]amino}-6-methyl-1H-indazool-1-yl)fenyl]carbonyl}-D-prolinamide | 1-{[3-(4-{[(2R)-4-[5-fluoro-2-(methyloxy)phenyl]-2-hydroxy-4-methyl-2-(trifluoromethyl)pentyl]amino}-6-methyl-1H-indazol-1-yl)phenyl]carbonyl}-D-prolinamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 4808-24-6 | 225-368-1 | 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrofenarsazine | 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 2865-70-5 | 220-684-6 | 10-chloor-10H-fenoxarsine | 10-chloro-10H-phenoxarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 211254-73-8 | 664-453-1 | 11ß-(4-acetylfenyl)-17ß-hydroxy-17alfa-(1,1,2,2,2-pentafluorethyl)estra-4,9-dieen-3-on | 11ß-(4-acetylphenyl)-17ß-hydroxy-17alpha-(1,1,2,2,2-pentafluorethyl)estra-4,9-dien-3-on | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 2991-07-3 | 112-277-6 | 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,19-heptadecafluornonadecaanthiol | 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,19-Heptadecafluorononadecanethiol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 20636-48-0 | 14-(4-nonylfenoxy)-3,6,9,12-tetraoxatetradecaan-1-ol | 14-(4-nonylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 26264-02-8 | 247-555-7 | 14-(nonylfenoxy)-3,6,9,12-tetraoxatetradecaan-1-ol | 14-(nonylphenoxy)-3,6,9,12-tetraoxatetradecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 34166-38-6 | 17-(4-nonylfenoxy)-3,6,9,12,15-pentaoxaheptadecaan-1-ol | 17-(4-nonylphenoxy)-3,6,9,12,15- pentaoxaheptadecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 27177-01-1 | 17-(nonylfenoxy)-3,6,9,12,15-pentaoxaheptadecaan-1-ol | 17-(nonylphenoxy)-3,6,9,12,15-pentaoxaheptadecan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | ||||||
| 928049-42-7 | 19-[4-(1,1-dimethylethyl)fenyl]-6,7,9,10,12,13-hexahydro-dibenzo[k,n][1,4,7,10,13]tetraoxathiacyclopentadecinium, tridecafluorhexaansulfonaat (1:1) | dibenzo[k,n][1,4,7,10,13]tetraoxathiacyclopentadecinium, 19-[4-(1,1-dimethylethyl)phenyl]-6,7,9,10,12,13-hexahydro-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 148961-88-0 | 683-415-5 | 1-benzo[b]thien-2-yltributylstannaan | 1-Benzo[b]thien-2-yltributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 206560-77-2 | 999-196-7 | 1-broom-4-(heptadecafluoroctyl)benzeen | 1-BROMO-4-(HEPTADECAFLUOROOCTYL)BENZENE | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 307-43-7 | 206-201-1 | 1-broomhenicosafluordecaan | 1-bromohenicosafluorodecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 106-94-5 | 203-445-0 | 1-broompropaan | 1-bromopropane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 2837-89-0 | 220-629-6 | 1-chloor-1,2,2,2-tetrafluorethaan | 1,1,1,2-tetrafluoro-2-chloroethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 75-88-7 | 200-912-0 | 1-chloor-2,2,2-trifluorethaan | 1-chloro-2,2,2-trifluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 251099-16-8 | 1-decanaminium, N-decyl-N,N-dimethyl-, zout met 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluor-1-octaansulfonzuur (1:1) | 1-decanaminium, N-decyl-N,N-dimethyl-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-1-octanesulfonic acid (1:1) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | |||||
| 57678-03-2 | 1-decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluor-, 1-(diwaterstof fosfaat) | 1-decanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-, 1-(dihydrogen phosphate) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 433-27-2 | 207-087-6 | 1-ethoxy-2,2,2-trifluorethanol | 1-ethoxy-2,2,2-trifluoroethanol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 754-96-1 | 670-426-5 | 1H,1H,10H,10H-perfluordecaan-1,10-diol | 1H,1H,10H,10H-Perfluorodecane-1,10-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 120226-60-0 | 1H,1H,2H,2H-perfluordodecaansulfonzuur | 1H,1H,2H,2H-perfluorododecanesulphonicacid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 757124-72-4 | 816-391-3 | 1H,1H,2H,2H-perfluorohexaansulfonzuur | 1H,1H,2H,2H-perfluorohexanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 355-47-5 | 625-098-8 | 1H,1H-perfluornonylamine | 1H,1H-Perfluorononylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 307-29-9 | 671-163-9 | 1H,1H-perfluoroctylamine | 1H,1H-Perfluorooctylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 300-88-9 | 1-hepteen-1-arsenigzuur, 2-chloor-, monoammonium zout | 1-heptene-1-arsonic acid, 2-chloro-, monoammonium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | ||||||
| 164656-23-9 | 638-758-5 | 1H-indeno(5,4-f)quinoline-7-carboxamide, N-(2,5-bis(trifluormethyl)fenyl)-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aR)- | 1H-indeno(5,4-f)quinoline-7-carboxamide, N-(2,5-bis(trifluoromethyl)phenyl)-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, (4aR,4bS,6aS,7S,9aS,9bS,11aR)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 255065-25-9 | 1-methoxy-2-[(1R)-2,2,2-trichloor-1-(4-methoxyfenyl)ethyl]-benzeen | 1-methoxy-2-[(1R)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]-benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 57 | |||||||
| 255065-26-0 | 1-methoxy-2-[(1S)-2,2,2-trichloor-1-(4-methoxyfenyl)ethyl]-benzeen | 1-methoxy-2-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]-benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 57 | |||||||
| 59424-81-6 | 1-methoxy-3-[2,2,2-trichloor-1-(4-methoxyfenyl)ethyl]-benzeen | 1-methoxy-3-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]-benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 57 | ||||||
| 118486-97-8 | 624-775-5 | 1-methyl-2-(tributylstannyl)-1H-pyrol | 1-methyl-2-(tributylstannyl)-1H-pyrrole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 70-25-7 | 200-730-1 | 1-methyl-3-nitro-1-nitrosoguanidine | 1-methyl-3-nitro-1-nitrosoguanidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 446285-73-0 | 689-534-9 | 1-methyl-4-(tributylstannyl)-1H-imidazool | 1-methyl-4-(tributylstannyl)-1H-imidazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 209860-87-7 | 682-458-7 | 1-methylethyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluor-4-fenoxy-1-butenyl]-3,5-dihydroxycyclopentyl}-5-heptenoaat | 1-methylethyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-butenyl]-3,5-dihydroxycyclopentyl}-5-heptenoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 90-12-0 | 201-966-8 | 1-methylnaftaleen | 1-methylnaphthalene | MVP 1 | 0,05 mg/Nm3 | 10-2-2022 | 10, 48 | ||||||
| 423-56-3 | 670-435-4 | 1-nonanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluor- | 1-Nonanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro- | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 53517-98-9 | 1-propaanaminium, N,N,N-trimethyl-3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl) amino]-, chloride (1:1) | 1-propanaminium,N,N,N-trimethyl-3- [(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl) amino]-, chloride (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 89685-61-0 | 1-propaansulfonzuur, 3-[ethyl (2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl)amino]-, natriumzout (1 :1) | 1-propanesulfonic acid,3-[ethyl (2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl)amino]-,sodium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 360-53-2 | 671-732-1 | 1-propeen, 1,3,3,3-tetrafluor-1-methoxy-2-(trifluormethyl)- | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 208934-35-4 | 107-067-6 | 1-trifenylmethyl-4-(tributylstannyl)imidazool | 1-Triphenylmethyl-4-(tributylstannyl)imidazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1072-63-5 | 214-012-0 | 1-vinylimidazool | 1-vinylimidazole | Ja | Ja | MVP 2 | 1 mg/Nm3 | 12-10-2018 | |||||
| 1282041-94-4 | 826-984-9 | 2-(1,1-difluorethyl)-5-methyl-N-[4-(pentafluor-λ6-sulfanyl)fenyl] [1,2,4]triazool[1,5-a]pyrimidin-7-amine | 2-(1,1-difluoroethyl)-5-methyl-N-[4-(pentafluoro-λ6-sulfanyl)phenyl] [1,2,4]triazolo[1,5-a]pyrimidin-7-amine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 186309-28-4 | 2-(2,4-dimethyl-3-cyclohexen-1-yl)-5-methyl-5-(1-methylpropyl)-1,3-dioxaan | 2-(2,4-dimethyl-3-cyclohexen-1-yl)-5-methyl-5-(1-methylpropyl)-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 9036-19-5 | 618-541-1 | 2-(2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]ethoxy)ethanol | 2-(2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 29-03-2019 | 57 | |||||
| 111-41-1 | 203-867-5 | 2-(2-aminoethylamino)ethanol | 2-(2-aminoethylamino)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3147-75-9 | 221-573-5 | 2-(2H-benzotriazool-2-yl)-4-(1,1,3,3-tetramethylbutyl)fenol | 2-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | |||||
| 36437-37-3 | 253-037-1 | 2-(2H-benzotriazool-2-yl)-4-(tert-butyl)-6-(sec-butyl)fenol | 2-(2H-benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 22-2-2016 | ||||||
| 25973-55-1 | 247-384-8 | 2-(2H-benzotriazool-2-yl)-4,6-di-tert-pentylfenol | 2-(2H-benzotriazol-2-yl)-4,6-ditertpentylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2015 | ||||||
| 111-77-3 | 203-906-6 | 2-(2-methoxyethoxy)ethanol | 2-(2-methoxyethoxy)ethanol | Ja | gO.2 | 50 mg/Nm3 | 8-7-2022 | 44 | |||||
| 929046-33-3 | 629-865-8 | 2-(3,5-bis(trifluormethyl)fenyl)-N-(4-(4-fluor-2-methylfenyl)-6-((7S,9aS)-7-(hydroxymethyl)hexahydropyrazino[2,1-c][1,4]oxazin-8(1H)-yl)pyridin-3-yl)-N,2-dimethylpropanamide | 2-(3,5-bis(trifluoromethyl)phenyl)-N-(4-(4-fluoro-2-methylphenyl)-6-((7S,9aS)-7-(hydroxymethyl)hexahydropyrazino[2,1-c][1,4]oxazin-8(1H)-yl)pyridin-3-yl)-N,2-dimethylpropanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 104-35-8 | 2-(4-nonylfenoxy)ethanol | 2-(4-nonylphenoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 57 | ||||||
| 80-54-6 | 201-289-8 | 2-(4-tert-butylbenzyl)propionaldehyde | 2-(4-tert-butylbenzyl)propionaldehyde | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | ||||
| 57041-67-5 | 688-023-8 | 2-(difluormethoxy)-1,1,1,2-tetrafluorethaan | 2-(difluoromethoxy)-1,1,1,2-tetrafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 119344-86-4 | 438-340-0 | 2-(dimethylamino)-2-[(4-methylfenyl)methyl]-1-[4-(morfoline-4-yl)fenyl]-1-butanon | 2-(dimethylamino)-2-[(4-methylphenyl)methyl]-1-[4-(morpholin-4-yl)phenyl]butan-1-one | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | ||||
| 85005-55-6 | 284-987-5 | 2-(isononylfenoxy)ethanol | 2-(isononylphenoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 27986-36-3 | 248-762-5 | 2-(nonylfenoxy)ethanol | 2-(nonylphenoxy)ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 1204580-71-1 | 882-090-9 | 2-(tributylstannyl)-4-chloorpyridine | 2-(Tributylstannyl)-4-chloropyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 611168-63-9 | 689-502-4 | 2-(tributylstannyl)-5-chloorpyridine | 2-(Tributylstannyl)-5-chloropyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 118486-94-5 | 629-205-9 | 2-(tributylstannyl)furaan | 2-(tributylstannyl)furan | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 205371-27-3 | 625-510-6 | 2-(tributylstannyl)pyrazine | 2-(tributylstannyl)pyrazine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 153435-63-3 | 687-738-2 | 2-(tributylstannyl)pyrimidine | 2-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 8004-59-9 | 616-837-5 | 2,[?]-naftaleendisulfonzuur, 4-[[4-[(4-amino-1-naftaleen)azo]-1-naftaleen]azo]-, dinatriumzout | 2,[?]-naphthalenedisulfonic acid, 4-[[4-[(4-amino-1-naphthalenyl)azo]-1-naphthalenyl]azo]-, disodium salt | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 57, 69 | ||||||
| 1116-54-7 | 214-237-4 | 2,2'-(nitrosoimino)bisethanol | 2,2'-(nitrosoimino)bisethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 75-89-8 | 200-913-6 | 2,2,2-trifluorethanol | 2,2,2-trifluoroethanol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 375-01-9 | 206-782-1 | 2,2,3,3,4,4,4-heptafluor-1-butanol | 2,2,3,3,4,4,4-heptafluorobutan-1-ol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 140-831-7 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-N-{3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctanoïl)amino]propyl}octaanamide | R588172 | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | ||||||
| 307-30-2 | 206-197-1 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaan-1-ol | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 3934-23-4 | 223-509-1 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctyl methacrylaat | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl methacrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 2328024-56-0 | 977-474-9 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2,3,4,5,6-13C6)decaanzuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2,3,4,5,6-13C6)decanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 960315-51-9 | 998-847-2 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluor(1,2-13C2)undecaanzuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoro(1,2-13C2)undecanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 307-78-8 | 626-276-8 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluordecaandizuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedioic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 38565-53-6 | 254-006-5 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonaan-1-ol | (2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)oxirane | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 76-21-1 | 200-944-5 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonaanzuur | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-oic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 376-18-1 | 206-806-0 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-ol | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 10331-08-5 | 977-267-3 | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluor-1-octanol | 2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluorooctan-1-ol | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 7383-71-3 | 230-957-1 | 2,2,3,3-tetrafluorpropylacrylaat | 2,2,3,3-tetrafluoropropyl acrylate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 207122-16-5 | 2,2',3,4,4',5',6-heptabroomdifenylether | heptabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 68631-49-2 | 2,2',4,4',5,5'-hexabroomdifenylether | hexabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 207122-15-4 | 2,2',4,4',5,6'-hexabroomdifenylether | hexabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 60348-60-9 | 2,2',4,4',5-pentabroomdifenylether | pentabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 189084-64-8 | 690-350-6 | 2,2',4,4',6-pentabroomdifenylether | 2,2',4,4',6-pentabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 30-10-2025 | 35 | ||||
| 5436-43-1 | 2,2',4,4'-tetrabroomdifenylether | 2,2',4,4'-tetrabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 79-94-7 | 201-236-9 | 2,2',6,6'-tetrabroom-4,4'-isopropylideendifenol | 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 926-564-6 | 2,2',6,6'-tetrabroom-4,4'-isopropylideendifenol, oligomerische reactieproducten met propyleenoxide en n-butylglycidylether | 2,2',6,6'-tetrabromo-4,4'-isopropylidenediphenol, oligomeric reaction products with propylene oxide and n-butyl glycidyl ether | MVP 1 | 0,05 mg/Nm3 | 25-9-2023 | 13, 57 | |||||||
| 14849-23-1 | 238-911-2 | 2,2'-[ethyleenbis(oxy)]bis[1,3,2-dioxarsolaan] | 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1464-53-5 | 215-979-1 | 2,2'-bioxiraan | 2,2'-bioxirane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 3296-90-0 | 221-967-7 | 2,2-bis(broommethyl)propaan-1,3-diol | 2,2-bis(bromomethyl)propane-1,3-diol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 57 | ||||
| 306-83-2 | 206-190-3 | 2,2-dichloor-1,1,1-trifluorethaan | 2,2-dichloro-1,1,1-trifluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 36483-57-5 | 253-057-0 | 2,2-dimethyl-1-propanol, tribroomderivaat | 2,2-dimethylpropan-1-ol, tribromo derivative | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||
| 13252-13-6 | 236-236-8 | 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propaanzuur | 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 70, 96 | ||||
| 799-974-4 | 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propaanzuur, zijn zouten en zijn acylhaliden | 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoic acid, its salts and its acyl halides | Ja | Ja | MVP 2 | 1 mg/Nm3 | 17-7-2019 | 96 | |||||
| 2062-98-8 | 218-173-8 | 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propionyl fluoride | 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propionyl fluoride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 96 | ||||
| 754-12-1 | 468-710-7 | 2,3,3,3-tetrafluorpropeen | 2,3,3,3-tetrafluoropropene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 60851-34-5 | 2,3,4,6,7,8-hexachloordibenzofuraan | 2,3,4,6,7,8-hexachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57117-31-4 | 2,3,4,7,8-pentachloordibenzofuraan | 2,3,4,7,8-pentachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 76523-40-5 | 809-723-3 | 2,3,7,8-tetrachloordibenzo[b,e][1,4]dioxine-13C12 | 2,3,7,8-tetrachlorodibenzo[b,e][1,4]dioxin-13C12 | ERS | 0,05 ng TEQ/Nm3 | 19-8-2024 | 69 | ||||||
| 1746-01-6 | 217-122-7 | 2,3,7,8-tetrachloordibenzodioxine | 2,3,7,8-tetrachlorodibenzo-p-dioxin | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | ||||||
| 51207-31-9 | 2,3,7,8-tetrachloordibenzofuraan | 2,3,7,8-tetrachlorodibenzofuran | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 96-13-9 | 202-480-9 | 2,3-dibroompropaan-1-ol | 2,3-dibromopropan-1-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 602-01-7 | 210-013-5 | 2,3-dinitrotolueen | 2,3-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 57044-25-4 | 404-660-4 | 2,3-epoxypropaan-1-ol | R-2,3-epoxy-1-propanol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 4016-14-2 | 223-672-9 | 2,3-epoxypropyl isopropyl ether | 2,3-epoxypropyl isopropyl ether | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 106-91-2 | 203-441-9 | 2,3-epoxypropylmethacrylaat | 2,3-epoxypropyl methacrylate | Ja | MVP 2 | 1 mg/Nm3 | 30-05-2017 | ||||||
| 3033-77-0 | 221-221-0 | 2,3-epoxypropyl-trimethylammoniumchloride | 2,3-epoxypropyltrimethylammonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 41318-75-6 | 868-402-6 | 2,4,4'-tribroomdifenylether | 2,4,4'-tribromodiphenyl ether | Ja | ERS | 0,05 ng TEQ/Nm3 | 30-10-2025 | 35 | |||||
| 16606-02-3 | 621-296-3 | 2,4',5-trichloorbifenyl | 2,4',5-trichlorobiphenyl | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 29-11-2024 | 57, 109 | ||||
| 137-17-7 | 205-282-0 | 2,4,5-trimethylaniline | 2,4,5-trimethylaniline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 21436-97-5 | 2,4,5-trimethylanilinehydrochloride | 2,4,5-trimethylaniline hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 12505-67-8 | 2,4,6,8,9,10-Hexaoxa-1,3,5,7-tetraarsatricyclo[3.3.1.13,7]decaan | 2,4,6,8,9,10-Hexaoxa-1,3,5,7-tetraarsatricyclo[3.3.1.13,7]decane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 2374-14-3 | 219-154-7 | 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluorpropyl)cyclotrisiloxaan | 2,4,6-trimethyl-2,4,6-tris(3,3,3-trifluoropropyl)cyclotrisiloxane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 21674-38-4 | 244-521-3 | 2,4,6-tris(pentadecafluorheptyl)-1,3,5-triazine | 2,4,6-tris(pentadecafluoroheptyl)-1,3,5-triazine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 732-26-3 | 211-989-5 | 2,4,6-tri-tert-butylfenol | 2,4,6-tri-tert-butylphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 615-05-4 | 210-406-1 | 2,4-diaminoanisool | 4-methoxy-m-phenylenediamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39156-41-7 | 254-323-9 | 2,4-diaminoanisoolsulfaat | 2,4-diaminoanisole sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 121-14-2 | 204-450-0 | 2,4-dinitrotolueen | 2,4-dinitrotoluene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 3864-99-1 | 223-383-8 | 2,4-di-tert-butyl-6-(5-chloorbenzotriazool-2-yl)fenol | 2,4-di-tert-butyl-6-(5-chlorobenzotriazol-2-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 22-2-2016 | ||||||
| 30667-99-3 | 690-154-0 | 2,4'-methoxychloor | 2,4'-methoxychlor | Ja | MVP 1 | 0,05 mg/Nm3 | 57 | ||||||
| 95-80-7 | 202-453-1 | 2,4-tolueendiamine | 4-methyl-m-phenylenediamine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 145483-63-2 | 687-043-4 | 2,5-bis(tri-n-butylstannyl)thiofeen | 2,5-Bis(tri-n-butylstannyl)thiophene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 89-61-2 | 201-923-3 | 2,5-dichloornitrobenzeen | 1,4-dichloro-2-nitrobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 81 | |||||
| 619-15-8 | 210-581-4 | 2,5-dinitrotolueen | 2,5-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84282-36-0 | 282-682-1 | 2,6-dimethyl-4-(1-naftyl)pyryliumhexafluorarsenaat | 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 84304-15-4 | 282-700-8 | 2,6-dimethyl-4-fenylpyryliumhexafluorarsenaat | 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 606-20-2 | 210-106-0 | 2,6-dinitrotolueen | 2,6-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1668-00-4 | 216-788-6 | 2,7-(bis(2-arsonofenylazo))-1,8-dihydroxynaftaleen-3,6-disulfonzuur | 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 72319-19-8 | 2,7-naftaleendisulfonzuur, nikkel(II)zout | 2,7-naphthalenedisulfonic acid, nickel(II) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 676367-05-8 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 343934-04-3 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-rel-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-rel-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-09-2 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 343934-05-4 | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-rel-1,3-dioxaan | 2-[(1R,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-rel-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-04-7 | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-08-1 | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1R,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-03-6 | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-07-0 | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1S,2R)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-02-5 | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxaan | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, cis-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 676367-06-9 | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxaan | 2-[(1S,2S)-2,4-dimethyl-3-cyclohexen-1-yl]-5-methyl-5-(1-methylpropyl)-, trans-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 350716-42-6 | 626-579-5 | 2-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluor-1,1-dimethylundecyloxy)carbonyloxyimino]-2-fenylacetonitril | 2-[(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1,1-dimethylundecyloxy)carbonyloxyimino]-2-phenylacetonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 3772-44-9 | 223-216-9 | 2-[[7-[(2-arsonofenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naftyl]azo]benzoëzuur | 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1265205-97-7 | 996-017-4 | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoroctylsulfonyl(1,1,2,2,2-pentadeuterioethyl)amino]azijnzuur | 2-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(1,1,2,2,2-pentadeuterioethyl)amino]acetic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 20427-84-3 | 243-816-4 | 2-[2-(4-nonylfenoxy)ethoxy]ethanol | 2-[2-(4-nonylphenoxy)ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 27176-93-8 | 248-291-5 | 2-[2-(nonylfenoxy)ethoxy]ethanol | 2-[2-(nonylphenoxy)ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 7311-27-5 | 230-770-5 | 2-[2-[2-[2-(4-nonylfenoxy)ethoxy]ethoxy]ethoxy]ethanol | 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 57 | |||||
| 2315-61-9 | 621-341-7 | 2-[2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]ethoxy]ethanol | 2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-03-2019 | 57 | |||||
| 151798-26-4 | 420-580-2 | 2-[2-hydroxy-3-(2-chloorfenyl)carbamoyl-1-naftylazo]-7-[2-hydroxy-3-(3-methylfenyl)-carbamoyl-1-naftylazo]fluoreen-9-on | 2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 937-904-8 | 2-[3-[1-octyl-4-(1H)quinolinylideen]-1-propenyl]-3-methylbenzothiazolium trifluormethaansulfonaat | 2-[3-[1-octyl-4-(1H)quinolinylidene]-1-propenyl]-3-methylbenzothiazolium trifluoromethanesulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 2315-67-5 | 621-345-9 | 2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]-ethanol | 4-tert-octylphenol monoethoxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-03-2019 | 57 | |||||
| 1119449-37-4 | 687-832-3 | 2-[4-(3,6-dimethylheptaan-3-yl)fenoxy]ethanol | 2-[4-(3,6-dimethylheptan-3-yl)phenoxy]ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 111991-14-1 | 830-355-4 | 2-[4-(trifluormethyl)fenyl]oxiraan | 2-[4-(trifluoromethyl)phenyl]oxirane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 376-14-7 | 206-805-5 | 2-[ethyl[(heptadecafluoroctyl)sulfonyl]amino]ethyl methacrylaat | 2-[ethyl[(heptadecafluorooctyl)sulphonyl]amino]ethyl methacrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 67584-55-8 | 266-733-5 | 2-[methyl[(nonafluorbutyl) sulfonyl]amino]ethyl acrylaat | 2-[methyl[(nonafluorobutyl) sulphonyl]amino]ethyl acrylate | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 1119449-38-5 | 687-833-9 | 2-{2-[4-(3,6-dimethylheptaan-3-yl)fenoxy]ethoxy}ethanol | 2-{2-[4-(3,6-dimethylheptan-3-yl)phenoxy]ethoxy}ethanol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 114248-23-6 | 806-458-5 | 2’,2’-difluor-2’-deoxyuridine | 2’,2’-difluoro-2’-deoxyuridine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 27942-27-4 | 248-743-1 | 20-(4-nonylfenoxy)-3,6,9,12,15,18-hexaoxaicosaan-1-ol | 20-(4-nonylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 57 | |||||
| 65455-69-8 | 265-785-6 | 20-(isononylfenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | 20-(isononylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 27177-03-3 | 248-292-0 | 20-(nonylfenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | 20-(nonylphenoxy)-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 2497-59-8 | 219-682-8 | 20-[4-(1,1,3,3-tetramethylbutyl)fenoxy]-3,6,9,12,15,18-hexaoxaicosaan-1-ol | 20-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-3,6,9,12,15,18-hexaoxaicosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-03-2019 | 57 | |||||
| 27177-05-5 | 248-293-6 | 23-(nonylfenoxy)-3,6,9,12,15,18,21-heptaoxatricosaan-1-ol | 23-(nonylphenoxy)-3,6,9,12,15,18,21-heptaoxatricosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 14409-72-4 | 604-395-6 | 26-(4-nonylfenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosaan-1-ol | 26-(4-nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 57 | |||||
| 26571-11-9 | 247-816-5 | 26-(nonylfenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosaan-1-ol | 26-(nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 42173-90-0 | 255-695-5 | 26-(nonylfenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | 26-(nonylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 65455-72-3 | 29-(isononylfenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol | 29-(isononylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosan-1-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | ||||||
| 27177-08-8 | 248-294-1 | 29-(nonylfenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol | 29-(nonylphenoxy)-3,6,9,12,15,18,21,24,27-nonaoxanonacosanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 5311-05-7 | 610-962-9 | 2-amine-4-methoxy-6-(trifluormethyl)-1,3,5-triazine | 1,3,5-triazin-2-amine, 4-methoxy-6-(trifluoromethyl)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 2045-00-3 | 218-064-5 | 2-aminofenylarsenigzuur | 2-aminophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 3846-71-7 | 223-346-6 | 2-benzotriazool-2-yl-4,6-di-tert-butylfenol | 2-benzotriazol-2-yl-4,6-di-tert-butylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2015 | ||||||
| 119313-12-1 | 404-360-3 | 2-benzyl-2-dimethylamino-4′-morfolinobutyrofenon | 2-benzyl-2-dimethylamino-4′-morpholinobutyrophenone | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | |||||
| 4067-80-5 | 694-727-6 | 2-broom(2-~2~H)propaan | 2-bromo(2-~2~H)propane | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 1514-82-5 | 627-872-0 | 2-broom-3,3,3-trifluor-1-propeen | 2-bromo-3,3,3-trifluoroprop-1-ene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||
| 1008756-65-7 | 685-903-3 | 2-broom-5-(tributylstannyl)pyridine | 2-bromo-5-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 189083-81-6 | 623-183-4 | 2-broom-6-(tributylstannyl)pyridine | 2-bromo-6-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 125 | ||||||
| 75-26-3 | 200-855-1 | 2-broompropaan | 2-bromopropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 52809-76-4 | 694-196-0 | 2-broompropaan-1,1,1,3,3,3-d6 | 2-bromopropane-1,1,1,3,3,3-d6 | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 39091-63-9 | 686-145-6 | 2-broompropaan-d7 | 2-bromopropane-d7 | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 1351378-24-9 | 800-777-3 | 2-buteendizuur (2Z)-, reactieproducten met ammonium di-µ3-hydroxyhexacosa-µ-oxododecaoxododecatungstaat(6-) (6:1), ammonium octa-µ-oxodi-µ3-oxo-µ4-oxododecaoxoheptamolybdaat(6-) (6:1), nikkel(2+) nitraat (1:2) en nikkel(2+) sulfaat (1:1) | 2-butenedioic acid (2Z)-, reaction products with ammonium di-µ3-hydroxyhexacosa-µ-oxododecaoxododecatungstate(6-) (6:1), ammonium octa-µ-oxodi-µ3-oxo-µ4-oxododecaoxoheptamolybdate(6-) (6:1), nickel(2+) nitrate (1:2) and nickel(2+) sulfate (1:1) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 4170-30-3 | 224-030-0 | 2-butenal | crotonaldehyde | MVP 1 | 0,05 mg/Nm3 | 24-11-2015 | 8 | ||||||
| 94723-86-1 | 425-150-8 | 2-butyryl-3-hydroxy-5-thiocyclohexaan-3-ylcyclohex-2-een-1-on | 2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39186-68-0 | 254-338-0 | 2-carboxyethylbis(2-hydroxyethyl)-3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl)amino]propylammoniumhydroxide | 2-carboxyethylbis(2-hydroxyethyl)-3-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl)amino]propylammonium hydroxide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 2804-50-4 | 2-chloor-1,1,3,3,3-pentafluor-1-propeen | 2-chloropentafluoropropene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 889672-73-5 | 663-233-2 | 2-chloor-5-(tributylstannyl)-1,3-thiazool | 2-Chloro-5-(tributylstannyl)-1,3-thiazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 155191-68-7 | 630-868-1 | 2-chloor-5-(tributylstannyl)pyrimidine | 2-chloro-5-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 2040-90-6 | 433-890-8 | 2-chloor-6-fluorfenol | 2-chloro-6-fluoro-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 70887-84-2 | 2-deceenzuur, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluor- | 2-decenoic acid, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 70887-94-4 | 2-dodeceenzuur, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-eicosafluor- | 2-dodecenoic acid, 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-eicosafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 484-410-9 | 2-ethoxy-3,3,4,4,5-pentafluor-2,5-bis[(1,2,2,2-tetrafluor-1-trifluormethyl)ethyl] tetrahydrofuran | 2-ethoxy-3,3,4,4,5-pentafluoro-2,5-bis[(1,2,2,2-tetrafluoro-1-trifluoromethyl)ethyl] tetrahydrofuran | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 110-80-5 | 203-804-1 | 2-ethoxyethanol | 2-ethoxyethanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 111-15-9 | 203-839-2 | 2-ethoxyethylacetaat | 2-ethoxyethyl acetate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 149-57-5 | 205-743-6 | 2-ethylhexaanzuur | 2-ethylhexanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81, 88 | |||||
| 24593-34-8 | 246-332-1 | 2-ethylhexaanzuur, cerium zout | 2-ethylhexanoic acid, cerium salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 7329-33-1 | 230-822-7 | 2-ethylhexaanzuur, chroomzout | 2-ethylhexanoic acid, chromium salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 19583-54-1 | 243-169-8 | 2-ethylhexaanzuur, ijzerzout | 2-ethylhexanoic acid, iron salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 3164-85-0 | 221-625-7 | 2-ethylhexaanzuur, kaliumzout | potassium 2-ethylhexanoate | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 22221-10-9 | 244-846-0 | 2-ethylhexaanzuur, koperzout | 2-ethylhexanoic acid, copper salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 16996-40-0 | 241-076-7 | 2-ethylhexaanzuur, loodzout | 2-ethylhexanoic acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 14, 57 | ||||||
| 15956-58-8 | 240-085-3 | 2-ethylhexaanzuur, mangaan zout | 2-ethylhexanoic acid, manganese salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 34041-09-3 | 251-807-1 | 2-ethylhexaanzuur, molybdeenzout | 2-ethylhexanoic acid, molybdenum salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 85114-00-7 | 285-503-5 | 2-ethylhexaanzuur, monoester met 1,2-diolpropaan | 2-ethylhexanoic acid, monoester with propane-1,2-diol | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | |||||
| 7580-31-6 | 231-480-1 | 2-ethylhexaanzuur, nikkelzout | 2-ethylhexanoic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 38584-87-1 | 254-020-1 | 2-ethylhexaanzuur, verbinding met 2,2',2''-nitrilotriethanol (1:1) | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 74931-55-8 | 278-031-6 | 2-ethylhexaanzuur, verbinding met 2-aminoethanol (1:1) | 2-ethylhexanoic acid, compound with 2-aminoethanol (1:1) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 58823-74-8 | 261-460-8 | 2-ethylhexaanzuur, verbinding met tributylamine (1:1) | 2-ethylhexanoic acid, compound with tributylamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 80, 81 | ||||||
| 85203-81-2 | 286-272-3 | 2-ethylhexaanzuur, zinkzout, basisch | hexanoic acid, 2-ethyl-, zinc salt, basic | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 22464-99-9 | 245-018-1 | 2-ethylhexaanzuur, zirconium zout | 2-ethylhexanoic acid, zirconium salt | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 57583-35-4 | 260-829-0 | 2-ethylhexyl 10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | dimethyltin bis(2-ethylhexyl thioglycolate) | MVP 1 | 0,05 mg/Nm3 | 16-5-2019 | 15, 57 | ||||||
| 15571-58-1 | 239-622-4 | 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoaat | 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 57583-34-3 | 260-828-5 | 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4- tintetradecanoaat | 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | MVP 1 | 0,05 mg/Nm3 | 16-5-2019 | 15, 57 | ||||||
| 10584-98-2 | 234-186-1 | 2-ethylhexyl 4,4-dibutyl-10-ethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoaat | 2-ethylhexyl 4,4-dibutyl-10-ethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 80387-97-9 | 279-452-8 | 2-ethylhexyl-[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyfenyl]methyl]thio]acetaat | 2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 155533-81-6 | 624-277-8 | 2-fluor-3-(tributylstannyl)pyridine | 2-Fluoro-3-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 457061-31-3 | 106-307-7 | 2-fluor-4-(tributylstannyl)pyridine | 2-Fluoro-4-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 138495-42-8 | 2H,3H-decafluoropentaan | 2H,3H-decafluoropentane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 88992-45-4 | 811-523-6 | 2-hydroxy-N,N,N-trimethyl-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)thio]-1-propanimiumchloride | 2-hydroxy-N,N,N-trimethyl-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)thio]-1-propanimium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 6107-83-1 | 629-552-6 | 2-hydroxypropaan-1,2,3-tricarboxylaat, lood(2+), trihydraat | 2-hydroxypropane-1,2,3-tricarboxylate;lead(2+);trihydrate | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 57 | ||||||
| 1105511-65-6 | 664-401-8 | 2-methoxy-3-(tributylstannyl)pyrazine | 2-methoxy-3-(tributylstannyl)pyrazine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1204580-72-2 | 107-063-4 | 2-methoxy-4-(tributylstannyl)pyridine | 2-Methoxy-4-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 164014-94-2 | 810-728-8 | 2-methoxy-6-(tributylstannyl)pyridine | 2-methoxy-6-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 109-86-4 | 203-713-7 | 2-methoxyethanol | ethyleenglycolmono-methylether | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 110-49-6 | 203-772-9 | 2-methoxyethylacetaat | 2-methoxyethyl acetate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 3121-61-7 | 221-499-3 | 2-methoxyethylacrylaat | 2-methoxyethyl acrylate | Ja | MVP 2 | 1 mg/Nm3 | 11-9-2020 | 81 | |||||
| 1589-47-5 | 216-455-5 | 2-methoxypropanol | 2-methoxypropanol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 70657-70-4 | 274-724-2 | 2-methoxypropylacetaat | 2-methoxypropyl acetate | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 36 | |||||
| 1446502-11-9 | 107-597-8 | 2-methyl-1-(4-(6-(trifluormethyl)pyridin-2-yl)-6-(2-(trifluormethyl)pyridin-4-ylamino)-1,3,5-triazin-2-ylamino)propan-2-ol | 2-Methyl-1-(4-(6-(trifluoromethyl)pyridin-2-yl)-6-(2-(trifluoromethyl)pyridin-4-ylamino)-1,3,5-triazin-2-ylamino)propan-2-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 71868-10-5 | 400-600-6 | 2-methyl-1-(4-methylthiofenyl)-2-morfolinopropaan-1-on | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | |||||
| 238098-26-5 | 487-120-0 | 2-methyl-4-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]aniline | 2-methyl-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 259807-95-9 | 677-938-8 | 2-methyl-6-(tri-n-butylstannyl)pyridine | 2-Methyl-6-(tri-n-butylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 125 | ||||||
| 75-55-8 | 200-878-7 | 2-methylaziridine | 2-methylaziridine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 693-98-1 | 211-765-7 | 2-methylimidazool | 2-methylimidazole | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | |||||
| 91-57-6 | 202-078-3 | 2-methylnaftaleen | 2-methylnaphthalene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 389625-14-3 | 811-442-6 | 2-naftaceencarboxamide, 4-(dimethylamine)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-7-iodo-1,11-dioxo-, (4S,4aS,5aR,12aS)-, mono(trifluoracetaat) (zout) | 2-naftacencarboxamide, 4-(dimethylamin)-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-7-iodo-1,11-dioxo-, (4S,4aS,5aR,12aS)-, mono(trifluoroacetate) (salt) | Ja | MVP 2 | 1 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 91-59-8 | 202-080-4 | 2-naftylamine | 2-naphthylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 25 | |||||
| 553-00-4 | 209-030-0 | 2-naftylamine azijnzuur | 2-naphthylamine acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 40 | |||||
| 612-52-2 | 210-313-6 | 2-naftylamine hydrochloride | 2-naphthylamine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 40 | |||||
| 68411-33-6 | 685-313-6 | 2-nitro-1,3-benzeendiol, loodzout, basisch | 1,3-benzenediol, 2-nitro-, lead salt, basic | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 57 | ||||||
| 91-23-6 | 202-052-1 | 2-nitroanisool | 2-nitroanisole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 5410-29-7 | 226-485-0 | 2-nitrofenylarsenigzuur | 2-nitrophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 581-89-5 | 209-474-5 | 2-nitronaftaleen | 2-nitronaphthalene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 79-46-9 | 201-209-1 | 2-nitropropaan | 2-nitropropane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 88-72-2 | 201-853-3 | 2-nitrotolueen | 2-nitrotoluene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 34202-69-2 | 629-519-6 | 2-propanon, hexafluor-, trihydraat | 2-propanone, hexafluoro-, trihydrate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 53515-73-4 | 2-propeenzuur, 2-methyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctylester, polymeer met 2-propeenzuur | 2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl ester, polymer with 2-propenoic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 65104-45-2 | 2-propeenzuur, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12, 12-heneicosafluordodecylester, polymeer met 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluordecyl-2-methyl-2-propenoaat, methyl-2-methyl-2-propenoaat, 3,3,4,4,5,5,6,6,7,7,8,8,9,9 | 2-propenoic acid, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl ester, polymer with 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluorodecyl 2-methyl-2-propenoate, methyl 2-methyl-2-propenoate,3,3,4,4,5,5,6,6,7,7,8,8 | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 125328-29-2 | 2-propeenzuur, 2-methyl-, C10-16-alkylesters, polymeren met 2-hydroxyethylmethacrylaat, Me-methacrylaat en perfluor-C8-14-alkylacrylaat | 2-propenoic acid, 2-methyl-, C10-16-alkyl esters, polymers with 2-hydroxyethyl methacrylate, Me methacrylate and perfluoro-C8-14-alkyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 129783-45-5 | 2-propeenzuur, 2-methyl-, C10-16-alkylesters, polymeren met 2-hydroxyethylmethacrylaat, Me-methacrylaat en γ-ω-perfluor-C8-14-alkylacrylaat | 2-propenoic acid, 2-methyl-, C10-16-alkyl esters, polymers with 2-hydroxyethyl methacrylate, Me methacrylate and γ-ω-perfluoro-C8-14-alkyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 74049-08-4 | 2-propeenzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylester, homopolymeer | 2-propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester, homopolymer | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 116984-14-6 | 2-propeenzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluordodecylester, polymeer met 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluordecyl-2-propenoaat, α-(2-methyl-1-oxo -2-propenyl)-ω-[(2-methyl-1-oxo-2-propenyl)oxy]poly(oxy-1,2- | 2-propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl ester, polymer with 3,3,4,4,5,5,6,6,7,7,8,8,9,9, 10,10,10-heptadecafluorodecyl 2-propenoate, α-(2-methyl-1-oxo-2-propenyl)-ω-[(2-methyl-1-oxo-2-propenyl)oxy]poly(oxy | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 115592-83-1 | 2-propeenzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluordodecylester, polymeer met 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl-2-propenoaat, hexadecyl-2-propenoaat, N-(hydroxymethyl)-2-propenamide, octadecyl-2-propenoaat | 2-propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl ester, polymer with 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 2-propenoate, hexadecyl 2-propenoate, N-(hydroxymethyl)-2-propenamide, octadecyl 2-prop | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 144031-01-6 | 2-propeenzuur, dodecylester, polymeren met Bu (1-oxo-2-propenyl) carbamaat en γ-ω-perfluor-C8-14-alkylacrylaat | 2-propenoic acid, dodecyl ester, polymers with Bu (1-oxo-2-propenyl)carbamate and γ-ω-perfluoro-C8-14-alkyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 85681-64-7 | 288-202-7 | 2-propeenzuur, perfluor-C8-16-alkylesters | 2-propenoic acid, perfluoro-C8-16-alkyl esters | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 85631-54-5 | 288-003-5 | 2-propeenzuur, γ-ω-perfluor-C8-14-alkylesters | 2-propenoic acid, γ-ω-perfluoro-C8-14-alkyl esters | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1199618-56-8 | 690-857-2 | 2-pyridinecarboxamide, 4-[4-[[[[4-chloor-3-(trifluormethyl)fenyl]amino]carbonyl]amino]fenoxy]-N-methyl-, benzeensulfonaat (1:1) | 2-pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-, benzenesulfonate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 157427-46-8 | 677-929-9 | 2-tributylstannyl-1-methyl-1H-indool | 2-Tributylstannyl-1-methyl-1H-indole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 88-17-5 | 201-806-7 | 2-trifluormethylaniline | 2-(trifluoromethyl)aniline | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 112-336-6 | 3-(2,2-difluor-3-(4-(piperazin-1-yl)butoxy)propoxy)-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)propanamide hydrochloride | 3-(2,2-difluoro-3-(4-(piperazin-1-yl)butoxy)propoxy)-N-(2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)propanamide Hydrochlori | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | ||||||
| 119489-67-7 | 999-197-2 | 3-(heptadecafluoroctyl)aniline | 3-(HEPTADECAFLUOROOCTYL)ANILINE | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 59020-10-9 | 626-493-8 | 3-(tributylstannyl)pyridine | 3-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 55525-54-7 | 259-695-6 | 3,3-(ureyleendimethyleen)bis(3,5,5-trimethylcyclohexyl)diisocyanaat | 3,3'-(ureylenedimethylene)bis(3,5,5-trimethylcyclohexyl) diisocyanate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 19430-93-4 | 243-053-7 | 3,3,4,4,5,5,6,6,6-nonafluorhexeen | 3,3,4,4,5,5,6,6,6-nonafluorohexene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 27619-97-2 | 248-580-6 | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctaansulfonzuur | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 17527-29-6 | 241-527-8 | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl acrylate | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 2144-53-8 | 218-407-9 | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl methacrylate | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctylmethacrylaat | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 21652-58-4 | 244-503-5 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordec-1-een | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 34143-74-3 | 629-356-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecaan-1-thiol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 17-5-2024 | 57, 69, 96 | ||||
| 39108-34-4 | 254-295-8 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluor-decaansulfonzuur | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 678-39-7 | 211-648-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecan-1-ol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-1-ol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 27905-45-9 | 248-722-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1996-88-9 | 217-877-2 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 865-86-1 | 212-748-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecanol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 30389-25-4 | 250-173-3 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodeceen | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 17741-60-5 | 241-732-2 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 57678-05-4 | 260-900-6 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecyldiwaterstof fosfaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 2144-54-9 | 218-408-4 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 39239-77-5 | 254-373-1 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluortetradecanol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 6014-75-1 | 227-870-6 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluortetradecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 60699-51-6 | 262-382-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorhexadecanol | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorohexadecanol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 4980-53-4 | 225-627-9 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorhexadecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-nonacosafluorohexadecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94158-63-1 | 303-135-6 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluor-17-(trifluormethyl) octadecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluoro-17-(trifluoromethyl)octadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94158-65-3 | 303-137-7 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluor-17-(trifluormethyl) octadecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,18,18,18-dotriacontafluoro-17-(trifluoromethyl)octadecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 91615-22-4 | 293-843-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluor-15-(trifluormethyl) hexadecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluoro-15-(trifluoromethyl)hexadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94158-64-2 | 303-136-1 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluor-15-(trifluormethyl) hexadecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,16,16,16-octacosafluoro-15-(trifluoromethyl)hexadecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 52956-82-8 | 258-277-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluor-13-(trifluormethyl)tetradecylacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluoro-13-(trifluoromethyl)tetradecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 74256-15-8 | 277-790-0 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluor-13-(trifluormethyl)tetradecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,14,14,14-tetracosafluoro-13-(trifluoromethyl)tetradecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 74256-14-7 | 277-789-5 | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluor-11-(trifluormethyl)dodecylmethacrylaat | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-icosafluoro-11-(trifluoromethyl)dodecyl methacrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1005-73-8 | 688-377-3 | 3,3,4,4,5,5-hexafluorcyclopenteen | 3,3,4,4,5,5-hexafluorocyclopent-1-ene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 74332-73-3 | 277-822-3 | 3,3’-dichloorbenzidine sulfaat | 3,3'-dichlorobenzidine sulphate | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 57, 69 | ||||||
| 91-94-1 | 202-109-0 | 3,3'-dichloorbenzidine | 3,3'-dichlorobenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 26 | |||||
| 612-83-9 | 210-323-0 | 3,3'-dichloorbenzidine dihydrochloride | 3,3'-dichlorobenzidine dihydrochloride | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 57, 69 | ||||||
| 2688115-44-6 | 172-067-5 | 3,3-difluor-1-nitrosoazetidine | 3,3-difluoro-1-nitrosoazetidine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 2648966-19-0 | 117-962-3 | 3,3-difluor-1-nitrosopyrrolidine | 3,3-difluoro-1-nitrosopyrrolidine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 119-90-4 | 204-355-4 | 3,3'-dimethoxybenzidine | 3,3'-dimethoxybenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 20325-40-0 | 243-737-5 | 3,3'-dimethoxybifenyl-4,4'-yleendiammonium dichloride | 3,3'-dimethoxybiphenyl-4,4'-ylenediammonium dichloride | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 57, 69 | ||||||
| 24216-05-5 | 246-083-9 | 3,4-bis[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluor-1-oxooctyl)amino]benzeensulfonylchloride | 3,4-bis[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-oxooctyl)amino]benzenesulphonyl chloride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 610-39-9 | 210-222-1 | 3,4-dinitrotolueen | 3,4-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 446285-70-7 | 677-934-6 | 3,5-dichloor-2-(tributylstannyl)pyrazine | 3,5-Dichloro-2-(tributylstannyl)pyrazine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 618-85-9 | 210-566-2 | 3,5-dinitrotolueen | 3,5-dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 91648-64-5 | 293-926-1 | 3,6,9,12-tetraoxatetradecaan-1-ol, 14-(4-nonylfenoxy)-, vertakt | 3,6,9,12-tetraoxatetradecan-1-ol, 14-(4-nonylphenoxy)-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 5146-66-7 | 225-918-0 | 3,7-dimethylocta-2,6-dieennitril | 3,7-dimethylocta-2,6-dienenitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 3586-60-5 | 803-606-0 | 3-[(dimethylcarbamothioyl)thio]-N,N,6-trimethyl-1,5-bis(thioxo)-2,4-dithia-6-aza-3-arsaheptan-1-amine; asomaat | 3-[(dimethylcarbamothioyl)thio]-N,N,6-trimethyl-1,5-bis(thioxo)-2,4-dithia-6-aza-3-arsaheptan-1-amine; asomate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 170729-80-3 | 677-636-6 | 3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluormethyl)fenyl]ethoxy)-3-(4-fluorfenyl)morfolino]methyl]-1H-1,2,4-triazool-5(4H)-on | 3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy)-3-(4-fluorophenyl)morpholino]methyl]-1H-1,2,4-triazol-5(4H)-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 956-990-8 | 3-[3-({6-[(6S,8R)-8-methyl-7-(2,2,2-trifluorethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinyl}amino)-1-azetidinyl]-1-propanol | 3-[3-({6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinyl}amino)-1-azetidinyl]-1-propanol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 121451-02-3 | 601-779-5 | 3-[3,5-dichloor-2-fluor-4-(1,1,2,3,3,3-hexafluorpropoxy)fenyl]-1-(2,6-difluorbenzoyl)ureum | 3-[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-1-(2,6-difluorobenzoyl)urea | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 287974-84-9 | 695-790-2 | 3-[4-(4'-trifluormethylbenzyloxy)fenyl]tetralon | 3-[4-(4'-trifluoromethylbenzyloxy)phenyl] tetralone | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 2163-77-1 | 218-494-3 | 3-amino-4-hydroxyfenylarsonzuur | 3-amino-4-hydroxyphenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 132-32-1 | 205-057-7 | 3-amino-9-ethylcarbazool | 3-amino-9-ethyl carbazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15087-24-8 | 239-139-9 | 3-benzylideenkamfer | 3-benzylidenecamphor | Ja | MVP 1 | 0,05 mg/Nm3 | 11-2-2019 | ||||||
| 1522-92-5 | 622-370-8 | 3-broom-2,2-bis(broommethyl)-1-propanol | 3-bromo-2,2-bis(bromomethyl)-1-propanol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||
| 2113-57-7 | 218-304-9 | 3-broombifenyl | 3-bromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 57 | ||||||
| 206357-78-0 | 803-194-2 | 3-chloor-2-(tributylstannyl)pyridine | 3-chloro-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 297730-93-9 | 435-790-1 | 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluor-2-(trifluormethyl)-hexaan | 3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 143860-04-2 | 421-150-7 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 43100-47-6 | 610-104-3 | 3-fenyl-5-(1,1,1-trifluor-2-{6-hydroxy-5-fenyl-[1,1'-bifenyl]-3-yl}propaan-2-yl)-[1,1'-bifenyl]-2-ol | 3-phenyl-5-(1,1,1-trifluoro-2-{6-hydroxy-5-phenyl-[1,1'-biphenyl]-3-yl}propan-2-yl)-[1,1'-biphenyl]-2-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 573675-60-2 | 800-494-5 | 3-fluor-2-(tributylstannyl)pyridine | 3-Fluoro-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 60154-16-7 | 262-085-2 | 3-formamido-4-hydroxyfenylarsonzuur | 3-formamido-4-hydroxyphenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 27569-09-1 | 248-532-4 | 3-methyl-4-(pyrrolidin-1-yl)benzeendiazoniumhexafluorarsenaat | 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1453-58-3 | 215-925-7 | 3-methylpyrazool | 3-methylpyrazole | Ja | MVP 2 | 1 mg/Nm3 | 12-7-2021 | 81 | |||||
| 121-17-5 | 204-451-6 | 3-nitro-4-chloorbenzotrifluoride | 3-nitro-4-chlorobenzotrifluoride | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 98-16-8 | 202-643-4 | 3-trifluormethylaniline | 3-(trifluoromethyl)aniline | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 832720-36-2 | 692-765-8 | 4-((2-(5-(2-fluor-3-methoxyfenyl)-3-(2-fluor-6-(trifluormethyl)benzyl)-4-methyl-2,6-dioxo-3,6-dihydropyrimidine-1(2H)-yl)-1-fenylethyl)amino)butaanzuur dinatriumzout | 4-((2-(5-(2-fluoro-3-methoxyphenyl)-3-(2-fluoro-6-(trifluoromethyl) benzyl)-4-methyl-2,6-dioxo-3,6-dihydropyrimidin-1(2H)-yl)-1-phenylethyl)amino) butanoic acid sodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 72861-06-4 | 4-(1,1,2,2-tetramethylpropyl)-fenol | 4-(1,1,2,2-tetramethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 861011-60-1 | 854-135-2 | 4-(1,1,2-trimethylbutyl)-fenol | 4-(1,1,2-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | |||||
| 33104-11-9 | 4-(1,1,3-trimethylbutyl)-fenol | 4-(1,1,3-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 521947-27-3 | 4-(1,1,5-trimethylhexyl)fenol | 4-(1,1,5-trimethylhexyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 57 | ||||||
| 37872-24-5 | 4-(1,1-diethylpropyl)-fenol | 4-(1,1-diethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 30784-31-7 | 4-(1,1-dimethylpentyl)-fenol | 4-(1,1-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 911371-06-7 | 4-(1,2,2-trimethylbutyl)-fenol | 4-(1,2,2-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 854904-93-1 | 4-(1,2-dimethylpentyl)-fenol | 4-(1,2-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 911371-07-8 | 4-(1,3,3-trimethylbutyl)-fenol | 4-(1,3,3-trimethylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 71945-81-8 | 4-(1,3-dimethylpentyl)-fenol | 4-(1,3-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 857629-71-1 | 4-(1,4-dimethylpentyl)-fenol | 4-(1,4-dimethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 30784-27-1 | 4-(1-ethyl-1,2-dimethylpropyl)-fenol | 4-(1-ethyl-1,2-dimethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 30784-32-8 | 4-(1-ethyl-1-methylbutyl)-fenol | 4-(1-ethyl-1-methylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 52427-13-1 | 257-907-1 | 4-(1-ethyl-1-methylhexyl)fenol | 4-(1-ethyl-1-methylhexyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 861010-65-3 | 4-(1-ethyl-2,2-dimethylpropyl)-fenol | 4-(1-ethyl-2,2-dimethylpropyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 854904-92-0 | 4-(1-ethyl-3-methylbutyl)-fenol | 4-(1-ethyl-3-methylbutyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 5425-62-7 | 226-569-7 | 4-(2-chlooracetamido)fenylarsonzuur | 4-(2-chloroacetamido)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 915087-16-0 | 857-186-9 | 4-(3-(4-cyaan-3-(trifluormethyl)fenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidine-1-yl)-N-methylbenzamide | 4-(3-(4-cyano-3-(trifluoromethyl)phenyl)-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl)-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 356055-77-1 | 623-608-3 | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzylalcohol | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)benzyl alcohol | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 609816-23-1 | 624-217-0 | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzylamine | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)benzylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 142623-70-9 | 625-041-7 | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylthio)fenol | 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-HEPTADECAFLUORODECYLTHIO)PHENOL | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 186825-36-5 | 635-389-1 | 4-(3,5-dimethylheptan-3-yl)fenol | 4-(3,5-dimethylheptan-3-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 142731-63-3 | 635-391-2 | 4-(3,6-dimethylheptaan-3-yl)fenol | 4-(3,6-dimethylheptan-3-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 57 | |||||
| 186825-39-8 | 4-(3-ethylheptaan-2-yl)fenol | 4-(3-ethylheptan-2-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 57 | ||||||
| 911370-98-4 | 4-(3-ethylpentyl)-fenol | 4-(3-ethylpentyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 102570-52-5 | 4-(3-methylhexyl)-fenol | 4-(3-methylhexyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 284461-73-0 | 608-209-4 | 4-(4-((((4-chloor-3-(trifluormethyl)fenyl)amino)carbonyl)amino)fenoxy)-N-methyl-2-pyridinecarboxamide | 4-(4-((((4-chloro-3-(trifluormethyl)phenyl)amino)carboxyl)amino)phenoxy)-N-methyl-2-pyridinecarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 755037-03-7 | 815-051-1 | 4-(4-(3-(4-chloor-3-(trifluormethyl)fenyl)ureido)-3-fluorfenoxy)-N-methylpicolinamide | 4-(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)-3-fluorophenoxy)-N-methylpicolinamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 494798-73-1 | 625-634-0 | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyloxy)benzaldehyde | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-HEPTADECAFLUOROUNDECYLOXY) BENZALDEHYDE | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 892155-69-0 | 118-458-6 | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyloxy)benzylalcohol | 4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-HEPTADECAFLUOROUNDECYLOXY)BENZYL ALCOHOL | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 6966-64-9 | 230-176-6 | 4-(4-aminofenylazo)fenylarsonzuur | 4-(4-aminophenylazo)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 622-68-4 | 210-750-2 | 4-(4-dimethylaminofenylazo)fenylarsonzuur | 4-(4-dimethylaminophenylazo)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1139800-98-8 | 4-(4-methylhexyl)-fenol | 4-(4-methylhexyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 100532-36-3 | 4-(5-methylhexyl)-fenol | 4-(5-methylhexyl)-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 63217-33-4 | 264-027-1 | 4-(diethylamino)-2-ethoxybenzeendiazonium hexafluorarsenaat | 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 63217-32-3 | 264-026-6 | 4-(diethylamino)-2-ethoxybenzeendiazoniumhexafluorarsenaat | 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 81121-61-1 | 632-855-6 | 4-(dimethylamino)pyridinium chloorchromaat | 4-(Dimethylamino)pyridinium chlorochromate | MVP 1 | 0,05 mg/Nm3 | 9-1-2023 | 12, 57 | ||||||
| 144-87-6 | 205-643-2 | 4-(glycolloylamino)fenylarsonzuur | 4-(glycolloylamino)phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 6863-24-7 | 4-(heptaan-2-yl)fenol | 4-(heptan-2-yl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 83766-52-3 | 628-976-9 | 4-(heptadecafluoroctyl)aniline | 4-(Heptadecafluorooctyl)aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 91083-54-4 | 623-055-8 | 4,14,22,32-tetrakis[4-(2-fenylpropaan-2-yl)fenoxy]-9,18,27,36,37,39,40,41-octaza-38lambda2-looddecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1(36),2(7),3,5,8,10(41),11(16),12,14,17,19,21,23,25,27,29(34),30,32,35(40)-nonadecaeen | 4,14,22,32-tetrakis[4-(2-phenylpropan-2-yl)phenoxy]-9,18,27,36,37,39,40,41-octaza-38lambda2-plumbadecacyclo[17.17.3.110,17.128,35.02,7.08,37.011,16.020,25.026,39.029,34]hentetraconta-1(36),2(7),3,5,8,10(41),11(16),12,14,17,19,21,23,25,27,29(34),30,32,35(40)-nonadecaene | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 87 | ||||||
| 77-40-7 | 201-025-1 | 4,4'-(1-methylpropylideen)bisfenol | 4,4'-(1-methylpropylidene)bisphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | |||||
| 34598-33-9 | 252-108-4 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecaanzuur | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 17-5-2024 | 57, 69, 96 | ||||
| 89373-67-1 | 625-067-9 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecanoylchloride | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 139175-50-1 | 626-638-5 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecylamine | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 852527-61-8 | 632-950-2 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecylazide | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl azide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 94158-70-0 | 303-142-4 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluor-2-hydroxytridecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 16083-78-6 | 240-236-3 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluor-2-hydroxy-16-(trifluormethyl)heptadecylacrylaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluoro-2-hydroxy-16-(trifluoromethyl)heptadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 63295-29-4 | 264-079-5 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluor-2-hydroxy-16-(trifluormethyl)heptadecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluoro-2-hydroxy-16-(trifluoromethyl)heptadecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 16083-87-7 | 240-237-9 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl)pentadecylacrylaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl acrylate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 63295-28-3 | 264-077-4 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl)pentadecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 63295-27-2 | 264-076-9 | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluor-2-hydroxy-12-(trifluormethyl)tridecyldiwaterstof fosfaat | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl dihydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1478-61-1 | 216-036-7 | 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]difenol | 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81, 96 | ||||
| 64049-29-2 | 4,4’-methylene-bis(2-chloroaniline) hydrochloride | 4,4'-Methylene-bis(2-chloroaniline) hydrochloride | MVP 1 | 0,05 mg/Nm3 | 8-2-2022 | 57, 69 | |||||||
| 119-93-7 | 204-358-0 | 4,4'-bi-o-toluïdine | 4,4'-bi-o-toluidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 23 | |||||
| 612-82-8 | 210-322-5 | 4,4'-bi-o-toluidine dihydrochloride | 4,4'-bi-o-toluidine dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64969-36-4 | 265-294-7 | 4,4'-bi-o-toluidine disulfaat | [3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl]diammonium bis(hydrogen sulphate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 74753-18-7 | 277-985-0 | 4,4'-bi-o-toluidinesulfaat | 4,4'-bi-o-toluidine sulphate | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 561-41-1 | 209-218-2 | 4,4'-bis(dimethylamino)-4''-(methylamino)trityl alcohol [met 0,1 procent of meer Michler's keton (EC nr. 202-027-5) of Michler's base (EC No. 202-959-2)] | 4,4'-bis(dimethylamino)-4''-(methylamino)trityl alcohol with >0.1% of Michler's ketone (EC No. 202-027-5) or Michler's base (EC No. 202-959-2)] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92-86-4 | 202-198-6 | 4,4'-dibroombifenyl | 4,4'-dibromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 57 | ||||||
| 6807-17-6 | 401-720-1 | 4,4-isobutylethylideendifenol | 4,4-isobutylethylidenediphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 101-14-4 | 202-918-9 | 4,4'-methyleenbis(2-chlooraniline) | 4,4'-methylenebis[2-chloroaniline] | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 101-77-9 | 202-974-4 | 4,4'-methyleendianiline | 4,4'-diaminodiphenylmethane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 838-88-0 | 212-658-8 | 4,4'-methyleendi-o-toluidine | 4,4'-methylenedi-o-toluidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 101-80-4 | 202-977-0 | 4,4'-oxydianiline | 4,4'-oxydianiline | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 27 | ||||
| 39635-79-5 | 254-551-9 | 4,4'-sulfonylbis[2,6-dibroomfenol] | 4,4'-sulphonylbis[2,6-dibromophenol] | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 57 | ||||||
| 80-09-1 | 201-250-5 | 4,4'-sulfonyldifenol | 4,4'-sulfonyldiphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | ||||
| 139-65-1 | 205-370-9 | 4,4'-thiodianiline | 4,4'-thiodianiline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 28 | |||||
| 1950587-20-8 | 942-798-1 | 4-[(1-[[6-cyano-5-(triflurmethyl)pyridine-3-yl]carbamoyl]cyclobutyl)amino]-2-fluor-N-methylbenzamide | 4-[(1-[[6-cyano-5-(trifluoromethyl)pyridin-3-yl]carbamoyl]cyclobutyl)amino]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 132-33-2 | 205-058-2 | 4-[(2-arsonofenyl)azo]-3-hydroxynaftaleen-2,7-disulfonzuur | 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1824346-00-0 | 4-[2-methyl-1-(1-methylethyl)propyl]-fenol | 4-[2-methyl-1-(1-methylethyl)propyl]-phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 1242137-18-3 | 857-185-3 | 4-[3-[4-cyaan-3-(trifluormethyl)fenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluor-N-methylbenzamide | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-2,4-dioxo-1-imidazolidinyl]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 915087-33-1 | 805-022-1 | 4-[3-[4-cyaan-3-(trifluormethyl)fenyl]-5,5-dimethyl-4-oxo-2-sulfanylideen-imidazolidine-1-yl]-2-fluor-N-methylbenzamide | 4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylidene-imidazolidin-1-yl]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1431697-81-2 | 112-259-8 | 4-[4-[[[[2-chloor-3-(trifluormethyl)fenyl]amino]carbonyl]amino]fenoxy]-N-methyl-2-pyridinecarboxamide | 4-[4-[[[[2-Chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-2-pyridinecarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 169590-42-5 | 685-962-5 | 4-[5-(4-methylfenyl)-3-(trifluormethyl)-1H-pyrazool-1-yl]benzeensulfonamide | 4-[5-(4-methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1221565-82-7 | 829-305-4 | 4-[5-(4-methylfenyl)-3-(trifluormethyl)-1H-pyrazool-1-yl]benzeensulfonamide en (1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyfenyl)cyclohexanol en waterstofchloride (1:1:1) | 4-[5-(4-Methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide - (1R,2R)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol hydrochloride (1:1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 956104-40-8 | 807-449-9 | 4-[7-[6-cyaan-5-(trifluormethyl)pyridine-3-yl]-8-oxo-6-sulfanylideen-5,7-diazaspiro[3.4]-5-octanyl]-2-fluor-N-methylbenzamide | 4-[7-[6-cyano-5-(trifluoromethyl)pyridin-3-yl]-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]-2-fluoro-N-methylbenzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 303186-20-1 | 608-462-0 | 4-[difluor(3,4,5-trifluorfenoxy)methyl]-3,5-difluor-4'-propyl-1,1'-bifenyl | 4-[difluor(3,4,5-trifluorphenoxy)methyl]-3,5-difluor-4'-propyl-1,1'-biphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 303186-19-8 | 608-461-5 | 4-[difluor(3,4,5-trifluorfenoxy)methyl]-4'-ethyl-3,5-difluor-1,1'-bifenyl | 4-[difluor(3,4,5-trifluorphenoxy)methyl]-4'-ethyl-3,5-difluor-1,1'-biphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| 57321-10-5 | 260-678-0 | 44-(nonylfenoxy)-3,6,9,12,15,18,21,24,27,30,33,36,39,42-tetradecaoxatetratetracontanol | 44-(nonylphenoxy)-3,6,9,12,15,18,21,24,27,30,33,36,39,42-tetradecaoxatetratetracontanol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 57 | |||||
| 618-22-4 | 210-541-6 | 4-acetamidofenylarsonzuur | 4-acetamidophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 399-95-1 | 402-230-0 | 4-amino-3-fluorfenol | 4-amino-3-fluorophenol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 60-09-3 | 200-453-6 | 4-aminoazobenzeen | 4-aminoazobenzene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 92-67-1 | 202-177-1 | 4-aminobifenyl | 4-aminobiphenyl | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1122-90-3 | 4-Aminofenylarsenoxide | 4-Aminophenylarsenoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 71130-51-3 | 4-arsenoso-benzeensulfonzuur | benzenesulfonic acid, 4-arsenoso- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 71130-50-2 | 4-arsenoso-benzeensulfonzuur, natriumzout | Benzenesulfonic acid, 4-arsenoso-, sodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 145745-05-7 | 803-033-6 | 4-benzyloxyfenyltributylstannaan | 4-Benzyloxyphenyltributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 92-66-0 | 202-176-6 | 4-broombifenyl | 4-bromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 57 | ||||||
| 104316-83-8 | 620-831-8 | 4-carboxypyridinium dichromaat | 4-Carboxypyridinium dichromate | MVP 1 | 0,05 mg/Nm3 | 9-1-2023 | 12, 57 | ||||||
| 106-47-8 | 203-401-0 | 4-chlooraniline | 4-chloroaniline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 5440-04-0 | 226-622-4 | 4-chloorfenylarsonzuur | 4-chlorophenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 95-69-2 | 202-441-6 | 4-chloor-o-toluïdine | 4-chloro-o-toluidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3165-93-3 | 221-627-8 | 4-chloor-o-toluidine hydrochloride | 4-chloro-o-toluidinium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 98-56-6 | 202-681-1 | 4-chloor-α,α,α-trifluortolueen | 4-chloro-α,α,α-trifluorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 84304-16-5 | 282-701-3 | 4-cyclohexyl-2,6-dimethylpyryliumhexafluorarsenaat | 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 6465-74-3 | 4-heptaan-3-ylfenol | 4-heptan-3-ylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 6465-71-0 | 4-heptaan-4-ylfenol | 4-heptan-4-ylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | ||||||
| 1987-50-4 | 217-862-0 | 4-heptylfenol | 4-heptylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57 | |||||
| 352010-68-5 | 688-487-1 | 4-hydroxy-3-{2-[[](2-methoxyethoxy)methyl]-6-(trifluormethyl)pyridine-3-carbonyl}bicyclo[[]3.2.1]oct-3-en-2-on | 4-hydroxy-3-{2-[[](2-methoxyethoxy)methyl]-6-(trifluoromethyl)pyridine-3-carbonyl}bicyclo[[]3.2.1]oct-3-en-2-one | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 98-14-6 | 202-641-3 | 4-hydroxyfenylarsenigzuur | 4-hydroxyphenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 27147-75-7 | 608-055-8 | 4-isododecylfenol | phenol, 4-isododecyl- | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | |||||
| 850501-35-8 | 622-264-1 | 4-methoxy-2-(tributylstannyl)pyrimidine | 4-methoxy-2-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 822-36-6 | 212-497-3 | 4-methylimidazool | 4-methylimidazole | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | |||||
| 641571-10-0 | 700-544-5 | 4-methyl-N-[3-(4-methyl-1H-imidazool-1-yl)-5-(trifluormethyl)fenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-benzamide | benzamide, 4-methyl-N-[3-(4-methyl-1H-imidazol-1-yl)-5-(trifluoromethyl)phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1304125-88-9 | 814-541-2 | 4-methyl-N-[3-(4-methyl-lH-imidazool-l-yl)-5-(trifluormethyl)-fenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-benzamidefumaraat | 4-methyl-N-[3-(4-methyl-lH-imidazol-l-yl)-5-(trifluoromethyl)-phenyl]-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]-benzamide fumarate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 92-93-3 | 202-204-7 | 4-nitrobifenyl | 4-nitrobiphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 57835-92-4 | 678-310-6 | 4-nitropyreen | 4-nitropyrene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 59-89-2 | 627-564-6 | 4-nitrosomorfoline | 4-nitrosomorpholine | Ja | MVP 2 | 1 mg/Nm3 | 25-1-2024 | 81 | |||||
| 84852-15-3 | 284-325-5 | 4-nonylfenol, vertakt | 4-nonylphenol, branched | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 57 | |||
| 4-nonylfenol, vertakt en lineair | 4-nonylphenol, branched and linear | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||||
| 98-73-7 | 202-696-3 | 4-tert-butylbenzoëzuur | 4-tert-butylbenzoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 98-54-4 | 202-679-0 | 4-tert-butylfenol | 4-tert-butylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 16-7-2019 | ||||||
| 288864-02-8 | 4-tert-heptylfenol | 4-tert-heptylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | ||||||
| 156609-10-8 | 4-t-nonylfenol-diethoxylaat | 4-t-nonylphenol-diethoxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 387353-98-2 | 803-945-4 | 4-tributylstannyl-1,3,5-trimethylpyrazool | 4-Tributylstannyl-1,3,5-trimethylpyrazole | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 117933-89-8 | 601-499-3 | 5-(butan-2-yl)-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxaan | 5-(butan-2-yl)-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | |||||
| 126085-91-4 | 677-924-1 | 5-(tributylstannyl)isoxazool-3-carbonzuurethylester | 5-(Tributylstannyl)isoxazole-3-carboxylic acid ethyl ester | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 144173-85-3 | 677-923-6 | 5-(tributylstannyl)pyrimidine | 5-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 171290-94-1 | 688-582-8 | 5,5′-bis(tri-n-butylstannyl)-2,2′-bithiofeen | 5,5′-Bis(tri-n-butylstannyl)-2,2′-bithiophene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 94134-56-2 | 302-825-4 | 5,5-dibutyl-3,3,7,7-tetramethoxy-2,4,6,8-tetraoxa-3,7-disila-5-stannanonaan | 5,5-dibutyl-3,3,7,7-tetramethoxy-2,4,6,8-tetraoxa-3,7-disila-5-stannanonane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 63612-50-0 | 624-700-6 | 5,5-dimethyl-3-[4-nitro-2-(trifluormethyl)fenyl]-1H-imidazool-2,4(3H,4H)-dion | 5,5-dimethyl-3-[4-nitro-2-(trifluoromethyl)phenyl]-1H-imidazol-2,4(3H,4H)-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 67485-29-4 | 405-090-9 | 5,5-dimethyl-perhydro-pyrimidin-2-on α-(4-trifluormethylstyryl)-α-(4-trifluormethyl)cinnamylideenhydrazon | 5,5-dimethyl-perhydro-pyrimidin-2-one α-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 355-43-1 | 206-586-6 | 5,6,6-tridecafluoro-6-iodo-1,1,1,2,2,3,3,4,4,5-hexaan | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | |||||
| 2101700-15-4 | 864-730-9 | 5-amino-3-[4-[[(5-fluor-2-methoxybenzoyl)amino]methyl]fenyl]-1-[(1S)-2,2,2-trifluor-1-methylethyl]-1H-pyrazool-4-carboxamide | 1H-pyrazole-4-carboxamide, 5-amino-3-[4-[[(5-fluoro-2-methoxybenzoyl)amino]methyl]phenyl]-1-[(1S)-2,2,2-trifluoro-1-methylethyl]- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 611168-46-8 | 684-700-7 | 5-broom-2-(tributylstannyl)pyridine | 5-bromo-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 123061-47-2 | 106-620-9 | 5-chloor-2-(methylthio)-4-(tributylstannyl)pyrimidine | 5-Chloro-2-(methylthio)-4-(tributylstannyl)pyrimidine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1092938-83-4 | 120-766-0 | 5-ethyl-2-(tributylstannyl)pyridine | 5-ethyl-2-(tributylstannyl)pyridine | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1185851-52-8 | 867-521-0 | 5-hepteenamide, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-difluor-4-fenoxy-1-buteen-1-yl]-3,5-dihydroxycyclopentyl]-N-ethyl-, (5Z)- (ACI) | 5-heptenamide, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-N-ethyl-, (5Z)- (ACI) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 2920059-96-5 | 175-553-5 | 5-hepteenzuur,7-{(1R,2R,3R,5S)-2-[(1E)-3,3,4-trifluor-4-fenoxy-1-buteen-1-yl]-3,5-dihydroxycyclopentyl}-, 1-methylethylester, (5Z)- | 5-Heptenoic acid,7-{(1R,2R,3R,5S)-2-[(1E)-3,3,4-trifluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-, 1-methylethyl ester, (5Z)- | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 209860-88-8 | 859-365-7 | 5-hepteenzuur,7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluor-4-fenoxy-1-buteen-1-yl]-3,5-dihydroxycyclopentyl}-, (5Z)- | 5-heptenoic acid,7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-, (5Z)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 3697-24-3 | 681-936-2 | 5-methylchryseen | 5-methylchrysene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 10, 48 | ||||||
| 1403564-06-6 | 991-648-1 | 5-methyl-N-[2-(trifluormethyl)fenyl]-1,2-oxazool-4-carboxamide | 5-methyl-N-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 602-87-9 | 210-025-0 | 5-nitroacenafteen | 5-nitroacenaphthene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 5-sec-butyl-2-(2,4-dimethylcyclohex-3-een-1-yl)-5-methyl-1,3-dioxaan | 5-sec-butyl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||||
| 5-sec-butyl-2-(4,6-dimethylcyclohex-3-een-1-yl)-5-methyl-1,3-dioxaan | 5-sec-butyl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2015 | ||||||||
| 87735-26-0 | 289-337-4 | 6,6-dibutyl-4,4,8,8-tetraethoxy-3,5,7,9-tetraoxa-4,8-disila-6-stannaundecaan | 6,6-dibutyl-4,4,8,8-tetraethoxy-3,5,7,9-tetraoxa-4,8-disila-6-stannaundecane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 139-93-5 | 205-386-6 | 6,6'-dihydroxy-3,3'-diarseen-1,2-diyldianiliniumdichloride | 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 119-47-1 | 204-327-1 | 6,6'-di-tert-butyl-2,2'-methyleendi-p-cresol | p-cresol, 2,2'-methylenebis(6-tert- butyl- | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-7-2021 | 81 | ||||
| 2156592-54-8 | 701-118-1 | 6-[(C10-C13)-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur | 6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | ||||
| 701-162-1 | 6-[C12-18-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | ||||||
| 701-271-4 | 6-[C12-18-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur, natrium en tris (2-hydroxyethyl)-ammoniumzouten | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | ||||||
| 85136-74-9 | 400-340-3 | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(fenylazo)fenylazo]-1,2-dihydro-3-pyridinecarbonitril | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 120-71-8 | 204-419-1 | 6-methoxy-m-toluïdine | 6-methoxy-m-toluidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 7496-02-8 | 626-732-6 | 6-nitrochryseen | 6-nitrochrysene | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 11, 48 | ||||||
| 194-59-2 | 205-895-3 | 7H-dibenzo[c,g]carbazool | 7H-dibenzo[c,g]carbazole | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 199327-61-2 | 429-400-7 | 7-methoxy-6-(3-morfoline-4-ylpropoxy)-3H-chinazoline-4-on [met 0,5 procent of meer formamide (EC-nr. 200-842-0)] | 7-methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one, [containing ≥ 0.5 % formamide (EC No 200-842-0) ] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 106-87-6 | 203-437-7 | 7-oxa-3-oxiranylbicyclo[4.1.0]heptaan | 7-oxa-3-oxiranylbicyclo[4.1.0]heptane | Ja | MVP 2 | 1 mg/Nm3 | 12-7-2021 | 81 | |||||
| 13973-14-3 | 640-843-7 | 8H-perfluoroctaanzuur | 8H-Perfluorooctanoic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 578-95-0 | 209-434-7 | 9(10H)acridoon | 9(10H)acridone | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 67968-63-2 | 267-966-5 | 9(of 10)-sulfooctadecaanzuur, kaliumzout | 9(or 10)-sulphooctadecanoic acid, potassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | |||||
| 68609-93-8 | 271-843-1 | 9-octadeceenzuur (Z)-, gesulfoneerd, kaliumzouten | 9-Octadecenoic acid (Z)-, sulfonated, potassium salts | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | |||||
| 64741-48-6 | 265-048-9 | aardgas (aardolie), ruw vloeibaar mengsel | natural gas (petroleum), raw liq. mix. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68919-39-1 | 272-896-3 | aardgascondensaten | natural gas condensates | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-47-5 | 265-047-3 | aardgascondensaten (aardolie) | natural gas condensates (petroleum) | Ja | 2-12-2013 | 4, 65 | |||||||
| 8002-05-9 | 232-298-5 | aardolie | petroleum | Ja | 2-12-2013 | 4 | |||||||
| 92045-80-2 | 295-463-0 | aardoliegassen vloeibaar gemaakt, stankvrij gemaakt, C4-fractie | petroleum gases, liquefied, sweetened, C4 fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 68514-79-4 | 271-058-4 | aardolieproducten hydrofiner-powerformer-reformaten | petroleum products, hydrofiner-powerformer reformates | Ja | 2-12-2013 | 4, 65 | |||||||
| 68607-11-4 | 271-750-6 | aardolieproducten raffinaderijgassen | petroleum products, refinery gases | Ja | 2-12-2013 | 4, 60 | |||||||
| 101316-45-4 | 309-851-5 | absorptieoliën bicyclo-aromatische en heterocyclische koolwaterstoffractie | absorption oils, bicyclo arom. and heterocyclic hydrocarbon fraction, | 2-12-2013 | 4 | ||||||||
| 83-32-9 | 201-469-6 | acenafteen | acenaphthene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 208-96-8 | 205-917-1 | acenaftyleen | acenaphthylene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 97-44-9 | 202-582-3 | acetarsol | acetarsol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 534-33-8 | 208-597-1 | acetarsol-diethylamine (1:1) | acetarsol-diethylamine (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 127-06-0 | 204-820-1 | aceton oxime | acetone oxime | Ja | MVP 2 | 1 mg/Nm3 | 10-1-2025 | 81 | |||||
| 5711-19-3 | 227-200-2 | acetoxytrimethyllood | acetoxytrimethylplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 13266-07-4 | 654-802-6 | acetoxytripropyllood | plumbane, acetoxytripropyl- | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 260-94-6 | 205-971-6 | acridine | acridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 101007-06-1 | 600-147-6 | acrinathrin | acrinathrin | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 79-06-1 | 201-173-7 | acrylamide | acrylamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 107-13-1 | 203-466-5 | acrylonitril | acrylonitrile | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 77536-66-4 | actinoliet | actinolite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | ||||||
| 94551-99-2 | 305-445-7 | afval van de opwerking van loodaccu's | wastes, lead battery reprocessing | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 57 | ||||||
| 102110-62-3 | 310-063-9 | afvalslik en bezinksel, afgasreiniging van koper-loodertsroosting, arseenhoudend. Het product verkregen door de zuivering van afgas van koper-loodertsconcentraatroosting. Bestaat voornamelijk uit arseenoxide (As2O3) | slimes and sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg. The product obtained by the purification of copper-lead ore concentrate roasting offgas. Composed primarily of arsenic oxide (As2O3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 100995-81-1 | 309-772-6 | afvalslik en bezinksel, electrolytische koper zuivering, ontkoperd, arseen-rijk. Verkregen door het centrifugeren van het de slik afscheiding aan de bases van cellen voor de ontkopering van elelctrolytische koper oplossingen. Bestaat voornamelijk uit arse | Slimes and Sludges, copper electrolytic refining, decopperized, arsenic-rich. Product obtained by centrifuging the slime discharged at the bases of cells for decopperization of electrolytic copper solutions. Composed primarily of a copper powder rich in a | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 94551-87-8 | 305-433-1 | afvalslik en bezinksel, elektrolytische koperzuivering, ontkoperd | slimes and sludges, copper electrolyte refining, decopperised | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92129-57-2 | 295-859-3 | afvalslik en bezinksel, elektrolytische koperzuivering, ontkoperd, nikkelsulfaat | slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 67712-00-9 | 266-977-2 | afvalslik en bezinksel, koper zuivering. Een complexe cominatie als resultaat van de verwerking van koper anders dan elektrolytisch. | Slimes and Sludges, copper refining A complex combination resulting from copper processing-other than electrolytic. | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 69012-21-1 | 273-721-3 | afvalwater, elektrolytische oplossing voornamelijk bestaand uit cadmiumsulfaat en zwavelzuur | wastewater, cadmium sulfate electrolytic, acid | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 309-00-2 | 206-215-8 | aldrin | aldrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 959-98-8 | 625-034-9 | alfa-endosulfan | alpha-endosulfan | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 134237-50-6 | alfa-hexabroomcyclododecaan | alpha-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||
| 319-84-6 | 206-270-8 | alfa-hexachloorcyclohexaan | alpha-hexachlorocyclohexane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 65996-83-0 | 266-017-2 | alkalisch extract koolteerolie (Het extract van koolteerolie dat wordt verkregen door te wassen met alkali, zoals verdund natriumhydroxide. bestaat voornamelijk uit de alkalizouten van verschillende fenolverbindingen) | extracts, coal tar oil alk., alkaline extract [The extract from coal tar oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 90640-88-3 | 292-610-0 | alkalisch extract, destillaten (koolteer), lichte oliën alkalische extracten (Het waterig extract uit fenololie dat wordt verkregen door te wassen met alkali, zoals verdund natriumhydroxide. Bestaat voornamelijk uit de alkalizouten van verschillende fenolverbindingen) | distillates (coal tar), light oils, alk. exts., alkaline extract [The aqueous extract from carbolic oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 90640-89-4 | 292-611-6 | alkalisch extract, destillaten (koolteer), naftaleenoliën alkalische extracten (Het waterig extract uit naftaleenolie dat wordt verkregen door te wassen met alkali, zoals verdund natriumhydroxide. Bestaat voornamelijk uit de alkalizouten van verschillende fenolverbindingen) | distillates (coal tar), naphthalene oils, alk. exts., Alkaline Extract [The aqueous extract from naphthalene oil produced by an alkaline wash such as aqueous sodium hydroxide. Composed primarily of the alkali salts of various phenolic compounds.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 68815-21-4 | 272-361-4 | alkalisch extract, teerzuren kresyl-, natriumzouten loogoplossingen | tar acids, cresylic, sodium salts, caustic solns., alkaline extract | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 954-979-2 | alkalische co-precipitatieproducten van oplosbare aluminium-, kobalt- en nikkelzouten | alkaline co-precipitation products of soluble aluminium, cobalt and nickel salts | MVP 1 | 0,05 mg/Nm3 | 23-9-2024 | 34, 57 | |||||||
| 954-825-4 | alkalische co-precipitatieproducten van oplosbare kobalt-, mangaan- en nikkelzouten | alkaline co-precipitation products of soluble cobalt, manganese and nickel salts | MVP 1 | 0,05 mg/Nm3 | 23-9-2024 | 34, 57 | |||||||
| 68475-57-0 | 270-651-5 | alkanen C1-2-, petroleumgas | alkanes, C1-2, petroleum gas | Ja | 2-12-2013 | 4, 60 | |||||||
| 90622-53-0 | 292-454-3 | alkanen C12-26-vertakte en niet-vertakte | alkanes, C12-26-branched and linear | Ja | 2-12-2013 | 4, 64 | |||||||
| 90622-55-2 | 292-456-4 | alkanen C1-4, rijk aan C3, petroleumgas | alkanes, C1-4, C3-rich, petroleum gas | Ja | 2-12-2013 | 4, 60 | |||||||
| 68475-58-1 | 270-652-0 | alkanen C2-3-, petroleumgas | alkanes, C2-3, petroleum gas | Ja | 2-12-2013 | 4, 60 | |||||||
| 68475-59-2 | 270-653-6 | alkanen C3-4-, petroleumgas | alkanes, C3-4, petroleum gas | Ja | 2-12-2013 | 4, 60 | |||||||
| 68475-60-5 | 270-654-1 | alkanen C4-5-, petroleumgas | alkanes, C4-5, petroleum gas | Ja | 2-12-2013 | 4, 60 | |||||||
| 68390-33-0 | alkyl jodiden, C10-12, γ-ω- perfluor | alkyl iodides, C10-12, γ-ω-perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 68188-12-5 | 269-141-5 | alkyl jodiden, C4-20, γ-ω-perfluor | alkyl iodides, C4-20, γ-ω-perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 90622-71-2 | 292-474-2 | alkyl jodiden, C6-18, perfluor | alkyl iodides, C6-18, perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 799-972-3 | alkyleringsproducten van fenol (voornamelijk in para-positie) met C12-rijke vertakte alkylketens van oligomerisatie, omvattend individuele isomeren en/of combinaties daarvan | phenol, alkylation products (mainly in para position) with C12-rich branched alkyl chains from oligomerisation, covering any individual isomers and/ or combinations thereof | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2022 | 81 | ||||||
| 590-34-1 | 209-678-4 | allylarsonzuur | allylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 24850-33-7 | 246-494-3 | allyltributylstannaan | allyltributylstannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 37382-15-3 | 680-872-2 | aluminium gallium arsenide | aluminium gallium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12003-78-0 | 234-439-6 | aluminium, verbinding met nikkel (1:1) | aluminium, compound with nickel (1:1) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 22831-42-1 | 245-255-0 | aluminiumarsenide | aluminium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 142844-00-6 | 604-314-4 | aluminiumsilicaat vuurvaste keramische vezels | aluminosilicate refractory ceramic fibres | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| amfotere gefluoreerde surfactant | amphoteric fluorinated surfactant | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 90622-99-4 | 292-504-4 | amiden, C7-19, α-ω-perfluor-N,N-bis(hydroxyethyl) | amides, C7-19, α-ω-perfluoro-N,N-bis(hydroxyethyl) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 85186-64-7 | 286-048-5 | amines, C10-14-vertakt en lineair alkyl, [1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, [1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 85029-59-0 | 285-084-9 | amines, C10-14-vertakt en lineair alkyl, [2,4-dihydro-4-[(2-hydroxy-5-nitrofenyl)azo]-5-methyl-2-fenyl-3H-pyrazol-3-onaat(2-)][2-[(4,5-dihydro-3-methyl-5-oxo-1-fenyl-1H-pyrazol-4-yl)azo]benzoaat(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, [2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 85186-67-0 | 286-051-1 | amines, C10-14-vertakt en lineair alkyl, bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 85186-66-9 | 286-050-6 | amines, C10-14-vetakt en lineair alkyl, bis[1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 480-310-4 | ammonium 2,2,3 trifluor-3-(1,1,2,2,3,3-hexafluor-3-trifluormethoxypropoxy), propionaat | ammonium 2,2,3 trifluor-3-(1,1,2,2,3,3-hexafluoro-3-trifluormethoxypropoxy), propionate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 62037-80-3 | 700-242-3 | ammonium 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propanoaat | ammonium 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 96 | ||||
| 13573-16-5 | 237-003-3 | ammonium diamminetetrakis(thiocyanaat-N)chromaat(1-) | ammonium diamminetetrakis(thiocyanato-N)chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 68214-26-6 | 269-290-6 | ammonium diaquabis[salicylaat(2-)-O1,O2]chromaat(1-) | ammonium diaquabis[salicylato(2-)-O1,O2]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 908020-52-0 | 700-323-3 | ammonium difluor[1,1,2,2-tetrafluor-2-(pentafluorethoxy)ethoxy]acetaat | ammonium difluoro[1,1,2,2-tetrafluoro-2-(pentafluoroethoxy)ethoxy]acetate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 32680-29-8 | 251-151-6 | ammonium koperarsenaat | ammonium copper arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 3825-26-1 | 223-320-4 | ammonium pentadecafluoroctaanzuur | ammonium pentadecafluorooctanoate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | |||
| 68259-10-9 | 269-513-7 | ammonium perfluorbutaansulfonaat | ammonium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 3108-42-7 | 221-470-5 | ammonium perfluordecaanzuur | ammonium nonadecafluorodecanoate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | 96 | |||
| 68259-08-5 | 269-511-6 | ammonium perfluorhexaan-1-sulfonaat | ammonium perfluorohexane-1-sulphonate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | ||||
| 21615-47-4 | 244-479-6 | ammonium undecafluorhexanoaat | ammonium undecafluorohexanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 7784-44-3 | 232-067-9 | ammoniumarsenaat | ammonium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 12124-97-9 | 235-183-8 | ammoniumbromide | ammonium bromide | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 7788-98-9 | 232-138-4 | ammoniumchromaat | ammonium chromate | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 12, 57 | ||||||
| 7789-09-5 | 232-143-1 | ammoniumdichromaat | ammonium dichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 27-6-2013 | |||||
| 13462-93-6 | 236-667-1 | ammoniumdiwaterstofarsenaat | ammonium dihydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 29081-56-9 | 249-415-0 | ammoniumheptadecafluoroctaansulfonaat | ammonium heptadecafluorooctanesulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||
| 10124-48-8 | 233-335-8 | ammonium-kwikchloride | aminomercuric chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 28-6-2016 | 42, 57 | |||||
| 14644-70-3 | ammoniummagnesiumarsenaat | ammonium magnesium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 6130-43-4 | 228-098-2 | ammoniumperfluorheptaanzuur | ammonium perfluoroheptanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 81, 96 | ||||
| 700-403-8 | ammoniumzouten van mono- en bis[3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl en/of poly(gesubstitueerd alkeen)]fosfaat | ammonium salts of mono- and bis[3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl and/or poly (substituted alkene)] phosphate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 4149-60-4 | ammoniumzouten van perfluornonaanzuur | ammonium salts of perfluorononan-1-oic-acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-2-2016 | 96 | ||||
| 955-817-3 | amorf bariumkoperzinkborobismutaat | amorphous barium copper zinc borobismuthate | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 57, 79 | |||||||
| 12172-73-5 | amosiet | amosite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | ||||||
| anorganische arseenverbindingen | inorganic arsenic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||||
| anorganische kwikverbindingen | inorganic mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||||
| anorganische loodverbindingen | inorganic lead compounds | MVP 1 | 0,05 mg/Nm3 | 31-05-2016 | |||||||||
| 77536-67-5 | anthofylliet | anthophyllite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | ||||||
| 91995-14-1 | 295-274-3 | anthraceen olie, extractie-residu, Een complexe verzameling koolwaterstoffen uit de van base ontdane fractie verkregen door de destillatie van koolteer, met een kooktraject van ongeveer 325°C tot 365°C. Bevat voornamelijk antraceen fenantreen en alkylderivaten daarvan. antraceenolie, zuur extract | anthracene oil, acid ext., Anthracene Oil Extract Residue [A complex combination of hydrocarbons from the base-freed fraction obtained from the distillation of coal tar and boiling in the range of approximately 325 °C to 365 °C (617 °F to 689 °F). It contains predominantly anthracene and phenanthrene and their alkyl derivatives.] | Ja | 2-12-2013 | 4, 63 | |||||||
| 135821-74-8 | anti-dodecachloorpentacyclooctadecadieen | anti-dodecachloropentacyclooctadecadiene | Ja | MVP 1 | 0,05 mg/Nm3 | 13-5-2019 | 57 | ||||||
| 8007-18-9 | 232-353-3 | antimoon nikkel titanium oxide geel | antimony nickel titanium oxide yellow | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 64475-90-7 | 264-904-9 | antimoonarseenoxide | antimony arsenic oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 28980-47-4 | 249-347-1 | antimoonarsenaat | antimony arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 68951-38-2 | 273-156-2 | antimoonoxide (Sb2O3), gemengd met arseenoxide (As2O3) | antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 120-12-7 | 204-371-1 | antraceen | anthracene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 90640-80-5 | 292-602-7 | antraceenolie | anthracene oil | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 63 | ||||
| 91995-17-4 | 295-278-5 | antraceenolie, antraceenpasta, lichte destillatiefracties | anthracene oil, anthracene paste, distn. lights | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 61, 63 | ||||
| 90640-81-6 | 292-603-2 | antraceenolie, fractie | anthracene oil fraction [The anthracene-rich solid obtained by the crystallization and centrifuging of anthracene oil. It is composed primarily of anthracene, carbazole and phenanthrene.]. anthracene oil, anthracene paste | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 61, 63 | ||||
| 91995-15-2 | 295-275-9 | antraceenolie, fractie | anthracene oil, anthracene paste, anthracene fraction. anthracene Oil Fraction [a complex combination of hydrocarbons from the distillation of anthracene obtained by the crystallization of anthracene oil from bituminous high temperature tar and boiling in the range of 330°C to 350°C (626°F to 662°F). It contains chiefly anthracene, carbazole and phenanthrene.] | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 61, 63 | ||||
| 90640-82-7 | 292-604-8 | antraceenolie, fractie [De olie die resteert na de verwijdering, door middel van een kristallisatieproces, van een antraceenrijke vaste stof (antraceenpasta) uit antraceenolie. Bestaat voornamelijk uit aromatische verbindingen met twee, drie of vier ringen] | anthracene oil, anthracene-low, anthracene Oil Fraction [The oil remaining after the removal, by a crystallization process, of an anthracene-rich solid (anthracene paste) from anthracene oil. It is composed primarily of two, three and four membered aromatic compounds.] | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 61, 63 | ||||
| 91995-16-3 | 295-276-4 | antraceenolie, fractie, Een complexe verzameling koolwaterstoffen uit de destillatie van antraceen die wordt verkregen door de kristallisatie van antraceenolie uit bitumineuze hoge-temperatuur-teer, met een kooktraject van ongeveer 350 °C tot 360 °C. Bevat hoofdzakelijk antraceen carbazool en fenantreen. antraceenolie, antraceenpasta, carbazoolfractie | anthracene oil, anthracene paste, carbazole fraction, anthracene Oil Fraction [a complex combination of hydrocarbons from the distillation of anthracene obtained by crystallization of anthracene oil from bituminous coal high temperature tar and boiling in the approximate range of 350°C to 360°C (662°F to 680°F). It contains chiefly anthracene, carbazole and phenanthrene.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 92061-92-2 | 295-505-8 | antraceenolie, fractie, Het residu van de fractionele destillatie van ongezuiverd antraceen met een kooktraject van ongeveer 340 °C tot 400 °C. Bestaat voornamelijk uit tri- en polycyclische aromatische en heterocyclische koolwaterstoffen. residuen (koolteer), antraceenolie, destillatie- | Residues (coal tar), anthracene oil distn., Anthracene Oil Fraction [The residue from the fraction distillation of crude anthracene boiling in the approximate range of 340°C to 400°C (644°F to 752°F). It consists predominantly of tri- and polynuclear aromatic and heterocyclic hydrocarbons.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84-65-1 | 201-549-0 | antrachinon | anthraquinone | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 431-89-0 | 207-079-2 | apafluraan | apaflurane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 101794-75-6 | 309-957-1 | aromatische koolwaterstoffen C20-28-, polycyclisch afkomstig uit de pyrolyse van gemengde koolteerpek en polyethyleen | aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene pyrolysis-derived | Ja | 2-12-2013 | 4, 63 | |||||||
| 101794-76-7 | 309-958-7 | aromatische koolwaterstoffen C20-28-, polycyclisch afkomstig uit de pyrolyse van gemengde koolteerpek en polystyreen | aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polystyrene pyrolysis-derived | Ja | 2-12-2013 | 4, 63 | |||||||
| 101794-74-5 | 309-956-6 | aromatische koolwaterstoffen C20-28-, polycyclisch afkomstig uit de pyrolyse van gemengde koolteerpek polyethyleen en polypropyleen | aromatic hydrocarbons, C20-28, polycyclic, mixed coal-tar pitch-polyethylene-polypropylene pyrolysis-derived | Ja | 2-12-2013 | 4, 63 | |||||||
| 68131-49-7 | 268-618-5 | aromatische koolwaterstoffen C6-10-, met zuur behandeld geneutraliseerd | aromatic hydrocarbons, C6-10, acid-treated, neutralized, low boiling point naphtha - unspecified | Ja | 2-12-2013 | 4, 65 | |||||||
| 90989-41-6 | 292-697-5 | aromatische koolwaterstoffen C6-10, rijk aan C8 | aromatic hydrocarbons, C6-10, C8-rich | Ja | 2-12-2013 | 4, 61 | |||||||
| 68475-70-7 | 270-658-3 | aromatische koolwaterstoffen C6-8-, afkomstig van pyrolysaat van nafta-raffinaat | aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 93571-75-6 | 297-401-8 | aromatische koolwaterstoffen C7-12-, rijk aan C8 | aromatic hydrocarbons, C7-12, C8-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 90989-42-7 | 292-698-0 | aromatische koolwaterstoffen C7-8-, dealkyleringsproducten destillatieresiduen | aromatic hydrocarbons, C7-8, dealkylation products, distn. residues | Ja | 2-12-2013 | 4, 65 | |||||||
| 90989-38-1 | 292-694-9 | aromatische koolwaterstoffen C8- | aromatic hydrocarbons, C8 | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-18-5 | 295-279-0 | aromatische koolwaterstoffen C8-, afkomstig uit katalytische hervorming | aromatic hydrocarbons, C8, catalytic reforming-derived | Ja | 2-12-2013 | 4, 65 | |||||||
| 90989-39-2 | 292-695-4 | aromatische koolwaterstoffen C8-10 | aromatic hydrocarbons, C8-10 | Ja | 2-12-2013 | 4, 65 | |||||||
| 91995-20-9 | 295-281-1 | aromatische koolwaterstoffen C8-9, bijproduct koolwaterstofhars-polymerisatie, | aromatic hydrocarbons, C8-9, hydrocarbon resin polymn. by-product, | Ja | 2-12-2013 | 4, 61 | |||||||
| 92062-36-7 | 295-551-9 | aromatische koolwaterstoffen C9-12, benzeendestillatie, lichte olie, herdestillaat, hoogkokende fractie | aromatic hydrocarbons, C9-12, benzene distn., light oil redistillate, high boiling | Ja | 2-12-2013 | 4, 61 | |||||||
| 98072-36-7 | 308-487-4 | aromatische koowaterstoffen, destillatie residue, rijk aan naftaleen | aromatic hydrocarbons, distn. residues, naphthalene-rich | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 80, 82 | ||||||
| 98-50-0 | 202-674-3 | arsanilzuur | arsanilic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7440-38-2 | 231-148-6 | arseen | arsenic | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||
| 1303-32-8 | 627-949-9 | arseen disulfide | arsenic disulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1303-33-9 | 215-117-4 | arseen sulfide | arsenic sulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1303-34-0 | 625-728-1 | arseen sulfide (As2S5) | arsenic sulfide (As2S5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 56320-22-0 | arseen sulfide (AsS2) | arsenic sulfide (AsS2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 87198-15-0 | arseen tetrachloride fluoride | arsenic tetrachloride fluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 56729-51-2 | arseen tetrasulfide | arsenic tetrasulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7784-45-4 | 232-068-4 | arseen trijodide | arsenic triiodide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12044-79-0 | arseen(II)sulfide | arsenic(II) sulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12044-50-7 | 629-626-8 | arseen(V)oxide hydraat | arsenic(V) oxide hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 7784-33-0 | 232-057-4 | arseenbromide | arsenicbromide | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 17522-78-0 | arseenchloride (AsCl) | arsenic chloride (AsCl) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 41996-37-6 | arseenchloride (AsCl2) | arsenic chloride (AsCl2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 85561-28-0 | arseenhoudend zuur, kobalt(2+) zout | arsenenous acid, cobalt(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 85561-29-1 | arseenhoudend zuur, mangaan(2+)zout | arsenenous acid, manganese(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 951-957-4 | arseenoxides, bismut-ijzer-antimoonoxides, natriumaluminiumfluoride, zinksulfaat, terugwinningsproducten uit koper- en zink-stof | arsenic oxides, bismuth iron antimony oxides, sodium aluminium fluoride, zinc sulphate, recovery products from copper and zinc dusts | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | ||||||
| 22441-45-8 | arseenpentachloride | arsenic pentachloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12626-31-2 | arseenselenide | Arsenic selenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7784-34-1 | 232-059-5 | arseentrichloride | arsenic chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 1327-53-3 | 215-481-4 | arseentrioxide | diarsenic trioxide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | |||
| arseenverbindingen | arsenic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||||
| 7778-39-4 | 231-901-9 | arseenzuur | arsenic acid | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | |||
| 127795-79-3 | arseenzuur (H3AsO4), ammoniumzout (2:1) | arsenic acid (H3AsO4), ammonium salt (2:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13702-38-0 | arseenzuur (H3AsO4), bismutzout (1:1) | arsenic acid (H3AsO4), bismuth salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 30621-31-9 | arseenzuur (H3AsO4), calciumzout (2:3), dihydraat | arsenic acid (H3AsO4), calcium salt(2:3), dihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 89067-81-2 | arseenzuur (H3AsO4), calciumzout (4:5) | arsenic acid (H3AsO4), calcium salt (4:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 85949-61-7 | arseenzuur (H3AsO4), calciumzout (7:10) | arsenic acid (H3AsO4), calcium salt (7:10) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 21093-83-4 | arseenzuur (H3AsO4), dipotassiumzout | arsenic acid (H3AsO4), dipotassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7774-41-6 | arseenzuur (H3ASO4), hemihydraat | arsenic acid (H3ASO4), hemihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 29871-10-1 | arseenzuur (H3AsO4), kobalt(2+) zout | arsenic acid (H3AsO4), cobalt(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13464-31-8 | arseenzuur (H3AsO4), koper(2+)zout (1:1) | arsenic acid (H3AsO4), copper(2+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 76407-89-1 | arseenzuur (H3AsO4), koper(2+)zout (2:3) | arsenic acid (H3AsO4), copper(2+) salt (2:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13478-34-7 | arseenzuur (H3AsO4), koper(2+)zout (2:3), tetrahydraat | arsenic acid (H3AsO4), copper(2+) salt (2:3), tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 102525-64-4 | arseenzuur (H3AsO4), koper(2+)zout (4:1) | arsenic acid (H3AsO4), copper(2+) salt (4:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 89054-01-3 | arseenzuur (H3AsO4), koper(2+)zout (4:5) | arsenic acid (H3AsO4), copper(2+) salt (4:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 120119-64-4 | arseenzuur (H3AsO4), lood(2+)zout (2:3), tetrahydraat | arsenic acid (H3AsO4), lead(2+) salt (2:3), tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 89054-03-5 | arseenzuur (H3AsO4), lood(2+)zout (4:5) | arsenic acid (H3AsO4), lead(2+) salt (4:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 33940-95-3 | arseenzuur (H3AsO4), lood(4+)zout (2:1), monohydraat | arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 10102-48-4 | arseenzuur (H3AsO4), lood(4+)zout (3:2) | arsenic acid (H3AsO4), lead(4+) salt (3:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 21480-65-9 | arseenzuur (H3AsO4), magnesiumzout (2:3) | arsenic acid (H3AsO4), magnesium salt (2:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 102110-21-4 | 310-019-9 | arseenzuur (H3AsO4), magnesiumzout, mangaan-gedoteerd | arsenic acid (H3AsO4), magnesium salt, manganese-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 16331-85-4 | 677-899-7 | arseenzuur (H3AsO4), monocesiumzout | arsenic acid (H3AsO4), monocesium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 164170-84-7 | arseenzuur (H3AsO4), monokaliumzout, 1/5-hydraat | arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13464-33-0 | arseenzuur (H3AsO4), zinkzout (1:1) | arsenic acid (H3AsO4), zinc salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 53404-12-9 | arseenzuur, (H3-As-O4), lood(4+) zout (4:3) | arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 94854-78-1 | arseenzuur, ammoniumkoperzout | arsenenous acid, ammonium copper salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 94854-80-5 | arseenzuur, ammoniumzinkzout | arsenenous acid, ammonium zinc salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 76871-66-4 | arseenzuur, cadmium neodymium(3+) zout (5:1:1) | arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 84953-43-5 | arseenzuur, cadmiumzout | arsenenous acid, cadmium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 10103-62-5 | 233-287-8 | arseenzuur, calciumzout | arsenic acid, calcium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13464-39-6 | arseenzuur, calciumzout (1:2) | arsenic acid, calcium salt (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 15194-98-6 | arseenzuur, calciumzout (2:1) | arsenenous acid, calcium salt (2:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13466-06-3 | arseenzuur, dinatriumzout | arsonic acid, disodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 24343-41-7 | arseenzuur, galliumzout (1:1) | arsenous acid, gallium salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 60168-33-4 | arseenzuur, ijzer(3+)zout (1:1) | arsenous acid, iron(3+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 29871-13-4 | 249-916-4 | arseenzuur, koper(2+)zout | arsenic acid, copper(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 73156-86-2 | arseenzuur, koper(2+)zout, hydraat, (2:3:3) | arsenous acid, copper(2+) salt, hydrate, (2:3:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 10103-61-4 | 233-286-2 | arseenzuur, koperzout | arsenic acid, copper salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 82980-40-3 | arseenzuur, kwik(2+) zout | arsenenous acid, mercury(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 76871-65-3 | arseenzuur, lutetium(3+)zout | arsenenous acid, lutetium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 6423-72-9 | arseenzuur, methyl-, calciumzout (1:1) | arsonic acid, methyl-, calcium salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 33972-75-7 | arseenzuur, methyl-, ijzerzout (9CI) | arsonic acid, methyl-, iron salt (9CI) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 54058-01-4 | arseenzuur, monoammoniumzout | arsonic acid, monoammonium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 10103-60-3 | arseenzuur, mononatriumzout | arsenic acid, monosodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 33992-49-3 | arseenzuur, nikkel(2+) zout | arsenenous acid, nickel(2+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 86859-92-9 | arseenzuur, praseodymium(3+)zout | arsenenous acid, praseodymium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 93080-00-3 | arseenzuur, tinzout | arsonic acid, tin salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 92278-94-9 | arseenzuur, titaanzout | arsenous acid, titanium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 36267-15-9 | arseenzuur, trikaliumzout | arsenous acid, tripotassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 33382-64-8 | arseenzuur, trikoper(1+)zout | arsenous acid, tricopper(1+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 37337-11-4 | arseenzuur, trikoper(1+)zout, geammoniseerd | arsenous acid, tricopper(1+) salt, ammoniated | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 69507-43-3 | arseenzuur, zilver(1+) zout | arsenenous acid, silver(1+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 28837-97-0 | arseenzuur, zinkzout (2:3) | arsenous acid, zinc salt (2:3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12344-68-2 | arsenaalsulfide (As2S4) | arsenic sulfide (As2S4) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12523-20-5 | arsenaalzuur, antimoon(3+)zout (1:1) | arsenous acid, antimony(3+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12005-86-6 | 624-772-9 | arsenaat(1-), hexafluoro-, natrium (1:1) | arsenate(1-), hexafluoro-, sodium (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 138608-19-2 | 630-782-4 | arsenazo III natrium | arsenazo III sodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 85906-44-1 | arseneenzuur, rubidiumzout | arsenenous acid, rubidium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 83877-96-7 | arsenenzuur, antimoon(3+)zout | arsenenous acid, antimony(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 16973-45-8 | arsenicum(5)hexafluoride | arsenic(5) hexafluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12777-38-7 | arsenicumoxide | arsenic oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13768-07-5 | arseniet | arsenenous acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13464-58-9 | arsenigzuur | arsenous acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 73688-85-4 | 620-678-7 | arsenigzuur, [4-[[4-(dimethylamino)fenyl]azo]fenyl]-, monohydrochloride | arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 88442-64-2 | arseninezuur (H3AsO4), koper(2+)zout (1:1), sesquihydraat | arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7645-25-2 | arseninezuur (H3AsO4), loodzout | arsenic acid (H3AsO4), lead salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 86859-93-0 | arseninezuur, cerium(3+)zout | arsenenous acid, cerium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 82005-78-5 | arseninezuur, cesiumzout | arsenenous acid, cesium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 72845-34-2 | arseninezuur, lithiumzout | arsenenous acid, lithium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 100822-74-0 | arseninezuur, lood(2+)zout (1:1) | arsenous acid, lead(2+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 76871-63-1 | arseninezuur, neodymium(3+) zout | arsenenous acid, neodymium(3+) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 10326-24-6 | arseninezuur, zinkzout | arsenenous acid, zinc salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 64436-13-1 | 634-697-3 | arsenobetaïne | arsenobetaine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12414-94-7 | arsenopyriet, kobalthoudend | arsenopyrite, cobaltoan | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7784-42-1 | 232-066-3 | arsine | arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 36465-76-6 | arsonaat | arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 109882-46-4 | arsonzuur, lood(2+)zout (1:1) | arsonic acid, lead(2+) salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 6379-37-9 | arsonzuur, methyl-, samengevoegd met 1-octanamine (1:1) | arsonic acid, methyl-, compd. with 1-octanamine (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12774-48-0 | arsoraan, pentahydroxy-, koper(2+)zout (1:2) | arsorane, pentahydroxy-, copper(2+) salt (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 119-96-0 | 204-361-7 | arsthinol | arsthinol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1332-21-4 | asbest | asbestos | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | |||||||
| asbest amfibolen | asbestos amphibole | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | |||||||
| 12001-29-5 | 601-650-3 | asbest chrysotiel | asbestos, chrysotile | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | |||||
| 3337-71-1 | 222-077-1 | asulam | asulam | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 113 | ||||||
| 2302-17-2 | 218-953-8 | asulam natrium | asulam sodium | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 113 | ||||||
| 68049-83-2 | 620-425-0 | azafenidin | azafenidin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 2879-60-9 | azijnzuur, 2,2,2-trichloro-, 2,3,4,5,6-pentachlorophenyl ester | acetic acid, 2,2,2-trichloro-, 2,3,4,5,6-pentachlorophenyl ester | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 57 | ||||||
| 19745-69-8 | azijnzuur, 2,2-dichloor-, 2,3,4,5,6-pentachloorfenylester | acetic acid, 2,2-dichloro-, 2,3,4,5,6-pentachlorophenyl ester | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 57 | ||||||
| 5743-04-4 | 611-525-5 | azijnzuur, cadmiumzout, dihydraat | acetic acid, cadmium salt, dihydrate | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 57, 86 | ||||||
| 6080-56-4 | 612-031-2 | azijnzuur, lood(2+) zout, trihydraat | acetic acid, lead(2+) salt, trihydrate | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 57 | ||||||
| 151-56-4 | 205-793-9 | aziridine | ethyleneimine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 103-33-3 | 203-102-5 | azobenzeen | azobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 41083-11-8 | 255-209-1 | azocyclotin | azocyclotin | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 123-77-3 | 204-650-8 | azodicarbonamide | diazene-1,2-dicarboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| azokleurstoffen op basis van benzidine | benzidine based azo dyes | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| azokleurstoffen op basis van o-dianisidine | o-dianisidine based azo dyes | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| azokleurstoffen op basis van o-tolidine | o-tolidine based dyes | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 18115-48-5 | 689-447-6 | barium tetrafluornikkelaat(2-) | barium tetrafluoronickelate(2-) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 10294-40-3 | 233-660-5 | bariumchromaat | barium chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 57 | |||||
| 13701-59-2 | 237-222-4 | bariumdiboortetraoxide | Barium diboron tetraoxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | ||||
| 51404-69-4 | 257-175-3 | basisch azijnzuur loodzout | acetic acid, lead salt, basic | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 73-48-3 | 200-800-1 | bendroflumethiazide | bendroflumethiazide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 1861-40-1 | 217-465-2 | benfluralin | benfluralin | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 17804-35-2 | 241-775-7 | benomyl | benomyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 413615-35-7 | 609-913-4 | benthiavalicarb | benthiavalicarb | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 114 | ||||||
| 177406-68-7 | 605-799-5 | benthiavalicarb-isopropyl | benthiavalicarb isopropyl | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 81 | |||||
| 225-11-6 | 205-929-7 | benz[a]acridine | benz[a]acridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 225-51-4 | 205-930-2 | benz[c]acridine | benz[c]acridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 71-43-2 | 200-753-7 | benzeen | benzene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 552-30-7 | 209-008-0 | benzeen-1,2,4-tricarbonzuur-1,2-anhydride | benzene-1,2,4-tricarboxylic acid 1,2 anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 24-4-2018 | ||||||
| 32602-97-4 | 694-638-2 | benzeen-13C6-d6 | benzene-13C6-d6 | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 57, 68 | ||||||
| 92-87-5 | 202-199-1 | benzidine | benzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 29 | |||||
| 36341-27-2 | 252-984-8 | benzidine acetaat | benzidine acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 531-85-1 | 208-519-6 | benzidine dihydrochloride | benzidine dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 41195-21-5 | benzidine diperchloraat | benzidine diperchlorate | MVP 1 | 0,05 mg/Nm3 | 2-2-2022 | 57, 69 | |||||||
| 14414-68-7 | benzidine hydrochloride | benzidine, hydrochloride | MVP 1 | 0,05 mg/Nm3 | 14-2-2022 | 57, 69 | |||||||
| 21136-70-9 | 244-236-4 | benzidinesulfaat | benzidine sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 86290-81-5 | 289-220-8 | benzine | gasoline | Ja | 2-12-2013 | 4, 65 | |||||||
| 93572-29-3 | 297-458-9 | benzine, C5-11-, gestabiliseerde, gereformde, met hoog octaangehalte | gasoline, C5-11, high-octane stabilised reformed | Ja | 2-12-2013 | 4, 65 | |||||||
| 68514-15-8 | 271-025-4 | benzine, dampterugwinning | gasoline, vapor-recovery | Ja | 2-12-2013 | 4, 65 | |||||||
| 68606-11-1 | 271-727-0 | benzine, direct door fractionering verkregen aftopinrichting | gasoline, straight-run, topping-plant | 2-12-2013 | 4 | ||||||||
| 8006-61-9 | 232-349-1 | benzine, natuurlijke | gasoline, natural | Ja | 2-12-2013 | 4, 65 | |||||||
| 68606-10-0 | 271-726-5 | benzine, pyrolyse, butaanverwijdering bodemfracties | gasoline, pyrolysis, debutanizer bottoms | Ja | 2-12-2013 | 4, 65 | |||||||
| 94114-03-1 | 302-639-3 | benzine, pyrolyse, gehydrogeneerd, | gasoline, pyrolysis, hydrogenated | Ja | 2-12-2013 | 4, 65 | |||||||
| 56-55-3 | 200-280-6 | benzo[a]antraceen | benz[a]anthracene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 50-32-8 | 200-028-5 | benzo[a]pyreen | benzo[a]pyrene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 205-99-2 | 205-911-9 | benzo[b]fluoranteen | benzo[e]acephenanthrylene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 192-97-2 | 205-892-7 | benzo[e]pyreen | benzo[e]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 191-24-2 | 205-883-8 | benzo[g,h,i]peryleen | benzo[ghi]perylene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 205-82-3 | 205-910-3 | benzo[j]fluoranteen | benzo[j]fluoranthene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 207-08-9 | 205-916-6 | benzo[k]fluoranteen | benzo[k]fluoranthene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 119-61-9 | 204-337-6 | benzofenon | benzophenone | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 65996-88-5 | 266-023-5 | benzolvoorloop (kool) | benzol forerunnings (coal) | Ja | 2-12-2013 | 4, 61 | |||||||
| 98-07-7 | 202-634-5 | benzotrichloride | α,α,α-trichlorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 98-08-8 | 202-635-0 | benzotrifluoride | α,α,α-trifluorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 577705-90-9 | 479-100-5 | benzyl(diëthylamino) difenylfosfonium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyfenyl)propaan-2-yl] fenolaat | benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81, 96 | ||||
| 85-68-7 | 201-622-7 | benzylbutylftalaat | benzyl butyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 100-44-7 | 202-853-6 | benzylchloride | α-chlorotoluene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 75768-65-9 | 278-305-5 | benzyltrifenylfosfonium, zout met 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]bis [fenol] (1:1) | benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81, 96 | ||||
| 7440-41-7 | 231-150-7 | beryllium | beryllium | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10210-64-7 | 233-513-5 | beryllium acetylacetonaat | Bis(pentane-2,4-dionato-O,O')beryllium | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 57, 69 | ||||||
| 506-66-1 | 208-050-7 | beryllium acetylide | beryllium acetylide | MVP 1 | 0,05 mg/Nm3 | 3-1-2022 | 57, 69 | ||||||
| 13106-47-3 | 236-030-8 | beryllium carbonaat | beryllium carbonate | MVP 1 | 0,05 mg/Nm3 | 3-1-2022 | 57, 69 | ||||||
| 7787-47-5 | 232-116-4 | beryllium chloride | beryllium chloride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 14874-86-3 | 238-948-4 | beryllium diammonium tetrafluoride | beryllium diammonium tetrafluoride | MVP 1 | 0,05 mg/Nm3 | 15-2-2022 | 57, 69 | ||||||
| 543-81-7 | 208-850-6 | beryllium diazijnzuur | Beryllium di(acetate) | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 12536-51-5 | 235-694-6 | beryllium diboride | beryllium diboride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 7787-46-4 | 232-115-9 | beryllium dibromide | beryllium dibromide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 7787-53-3 | 232-119-0 | beryllium dijodide | beryllium diiodide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 58127-61-0 | 261-137-1 | beryllium fosfide | beryllium phosphide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 12429-94-6 | 235-657-4 | beryllium hexaboride | beryllium hexaboride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 69 | ||||||
| 13327-32-7 | 236-368-6 | beryllium hydroxide | beryllium hydroxide | MVP 1 | 0,05 mg/Nm3 | 3-1-2022 | 57, 69 | ||||||
| 15191-85-2 | 239-251-8 | beryllium kiezelzuur | beryllium orthosilicate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 13597-99-4 | 237-062-5 | beryllium nitraat | beryllium nitrate | MVP 1 | 0,05 mg/Nm3 | 30-05-2016 | 69 | ||||||
| 1304-56-9 | 215-133-1 | beryllium oxide | beryllium oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 19049-40-2 | 242-785-4 | beryllium oxyazijnzuur | hexakis[μ-(acetato-O:O')]-μ4-oxotetraberyllium | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 57, 69 | ||||||
| 63990-88-5 | beryllium oxyfluoride | beryllium oxyfluoride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | |||||||
| 13510-49-1 | 236-842-2 | beryllium sulfaat | beryllium sulphate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 7787-56-6 | 629-461-1 | beryllium sulfaat tetrahydraat | beryllium sulfate tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 13598-22-6 | 237-064-6 | beryllium sulfide | beryllium sulphide | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 12232-27-8 | 235-451-4 | beryllium telluride | beryllium telluride | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 7787-55-5 | beryllium trihydraat | beryllium nitrate trihydrate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | |||||||
| 25638-88-4 | 247-151-0 | beryllium zink silicaat | beryllium zinc silicate | MVP 1 | 0,05 mg/Nm3 | 16-2-2022 | 57, 69 | ||||||
| 148896-39-3 | 890-452-2 | beryllium, bis(benzo[h]quinoline-10-olato-κN1,κO10)-, (T-4)- | beryllium, bis(benzo[h]quinolin-10-olato-κN1,κO10)-, (T-4)- | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 57, 69 | ||||||
| 220694-90-6 | 890-441-2 | beryllium; 2-pyridin-2-ylphenolaat | beryllium; 2-pyridin-2-ylphenolate | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 57, 69 | ||||||
| berylliumverbindingen | beryllium compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 3 | |||||||
| 1329995-45-0 | beta-cyclodextrin, verbinding met tridecafluorhexaansulfonzuur ion(1-) (1:1) | beta-cyclodextrin, compd. with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid ion(1-) (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 33213-65-9 | 625-635-6 | beta-endosulfan | beta-endosulfan | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 134237-51-7 | beta-hexabroomcyclododecaan | beta-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||
| 319-85-7 | 206-271-3 | beta-hexachloorcyclohexaan | beta-hexachlorocyclohexane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 64742-67-2 | 265-171-8 | bezinkselolie (aardolie) | foots oil (petroleum) | Ja | 2-12-2013 | 4, 62 | |||||||
| 97862-77-6 | 308-127-6 | bezinkselolie (aardolie), behandeld met kiezelzuur | foots oil (petroleum), silicic acid-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 97862-76-5 | 308-126-0 | bezinkselolie (aardolie), met koolstof behandeld | foots oil (petroleum), carbon-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 92045-12-0 | 295-394-6 | bezinkselolie (aardolie), met waterstof behandeld | foots oil (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 93924-31-3 | 300-225-7 | bezinkselolie (aardolie), zuurbehandeld | foots oil (petroleum), acid-treated | Ja | 2-12-2013 | 4, 60 | |||||||
| 93924-32-4 | 300-226-2 | bezinkselolie, met klei behandeld | foots oil (petroleum), clay-treated | Ja | 2-12-2013 | 4, 60 | |||||||
| 82657-04-3 | 617-373-6 | bifenthrin | bifenthrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 91-95-2 | 202-110-6 | bifenyl-3,3',4,4'-tetrayltetraamine | biphenyl-3,3',4,4'-tetrayltetraamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 485-31-4 | 207-612-9 | binapacryl | binapacryl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14949-69-0 | 239-028-5 | bis(1,1,1,5,5,5-hexafluorpentaan-2,4-dionato-O,O')nikkel | bis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-O,O')nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 96 | |||||
| 111532-88-8 | 631-201-7 | bis(1,2-benzeendiaminato-N,N')nikkel | bis(1,2-benzenediaminato-N,N')nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 1295-35-8 | 215-072-0 | bis(1,5-cyclooctadieen)nikkel | bis(1,5-cyclooctadiene)nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 21319-43-7 | 621-125-2 | bis(2,2,6,6-tetramethyl-3,5-heptaandionaat)lood(II) | bis(2,2,6,6-tetramethyl-3,5-heptanedionato)lead(II) | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 57 | ||||||
| 40334-69-8 | bis(2-chloorvinyl)chloorarsine | arsine, bis(2-chlorovinyl)chloro- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 26040-51-7 | 247-426-5 | bis(2-ethylhexyl) tetrabroomftalaat | bis(2-ethylhexyl) tetrabromophthalate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57, 90 | |||||
| 117-81-7 | 204-211-0 | bis(2-ethylhexyl)ftalaat | bis(2-ethylhexyl) phthalate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||
| 117-82-8 | 204-212-6 | bis(2-methoxyethyl)ftalaat | bis(2-methoxyethyl) phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 678-41-1 | 211-649-6 | bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)waterstof fosfaat | bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) hydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 80-07-9 | 201-247-9 | bis(4-chloorfenyl)sulfon | bis(4-chlorophenyl) sulphone | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 81 | |||||
| 341548-85-4 | bis(4-methylfenyl)fenyl-sulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, bis(4-methylphenyl)phenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 194999-85-4 | 432-660-4 | bis(4-t-butylfenyl) iodonium perfluorbutaansulfonaat | bis(4-t-butylphenyl) iodonium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 3570-80-7 | 222-673-1 | bis(acetaat-O)[μ-(3',6'-dihydroxy-3-oxospiro[isobenzofuraan-1(3H),9'-[9H]xantheen]-2',7'-diyl)]dikwik | bis(acetato-O)[μ-(3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-2',7'-diyl)]dimercury | MVP 1 | 0,05 mg/Nm3 | 23-2-2022 | 42, 57 | ||||||
| 112-243-0 | bis(butylammonium) tris(methylammonium) tridecaiodotetraplumbaat | Bis(butylammonium) tris(methylammonium) tridecaiodotetraplumbate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 127 | |||||||
| 542-88-1 | 208-832-8 | bis(chloormethyl)ether | bis(chloromethyl) ether | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 71957-07-8 | 276-205-6 | bis(D-gluconato-O.su.1.su.,O.su.2.su.)nikkel | bis(d-gluconato-O1,O2)nickel | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 17549-30-3 | 241-534-6 | bis(diethyldithiocarbamaat-S,S')lood | bis(diethyldithiocarbamato-S,S')lead | MVP 1 | 0,05 mg/Nm3 | 1-2-2022 | 14, 57 | ||||||
| 14267-17-5 | 238-157-4 | bis(diethyldithiocarbamato-S,S')nikkel | bis(diethyldithiocarbamato-S,S')nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 120045-16-1 | 631-453-8 | bis(N,N-dimethyl-N'-5H-pyrido[2,3-a]fenothiazin-5-ylideen-1,4-fenyleendiamine)nikkel(II)diperchloraat | bis(N,N-dimethyl-N'-5H-pyrido[2,3-a]phenothiazin-5-ylidene-1,4-phenylenediamine)nickel(II) diperchlorate | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 52299-25-9 | 700-183-3 | bis(nonafluorbutyl)fosfinezuur | bis(nonafluorobutyl)phosphinic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 207596-30-3 | 103-381-2 | bis(octaanzuur)hydraat nikkel | Bis(octanoic acid) hydrate nickel | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 15282-88-9 | 239-323-9 | bis(pentaan-2,4-dionaat-O,O')lood | bis(pentane-2,4-dionato-O,O')lead | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 68892-01-3 | 272-591-5 | bis(pentaan-2,4-dionato-O,O')boor(1+) hexafluorarsenaat(1-) | bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 3264-82-2 | 221-875-7 | bis(pentaan-2,4-dionato-O,O')nikkel | bis(pentane-2,4-dionato-O,O')nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 1163-19-5 | 214-604-9 | bis(pentabroomfenyl)ether | bis(pentabromophenyl) ether | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 40143-79-1 | bis(perfluoroctyl)fosfinezuur | bis(perfluorooctyl)phosphinic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 18958-57-1 | 677-981-2 | bis(tetrabutylammonium) bis(maleonitrieldithiolato)nikkel(II) complex | bis(tetrabutylammonium) bis(maleonitriledithiolato)nickel(II) complex | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 19999-87-2 | 624-241-1 | bis(tricyclohexylfosfine)nikkel(II) dichloride | bis(tricyclohexylphosphine)nickel(II) dichloride | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 14264-16-5 | 238-154-8 | bis(trifenylfosfine)nikkel(II) chloride | bis(triphenylphosphine)nickel(II) chloride | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 27057-09-6 | 809-042-1 | bis(trifenylfosfino)(2-methylfenyl)chloornikkel(II) | bis(triphenylphosphino)(2-methylphenyl)chloronickel(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 1624-02-8 | 216-612-8 | bis(trifenylsilyl)chromaat | bis(triphenylsilyl) chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 80-43-3 | 201-279-3 | bis(α,α-dimethylbenzyl)peroxide | bis(α,α-dimethylbenzyl) peroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | |||||
| 1271-28-9 | 215-039-0 | bis(η5-2,4-cyclopentadieen-1-yl)nikkel | bis(η5-2,4-cyclopentadien-1-yl)nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 866621-50-3 | bis[(1,1-dimethylethyl)fenyl]-jodonium, zout met tridecafluorhexaansulfonzuur (1:1) (9CI) | iodonium, bis[(1,1-dimethylethyl)phenyl]-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) (9CI) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 23582-05-0 | 245-756-4 | bis[(2-difenylarsinoethyl)fenyl]fosfine | bis[(2-diphenylarsinoethyl)phenyl]phosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 38465-55-3 | 253-958-9 | bis[1-[4-(dimethylamino)fenyl]-2-fenylethyleen-1,2-dithiolato(2-)-S,S']nikkel | bis[1-[4-(dimethylamino)phenyl]-2-phenylethylene-1,2-dithiolato(2-)-S,S']nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 625080-35-5 | 684-861-3 | bis[2-(nitro-kO)-4-nitrofenolaat-kO]-lood | bis[2-(nitro-kO)-4-nitrophenolato-kO]-lead | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 1895-26-7 | 217-585-5 | bis[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluordodecyl]waterstof fosfaat | bis[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl] hydrogen phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 213740-81-9 | bis[4-(1,1-dimethylethyl)fenyl]-jodonium, tridecafluorhexaansulfonaat (1:1) | iodonium, bis[4-(1,1-dimethylethyl)phenyl]-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 421555-74-0 | bis[4-(1,1-dimethylpropyl)fenyl]-jodonium, zout met tridecafluorhexaansulfonzuur | iodonium, bis[4-(1,1-dimethylpropyl)phenyl]-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 892154-91-5 | 693-595-7 | bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]fenylfosfine | bis[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]phenylphosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 38951-97-2 | 254-212-5 | bis[4,4'-dimethoxy-α,α'-stilbenedithiolato(2-)]nikkel | bis[4,4'-dimethoxy-α,α'-stilbenedithiolato(2-)]nickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 14426-25-6 | 238-398-5 | bis[p-(dimethylamino)fenyl][p-(dimethylammonio)fenyl]methylium | bis[p-(dimethylamino)phenyl][p-(dimethylammonio)phenyl]methylium | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56, 57 | |||||
| 28984-20-5 | 249-353-4 | bis[stilbeen-α,β-dithiolato(2-)]nikkel | Bis[stilbene-α,β-dithiolato(2-)]nickel | MVP 1 | 20-8-2024 | 34, 57 | |||||||
| 326475-44-9 | 118-481-1 | bis[tris(4-(heptadecafluoroctyl)fenyl)fosfine | BIS[TRIS(4-(HEPTADECAFLUOROOCTYL)PHENYL)PHOSPHINE | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 80-05-7 | 201-245-8 | bisfenol A | 4,4'-isopropylidenediphenol | Ja | Ja | MVP 2 | 1 mg/Nm3 | 4-1-2017 | |||||
| 67874-71-9 | 267-499-7 | bismut tris(2-ethylhexanoaat) | bismuth tris(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 956-085-8 | bismutwolfraamloodtelluriet, amorf | amorphous bismuth tungsten lead tellurite | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 14, 57 | |||||||
| 13510-31-1 | boorarsenaat | boron arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12005-70-8 | boorarsenide (B6As) | boron arsenide (B6As) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12005-69-5 | boorarsenide (BAs) | boron arsenide (BAs) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 956-834-9 | boorlithiumzinktelluriet, amorf | amorphous boron lithium zinc tellurite | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 80, 82 | |||||||
| 10043-35-3 | 233-139-2 | boorzuur | boric acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 22454-04-2 | boorzuur (H3BO3), dinatrium zout | boric acid (H3BO3), disodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 57 | ||||||
| 14890-53-0 | boorzuur (H3BO3), natriumzout (1:1) | boric acid (H3BO3), sodium salt (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 57 | ||||||
| 25747-83-5 | boorzuur (H3BO3), natriumzout, hydraat | boric acid (H3BO3), sodium salt, hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 57 | ||||||
| 12712-38-8 | 603-184-6 | boorzuur, kaliumzout | boric acid, potassium salt | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 1333-73-9 | 215-604-1 | boorzuur, natrium zout | boric acid, sodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 57 | |||||
| 11130-12-4 | 601-071-6 | boorzuur, natriumzout, pentahydraat | boric acid, sodium salt, pentahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 90568-23-3 | boraat(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, natrium (1:2) | borate(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, sodium (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 125022-34-6 | boraat(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, natrium, hydraat (1:2:6) | borate(2-), tetrahydroxybis[μ-(peroxy-kappaO1:kappaO2)]di-, sodium, hydrate (1:2:6) | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 1303-96-4 | 603-411-9 | boraxdecahydraat | sodium tetraborate decahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 12179-04-3 | 601-808-1 | boraxpentahydraat | disodium tetraborate pentahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68334-30-5 | 269-822-7 | brandstoffen, diesel- | fuels, diesel | MVP 1 | 0,05 mg/Nm3 | 28-3-2022 | 80, 82 | ||||||
| 68476-26-6 | 270-667-2 | brandstofgassen | fuel gases | Ja | 2-12-2013 | 4, 60 | |||||||
| 68476-29-9 | 270-670-9 | brandstofgassen, destillaten van ruwe olie | fuel gases, crude oil of distillates | Ja | 2-12-2013 | 4, 60 | |||||||
| 68553-00-4 | 271-384-7 | brandstofolie, nr. 6 | fuel oil, No 6 | Ja | 2-12-2013 | 4 | |||||||
| 68476-33-5 | 270-675-6 | brandstofolie, residuaal | fuel oil, residual | Ja | 2-12-2013 | 4 | |||||||
| brandstofreservoir voor hydraulisch aggregaat voor vliegtuigen | fuel tank for aircraft hydraulic generator | Ja | Ja | MVP 2 | 1 mg/Nm3 | 29-11-2024 | 82, 106, 107 | ||||||
| 56073-10-0 | 259-980-5 | brodifacoum | brodifacoum | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 28772-56-7 | 249-205-9 | bromadiolon | bromadiolone | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 63468-73-5 | 264-254-6 | broom(hydroxytetraphenylarsoranato)magnesium | bromo(hydroxytetraphenylarsoranato)magnesium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 894102-11-5 | 679-543-6 | broom[(2,6-pyridinediyl)bis(3-methyl-1-imidazolyl-2-ylideen)]nikkel bromide | bromo[(2,6-pyridinediyl)bis(3-methyl-1-imidazolyl-2-ylidene)]nickel bromide | MVP 1 | 20-8-2024 | 34, 57 | |||||||
| 41141-89-3 | 621-229-8 | broomtriethyllood | plumbane, bromotriethyl- | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 3896-11-5 | 223-445-4 | bumetrizool | bumetrizole | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | |||||
| 34492-97-2 | bunseniet | bunsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 106-97-8 | 203-448-7 | butaan | butane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 32 | |||||
| 1882109-60-5 | butaanzuur, 2,3,3,4,4,4-hexafluor-2-[2,2,2-trifluor-1,1-bis(trifluormethyl)ethyl]- | butanoic acid, 2,3,3,4,4,4-hexafluoro-2-[2,2,2-trifluoro-1,1-bis(trifluoromethyl)ethyl]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-61-6 | butaanzuur, 2,3,4,4,4-pentafluor-2-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]-3-(trifluormethyl)- | butanoic acid, 2,3,4,4,4-pentafluoro-2-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-58-1 | butaanzuur, 3,3,4,4,4-pentafluor-2,2-bis(1,1,2,2,2-pentafluorethyl)- | butanoic acid, 3,3,4,4,4-pentafluoro-2,2-bis(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-59-2 | butaanzuur, 3,3,4,4,4-pentafluor-2-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]-2-(trifluormethyl)- | butanoic acid, 3,3,4,4,4-pentafluoro-2-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-62-7 | butaanzuur, 4,4,4-trifluor-2,2,3,3-tetrakis(trifluormethyl)- | butanoic acid, 4,4,4-trifluoro-2,2,3,3-tetrakis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 96-29-7 | 202-496-6 | butanon oxime | 2-butanone oxime | Ja | MVP 2 | 1 mg/Nm3 | 24-3-2020 | ||||||
| 15546-16-4 | 239-596-4 | butyl (Z,Z)-6,6-dibutyl-4,8,11-trioxo-5,7,12-trioxa-6-stannahexadeca-2,9-dienoaat | butyl (Z,Z)-6,6-dibutyl-4,8,11-trioxo-5,7,12-trioxa-6-stannahexadeca-2,9-dienoate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 2273-43-0 | 218-880-1 | butylhydroxyoxostannaan | butylhydroxyoxostannane | Ja | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | |||||
| 94-26-8 | 202-318-7 | butylparabeen | butyl 4-hydroxybenzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-7-2020 | ||||||
| 2580-56-5 | 219-943-6 | C.I. basic blue 26 [met 0,1 procent of meer Michler's keton (EC nr. 202-027-5) of Michler's base (EC No. 202-959-2)] | C.I. basic blue 26 [with >0.1% of Michler's ketone (EC No. 202-027-5) or Michler's base (EC No. 202-959-2)] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 569-61-9 | 209-321-2 | C.I. basic red 9 | 4,4'-(4-iminocyclohexa-2,5-dienylidenemethylene)dianiline hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 548-62-9 | 208-953-6 | C.I. basic violet 3 [met 0,1 procent of meer Michler's keton (EG-nr. 202-027-5)] | C.I. basic violet 3 with ≥ 0.1 % of Michler's ketone (EC no. 202-027-5) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 573-58-0 | 209-358-4 | C.I. direct red 28 | disodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalene-1-sulphonate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 6786-83-0 | 229-851-8 | C.I. solvent blue 4 [met 0,1 procent of meer Michler's keton (EG-nr. 202-027-5) of Michler's base (EG-nr. 202-959-2)] | α,α-bis[4-(dimethylamino)phenyl]-4 (phenylamino)naphthalene-1-methanol (C.I. solvent blue 4) [with >0.1% of Michler's ketone (EC No. 202-027-5) or Michler's base (EC No. 202-959-2)] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85535-84-8 | 287-476-5 | C10-13-chlooralkanen | chlorinated paraffins, C10-C13 | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||
| 85535-85-9 | 287-477-0 | C14-17-chlooralkanen | Alkanes, C14-17, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | |||||
| 84776-07-8 | 283-931-7 | C16-27-chlooralkanen | alkanes, C16-27, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 85049-26-9 | 285-195-2 | C16-36-chlooralkanen | alkanes, C16-35, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 91079-47-9 | 293-435-2 | C9-11-fenolen | phenols, C9-11 | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 61, 63 | |||||
| 7440-43-9 | 231-152-8 | cadmium | cadmium | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||
| 35658-65-2 | 621-024-3 | cadmium (II) chloride monohydraat | cadmium (II) chloride monohydrate | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 57, 86 | ||||||
| 2420-98-6 | 219-346-0 | cadmium bis(2-ethylhexanoaat) | cadmium bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 14402-75-6 | 238-371-8 | cadmium di-kalium tetracyanide | cadmium dipotassium tetracyanide | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 69011-69-4 | 273-707-7 | cadmium, slakken | cadmium, dross | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 7789-42-6 | 232-165-1 | cadmiumbromide | cadmium bromide | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 513-78-0 | 208-168-9 | cadmiumcarbonaat | cadmium carbonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57 | ||||
| 10108-64-2 | 233-296-7 | cadmiumchloride | cadmium chloride | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||
| 654054-66-7 | 629-592-4 | cadmiumchloride hydraat | cadmium chloride hydrate | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 7790-78-5 | 640-998-0 | cadmiumchloride, hydraat (2:5) | cadmium chloride, hydrate (2:5) | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57 | |||||
| 542-83-6 | 208-829-1 | cadmiumcyanide | Cadmium cyanide | MVP 1 | 0,05 mg/Nm3 | 30-8-2024 | 57, 86 | ||||||
| 543-90-8 | 208-853-2 | cadmiumdiazijnzuur | cadmium di(acetate) | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 4464-23-7 | 224-729-0 | cadmiumdiformiaat | cadmium diformate | MVP 1 | 0,05 mg/Nm3 | 30-8-2024 | 57, 86 | ||||||
| 7790-79-6 | 232-222-0 | cadmiumfluoride | cadmium fluoride | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 17010-21-8 | 241-084-0 | cadmiumhexafluorosilicaat(2-) | cadmium hexafluorosilicate(2-) | MVP 1 | 0,05 mg/Nm3 | 30-8-2024 | 57, 86 | ||||||
| 21041-95-2 | 244-168-5 | cadmiumhydroxide | cadmium hydroxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57 | ||||
| 7790-80-9 | 232-223-6 | cadmiumjodide | cadmium iodide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 86 | ||||||
| 10325-94-7 | 233-710-6 | cadmiumnitraat | cadmium nitrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57 | ||||
| 10022-68-1 | 638-751-7 | cadmiumnitraat tetrahydraat | cadmium nitrate tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 1306-19-0 | 215-146-2 | cadmiumoxide | cadmium oxide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||
| 10124-36-4 | 233-331-6 | cadmiumsulfaat | cadmium sulphate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 37, 57 | |||
| 15244-35-6 | 626-360-4 | cadmiumsulfaat hydraat | cadmium sulfate hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57 | |||||
| 7790-84-3 | 616-572-5 | cadmiumsulfaat hydraat (3:8) | cadmium sulphate hydrate (3:8) | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57 | |||||
| 1306-23-6 | 215-147-8 | cadmiumsulfide | cadmium sulphide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 68877-00-9 | 272-541-2 | cadmiumsulfide (CdS), gedoteerd met koperchloride | cadmium sulfide (CdS), copper chloride-doped | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 68512-49-2 | 270-977-8 | cadmiumsulfide (CdS), vaste oplossing met zinksulfide, gedoteerd met koperchloride | cadmium sulfide (CdS), solid soln. with zinc sulfide, copper chloride-doped | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 68583-45-9 | 271-513-7 | cadmiumsulfide (CdS), vaste oplossing met zinksulfide, gedoteerd met zilverchloride | cadmium sulfide (CdS), solid soln. with zinc sulfide, silver chloride-doped | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| cadmiumverbindingen | cadmium compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 15195-00-3 | 672-782-7 | calcium arsenaat (CaHAsO4) (6CI,7CI) | calcium arsenate (CaHAsO4) (6CI,7CI) | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 136-51-6 | 205-249-0 | calcium bis(2-ethylhexaanzuur) | calcium bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 5785-43-3 | 227-311-6 | calcium bis(dimethylarsinaat) | calcium bis(dimethylarsinate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 5902-95-4 | 227-598-8 | calcium bis(methylarsonaat) | calcium bis(methylarsonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 701-251-5 | calcium, vertakt alkylfenaatsulfide | calcium branched alkyl phenate sulphide | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 80, 82 | |||||||
| 7778-44-1 | 231-904-5 | calciumarsenaat | calcium arsenate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | ||||
| 17068-86-9 | calciumarsenaatfluoride | calcium arsenate fluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 52740-16-6 | 258-147-3 | calciumarseniet | calcium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 20-12-2021 | 57, 92 | |||||
| 13765-19-0 | 237-366-8 | calciumchromaat | calcium chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 27-6-2013 | ||||||
| 14307-33-6 | 238-243-1 | calciumdichromaat | calcium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 12213-73-9 | 996-239-1 | calciumnikkel-legering (CaNi5) | Calcium Nickel Alloy (CaNi5) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 2425-06-1 | 219-363-3 | captafol | captafol | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6804-07-5 | 229-879-0 | carbadox | carbadox | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 95370-51-7 | 305-913-0 | carbaminezuur, [2-( sulfothio )ethyl]-, C-(γ-ω-perfluor-C6-9-alkyl)esters, mononatrium zouten | carbamic acid, [2-(sulfothio)ethyl]-, C-(γ-ω-perfluoro-C6-9-alkyl) esters, monosodium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 121-59-5 | 204-484-6 | carbarson | carbarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 10605-21-7 | 234-232-0 | carbendazim | carbendazim | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16118-49-3 | 240-286-6 | carbetamide | carbetamide | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 18942-25-1 | 677-958-7 | carbonzuur, 1,1-dimethylethyl pentachloorfenylester | carbonic acid, 1,1-dimethylethyl pentachlorophenyl ester | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 57 | |||||
| 72968-38-8 | 277-138-5 | carboxylzuren, C7-13, perfluor, ammonium zouten | carboxylic acids, C7-13, perfluoro, ammonium salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-8-2024 | 57, 94, 96 | ||||
| 120-80-9 | 204-427-5 | catechol | pyrocatechol | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | ||||||
| 440667-11-8 | 810-778-0 | cerium nikkel zirconiumoxide | cerium nickel zirconium oxide | MVP 1 | 20-8-2024 | 34, 57 | |||||||
| 56797-01-4 | 260-386-3 | cerium tris(2-ethylhexanoaat) | cerium tris(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 56320-90-2 | 620-910-7 | cesiumchromaat | cesium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 13530-67-1 | 236-879-4 | cesiumdichromaat | caesium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 18041-25-3 | 835-807-4 | cesiumlood tri-jodide (laag watergehalte) | cesium lead triiodide (low water content) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 15243-48-8 | 835-536-1 | cesiumloodtribromide (laag watergehalte) | cesium lead tribromide (low water content) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 91-22-5 | 202-051-6 | chinoline | quinoline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1501945-23-8 | 817-158-9 | chloor(2-methylfenyl)[1,1'-bis(difenylfosfino)ferroceen]nikkel(II) | Chloro(2-methylphenyl)[1,1'-bis(diphenylphosphino)ferrocene]nickel (II) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 61788-76-9 | 263-004-3 | chlooralkanen | alkanes, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 108171-26-2 | chlooralkanen, C10-12 | chloroalkanes, C10-12 | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56, 57 | ||||||
| 85681-73-8 | 288-211-6 | chlooralkanen, C10-14 | chloroalkanes, C10-14 | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56, 57 | |||||
| 84082-38-2 | 281-985-6 | chlooralkanen, C10-21 | alkanes, C10-21, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 97659-46-6 | 307-451-5 | chlooralkanen, C10-26 | alkanes, C10-26, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 84776-06-7 | 283-930-1 | chlooralkanen, C10-32 | alkanes, C10-32, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 71011-12-6 | chlooralkanen, C12-13 | chloroalkanes, C12-13 | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56, 57 | ||||||
| 85536-22-7 | 287-504-6 | chlooralkanen, C12-14 | alkanes, C12-14, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 68920-70-7 | 272-924-4 | chlooralkanen, C6-18 | alkanes, C6-18, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| chloorbenzotrifluoriden | chlorobenzotrifluorides | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 1419179-26-2 | 835-019-0 | chloorbis[dicyclohexyl(fenyl)fosfino](o-tolyl)nikkel(II) | chlorobis[dicyclohexyl(phenyl)phosphino](o-tolyl)nickel(II) | MVP 1 | 20-8-2024 | 34, 57 | |||||||
| 57-74-9 | 200-349-0 | chloordaan | chlordane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 143-50-0 | 205-601-3 | chloordecon | chlordecone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 107-30-2 | 203-480-1 | chloordimethylether | chloromethyl methyl ether | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 3691-35-8 | 223-003-0 | chloorfacinon | chlorophacinone | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 122453-73-0 | 602-782-4 | chloorfenapyr | chlorfenapyr | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 470-90-6 | 207-432-0 | chloorfenvinfos | chlorfenvinphos | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 71422-67-8 | 615-292-0 | chloorfluazuron | chlorfluazuron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| chloorfluorkoolstoffen | chlorofluorocarbons | Ja | - | 18-11-2024 | 101, 102 | ||||||||
| chloorfluorkoolwaterstoffen | chlorofluorohydrocarbons | Ja | - | 18-11-2024 | 101, 102 | ||||||||
| 115-09-3 | 204-064-2 | chloormethylkwik | chloromethylmercury | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57 | |||||
| 3724-43-4 | 425-970-6 | chloor-N,N-dimethylformiminiumchloride | chloro-N,N-dimethylformiminium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 76-15-3 | 200-938-2 | chloorpentafluorethaan | chloropentafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 1067-14-7 | 213-925-1 | chloortriethyllood | chlorotriethylplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 1153-06-6 | 214-572-6 | chloortrifenyllood | chlorotriphenylplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 56966-02-0 | 105-911-8 | chloortris(4-methoxyfenyl)lood | CHLOROTRIS(4-METHOXYPHENYL)LEAD | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 127 | ||||||
| 14973-92-3 | 239-051-0 | chloortris(trifenylarsine)rodium | chlorotris(triphenylarsine)rhodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 126-99-8 | 204-818-0 | chloropreen | chloroprene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 71701-12-7 | 275-861-0 | chromaat(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftaleen]acetamidaat(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftaleenolato(2-)]-, waterstof, verbinding met N-cyclohexylcyclohexanamine (1:1) | chromate(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthalenyl]acetamidato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-, hydrogen, compd. with N-cyclohexylcyclohexanamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 14977-61-8 | 239-056-8 | chromyldichloride | chromyl dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 18540-29-9 | 606-053-1 | chroom (VI) | chromium (VI) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 6 | |||||
| chroom (VI) verbindingen | chromium(VI) compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 6 | |||||||
| 68141-02-6 | 268-824-5 | chroom(3+)perfluoroctanoaat | chromium(3+) perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 12007-16-8 | 234-499-3 | chroomdiboride | chromium diboride | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 12, 57 | ||||||
| 1333-82-0 | 215-607-8 | chroomtrioxide | chromium trioxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 3444-17-5 | 222-357-3 | chroomtris(2-ethylhexaanzuur) | chromium tris(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 25-9-2023 | 69, 81 | ||||||
| 7738-94-5 | 231-801-5 | chroomzuur | chromic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 27-6-2013 | 24 | |||||
| 218-01-9 | 205-923-4 | chryseen | chrysene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 132207-32-0 | chrysotiel asbest | chrysotile asbestos | Ja | sA.1 | 0,05 mg/Nm3 | 10-5-2019 | 57 | ||||||
| 13149-00-3 | 236-086-3 | cis-cyclohexaan-1,2-dicarbonzuuranhydride | cis-cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 18283-82-4 | 242-161-1 | citroenzuur ammoniumnikkelzout | citric acid, ammonium nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 22605-92-1 | 245-119-0 | citroenzuur nikkelzout | citric acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14450-60-3 | 238-432-9 | citroenzuur, loodzout | citric acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 74115-24-5 | 277-728-2 | clofentezine | 3,6-bis(o-chlorophenyl)-1,2,4,5-tetrazine | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 115 | ||||||
| 23593-75-1 | 245-764-8 | clotrimazol | clotrimazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92062-20-9 | 295-535-1 | cokes- en as-bevattende vaste residuen die worden afgescheiden bij destillatie en thermische behandeling van uit bitumineuze kool afkomstige hoge-temperatuur-teer in destillatie-installaties en opslagtanks. Bestaat voornamelijk uit koolstof en bevat een kleine hoeveelheid heteroverbindingen alsmede asbestanddelen. Steenkoolteer, vaste behanddelen teer, kool hoge temperatuur, destillatie- en opslagresiduen | tar, coal, high-temp., distn. and storage residues, coal tar solids residue [coke- and ash-containing solid residues that separate on distillation and thermal treatment of bituminous coal high temperature tar in distillation installations and storage vessels. Consists predominantly of carbon and contains a small quantity of hetero compounds as well as ash components] | Ja | 2-12-2013 | 4, 63 | |||||||
| 64-86-8 | 200-598-5 | colchicine | colchicine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 67-97-0 | 200-673-2 | colecalciferol | cholecalciferol | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 81, 120 | ||||||
| 936-276-2 | concentraten van lood- en zinkverbindingen met zwavel afkomstig van hydrometallurgie (uitloging met heet zuur, uitloging met superheet zuur en flotatie) | concentrates of lead and zinc compounds with sulfur resulting from hydrometallurgy (hot acid leaching, super-hot acid leaching and flotation) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | |||||||
| 8001-58-9 | 232-287-5 | creosoot | creosote | Ja | 2-12-2013 | 4 | |||||||
| 8021-39-4 | 232-419-1 | creosoot, hout | creosote wood | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 47 | ||||||
| 61789-28-4 | 263-047-8 | creosootolie | creosote oil [A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200°C to 325°C (392°F to 617°F).] | Ja | 2-12-2013 | 4, 63 | |||||||
| 90640-85-0 | 292-606-9 | creosootolie, acenafteenfractie, acenafteenvrij, De olie die resteert na verwijdering door een kristallisatieproces van acenafteen uit acenafteenolie afkomstig uit koolteer. Bestaat voornamelijk uit naftaleen en alkylnaftalenen. Wasolie, herdestillaat | creosote oil, acenaphthene fraction, acenaphthene-free, Wash Oil Redistillate [The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] | Ja | 2-12-2013 | 4, 63 | |||||||
| 90640-84-9 | 292-605-3 | creosootolie, acenafteenfractie, wasolie | creosote oil, acenaphthene fraction, Wash Oil [A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240°C to 280°C (464°F to 536°F). Composed primarily of acenaphthene, naphthalene and alkyl naphthalene.] | Ja | 2-12-2013 | 4, 63 | |||||||
| 70321-79-8 | 274-565-9 | creosootolie, hoogkokend destillaat, De hoogkokende destillatiefractie die wordt verkregen door bitumineuze kool bij hoge temperatuur te fenoliseren en die verder wordt gezuiverd om een overmaat kristallijne zouten te verwijderen. Bestaat voornamelijk uit creosootolie waaruit enkele normale polycyclische aromatische zouten bestanddelen van koolteerdestillaten zijn verwijderd. Kristalvrij bij ongeveer 5°C. Wasolie | creosote oil, high-boiling distillate, Wash Oil [The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillates, removed. It is crystal free at approximately 5°C (41°F).] | Ja | 2-12-2013 | 4, 63 | |||||||
| 70321-80-1 | 274-566-4 | creosootolie, laagkokend destillaat, De laagkokende destillatiefractie die wordt verkregen door bitumineuze kool bij hoge temperatuur te verkooksen en die verder wordt gezuiverd om een overmaat kristallijne zouten te verwijderen. Bestaat voornamelijk uit creosootolie waaruit enkele normale polycyclische aromatische zouten bestanddelen van koolteerdestillaten zijn verwijderd. Kristalvrij bij ongeveer 38°C. Wasolie | creosote oil, low-boiling distillate, Wash Oil [The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillate, removed. It is crystal free at approximately 38°C (100°F).] | Ja | 2-12-2013 | 4, 63 | |||||||
| 14464-46-1 | 238-455-4 | cristoballiet | cristobalite | sA.1 | 0,05 mg/Nm3 | 19-5-2021 | 44, 83 | ||||||
| 12001-28-4 | crocidoliet | crocidolite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | ||||||
| 123-73-9 | 204-647-1 | crotonaldehyde | (E)-crotonaldehyde | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 5836-29-3 | 227-424-0 | cumatetralyl | coumatetralyl | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 98-82-8 | 202-704-5 | cumeen | cumene | Ja | gO.2 | 50 mg/Nm3 | 8-7-2022 | 44 | |||||
| 420-04-2 | 206-992-3 | cyanamide | cyanamide | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 116 | ||||||
| 5571-36-8 | 427-230-8 | cyclisch 3-(1,2-ethaandiylacetaal)oestra-5(10),9(11)-dieen-3,17-dion | cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 17976-43-1 | 241-894-4 | cyclo-di-μ-oxo(μ-ftalaat)trilood | cyclo-di-μ-oxo(μ-phthalato)trilead | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 294-62-2 | 206-033-9 | cyclododecaan | cyclododecane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 66-81-9 | 200-636-0 | cycloheximide | cycloheximide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 180409-60-3 | 605-896-2 | cyflufenamide | cyflufenamid | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 400882-07-7 | 642-974-5 | cyflumetofen | cyflumetofen | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 13121-70-5 | 236-049-1 | cyhexatin | cyhexatin | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 57 | ||||||
| 94361-06-5 | 619-020-1 | cyproconazool | cyproconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 3424-82-6 | 222-318-0 | DDE, 2,4'-isomeer | 2,2,o,p'-tetrachlorovinylidenebisbenzene | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 789-02-6 | 212-332-5 | DDT, 2,4'-isomeer | 2,2,2,o,p'-pentachloroethylidenebisbenzene | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 50-29-3 | 200-024-3 | DDT, 4,4'-isomeer | 1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27854-31-5 | decaanzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluor- | decanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 13654-09-6 | 237-137-2 | decabroombifenyl | decabromobiphenyl | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 13, 57 | ||||||
| 84852-53-9 | 284-366-9 | decabroomdifenylethaan | decabromodiphenyl ethane | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 57 | ||||||
| 541-02-6 | 208-764-9 | decamethylcyclopentasiloxaan | decamethylcyclopentasiloxane | Ja | MVP 2 | 1 mg/Nm3 | 6-7-2018 | ||||||
| 141-62-8 | 205-491-7 | decamethyltetrasiloxaan | decamethyltetrasiloxane | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 13560-89-9 | 236-948-9 | dechloraan plus | 1,6,7,8,9,14,15,16,17,17,18,18-dodecachloropentacyclo[12.2.1.16,9.02,13.05,10]octadeca-7,15-diene | Ja | MVP 1 | 0,05 mg/Nm3 | 22-1-2018 | 54 | |||||
| 319-86-8 | 206-272-9 | delta-hexachloorcyclohexaan | (1α,2α,3α,4β,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-07-2016 | 43 | |||||
| 90357-05-4 | 672-576-7 | desfluorbicalutamide | desfluoro bicalutamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 68955-27-1 | 273-263-4 | destillaten (aardolie), aardolieresiduen vacuüm- | distillates (petroleum), petroleum residues vacuum | Ja | 2-12-2013 | 4 | |||||||
| 91995-53-8 | 295-315-5 | destillaten (aardolie), afkomstig van nafta-stoomkraken oplosmiddelgeraffineerde lichte waterstofbehandelde | distillates (petroleum), naphtha steam cracking-derived, solvent-refined light hydrotreated | Ja | 2-12-2013 | 4, 65 | |||||||
| 68425-29-6 | 270-344-6 | destillaten (aardolie), afkomstig van pyrolysaat van nafta-raffinaat, benzinemenging | distillates (petroleum), naphtha-raffinate pyrolyzate-derived, gasoline-blending | Ja | 2-12-2013 | 4, 65 | |||||||
| 68477-34-9 | 270-725-7 | destillaten (aardolie), C3-5, rijk aan 2-methyl-2-buteen | distillates (petroleum), C3-5, 2-methyl-2-butene-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 68477-35-0 | 270-726-2 | destillaten (aardolie), C3-6, rijk aan piperyleen | distillates (petroleum), C3-6, piperylene-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 101316-56-7 | 309-862-5 | destillaten (aardolie), C7-9-, rijk aan C8, waterstofontzwaveld gedearomatiseerd | distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized | 2-12-2013 | 4 | ||||||||
| 64742-30-9 | 265-130-4 | destillaten (aardolie), chemisch geneutraliseerd middenfractie | distillates (petroleum), chemically neutralized middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-35-4 | 265-136-7 | destillaten (aardolie), chemisch geneutraliseerde lichte nafteenhoudende | distillates (petroleum), chemically neutralized light naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64742-28-5 | 265-128-3 | destillaten (aardolie), chemisch geneutraliseerde lichte paraffinehoudende | distillates (petroleum), chemically neutralized light paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 64742-34-3 | 265-135-1 | destillaten (aardolie), chemisch geneutraliseerde zware nafteenhoudende | distillates (petroleum), chemically neutralized heavy naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64742-27-4 | 265-127-8 | destillaten (aardolie), chemisch geneutraliseerde zware paraffinehoudende | distillates (petroleum), chemically neutralized heavy paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 90640-92-9 | 292-614-2 | destillaten (aardolie), complexe van was ontdane lichte paraffinische | distillates (petroleum), complex dewaxed light paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-91-8 | 292-613-7 | destillaten (aardolie), complexe van was ontdane zware paraffinehoudende | distillates (petroleum), complex dewaxed heavy paraffinci | Ja | 2-12-2013 | 4, 62 | |||||||
| 68477-40-7 | 270-729-9 | destillaten (aardolie), gekraakte gestripte stoomgekraakte aardoliedestillaten, C10-12-fractie | distillates (petroleum), cracked stripped steam-cracked petroleum distillates, C10-12 fraction | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 80, 82 | ||||||
| 68477-38-3 | 270-727-8 | destillaten (aardolie), gekraakte stoomgekraakte aardoliedestillaten | distillates (petroleum), cracked steam-cracked petroleum distillates | Ja | 2-12-2013 | 4 | |||||||
| 68477-50-9 | 270-735-1 | destillaten (aardolie), gepolymeriseerde stoomgekraakte aardoliedestillaten C5-12-fractie | distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 91995-41-4 | 295-302-4 | destillaten (aardolie), hitteverzadigde stoomgekraakte nafta, rijk aan C5 | distillates (petroleum), heat-soaked steam-cracked naphtha, C5-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 90640-93-0 | 292-615-8 | destillaten (aardolie), hooggezuiverde midden- | distillates (petroleum), highly refined middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 92201-60-0 | 295-991-1 | destillaten (aardolie), katalytisch gekraakte lichte fracties, thermisch gedesintegreerd | distillates (petroleum), light catalytic cracked, thermally degraded | Ja | 2-12-2013 | 4 | |||||||
| 92201-59-7 | 295-990-6 | destillaten (aardolie), katalytisch gekraakte middenfracties, thermisch gedesintegreerd | distillates (petroleum), intermediate catalytic cracked, thermally degraded | Ja | 2-12-2013 | 4 | |||||||
| 68475-79-6 | 270-660-4 | destillaten (aardolie), katalytisch gereformde pentaanverwijdering- | distillates (petroleum), catalytic reformed depentanizer | Ja | 2-12-2013 | 4, 65 | |||||||
| 85116-58-1 | 285-509-8 | destillaten (aardolie), katalytisch gereformde, waterstofbehandelde, lichte fractie, C8-12- aromatische fractie | distillates (petroleum), catalytic reformed hydrotreated light, C8-12 arom. fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 91995-34-5 | 295-294-2 | destillaten (aardolie), katalytische reformator, concentraat van zware aromaten | distillates (petroleum) catalytic reformer, heavy arom. conc. | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-30-5 | 270-721-5 | destillaten (aardolie), katalytische reformator-fractioneerderresidu, bij middentemperaturen kokend | distillates (petroleum), catalytic reformer fractionator residue, intermediate-boiling | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-29-2 | 270-719-4 | destillaten (aardolie), katalytische reformator-fractioneerderresidu, hoogkokend | distillates (petroleum), catalytic reformer fractionator residue, high-boiling | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-31-6 | 270-722-0 | destillaten (aardolie), katalytische reformator-fractioneerderresidu, laagkokend | distillates (petroleum), catalytic reformer fractionator residue, low-boiling | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-59-9 | 265-060-4 | destillaten (aardolie), licht katalytisch gekraakte | distillates (petroleum), light catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 64741-82-8 | 265-084-5 | destillaten (aardolie), licht thermisch gekraakt | distillates (petroleum), light thermal cracked | Ja | 2-12-2013 | 4 | |||||||
| 67891-80-9 | 267-565-5 | destillaten (aardolie), lichte aromatische fractie | distillates (petroleum), light arom. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68921-08-4 | 272-931-2 | destillaten (aardolie), lichte direct door fractionering verkregen benzine, topproducten uit fractioneringsstabilisator | distillates (petroleum), light straight-run gasoline fractionation stabilizer overheads | Ja | 2-12-2013 | 4, 65 | |||||||
| 68410-05-9 | 270-077-5 | destillaten (aardolie), lichte direct uit fractionering verkregen | distillates (petroleum), straight-run light | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-52-2 | 265-053-6 | destillaten (aardolie), lichte nafteenhoudende | distillates (petroleum), light naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64741-50-0 | 265-051-5 | destillaten (aardolie), lichte paraffinehoudende | distillates (petroleum), light paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 68475-80-9 | 270-662-5 | destillaten (aardolie), lichte stoomgekraakte nafta | distillates (petroleum), light steam-cracked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 68955-29-3 | 273-266-0 | destillaten (aardolie), lichte thermisch gekraakte, gedebutaniseerde aromatische | distillates (petroleum), light thermal cracked, debutanized arom. | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 70592-77-7 | 274-684-6 | destillaten (aardolie), lichte vacuüm- | distillates (petroleum), light vacuum | Ja | 2-12-2013 | 4 | |||||||
| 64742-44-5 | 265-146-1 | destillaten (aardolie), met klei behandeld zware nafteenhoudende fractie | distillates (petroleum), clay-treated heavy naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-45-6 | 265-147-7 | destillaten (aardolie), met klei behandelde lichte naftenische | distillates (petroleum), clay-treated light naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-37-6 | 265-138-8 | destillaten (aardolie), met klei behandelde lichte paraffinische | distillates (petroleum), clay-treated light paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-38-7 | 265-139-3 | destillaten (aardolie), met klei behandelde middenfractie | distillates (petroleum), clay-treated middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-36-5 | 265-137-2 | destillaten (aardolie), met klei behandelde zware paraffinische | distillates (petroleum), clay-treated paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 100683-97-4 | 309-667-5 | destillaten (aardolie), met koolstof behandelde lichte paraffine-houdende | distillates (petroleum), carbon-treated light paraffinic | Ja | 2-12-2013 | 4, 64 | |||||||
| 97488-74-9 | 307-011-2 | destillaten (aardolie), met oplosmiddel geraffineerde gehydrogeneerde zware | distillates (petroleum), solvent-refined hydrogenated heavy | Ja | 2-12-2013 | 4, 62 | |||||||
| 64741-89-5 | 265-091-3 | destillaten (aardolie), met oplosmiddel geraffineerde lichte paraffinehoudende | distillates (petroleum), solvent-refined light paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 94733-08-1 | 305-588-5 | destillaten (aardolie), met oplosmiddel geraffineerde met waterstof behandelde zware, gehydrogeneerd | distillates (petroleum), solvent-refined hydrotreated heavy, hydrogenated | Ja | 2-12-2013 | 4, 62 | |||||||
| 64741-96-4 | 265-097-6 | destillaten (aardolie), met oplosmiddel geraffineerde zware nafteenhoudende fractie | distillates (petroleum), solvent-refined heavy naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64741-88-4 | 265-090-8 | destillaten (aardolie), met oplosmiddel geraffineerde zware paraffinische | distillates (petroleum), solvent-refined heavy paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 94733-09-2 | 305-589-0 | destillaten (aardolie), met oplosmiddel gezuiverd met waterstof gekraakt lichte | distillates (petroleum), solvent-refined hydrocracked light | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-96-3 | 292-618-4 | destillaten (aardolie), met oplosmiddel van was ontdane lichte paraffinehoudende, met klei behandeld | distillates (petroleum), solvent dewaxed light paraffinic, clay-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-56-9 | 265-159-2 | destillaten (aardolie), met oplosmiddel van was ontdane lichte paraffinische | distillates (petroleum), solvent-dewaxed light paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-97-4 | 292-620-5 | destillaten (aardolie), met oplosmiddel van was ontdane lichte paraffinische, met waterstof behandeld | distillates (petroleum), solvent dewaxed light paraffinic, hydrotreated, | 2-12-2013 | 4 | ||||||||
| 64742-65-0 | 265-169-7 | destillaten (aardolie), met oplosmiddel van was ontdane paraffinehoudende | distillates (petroleum), solvent-dewaxed heavy paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-94-1 | 292-616-3 | destillaten (aardolie), met oplosmiddel van was ontdane zware paraffinehoudende, met klei behandeld | distillates (petroleum), solvent dewaxed heavy paraffinic, clay-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-64-9 | 265-168-1 | destillaten (aardolie), met solvent van was ontdane lichte nafteenhoudende | distillates (petroleum), solvent-dewaxed light naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-63-8 | 265-167-6 | destillaten (aardolie), met solvent van was ontdane zware nafteenhoudende | distillates (petroleum), solvent-dewaxed heavy naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-47-8 | 265-149-8 | destillaten (aardolie), met waterstof behandelde lichte fractie | distillates (petroleum), hydrotreated light | MVP 1 | 0,05 mg/Nm3 | 10-11-2022 | 48, 80 | ||||||
| 64742-53-6 | 265-156-6 | destillaten (aardolie), met waterstof behandelde lichte naftenische | distillates (petroleum), hydrotreated light naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-55-8 | 265-158-7 | destillaten (aardolie), met waterstof behandelde lichte paraffinische | distillates (petroleum), hydrotreated light paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-46-7 | 265-148-2 | destillaten (aardolie), met waterstof behandelde middenfractie | distillates (petroleum), hydrotreated middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-52-5 | 265-155-0 | destillaten (aardolie), met waterstof behandelde zware naftenische | distillates (petroleum), hydrotreated heavy naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-54-7 | 265-157-1 | destillaten (aardolie), met waterstof behandelde zware paraffinische | distillates (petroleum), hydrotreated heavy paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 101316-59-0 | 309-865-1 | destillaten (aardolie), met waterstof ontzwaveld middelste verkookser- | distillates (petroleum), hydrodesulfurized middle coker | Ja | 2-12-2013 | 4 | |||||||
| 68333-27-7 | 269-783-6 | destillaten (aardolie), met waterstof ontzwavelde katalytisch gekraakte tussenfractie | distillates (petroleum), hydrodesulfurized intermediate catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 64742-80-9 | 265-183-3 | destillaten (aardolie), met waterstof ontzwavelde middenfractie | distillates (petroleum), hydrodesulfurized middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 85116-53-6 | 285-505-6 | destillaten (aardolie), met waterstof ontzwavelde thermisch gekraakte middenfractie | distillates (petroleum), hydrodesulfurized thermal cracked middle | Ja | 2-12-2013 | 4 | |||||||
| 101316-57-8 | 309-863-0 | destillaten (aardolie), met waterstof ontzwavelde volledig bereik aan middelste | distillates (petroleum), hydrodesulfurized full-range middle | Ja | 2-12-2013 | 4 | |||||||
| 68333-28-8 | 269-784-1 | destillaten (aardolie), met waterstof ontzwavelde zware katalytisch gekraakte fractie | distillates (petroleum), hydrodesulfurized heavy catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64742-14-9 | 265-114-7 | destillaten (aardolie), met zuur behandelde lichte fractie | distillates (petroleum), acid-treated light | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-13-8 | 265-113-1 | destillaten (aardolie), met zuur behandelde middenfractie | distillates (petroleum), acid-treated middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-18-3 | 265-117-3 | destillaten (aardolie), met zuur behandelde zware nafteenhoudende fractie | distillates (petroleum), acid-treated heavy naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 100683-99-6 | 309-669-6 | destillaten (aardolie), middelste paraffine-houdende, behandeld met klei | distillates (petroleum), intermediate paraffinic, clay-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 100683-98-5 | 309-668-0 | destillaten (aardolie), middelste paraffine-houdende, behandeld met koolstof | distillates (petroleum), intermediate paraffinic, carbon-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 70592-76-6 | 274-683-0 | destillaten (aardolie), middelste vacuüm- | distillates (petroleum), intermediate vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-60-2 | 265-062-5 | destillaten (aardolie), middenfractie katalytisch gekraakt | distillates (petroleum), intermediate catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 68921-09-5 | 272-932-8 | destillaten (aardolie), nafta-unifiner-stripper | distillates (petroleum), naphtha unifiner stripper | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-97-5 | 265-098-1 | destillaten (aardolie), oplosmiddelgeraffineerde lichte naftenische | distillates (petroleum), solvent-refined light naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-54-9 | 295-316-0 | destillaten (aardolie), oplosmiddelgeraffineerde naftenische lichte, het waterstof behandeld | distillates (petroleum), solvent-refined light naphthenic, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 68477-89-4 | 270-771-8 | destillaten (aardolie), pentaanverwijdering, topproducten | distillates (petroleum), depentanizer overheads | Ja | 2-12-2013 | 4, 65 | |||||||
| 91995-31-2 | 295-292-1 | destillaten (aardolie), pyrolyseolie uit de alkeen-alkynproductie, gemengd met hoge-temperatuur-koolteer, indeenfractie | distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, mixed with high-temp. coal tar, indene fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 93165-19-6 | 296-903-4 | destillaten (aardolie), rijk aan C6 | distillates (petroleum), C6-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-91-9 | 265-093-4 | destillaten (aardolie), solvent-geraffineerd middelste fractie | distillates (petroleum), solvent-refined middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-86-2 | 265-088-7 | destillaten (aardolie), stankvrij gemaakt midden fractie | distillates (petroleum), sweetened middle | Ja | 2-12-2013 | 4, 64 | |||||||
| 68477-55-4 | 270-738-8 | destillaten (aardolie), stoomgekraakt, C5-10-fractie, gemengd met lichte stoomgekraakte aardolienafta-C5-fractie | distillates (petroleum), steam-cracked, C5-10 fraction, mixed with light steam-cracked petroleum naphtha C5 fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 68477-53-2 | 270-736-7 | destillaten (aardolie), stoomgekraakt, C5-12-fractie | distillates (petroleum), steam-cracked, C5-12 fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 68477-54-3 | 270-737-2 | destillaten (aardolie), stoomgekraakt, C8-C12 fractie | distillates (petroleum), steam-cracked, C8-12 fraction | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 80, 82 | ||||||
| 95009-23-7 | 305-750-5 | destillaten (aardolie), stoomgekraakt, gepolymeriseerde C8-12-fractie, lichte destillatiefracties | distillates (petroleum), steam-cracked, C8-12 fraction, polymd., distn. lights | Ja | 2-12-2013 | 4, 65 | |||||||
| 68603-00-9 | 271-631-9 | destillaten (aardolie), thermisch gekraakte nafta en gasolie | distillates (petroleum), thermal cracked naphtha and gas oil | Ja | 2-12-2013 | 4, 65 | |||||||
| 68603-01-0 | 271-632-4 | destillaten (aardolie), thermisch gekraakte nafta en gasolie, C5-dimeer bevattend | distillates (petroleum), thermal cracked naphtha and gas oil, C5-dimer-contg. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68603-03-2 | 271-634-5 | destillaten (aardolie), thermisch gekraakte nafta en gasolie, extractieve | distillates (petroleum), thermal cracked naphtha and gas oil, extractive | Ja | 2-12-2013 | 4, 65 | |||||||
| 68513-63-3 | 271-008-1 | destillaten (aardolie), topproducten van katalytisch gereformde, door directe fractionering verkregen nafta | distillates (petroleum), catalytic reformed straight-run naphtha overheads | Ja | 2-12-2013 | 4, 65 | |||||||
| 70592-78-8 | 274-685-1 | destillaten (aardolie), vacuüm- | distillates (petroleum), vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 91995-40-3 | 295-301-9 | destillaten (aardolie), van was ontdane paraffinehoudende lichte, met waterstof behandeld | distillates (petroleum), dewaxed light paraffinic, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-39-0 | 295-300-3 | destillaten (aardolie), van was ontdane zware paraffinehoudende, met waterstof behandeld | distillates (petroleum), dewaxed heavy paraffinic, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 68814-87-9 | 272-341-5 | destillaten (aardolie), volledig bereik door directe fractionering verkregen middenfractie | distillates (petroleum), full-range straight-run middle | MVP 1 | 0,05 mg/Nm3 | 19-5-2021 | 80, 82 | ||||||
| 91995-50-5 | 295-311-3 | destillaten (aardolie), waterstofbehandelde aromatische lichte, afkomstig van het stoomkraken van nafta | distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68410-97-9 | 270-093-2 | destillaten (aardolie), waterstofbehandelde lichte fracties, laagkokend | distillates (petroleum), light distillate hydrotreating process, low-boiling | Ja | 2-12-2013 | 4, 65 | |||||||
| 68410-96-8 | 270-092-7 | destillaten (aardolie), waterstofbehandelde middenfracties, tussenfracties | distillates (petroleum), hydrotreated middle, intermediate boiling | Ja | 2-12-2013 | 4, 65 | |||||||
| 68410-98-0 | 270-094-8 | destillaten (aardolie), waterstofbehandelde zware nafta, topproducten isohexaanverwijdering | distillates (petroleum), hydrotreated heavy naphtha, deisohexanizer overheads | Ja | 2-12-2013 | 4, 65 | |||||||
| 97488-73-8 | 307-010-7 | destillaten (aardolie), waterstofgekraakte met oplosmiddel geraffineerde lichte | distillates (petroleum), hydrocracked solvent-refined light | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-45-8 | 295-306-6 | destillaten (aardolie), waterstofgekraakte solventgeraffineerde, van was ontdaan | distillates (petroleum), hydrocracked solvent-refined, dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 68333-25-5 | 269-781-5 | destillaten (aardolie), waterstofontzwavelde lichte fractie katalytisch gekraakt | distillates (petroleum), hydrodesulfurized light catalytic cracked | Ja | 2-12-2013 | 4 | |||||||
| 64742-19-4 | 265-118-9 | destillaten (aardolie), zuurbehandelde lichte nafteenhoudende | distillates (petroleum), acid-treated light naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64742-21-8 | 265-121-5 | destillaten (aardolie), zuurbehandelde lichte paraffinehoudende | distillates (petroleum), acid-treated light paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 64742-20-7 | 265-119-4 | destillaten (aardolie), zuurbehandelde zware paraffinehoudende | distillates (petroleum), acid-treated heavy paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 64741-61-3 | 265-063-0 | destillaten (aardolie), zwaar katalytisch gekraakt | distillates (petroleum), heavy catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-81-7 | 265-082-4 | destillaten (aardolie), zwaar thermisch gekraakt | distillates (petroleum), heavy thermal cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-76-0 | 265-077-7 | destillaten (aardolie), zwaar waterstofgekraakt | distillates (petroleum), heavy hydrocracked | Ja | 2-12-2013 | 4, 62 | |||||||
| 67891-79-6 | 267-563-4 | destillaten (aardolie), zware aromatische fractie | distillates (petroleum), heavy arom. | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-53-3 | 265-054-1 | destillaten (aardolie), zware nafteenhoudende | distillates (petroleum), heavy naphthenic | Ja | 2-12-2013 | 4 | |||||||
| 64741-51-1 | 265-052-0 | destillaten (aardolie), zware paraffinehoudende | distillates (petroleum), heavy paraffinic | Ja | 2-12-2013 | 4 | |||||||
| 101631-14-5 | 309-939-3 | destillaten (aardolie), zware stoomgekraakte | distillates (petroleum), heavy steam-cracked | Ja | 2-12-2013 | 4 | |||||||
| 68915-96-8 | 272-817-2 | destillaten (aardolie), zware, directe destillatie | distillates (petroleum), heavy straight-run | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 80, 82 | ||||||
| 85029-51-2 | 285-076-5 | destillaten (kool), lichte olie uit de cokesoven naftaleenfractie | distillates (coal), coke-oven light oil, naphthalene cut | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 94114-53-1 | 302-689-6 | destillaten (kool), oplosmiddelextractie, waterstofgekraakt | distillates (coal), solvent extn., hydrocracked | Ja | 2-12-2013 | 4, 61 | |||||||
| 94114-57-5 | 302-693-8 | destillaten (kool), oplosmiddelextractie, waterstofgekraakte gehydrogeneerde middenfractie | distillates (coal), solvent extn., hydrocracked hydrogenated middle | Ja | 2-12-2013 | 4, 61 | |||||||
| 94114-56-4 | 302-692-2 | destillaten (kool), oplosmiddelextractie, waterstofgekraakte middenfractie | distillates (coal), solvent extn., hydrocracked middle | Ja | 2-12-2013 | 4, 61 | |||||||
| 94114-52-0 | 302-688-0 | destillaten (kool), primaire, vloeibaar-oplosmiddelextractie | distillates (coal), liq. solvent extn., primary | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-35-6 | 295-295-8 | destillaten (kool), residuele pyrolyseoliën uit koolteer, naftaleenoliën | distillates (coal), coal tar-residual pyrolysis oils, naphthalene oils | Ja | 2-12-2013 | 4, 61 | |||||||
| 68188-48-7 | 269-159-3 | destillaten (kool-aardolie), gecondenseerde ringen-aromatisch | distillates (coal-petroleum), condensed-ring arom | Ja | 2-12-2013 | 4, 63 | |||||||
| 65996-92-1 | 266-027-7 | destillaten (koolteer) | distillates (coal tar) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 63 | |||||
| 84650-02-2 | 283-482-7 | destillaten (koolteer), benzolfractie | distillates (coal tar), benzole fraction | Ja | 2-12-2013 | 4 | |||||||
| 121620-46-0 | 310-165-3 | destillaten (koolteer), benzolfractie, destillatieresiduen | distillates (coal tar), benzole fraction, distn. residues | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 101896-26-8 | 309-984-9 | destillaten (koolteer), benzolfractie, rijk aan benzeen tolueen en xyleen | distillates (coal tar), benzole fraction, BTX-rich | Ja | 2-12-2013 | 4, 61 | |||||||
| 65996-91-0 | 266-026-1 | destillaten (koolteer), bovenste | distillates (coal tar), upper | Ja | 2-12-2013 | 4, 63 | |||||||
| 84989-10-6 | 284-899-7 | destillaten (koolteer), bovenste, fluoreenvrij | distillates (coal tar), upper, fluorene-free | Ja | 2-12-2013 | 4, 63 | |||||||
| 84989-11-7 | 284-900-0 | destillaten (koolteer), bovenste, rijk aan fluoreen | distillates (coal tar), upper, fluorene-rich | Ja | 2-12-2013 | 4, 63 | |||||||
| 84650-03-3 | 283-483-2 | destillaten (koolteer), lichte oliën | distillates (coal tar), light oils | Ja | 2-12-2013 | 4, 61 | |||||||
| 101794-90-5 | 309-971-8 | destillaten (koolteer), lichte oliën neutrale fractie. lichte olie, extractieresidu, hoogkokende fractie | distillates (coal tar), light oils, neutral fraction, light oil extract residues, high boiling | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-87-2 | 292-609-5 | destillaten (koolteer), lichte oliën zuurextracten | distillates (coal tar), light oils, acid exts | Ja | 2-12-2013 | 4, 61 | |||||||
| 84650-04-4 | 283-484-8 | destillaten (koolteer), naftaleenoliën | distillates (coal tar), naphthalene oils | 2-12-2013 | 4 | ||||||||
| 101794-91-6 | 309-972-3 | destillaten (koolteer), naftaleenoliën indool-methylnaftaleenfractie | distillates (coal tar), naphthalene oils, indole-methylnaphthalene fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 101896-27-9 | 309-985-4 | destillaten (koolteer), naftaleenoliën methylnaftaleenfractie | distillates (coal tar), naphthalene oils, methylnaphthalene fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84989-09-3 | 284-898-1 | destillaten (koolteer), naftaleenoliën naftaleenarm | distillates (coal tar), naphthalene oils, naphthalene-low | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 90640-90-7 | 292-612-1 | destillaten (koolteer), naftaleenoliën naftaleenvrij, alkalische extracten | distillates (coal tar), naphthalene oils, naphthalene-free, alk. exts. | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 91995-48-1 | 295-309-2 | destillaten (koolteer), naftaleenoliën zuurextracten | distillates (coal tar), naphthalene oils, acid exts. | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 101316-49-8 | 309-855-7 | destillaten (koolteer), pek | distillates (coal tar), pitch | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 63 | |||||
| 91995-52-7 | 295-313-4 | destillaten (koolteer), pek pyreenfractie | distillates (coal tar), pitch, pyrene fraction | Ja | 2-12-2013 | 4, 63 | |||||||
| 91995-51-6 | 295-312-9 | destillaten (koolteer), pek zware oliën | distillates (coal tar), pitch, heavy oils | Ja | 2-12-2013 | 4, 63 | |||||||
| 90640-86-1 | 292-607-4 | destillaten (koolteer), zware oliën | distillates (coal tar), heavy oils | Ja | 2-12-2013 | 4 | |||||||
| 91995-42-5 | 295-304-5 | destillaten (koolteer), zware oliën, pyreenfractie | distillates (coal tar), heavy oils, pyrene fraction | Ja | 2-12-2013 | 4, 63 | |||||||
| 91995-49-2 | 295-310-8 | destillatie (koolteer), moederloog uit naftaleenoliekristallisatie | distillates (coal tar), naphthalene oil crystn. mother liquor | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 950-299-5 | di-, tri- en tetrachloortetradecaan | di-, tri- and tetrachlorotetradecane | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||||
| 12004-35-2 | 234-454-8 | dialuminiumnikkeltetraoxide | dialuminium nickel tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25376-45-8 | 246-910-3 | diaminotolueen, isomerenmengsel van 2,4-tolueendiamine en 2,6-tolueendiamine | diaminotoluene | MVP 1 | 0,05 mg/Nm3 | 31-1-2023 | 74 | ||||||
| 93857-44-4 | 299-178-2 | diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylfosfaat | diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-45-0 | 303-523-5 | diammonium- 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluor-2-hydroxyundecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxyundecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-46-1 | 303-524-0 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluor-2-hydroxytridecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxytridecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-47-2 | 303-525-6 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluor-2-hydroxypentadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-pentacosafluoro-2-hydroxypentadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-48-3 | 303-526-1 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluor-2-hydroxyheptadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-nonacosafluoro-2-hydroxyheptadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-52-9 | 303-530-3 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluor-2-hydroxy-16-(trifluormethyl) heptadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,17,17,17-octacosafluoro-2-hydroxy-16-(trifluoromethyl)heptadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-51-8 | 303-529-8 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluor-2-hydroxy-14-(trifluormethyl) pentadecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,15,15,15-tetracosafluoro-2-hydroxy-14-(trifluoromethyl)pentadecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 94200-50-7 | 303-528-2 | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluor-2-hydroxy-12-( trifluormethyl) tridecylfosfaat | diammonium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,13,13,13-icosafluoro-2-hydroxy-12-(trifluoromethyl)tridecyl phosphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 15699-18-0 | 239-793-5 | diammoniumnikkelbis(sulfaat) | diammonium nickel bis(sulfate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 74195-78-1 | diammoniumnikkelhexacyanoferraat | diammonium nickel hexacyanoferrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 13510-89-9 | 236-845-9 | diantimoontrilood octaoxide | diantimony trilead octaoxide | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 14, 57 | ||||||
| 12044-54-1 | 234-955-1 | diarseen tritelluride | diarsenic tritelluride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1303-28-2 | 215-116-9 | diarseenpentaoxide | diarsenic pentaoxide | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | |||
| 1303-36-2 | 215-119-5 | diarseentrielenide | diarsenic triselenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13453-15-1 | diarseenzuur | diarsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13464-42-1 | diarseenzuur, tetranatriumzout | diarsenic acid, tetrasodium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 334-88-3 | 206-382-7 | diazomethaan | diazomethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 1344-40-7 | dibasisch loodfosfiet | dibasic lead phosphite | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | |||||||
| 192-65-4 | 205-891-1 | dibenzo[a,e]pyreen | naphtho[1,2,3,4-def]chrysene | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 226-36-8 | 680-472-8 | dibenzo[a,h]acridine | dibenz[a,h]acridine | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 53-70-3 | 200-181-8 | dibenzo[a,h]antraceen | dibenz[a,h]anthracene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 189-64-0 | 205-878-0 | dibenzo[a,h]pyreen | dibenz[a,h]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 189-55-9 | 205-877-5 | dibenzo[a,i]pyreen | dibenz[a,i]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 224-42-0 | 635-000-5 | dibenzo[a,j]acridine | dibenz[a,j[acridine | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | 16 | ||||||
| 191-30-0 | 205-886-4 | dibenzo[a,l]pyreen | dibenzo[def,p]chrysene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 85237-42-9 | 286-401-3 | dibismut-tris(methylarsonaat) | dibismuth tris(methylarsonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1303-86-2 | 215-125-8 | diboortrioxide | diboron trioxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 207569-11-7 | 688-199-6 | dibromonikkelhydraat | Dibromonickel hydrate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 15242-92-9 | 621-434-2 | dibroombis(tributylfosfine)nikkel(II) | dibromobis(tributylphosphine)nickel(II) | MVP 1 | 20-8-2024 | 34, 57 | |||||||
| 10222-01-2 | 233-539-7 | dibroomnitrilopropiamide | 2,2-dibromo-2-cyanoacetamide | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 71 | ||||||
| 3349-36-8 | 222-103-1 | dibutoxydibutylstannaan | dibutoxydibutylstannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 1185-81-5 | 214-688-7 | dibutylbis(dodecylthio)stannaan | dibutylbis(dodecylthio)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 28660-67-5 | 249-134-3 | dibutylbis(myristoyloxy)stannaan | dibutylbis(myristoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 25955-19-5 | 247-367-5 | dibutylbis(nonanoyloxy)stannaan | dibutylbis(nonanoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 13323-62-1 | 236-359-7 | dibutylbis(octadec-9(Z)-enoyloxy)stannaan | dibutylbis(octadec-9(Z)-enoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 85391-79-3 | 286-834-8 | dibutylbis(octadeca-9(Z),12(Z)-dienoyloxy)stannaan | dibutylbis(octadeca-9(Z),12(Z)-dienoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 4731-77-5 | 225-236-3 | dibutylbis(octanoyloxy)stannaan | dibutylbis(octanoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 13323-63-2 | 236-360-2 | dibutylbis(palmitoyloxy)stannaan | dibutylbis(palmitoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 22673-19-4 | 245-152-0 | dibutylbis(pentaan-2,4-dionato-O,O”)tin | dibutylbis(pentane-2,4-dionato-O,O’)tin | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | 57 | ||||
| 5847-55-2 | 227-438-7 | dibutylbis(stearoyloxy)stannaan | dibutylbis(stearoyloxy)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 25168-22-3 | 246-702-2 | dibutylbis[(1-oxoneodecyl)oxy]stannaan | dibutylbis[(1-oxoneodecyl)oxy]stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 84-74-2 | 201-557-4 | dibutylftalaat | dibutyl phthalate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 4253-22-9 | 224-220-3 | dibutylthioxostannaan | dibutylthioxostannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 14488-53-0 | dibutyltin (kation) | tin(2+), dibutyl-, ion | Ja | MVP 1 | 0,05 mg/Nm3 | 6-9-2022 | 57 | ||||||
| 2781-10-4 | 220-481-2 | dibutyltin bis(2-ethylhexanoaat) | dibutyltin bis(2-ethylhexanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 57 | |||||
| 1067-33-0 | 213-928-8 | dibutyltindiazijnzuur | dibutyltin di(acetate) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 57 | |||||
| 683-18-1 | 211-670-0 | dibutyltindichloride | dibutyltin-dichloride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 77-58-7 | 201-039-8 | dibutyltindilauraat | dibutyltin dilaurate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 1002-53-5 | dibutyltinhydride | dibutyltin hydride | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 57 | |||||||
| 78-04-6 | 201-077-5 | dibutyltinmaleaat | dibutyltin maleate | Ja | MVP 1 | 0,05 mg/Nm3 | 6-9-2022 | 57 | |||||
| 818-08-6 | 212-449-1 | dibutyltinoxide | dibutyltin-oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 75113-37-0 | 401-040-5 | dibutyltinwaterstofboraat | dibutyltin hydrogen borate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13007-90-4 | 235-851-9 | dicarbonylbis(trifenylfosfine)nikkel | dicarbonylbis(triphenylphosphine)nickel | MVP 1 | 20-8-2024 | 34, 57 | |||||||
| 13454-78-9 | 236-640-4 | dicesiumchromaat | dicesium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 333-25-5 | dichloor(2-chloorovinyl)-arseenoxide | arsine oxide, dichloro(2-chlorovinyl)- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 696-28-6 | 211-791-9 | dichloor(fenyl)arsine | dichloro(phenyl)arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 19232-03-2 | 834-779-0 | dichloorbis(dicyclohexylfenylfosfine)nikkel(II) | dichlorobis(dicyclohexylphenylphosphine)nickel(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 15274-43-8 | 624-942-2 | dichloorbis(tributylfosfine)nikkel(II) | dichlorobis(tributylphosphine)nickel(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 13231-90-8 | 621-088-2 | dichloordiethyllood | plumbane dichlorodiethyl- | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 3542-36-7 | 222-583-2 | dichloordioctylstannaan | dichlorodioctylstannane | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 57 | |||||
| 593-89-5 | 695-189-5 | dichloormethylarsine | arsine, dichloromethyl- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 29046-78-4 | 627-461-6 | dichloornikkel-1,2-dimethoxyethaan | dichloronickel-1,2-dimethoxyethane | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 12018-18-7 | 234-636-7 | dichroom nikkel tetraoxide | dichromium nickel tetraoxide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 12254-85-2 | 235-499-6 | dichroomarsenide | dichromium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 24613-89-6 | 246-356-2 | dichroomtris(chromaat) | dichromium tris(chromate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 13530-68-2 | 236-881-5 | dichroomzuur | dichromic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 24 | |||||
| 115-32-2 | 204-082-0 | dicofol | dicofol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 84-61-7 | 201-545-9 | dicyclohexylftalaat | dicyclohexyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||
| 60-57-1 | 200-484-5 | dieldrin | dieldrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64741-44-2 | 265-044-7 | dieselolie | distillates (petroleum), straight-run middle | MVP 1 | 0,05 mg/Nm3 | 18-5-2021 | 80, 82 | ||||||
| 70225-14-8 | 274-460-8 | diethanolamineperfluoroctaansulfonaat | diethanolamine perfluorooctane sulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||
| 67-43-6 | 200-652-8 | di-ethyleentriaminepenta-azijnzuur | N-carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 64-67-5 | 200-589-6 | diethylsulfaat | diethyl sulphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 56073-07-5 | 259-978-4 | difenacum | difenacoum | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 58-36-6 | 200-377-3 | difenoxarsine-10-yl oxide | diphenoxarsin-10-yl oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 75980-60-8 | 278-355-8 | difenyl(2,4,6-trimethylbenzoyl) fosfineoxide | diphenyl(2,4,6-trimethylbenzoyl) phosphine oxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 81 | ||||
| 578-94-9 | 209-433-1 | difenylaminochloorarsine | diphenylaminechlorarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 829-83-4 | 212-589-3 | difenylarsine | diphenylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 23525-22-6 | 245-716-6 | difenylarsinecarbonitril | diphenylarsinecarbonitrile | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 712-48-1 | 211-921-4 | difenylchloorarsine | diphenylchloroarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 4519-32-8 | 224-845-1 | difenyldiarsenzuur | diphenyldiarsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 62613-15-4 | 263-638-0 | difenyljodonium hexafluoroarsenaat | diphenyliodonium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 153443-35-7 | difenyljodonium, tridecafluorhexaansulfonaat (1:1) | iodonium, diphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 2117-69-3 | 218-325-3 | difenyllooddichloride | diphenyllead dichloride | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 3639-19-8 | 222-866-0 | difetarson | difetarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 515-76-4 | 208-209-0 | difetarson dinatrium | difetarsone disodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 104653-34-1 | difethialon | difethialone | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||||
| 83164-33-4 | 617-446-2 | diflufenican | diflufenican | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 19372-20-4 | difosforzuur nikkel(II)zout | diphosphoric acid, nickel(II) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 12044-20-1 | 234-948-3 | digalliumarsenidefosfide | digallium arsenide phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 111-96-6 | 203-924-4 | diglyme | bis(2-methoxyethyl) ether | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 84-75-3 | 201-559-5 | dihexylftalaat | dihexyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 6018-94-6 | 626-687-2 | dihydraat nikkel oxalaat | dihydrate nickel oxalate | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 13464-80-7 | 236-688-6 | dihydraziniumsulfaat | dihydrazinium sulphate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 12005-88-8 | 234-474-7 | diijzerarsenide | diiron arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 6380-34-3 | 228-965-5 | diiodo(fenyl)arsine | diiodo(phenyl)arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 84-69-5 | 201-553-2 | diisobutylftalaat | diisobutyl phthalate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 71850-09-4 | 276-090-2 | diisohexylftalaat | diisohexyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | |||||
| 27554-26-3 | 248-523-5 | diisoöctylftalaat | diisooctyl phthalate | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | |||||
| 605-50-5 | 210-088-4 | di-isopentylftalaat | diisopentylphthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 356056-15-0 | 625-007-1 | diisopropyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)silaan | Diisopropyl(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 13842-46-1 | 237-563-9 | dikaliumnikkelbis(sulfaat) | nickel dipotassium bis(sulfate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13826-95-4 | 621-083-5 | di-lithium tetrabroomnikkelaat(II) | di-lithium tetrabromonickelate(II) | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 12031-75-3 | 663-306-9 | dilithium trimangaan nikkel octoxide | dilithium trimanganese nickel octoxide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 18454-12-1 | 242-339-9 | diloodchromaatoxide | dilead chromate oxide | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 12, 14, 57 | ||||||
| 110488-70-5 | 404-200-2 | dimethomorf | dimethomorph | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | |||||
| 84750-88-9 | 977-405-2 | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluordodecaandioaat | dimethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-icosafluorododecanedioate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 220133-51-7 | 452-310-4 | dimethyl(fenyl)sulfonium perfluorbutaansulfonaat | dimethyl(phenyl)sulfanium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 79-44-7 | 201-208-6 | dimethylcarbamoylchloride | dimethylcarbamoyl chloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 93983-68-7 | 301-323-2 | dimethylhexaanzuur nikkelzout | dimethylhexanoic acid nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 18755-43-6 | 242-555-3 | dimethylpropylfosfonaat | dimethyl propylphosphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | |||||
| 77-78-1 | 201-058-1 | dimethylsulfaat | dimethyl sulphate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 13360-57-1 | 236-412-4 | dimethylsulfamoylchloride | dimethylsulfamoylchloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 753-73-1 | 212-039-2 | dimethyltin dichloride | dimethyltin dichloride | 6-9-2022 | 15 | ||||||||
| 3547-38-4 | 222-600-3 | dinatrium 3-[(o-fenylarsenigzuur)azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 84215-48-5 | 282-454-1 | dinatrium 3-[[2-[(dihydroxyarsino)oxy]fenyl]azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 27336-24-9 | dinatrium 4,4'-diaminobifenyl-2,2'-disulfonaat | disodium 4,4'-diaminobiphenyl-2,2'-disulfonate | MVP 1 | 0,05 mg/Nm3 | 8-3-2022 | 57, 69 | |||||||
| 3688-92-4 | 222-993-1 | dinatrium 4-[(o-fenylarsenigzuur)azo]-3-hydroxynaftaleen-2,7-disulfonaat | disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 4335-09-5 | 224-376-2 | dinatrium 4-amino-5-hydroxy-6-[[4'-[(4-hydroxyfenyl)azo][1,1'-bifenyl]-4-yl]azo]-3-[(4-nitrofenyl)azo]naftaleen-2,7-disulfonaat | disodium 4-amino-5-hydroxy-6-[[4'-[(4-hydroxyphenyl)azo][1,1'-biphenyl]-4-yl]azo]-3-[(4-nitrophenyl)azo]naphthalene-2,7-disulphonate | MVP 1 | 0,05 mg/Nm3 | 18-4-2023 | 57, 69 | ||||||
| 126-82-9 | 204-806-5 | dinatrium arseenazijnzuur | disodium arsonoacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 94313-58-3 | 304-956-2 | dinatrium p-tolylarsonaat | disodium p-tolylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13871-27-7 | 237-630-2 | dinatrium tetrafluorberyllaat | disodium tetrafluoroberyllate | Ja | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 93 | |||||
| 3599-28-8 | 222-749-4 | dinatrium-[4-[(4,6-diamino-1,3,5-triazine-2-yl)amino]fenyl]arsonaat | disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 16071-86-6 | 240-221-1 | dinatrium-{5-[(4'-((2,6-dihydroxy-3-((2-hydroxy-5-sulfofenyl)azo)fenyl)azo)(1,1'-bifenyl)-4-yl)azo]salicylato(4-)}cupraat(2-) | disodium {5-[(4'-((2,6-hydroxy-3-((2-hydroxy-5-sulphophenyl)azo)phenyl)azo)(1,1'-biphenyl)-4-yl)azo]salicylato(4-)}cuprate(2-) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 62337-00-2 | 263-516-7 | dinatrium-3,6-bis[(o-arsonofenyl)azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 84215-47-4 | 282-453-6 | dinatrium-3,6-bis[[2-[(dihydroxyarsino)oxy]fenyl]azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1937-37-7 | 217-710-3 | dinatrium-4-amino-3-[[4'-[(2,4-diaminofenyl)azo][1,1'-bifenyl]-4-yl]azo]-6-(fenylazo)-5-hydroxynaftaleen-2,7-disulfonaat | disodium 4-amino-3-[[4'-[(2,4-diaminophenyl)azo][1,1'-biphenyl]-4-yl]azo]-5-hydroxy-6-(phenylazo)naphtalene-2,7-disulphonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 22904-40-1 | 245-314-0 | dinatriumlood N,N'-ethyleenbis[N-(carboxylaatmethyl)aminoacetaat] | disodium lead N,N'-ethylenebis[N-(carboxylatomethyl)aminoacetate] | MVP 1 | 0,05 mg/Nm3 | 4-2-2022 | 14, 57 | ||||||
| 144-21-8 | 205-620-7 | dinatriummethylarsionaat | disodium methylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12280-03-4 | 602-894-3 | dinatriumoctaboraat tetrahydraat | disodium octaborate tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 12008-41-2 | 234-541-0 | dinatriumoctaboraat, watervrij | disodium octaborate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||
| 1330-43-4 | 215-540-4 | dinatriumtetraboraat, watervrij | disodium tetraborate, anhydrous | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 14674-83-0 | 238-715-7 | dinatriumwaterstof 2-[[7-[(2-arsonofenyl)azo]-1,8-dihydroxy-3,6-disulfonato-2-naftyl]azoaat | disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7778-43-0 | 231-902-4 | dinatriumwaterstofarsenaat | disodium hydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 12007-01-1 | 234-494-6 | dinikkelboride | dinickel boride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14448-18-1 | 238-426-6 | dinikkeldifosfaat | dinickel diphosphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-64-2 | 234-828-0 | dinikkelfosfide | dinickel phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14874-78-3 | 238-946-3 | dinikkelhexacyanoferraat | dinickel hexacyanoferrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13775-54-7 | 237-411-1 | dinikkelorthosilicaat | dinickel orthosilicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12059-14-2 | 235-033-1 | dinikkelsilicide | dinickel silicide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1314-06-3 | 215-217-8 | dinikkeltrioxide | dinickel trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25321-14-6 | 246-836-1 | dinitrotolueen | dinitrotoluene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39300-45-3 | 254-408-0 | dinocap | dinocap | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 88-85-7 | 201-861-7 | dinoseb | dinoseb | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1420-07-1 | 215-813-8 | dinoterb | dinoterb | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 131-18-0 | 205-017-9 | di-n-pentylftalaat | di-n-pentyl phthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| dioctyltin dilauraat; stannaan, dioctyl-, bis(kokos-acyloxy)derivaten | dioctyltin dilaurate; stannane, dioctyl-, bis(coco acyloxy) derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | |||||||
| 870-08-6 | 212-791-1 | dioctyltin oxide | dioctyltin oxide | 6-9-2022 | 15 | ||||||||
| 3648-18-8 | 222-883-3 | dioctyltindilauraat | dioctyltin dilaurate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 57 | ||||
| 799-973-9 | dioctyltindilauraat, stannaan, dioctyl-, bis(kokosacyloxy)derivaten en alle andere stannaan-, dioctyl-, bis(vetacyloxy)derivaten waarin C12 het overheersende koolstofgetal is van de vetzuuracyloxygroep | dioctyltin dilaurate, stannane, dioctyl-, bis(coco acyloxy) derivs., and any other stannane, dioctyl-, bis(fatty acyloxy) derivs. wherein C12 is the predominant carbon number of the fatty acyloxy moiety | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | ||||||
| 512-04-9 | 208-134-3 | diosgenin | diosgenin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| dioxinen en dioxineachtige verbindingen | dioxins and dioxin-like compounds | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 5 | |||||||
| dioxinen som | dioxine | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||||
| 12578-12-0 | 235-702-8 | dioxobis(stearaat)trilood | dioxobis(stearato)trilead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 70333-07-2 | 274-573-2 | disilverarsenide | disilver arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 10024-97-2 | 233-032-0 | distikstofmonoxide | dinitrogen oxide | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 330-54-1 | 206-354-4 | diuron | diuron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 111 | |||||
| 12170-92-2 | 235-339-5 | di-μ-carbonylbis(η5-2,4-cyclopentadieen-1-yl)dinikkel | di-μ-carbonylbis(η5-2,4-cyclopentadien-1-yl)dinickel | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 53826-13-4 | dodecaanzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluor- | dodecanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 540-97-6 | 208-762-8 | dodecamethylcyclohexasiloxaan | dodecamethylcyclohexasiloxane | Ja | MVP 1 | 0,05 mg/Nm3 | 6-7-2018 | 51 | |||||
| 69029-47-6 | 273-793-6 | dore | dore | Ja | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 80, 82, 92 | |||||
| 53513-80-7 | 611-005-8 | D-valine, 3-mercapto-, lood complex | D-valine, 3-mercapto-, lead complex | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 57 | ||||||
| 12005-81-1 | 234-473-1 | dysprosiumarsenide | dysprosium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| e-glas microvezels met een representatieve samenstelling | e-glass microfibres of representative composition | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||||
| 852403-68-0 | 701-454-9 | E-metaflumizon | E-metaflumizone | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 115-29-7 | 204-079-4 | endosulfan | endosulfan | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 72-20-8 | 200-775-7 | endrin | endrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13838-16-9 | 237-553-4 | enfluraan | enflurane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 106-89-8 | 203-439-8 | epichloorhydrine | epichlorhydrin | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 133855-98-8 | 406-850-2 | epoxiconazool | epoxiconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12254-88-5 | 235-501-5 | erbiumarsenide | erbium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12510-42-8 | 620-440-2 | erioniet | erionite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 129453-61-8 | 642-998-6 | estra-1,3,5(10)-trieen-3,17-diol, 7-(9-((4,4,5,5,5-pentafluorpentyl)sulfinyl)nonyl)-, (7alfa,17beta)- | estra-1,3,5(10)-triene-3,17-diol, 7-(9-((4,4,5,5,5-pentafluoropentyl)sulfinyl)nonyl)-, (7alpha,17beta)- | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 37894-46-5 | 253-704-7 | etacelasil | etacelasil | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6108-12-9 | eta-hexachloorcyclohexaan | eta-hexachlorocyclohexane | Ja | MVP 1 | 0,05 mg/Nm3 | 26-07-2016 | 43 | ||||||
| 98241-25-9 | ethaanaminium, N,N,N- triethyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctanoaat (1:1) | ethanaminium, N,N,N-triethyl-, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 75-07-0 | 200-836-8 | ethanal | acetaldehyde | Ja | MVP 2 | 1 mg/Nm3 | 12-10-2018 | ||||||
| 97925-95-6 | 308-208-6 | ethanol, 2,2'-iminobis-, N- (C13-15-vertakt en lineair alkyl)-derivaten | ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | ||||||
| 91673-24-4 | 294-139-6 | ethanol, 2-[2-[2-[2-(4-nonylfenoxy)ethoxy]ethoxy]ethoxy]-, vertakt | ethanol, 2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]-, branched | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57, 69 | ||||||
| 51000-52-3 | 256-905-8 | ethenyl ester van neodecaanzuur | vinyl neodecanoate | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 682-00-8 | 626-513-5 | ethoxytributylstannaan | Ethoxytributylstannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 103112-35-2 | 401-290-5 | ethyl-1-(2,4-dichloorfenyl)-5-(trichloormethyl)-1H-1,2,4-triazool-3-carboxylaat | ethyl 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1H-1,2,4-triazole-3-carboxylate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 598-14-1 | 209-919-3 | ethyldichloorarsine | ethyldichloroarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 4431-24-7 | 224-629-7 | ethyleenbis(difenylarsine) | ethylenebis(diphenylarsine) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 107-15-3 | 203-468-6 | ethyleendiamine | ethylenediamine | Ja | MVP 2 | 1 mg/Nm3 | 6-7-2018 | ||||||
| 11079-07-5 | 679-904-8 | ethyleendiaminetetra-azijnzuur dinatrium nikkel(II)zout hydraat | ethylenediaminetetraacetic acid disodium nickel(II) salt hydrate | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 75-21-8 | 200-849-9 | ethyleenoxide | ethylene oxide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| ethyleenoxide en propyleenoxide, mengsel | ethylene oxide and propylene oxide, mixture | Ja | MVP 2 | 29-11-2024 | 82, 104 | ||||||||
| 96-45-7 | 202-506-9 | ethyleenthioureum | ethylene thiourea | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 3108-24-5 | 221-468-4 | ethylperfluoroctanoaat | ethyl perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 2104-64-5 | 218-276-8 | ethyl-p-nitrofenylthiobenzeenfosfenaat | O-ethyl O-4-nitrophenyl phenylphosphonothioate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 71720-48-4 | 275-897-7 | ethylwaterstofsulfaat, nikkel(II)zout | ethyl hydrogen sulfate, nickel(II) salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 32775-46-5 | 251-206-4 | europiumarsenide | europium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 68477-61-2 | 270-741-4 | extracten (aardolie), koud zuur, C4-6 | extracts (petroleum), cold-acid, C4-6 | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-03-6 | 265-102-1 | extracten (aardolie), licht nafteenhoudend destillaat oplosmiddel | extracts (petroleum), light naphthenic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 100684-02-4 | 309-672-2 | extracten (aardolie), licht paraffinehoudend destillaat oplosmiddel, met koolstof behandeld | extracts (petroleum), light paraffinic distillate solvent, carbon-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 90641-09-1 | 292-633-6 | extracten (aardolie), licht paraffinehoudend destillaat oplosmiddel, met waterstof behandeld | extracts (petroleum), light paraffinic distillate solvent, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-05-8 | 265-104-2 | extracten (aardolie), lichte paraffinehoudend destillaat oplosmiddel | extracts (petroleum), light paraffinic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 100684-03-5 | 309-673-8 | extracten (aardolie), lichte paraffinehoudend destillaat oplosmiddel, met klei behandeld | extracts (petroleum), light paraffinic distillate solvent, clay-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 100684-04-6 | 309-674-3 | extracten (aardolie), lichte vacuüm-, gasolieoplosmiddel, behandeld met koolstof | extracts (petroleum), light vacuum, gas oil solvent, carbon-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-78-7 | 295-341-7 | extracten (aardolie), lichte vacuümgasolieoplosmiddel | extracts (petroleum), light vacuum gas oil solvent | Ja | 2-12-2013 | 4 | |||||||
| 100684-05-7 | 309-675-9 | extracten (aardolie), lichte vacuümgasolieoplosmiddel, behandeld met klei | extracts (petroleum), light vacuum gas oil solvent, clay-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-79-8 | 295-342-2 | extracten (aardolie), lichte vacuümgasolieoplosmiddel, waterstofbehandeld | extracts (petroleum), light vacuum gas oil solvent, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 93763-11-2 | 297-829-5 | extracten (aardolie), met oplosmiddel van was ontdane zwaar paraffinisch zwaar destillaat-oplosmiddel-, met waterstof ontzwaveld | extracts (petroleum), solvent-dewaxed heavy paraffinic distillate solvent, hydrodesulfurized | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-75-4 | 295-338-0 | extracten (aardolie), nafteenhoudend licht destillaat oplosmiddel, waterstofontzwaveld | extracts (petroleum), light naphthenic distillate solvent, hydrodesulfurized | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21, 62 | |||||
| 91995-68-5 | 295-331-2 | extracten (aardolie), oplosmiddel-, katalytisch gereformde lichte nafta | extracts (petroleum), catalytic reformed light naphtha solvent | Ja | 2-12-2013 | 4, 65 | |||||||
| 68783-04-0 | 272-180-0 | extracten (aardolie), oplosmiddlegeraffineerde zwaar paraffinehoudend destillaat oplosmiddel | extracts (petroleum), solvent-refined heavy paraffinic distillate solvent | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-77-6 | 295-340-1 | extracten (aardolie), paraffinehoudend licht destillaat oplosmiddel, waterstofontzwaveld | extracts (petroleum), light paraffinic distillate solvent, hydrodesulfurized | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-76-5 | 295-339-6 | extracten (aardolie), paraffinehoudend licht destillaat oplosmiddel, zuurbehandeld | extracts (petroleum), light paraffinic distillate solvent, acid-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 91995-73-2 | 295-335-4 | extracten (aardolie), waterstofbehandeld paraffinehoudend licht destillaat oplosmiddel | extracts (petroleum), hydrotreated light paraffinic distillate solvent | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-11-6 | 265-111-0 | extracten (aardolie), zwaar nafteenhoudend destillaat oplosmiddel | extracts (petroleum), heavy naphthenic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 90641-07-9 | 292-631-5 | extracten (aardolie), zwaar nafteenhoudend destillaat oplosmiddel, met waterstof behandeld | extracts (petroleum), heavy naphthenic distillate solvent, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 93763-10-1 | 297-827-4 | extracten (aardolie), zwaar nafteenhoudend destillaat oplosmiddel, waterstofontzwaveld | extracts (petroleum), heavy naphthenic distillate solvent, hydrodesulfurized | Ja | 2-12-2013 | 4, 62 | |||||||
| 68783-00-6 | 272-175-3 | extracten (aardolie), zwaar nafteen-houdend destillaatoplosmiddel, aromaatconcentraat | extracts (petroleum), heavy naphthenic distillate solvent, arom. conc. | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-04-7 | 265-103-7 | extracten (aardolie), zwaar paraffinehoudend destillaat oplosmiddel | extracts (petroleum), heavy paraffinic distillate solvent | Ja | 2-12-2013 | 4 | |||||||
| 92704-08-0 | 296-437-1 | extracten (aardolie), zwaar paraffinehoudend destillaat oplosmiddel, met klei behandeld | extracts (petroleum), heavy paraffinic distillate solvent, clay-treated | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21, 62 | |||||
| 90641-08-0 | 292-632-0 | extracten (aardolie), zwaar paraffinehoudend destillaat oplosmiddel, met waterstof behandeld | extracts (petroleum), heavy paraffinic distillate solvent, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-43-7 | 308-261-5 | extracten (aardolie), zware naftaoplosmiddeL met klei behandeld | extracts (petroleum) heavy naphtha solvent, clay-treated | Ja | 2-12-2013 | 4, 65 | |||||||
| 68814-89-1 | 272-342-0 | extracten (aardolie), zware paraffinehoudende destillaten oplosmiddel-gedeasfalteerd | extracts (petroleum), heavy paraffinic distillates, solvent-deasphalted | Ja | 2-12-2013 | 4, 62 | |||||||
| 122070-80-8 | 310-171-6 | extractieoliën (kool), koolteer en pyrolyse-residuoliën naftaleenolie, destillatieresiduen | extract oils (coal), coal tar residual pyrolysis oils, naphthalene oil, distn. residues | Ja | 2-12-2013 | 4, 61 | |||||||
| 122070-79-5 | 310-170-0 | extractie-oliën (kool), koolteer en pyrolyse-residuoliën naftaleenoliën | extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oils | Ja | 2-12-2013 | 4, 61 | |||||||
| 90640-99-6 | 292-622-6 | extractieoliën (kool), lichte olie | extract oils (coal), light oil | Ja | 2-12-2013 | 4, 61 | |||||||
| 91995-66-3 | 295-329-1 | extractieoliën (kool), residuele pyrolyseoliën uit koolteer, naftaleenolie, herdestillaat | extract oils (coal), coal tar-residual pyrolysis oils, naphthalene oil, redistillate | Ja | 2-12-2013 | 4, 61 | |||||||
| 68937-63-3 | 273-077-3 | extractieoliën (kool), teerbase, collidinefractie | extract oils (coal), tar base, collidine fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 65996-86-3 | 266-020-9 | extractieoliën (kool), teerbasen | extract oils (coal), tar base | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84989-12-8 | 284-901-6 | extractieoliën (kool), zuur, vrij van teerbasen | extract oils (coal), acidic, tar-base free | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 91995-61-8 | 295-323-9 | extractieresiduen (kool), benzolfractie alkalisch zuurextract | extract residues (coal), benzole fraction alk., acid ext. | Ja | 2-12-2013 | 4, 61 | |||||||
| 93821-38-6 | 298-725-2 | extractieresiduen (kool), benzolfractie zuur | extract residues (coal), benzole fraction acid | Ja | 2-12-2013 | 4, 61 | |||||||
| 122384-77-4 | 310-189-4 | extractieresiduen (kool), creosootolie, zure | extract residues (coal), creosote oil acid | Ja | 2-12-2013 | 4, 63 | |||||||
| 90641-02-4 | 292-625-2 | extractieresiduen (kool), lichte olie alkalisch destillatietopproducten | extract residues (coal), light oil alk., distn. overheads | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-03-5 | 292-626-8 | extractieresiduen (kool), lichte olie alkalisch indeen-naftafractie | extract residues (coal), light oil alk., indene naphtha fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-01-3 | 292-624-7 | extractieresiduen (kool), lichte olie alkalisch zuurextract | extract residues (coal), light oil alk., acid ext. | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-62-5 | 309-867-2 | extractieresiduen (kool), lichte olie alkalisch zuurextract, indeenfractie | extract residues (coal), light oil alk., acid ext., indene fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-05-7 | 292-628-9 | extractieresiduen (kool), naftaleenolie alkalisch destillatieresiduen | Extract residues (coal), naphthalene oil alk., distn. residues | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 121620-47-1 | 310-166-9 | extractieresiduen (kool), naftaleenolie, alkalisch | extract residues (coal), naphthalene oil, alk. | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 90641-04-6 | 292-627-3 | extractieresiduen (kool), naftaleenolie, alkalisch destillatietopproducten | extract residues (coal), naphthalene oil alk., distn. overheads | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 121620-48-2 | 310-167-4 | extractieresiduen (kool), naftaleenolie, alkalisch naftaleenarm | extract residues (coal), naphthalene oil, alk., naphthalene-low | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 65996-87-4 | 266-021-4 | extractieresiduen (kool), teerolie alkalisch | extract residues (coal), tar oil alk. | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-06-8 | 292-629-4 | extractieresiduen (kool), teerolie alkalisch gecarboneerd met ongebluste kalk behandeld | extract residues (coal), tar oil alk., carbonated, limed | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 73665-18-6 | 277-567-8 | extractieresiduen (kool), teerolie, alkalische, naftaleendestillatieresiduen | extract residues (coal), tar oil alk., naphthalene distn. residues | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 61, 63 | |||||
| 101316-63-6 | 309-868-8 | extractieresiduen (koolteer), benzolfractie alkalisch zuurextract | extract residues (coal tar), benzole fraction alk., acid ext. | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-00-2 | 292-623-1 | extract-oliën (kool), naftaleenoliën | extract oils (coal), naphthalene oils | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 91697-23-3 | 294-285-0 | extractresiduen (kool), bruin | extract residues (coal), brown | Ja | 2-12-2013 | 4, 63 | |||||||
| 85-01-8 | 201-581-5 | fenantreen | phenanthrene | Ja | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | ||||||
| 122070-78-4 | 310-169-5 | fenantreen destillatieresiduen | phenanthrene, distn. residues | Ja | 2-12-2013 | 4, 63 | |||||||
| 229-87-8 | 205-934-4 | fenantridine | phenanthridine | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 13356-08-6 | 236-407-7 | fenbutatin | bis(tris(2-methyl-2-phenylpropyl)tin) oxide | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 57 | ||||||
| 74499-35-7 | fenol, (tetrapropenyl)-derivaten | phenol, (tetrapropenyl) derivs. | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 1801269-80-6 | 701-105-0 | fenol, 2-dodecyl-, vertakt | phenol, 2-dodecyl-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 1801269-77-1 | 701-107-1 | fenol, 3-dodecyl-, vertakt | phenol, 3-dodecyl-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 210555-94-5 | fenol, 4-dodecyl-, vertakt | phenol, 4-dodecyl-, branched | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | ||||||
| 3050-88-2 | 608-492-4 | fenol, 4-nonyl-, fosfiet (3:1) | phenol, 4-nonyl-, phosphite (3:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57 | |||||
| 121158-58-5 | 310-154-3 | fenol, dodecyl-, vertakt | phenol, dodecyl-, branched | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | |||||
| 72624-02-3 | 276-743-1 | fenol, heptyl derivaten | phenol, heptyl derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57 | |||||
| 68512-30-1 | 270-966-8 | fenol, methylstyrenaat | phenol, methylstyrenated | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | |||||
| 126049-00-1 | 685-154-2 | fenol,4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]bis-, ion(1-), tributyl 2-methoxypropyl fosfonium | phenol,4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis-, ion(1-), tributyl 2-methoxypropyl phosphonium | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 84988-93-2 | 284-881-9 | fenolen ammoniakprocesvochtextract | phenols, ammonia liquor ext. | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 77-09-8 | 201-004-7 | fenolftaleïne | phenolphthalein | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 98-05-5 | 202-631-9 | fenylarsenigzuur | phenylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 637-03-6 | 211-275-3 | fenylarsine oxide | phenylarsine oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 100-63-0 | 202-873-5 | fenylhydrazine | phenylhydrazine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 59-88-1 | 200-444-7 | fenylhydrazinechloride | phenylhydrazinium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27140-08-5 | 248-259-0 | fenylhydrazinehydrochloride | phenylhydrazine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 52033-74-6 | 257-622-2 | fenylhydrazinesulfaat | phenylhydrazinium sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13302-00-6 | 236-326-7 | fenylkwik-2-ethylhexanoaat | phenylmercury 2-ethylhexanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 62-38-4 | 200-532-5 | fenylkwikacetaat | phenylmercury acetate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 100-57-2 | 202-866-7 | fenylkwikhydroxide | phenylmercury hydroxide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 26545-49-3 | 247-783-7 | fenylkwikneodecanoaat | phenylmercury neodecanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 55-68-5 | 200-242-9 | fenylkwiknitraat | phenylmercury nitrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 13864-38-5 | fenylkwikoctanoaat | phenylmercury octanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 103-27-5 | 203-094-3 | fenylkwikpropionaat | phenylmercury propionate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| fenylkwikverbindingen | phenylmercury compounds | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||||
| 14402-61-0 | 604-391-4 | ferraat(4-), hexakis(cyaan-κC)-, lood(2+) (1:2), (OC-6-11)- | ferrate(4-), hexakis(cyano-κC)-, lead(2+) (1:2), (OC-6-11)- | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 57 | ||||||
| 948-083-0 | filterkoek van koperprecipitatieresidu, zuivering van looddinitraatoplossing, lood- en bismutverbindingen | filter cake of copper precipitation residue, lead dinitrate solution purification, lead and bismuth compounds | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 57 | |||||||
| 120068-37-3 | 424-610-5 | fipronil | fipronil | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 104040-78-0 | 600-514-0 | flazasulfuron | flazasulfuron | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 90035-08-8 | 421-960-0 | flocumafen | flocoumafen | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | 96 | ||||
| 158062-67-0 | 605-127-0 | flonicamid | flonicamid | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 69335-91-7 | 614-949-9 | fluazifop | fluazifop | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 69806-50-4 | 274-125-6 | fluazifop-butyl | fluazifop-butyl | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 83066-88-0 | 617-435-2 | fluazifop-p | fluazifop-p | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 79241-46-6 | 616-669-2 | fluazifop-P-butyl | fluazifop-P-butyl | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 79622-59-6 | 616-712-5 | fluazinam | fluazinam | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 272451-65-7 | 608-064-7 | flubendiamide | flubendiamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 37893-02-0 | 253-703-1 | flubenzimine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | ||||||
| 33245-39-5 | 251-426-0 | fluchloralin | fluchloralin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 70124-77-5 | 274-322-7 | flucythrinaat | flucythrinate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 142459-58-3 | 604-290-5 | flufenacet | flufenacet | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 5002-47-1 | 225-672-4 | flufenazine o-decanoaat | fluphenazine o-decanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 101463-69-8 | 417-680-3 | flufenoxuron | 1-(4-(2-cloro-α,α,α-p-trifluorotolyloxy)-2-fluorophenyl)-3-(2,6-difluorobenzolyl)urea | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 2164-17-2 | 218-500-4 | fluometuron | fluometuron | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 239110-15-7 | 607-285-6 | fluopicolide | fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridylmethyl]benzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 658066-35-4 | 619-797-7 | fluopyram | fluopyram | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 68958-61-2 | 614-861-0 | fluoralkylalkoxylaat | fluoralkylalkoxylat | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 206-44-0 | 205-912-4 | fluoranteen | fluoranthene | Ja | MVP 1 | 0,05 mg/Nm3 | 12-8-2014 | ||||||
| 86-73-7 | 201-695-5 | fluoreen | fluorene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 77501-90-7 | 616-467-4 | fluorglycofen-ethyl | fluorglycofen-ethyl | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| fluorkoolwaterstoffen | fluorohydrocarbons | Ja | - | 18-11-2024 | 101, 102 | ||||||||
| 146-56-5 | 205-674-1 | fluphenazine dihydrochloride | fluphenazine dihydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 144740-54-5 | 604-441-5 | flupyrsulfuron-methyl | flupyrsulfuron-methyl-sodium | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 61213-25-0 | 262-661-3 | flurochloridone | flurochloridon | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81, 96 | ||||
| 96525-23-4 | 619-224-0 | flurtamone | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | ||||||
| 85509-19-9 | 617-717-5 | flusilazool | flusilazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13311-84-7 | 236-341-9 | flutamide | flutamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 66332-96-5 | 613-921-3 | flutolanil | flutolanil | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 69409-94-5 | 805-993-1 | fluvalinaat | fluvalinate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 50-00-0 | 200-001-8 | formaldehyde | formaldehyde | Ja | MVP 2 | 1 mg/Nm3 | 3-2-2015 | ||||||
| 25214-70-4 | 500-036-1 | formaldehyde, oligomere reactieproducten met aniline | formaldehyde, oligomeric reaction products with aniline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 93925-00-9 | 300-298-5 | formaldehyde, reactie producten met vertakt en lineair heptylfenol, koolstof disulfide en hydrazine | formaldehyde, reaction products with branched and linear heptylphenol, carbon disulfide and hydrazine | Ja | MVP 1 | 0,05 mg/Nm3 | 7-1-2022 | 57 | |||||
| 3228-27-1 | 687-203-3 | formaldehyde-13C | formaldehyde-13C | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 57, 68 | ||||||
| 63101-50-8 | 694-347-0 | formaldehyde-d2-13C | formaldehyde-d2-13C | MVP 2 | 1 mg/Nm3 | 16-10-2025 | 57, 68 | ||||||
| 75-12-7 | 200-842-0 | formamide | formamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 325459-92-5 | fosfine, tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]- | phosphine, tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 68412-69-1 | 270-206-5 | fosfinezuur, bis(perfluor-C6-12-alkyl) derivaten | phosphinic acid, bis(perfluoro-C6-12-alkyl) derivs. | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 93062-53-4 | 296-807-2 | fosfinezuur, bis(perfluor-C6-12-alkyl) derivaten, aluminium zouten | phosphinic acid, bis(perfluoro-C6-12-alkyl) derivs., aluminum salts | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 17169-61-8 | fosforzuur calciumnikkelzout | phosphoric acid, calcium nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 92203-02-6 | 875-679-7 | fosforzuur, reactieproducten met aluminumhydroxide en chroomoxide (CrO3) | phosphoric acid, reaction products with aluminum hydroxide and chromium oxide (CrO3) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 12, 57 | ||||||
| 65997-18-4 | 266-047-6 | frits, chemicaliën | frits, chemicals | MVP 1 | 0,05 mg/Nm3 | 13-4-2023 | 14, 57 | ||||||
| 110-00-9 | 203-727-3 | furaan | furan | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 12005-89-9 | 234-475-2 | gadoliniumarsenide | gadolinium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 60953-19-7 | galliumarseenfosfide | gallium arsenic phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 1303-00-0 | 215-114-8 | galliumarsenide | gallium arsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | ||||
| 106097-61-4 | galliumarsenidefosfide | gallium arsenide phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 98106-56-0 | 308-577-3 | galliumzinktriarsenide | gallium zinc triarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1329995-69-8 | gamma-cyclodextrin, verbinding met tridecafluorhexaansulfonzuur ion(1-) (1:1) | gamma-cyclodextrin, compd. with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid ion(1-) (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 134237-52-8 | gamma-hexabroomcyclododecaan | gamma-hexabromocyclododecane | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 58-89-9 | 200-401-2 | gamma-hexachloorcyclohexaan | gamma-hexachlorocyclohexane | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 94114-55-3 | 302-691-7 | gasolie, kool solventextractie, met waterstof gekraakte nafta | gasoline, coal solvent extn., hydrocracked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 64742-29-6 | 265-129-9 | gasoliën (aardolie), chemisch geneutraliseerd | gas oils (petroleum), chemically neutralized | Ja | 2-12-2013 | 4, 64 | |||||||
| 97926-59-5 | 308-278-8 | gasoliën (aardolie), lichte vacuüm-, thermisch gekraakt met waterstof ontzwaveld | gas oils (petroleum), light vacuum, thermal-cracked hydrodesulfurized | Ja | 2-12-2013 | 4 | |||||||
| 64742-59-2 | 265-162-9 | gasoliën (aardolie), met waterstof behandelde vacuümdestillatiefractie | gas oils (petroleum), hydrotreated vacuum | Ja | 2-12-2013 | 4 | |||||||
| 64742-79-6 | 265-182-8 | gasoliën (aardolie), met waterstof ontzwaveld | gas oils (petroleum), hydrodesulfurized | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-86-5 | 265-189-6 | gasoliën (aardolie), met waterstof ontzwaveld zwaar vacuümdestillatiefractie | gas oils (petroleum), hydrodesulfurized heavy vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 85117-03-9 | 285-555-9 | gasoliën (aardolie), met waterstof ontzwavelde verkookser zware vacuümdestillatiefractie | gas oils (petroleum), hydrodesulfurized coker heavy vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64742-12-7 | 265-112-6 | gasoliën (aardolie), met zuur behandeld | gas oils (petroleum), acid-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-90-8 | 265-092-9 | gasoliën (aardolie), solvent-geraffineerd | gas oils (petroleum), solvent-refined | Ja | 2-12-2013 | 4, 64 | |||||||
| 68527-18-4 | 271-260-2 | gasoliën (aardolie), stoomgekraakt | gas oils (petroleum), steam-cracked | Ja | 2-12-2013 | 4 | |||||||
| 92045-29-9 | 295-411-7 | gasoliën (aardolie), thermisch gekraakt, met water ontzwaveld | gas oils (petroleum), thermal-cracked, hydrodesulfurized | Ja | 2-12-2013 | 4 | |||||||
| 68783-08-4 | 272-184-2 | gasoliën (aardolie), zwaar atmosferische destillatie | gas oils (petroleum), heavy atmospheric | Ja | 2-12-2013 | 4 | |||||||
| 64741-57-7 | 265-058-3 | gasoliën (aardolie), zware vacuümdestillatiefractie | gas oils (petroleum), heavy vacuum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 93924-33-5 | 300-227-8 | gasoliën paraffinehoudend | gas oils, paraffinic | Ja | 2-12-2013 | 4, 64 | |||||||
| 97862-78-7 | 308-128-1 | gasoliën waterstofbehandeld | gas oils, hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68606-27-9 | 271-737-5 | gassen (aardolie), alkyleringsinvoer | gases (petroleum), alkylation feed | Ja | 2-12-2013 | 4, 60 | |||||||
| 68602-82-4 | 271-623-5 | gassen (aardolie), benzeeninstallatie, waterstofbehandelaar, pentaanverwijdering-topproducten | gases (petroleum), benzene unit hydrotreater depentanizer overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68602-83-5 | 271-624-0 | gassen (aardolie), C1-5, nat | gases (petroleum), C1-5, wet | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-70-3 | 270-751-9 | gassen (aardolie), C2-3 | gases (petroleum), C2-3- | Ja | 2-12-2013 | 4, 60 | |||||||
| 68783-65-3 | 272-205-5 | gassen (aardolie), C2-4-, stankvrij gemaakt | gases (petroleum), C2-4, sweetened | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-84-9 | 270-766-0 | gassen (aardolie), C2-terugstroom | gases (petroleum), C2-return stream | Ja | 2-12-2013 | 4, 60 | |||||||
| 68131-75-9 | 268-629-5 | gassen (aardolie), C3-4 | gases (petroleum), C3-4 | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-33-8 | 270-724-1 | gassen (aardolie), C3-4, rijk aan isobutaan | gases (petroleum), C3-4, isobutane-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-83-8 | 270-765-5 | gassen (aardolie), C3-5 olefine-paraffine-alkyleringsreagens | gases (petroleum), C3-5 olefinic-paraffinic alkylation feed | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-85-0 | 270-767-6 | gassen (aardolie), C4-rijk | gases (petroleum), C4-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-81-6 | 270-762-9 | gassen (aardolie), C6-8-katalytische reformer | gases (petroleum), C6-8 catalytic reformer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-01-7 | 272-873-8 | gassen (aardolie), destillaat, unifiner-ontzwaveling, stripperuitstoot | gases (petroleum), distillate unifiner desulfurization stripper off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-93-0 | 270-776-5 | gassen (aardolie), destillatie gasconcentratie-herabsorbeerder | gases (petroleum), gas concn. reabsorber distn. | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-05-1 | 272-878-5 | gassen (aardolie), direct door fractionering verkregen lichte benzine, stabilisatoruitstoot | gases (petroleum), light straight run gasoline fractionation stabilizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68955-34-0 | 273-270-2 | gassen (aardolie), direct door fractionering verkregen nafta, katalytische reformer, stabilisator-topproducten | gases (petroleum), straight-run naphtha catalytic reformer stabilizer overhead | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-09-5 | 272-882-7 | gassen (aardolie), direct door fractionering verkregen nafta, katalytische reforming, uitstoot | gases (petroleum), straight-run naphtha catalytic reforming off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-10-8 | 272-883-2 | gassen (aardolie), directe fractionering, stabilisatoruitstoot | gases (petroleum), straight-run stabilizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-92-9 | 270-774-4 | gassen (aardolie), droog zwavelhoudend uitstoot gasconcentratie-installatie | gases (petroleum), dry sour, gas-concn.-unit-off | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-17-5 | 295-399-3 | gassen (aardolie), gasolie, ontgassing waterstofontzwaveling | gases (petroleum), gas oil hydrodesulfurization purge | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-15-3 | 295-397-2 | gassen (aardolie), gasolie, uitstoot diethanolamine-gaswasser | rases (petroleum), gas oil diethanolamine scrubber off | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-16-4 | 295-398-8 | gassen (aardolie), gasolie, uitstroom waterstofontzwaveling | gases (petroleum), gas oil hydrodesulfurization effluent | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-94-1 | 270-777-0 | gassen (aardolie), gasterugwinning-installatie, topproducten van propaanverwijdering | gases (petroleum), gas recovery plant depropanizer overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-99-6 | 270-782-8 | gassen (aardolie), geïsomeriseerde naftafractionator, rijk aan C4, vrij van waterstofsulfide | gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-95-2 | 270-778-6 | gassen (aardolie), grondstof Girbatol-installatie | gases (petroleum), Girbotol unit feed | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-00-6 | 272-872-2 | gassen (aardolie), hexaanverwijdering-uitstoot | gases (petroleum), dehexanizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-18-6 | 295-400-7 | gassen (aardolie), hydogenatoruitstroom uitstoot afdampvat | gases (petroleum), hydrogenator effluent flash drum off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-71-4 | 270-752-4 | gassen (aardolie), katalytisch gekraakte gasolie, bodemfracties uit propaanverwijdering, C4-rijk zuurvrij | gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68952-76-1 | 273-169-3 | gassen (aardolie), katalytisch gekraakte nafta, butaanverwijdering | gases (petroleum), catalytic cracked naphtha debutanizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-72-5 | 270-754-5 | gassen (aardolie), katalytisch gekraakte nafta, butaanverwijdering-bodemfracties, C3-5-rijk | gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-73-6 | 270-755-0 | gassen (aardolie), katalytisch gekraakte nafta, propaanverwijdering-topproducten C3-rijke zuurvrije | gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68409-99-4 | 270-071-2 | gassen (aardolie), katalytisch gekraakte topfracties | gases (petroleum), catalytic cracked overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-76-9 | 270-758-7 | gassen (aardolie), katalytisch gepolymeriseerde nafta, stabilisator-topfractie, C2-4-rijk | gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-77-0 | 270-759-2 | gassen (aardolie), katalytisch gereformde nafta, stripper-topproducten | gases (petroleum), catalytic reformed naphtha stripper overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68783-64-2 | 272-203-4 | gassen (aardolie), katalytisch kraken | gases (petroleum), catalytic cracking | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-74-7 | 270-756-6 | gassen (aardolie), katalytische kraker | gases (petroleum), catalytic cracker | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-02-8 | 272-874-3 | gassen (aardolie), katalytische kraker met wervelbed fractioneringsuitstoot | gases (petroleum), fluidized catalytic cracker fractionation off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-20-0 | 272-893-7 | gassen (aardolie), katalytische kraker met wervelbed splitter-topproducten | gases (petroleum), fluidized catalytic cracker splitter overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-03-9 | 272-875-9 | gassen (aardolie), katalytische kraker met wervelbed wassing uitstoot secundair absorptievat | gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-75-8 | 270-757-1 | gassen (aardolie), katalytische kraker, C1-5-rijk | gases (petroleum), catalytic cracker, C1-5-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-79-2 | 270-760-8 | gassen (aardolie), katalytische reformer, C1-4-rijk | gases (petroleum), catalytic reformer, C1-4-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68513-14-4 | 270-999-8 | gassen (aardolie), katalytische reforming van door directe fractionering verkregen nafta, stabilisator-topproducten | gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68513-17-7 | 271-002-9 | gassen (aardolie), lichte door directe fractionering verkregen nafta, stabilisatoruitstoot | gases (petroleum), light straight-run naphtha stabilizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68955-28-2 | 273-265-5 | gassen (aardolie), lichte stoomgekraakte, butadieenconcentraat | gases (petroleum, light steam-cracked, butadiene conc. | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 20, 60 | |||||
| 68477-68-9 | 270-749-8 | gassen (aardolie), mengolie, rijk aan waterstof en stikstof | gases (petroleum), blend oil, hydrogen-nitrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-06-2 | 272-879-0 | gassen (aardolie), nafta-unifiner-ontzwaveling stripperuitstoot | gases (petroleum), naphtha unifiner desulfurization stripper off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68527-15-1 | 271-258-1 | gassen (aardolie), olieraffinage, uitstoot gasdestillatie | gases (petroleum), oil refinery gas distn. off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-07-3 | 272-880-6 | gassen (aardolie), platforming, stabilisatoruitstoot, fractionering van lichte eindfracties | gases (petroleum), platformer stabilizer off, light ends fractionation | Ja | 2-12-2013 | 4, 60 | |||||||
| 68814-90-4 | 272-343-6 | gassen (aardolie), platformingproducten afscheideruitstoot | gases (petroleum), platformer products separator off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-90-7 | 270-772-3 | gassen (aardolie), propaanverwijdering droog, rijk aan propeen | gases (petroleum), depropanizer dry, propene-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68606-34-8 | 271-742-2 | gassen (aardolie), propaanverwijdering-bodemfracties, fractioneringsuitstoot | gases (petroleum), depropanizer bottoms fractionation off | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 20, 60 | |||||
| 68814-67-5 | 272-338-9 | gassen (aardolie), raffinage | gases (petroleum), refinery | Ja | 2-12-2013 | 4, 60 | |||||||
| 68783-07-3 | 272-183-7 | gassen (aardolie), raffinage-meng- | gases (petroleum), refinery blend | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-02-4 | 270-785-4 | gassen (aardolie), reformende waterstofbehandelaar | gases (petroleum), reforming hydrotreater | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-04-6 | 270-788-0 | gassen (aardolie), reformende waterstofbehandelaar aanvullings-, waterstof-rijk | gases (petroleum), reforming hydrotreater make-up, hydrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-03-5 | 270-787-5 | gassen (aardolie), reformende waterstofbehandelaar, rijk aan waterstof en methaan | gases (petroleum), reforming hydrotreater, hydrogen-methane-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68513-18-8 | 271-003-4 | gassen (aardolie), reformeruitstroom uitstoot hogedruk-afdampvat | gases (petroleum), reformer effluent high-pressure flash drum off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68513-19-9 | 271-005-5 | gassen (aardolie), reformeruitstroom uitstoot lagedruk-afdampvat | gases (petroleum), reformer effluent low-pressure flash drum off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-01-3 | 270-784-9 | gassen (aardolie), reformer-verzamel-, waterstof-rijk | gases (petroleum), reformer make-up, hydrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-20-0 | 295-402-8 | gassen (aardolie), residu visbreaking uitstoot | gases (petroleum), residue visbaking off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68989-88-8 | 273-563-5 | gassen (aardolie), ruwe destillatie en katalytisch kraken | gases (petroleum), crude distn. and catalytic cracking | Ja | 2-12-2013 | 4, 60 | |||||||
| 68918-99-0 | 272-871-7 | gassen (aardolie), ruwe olie, fractioneringsuitstoot, | gases (petroleum), crude oil fractionation off | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-19-7 | 295-401-2 | gassen (aardolie), stoomkraken van nafta, hogedruk-restgassen | gases (petroleum), naphtha steam cracking high-pressure residual | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-22-2 | 295-404-9 | gassen (aardolie), stoomkraker, rijk aan C3 | gases (petroleum), steam-cracker C3-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-67-8 | 270-748-2 | gassen (aardolie), terugvoer benzeeninstallatie, rijk aan waterstof | gases (petroleum), benzene unit recycle, hydrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-82-7 | 270-763-4 | gassen (aardolie), terugvoer C6-8 katalytische reformer, rijk aan waterstof | gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-80-5 | 270-761-3 | gassen (aardolie), terugvoer C6-8-katalytische reformer | gases (petroleum), C6-8 catalytic reformer recycle | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-00-2 | 270-783-3 | gassen (aardolie), terugvoer-, waterstof-rijk | gases (petroleum), recycle, hydrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-05-7 | 270-789-6 | gassen (aardolie), thermisch kraken-destillatie- | gases (petroleum), thermal cracking distn. | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-65-6 | 270-746-1 | gassen (aardolie), toevoer aminesysteem | gases (petroleum), amine system feed | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-69-0 | 270-750-3 | gassen (aardolie), topproducten butaansplitter | gases (petroleum), butane splitter overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-86-1 | 270-768-1 | gassen (aardolie), topproducten van ethaanverwijdering | gases (petroleum), deethanizer overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-87-2 | 270-769-7 | gassen (aardolie), topproducten van isobutaanverwijdering-toren | gases (petroleum), deisobutanizer tower overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-91-8 | 270-773-9 | gassen (aardolie), topproducten van propaanverwijdering | gases (petroleum), depropanizer overheads | Ja | 2-12-2013 | 4, 60 | |||||||
| 68513-15-5 | 271-000-8 | gassen (aardolie), totaalfractie door directe fractionering verkregen nafta, uitstoot van hexaanverwijdering | gases (petroleum), full-range straight-run naphtha dehexanizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-66-7 | 270-747-7 | gassen (aardolie), uitstoot benzeeninstallatie, waterstofontzwavelaar | gases (petroleum), benzene unit hydrodesulfurizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68602-84-6 | 271-625-6 | gassen (aardolie), uitstoot secundaire absorbeerder, fractionering van topproducten uit katalytische kraker wervelbed | gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionator | Ja | 2-12-2013 | 4, 60 | |||||||
| 68955-33-9 | 273-269-7 | gassen (aardolie), uitstoot sponsabsorptievat, katalytische kraker met wervelbed en gasolieontzwavelaar, fractionering topproducten | gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionation | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-11-9 | 272-884-8 | gassen (aardolie), uitstoot teerstripper | gases (petroleum), tar stripper off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-12-0 | 272-885-3 | gassen (aardolie), uitstoot unifiner-stripper | gases (petroleum), unifiner stripper off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-08-4 | 272-881-1 | gassen (aardolie), uitstoot voor-afdampingstoren ruwe destillatie | gases (petroleum), preflash tower off, crude distn. | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-96-3 | 270-779-1 | gassen (aardolie), uitstoot waterstofabsorbeerder | gases (petroleum), hydrogen absorber off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-98-5 | 270-781-2 | gassen (aardolie), waterstofbehandelaar-mengolie-terugvoer-, rijk aan waterstof en stikstof | gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68911-59-1 | 272-776-0 | gassen (aardolie), waterstofbehandelde zwavelhoudende kerosine, afdampvat | gases (petroleum), hydrotreated sour kerosine flash drum | Ja | 2-12-2013 | 4, 60 | |||||||
| 68911-58-0 | 272-775-5 | gassen (aardolie), waterstofbehandelde zwavelhoudende kerosine, uitstoot pentaanverwijdering-stabilisatie | gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer off | Ja | 2-12-2013 | 4, 60 | |||||||
| 68783-06-2 | 272-182-1 | gassen (aardolie), waterstofkraken lagedruk-afscheider | gases (petroleum), hydrocracking low-pressure separator | Ja | 2-12-2013 | 4, 60 | |||||||
| 68513-16-6 | 271-001-3 | gassen (aardolie), waterstofkraken uitstoot van propaanverwijdering, koolwaterstofrijk | gases (petroleum), hydrocracking depropanizer off, hydrocarbon-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68477-97-4 | 270-780-7 | gassen (aardolie), waterstof-rijk | gases (petroleum), hydrogen-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68919-04-0 | 272-876-4 | gassen (aardolie), zwaar destillaat, waterstofontzwaveling, stripper-uitstoot | gases (petroleum), heavy distillate hydrotreater desulfurization stripper off | Ja | 2-12-2013 | 4, 60 | |||||||
| gebromeerde brandvertragers | brominated flame retardants | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| gebromeerde difenylethers | brominated diphenyl ethers | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 2, 35, 123 | |||||
| 97553-43-0 | 307-202-0 | gechloreerde aardolie paraffines, normaal C>10 | paraffins (petroleum), normal C>10, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 56, 57 | |||||
| 1372804-76-6 | gechloreerde alkanen, C14-C16 | alkanes, C14-16, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||||
| 85422-92-0 | 287-196-3 | gechloreerde paraffine-oliën | paraffin oils, chloro | Ja | MVP 1 | 0,05 mg/Nm3 | 13-07-2021 | 56, 81 | |||||
| 799-971-8 | gechloreerde paraffines van middellange keten | medium-chain chlorinated paraffins | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||||
| 936-076-5 | gedisulfoneerd nikkel(II)ftalocyanine | disulfonated nickel(II) phtalocyanine | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34 | |||||||
| geëthoxyleerd 4-(1,1,3,3-tetramethylbutyl)fenol | 4-(1,1,3,3-tetramethylbutyl)phenol, ethoxylated | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 26027-38-3 | 500-045-0 | geëthoxyleerd 4-nonylfenol | ethoxylated 4-nonylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 57 | |||||
| 37205-87-1 | geëthoxyleerd isononylfenol | ethoxylated isononylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 799-990-1 | geëthoxyleerd lineair en vertakt 4-nonylfenol | 4-Nonylphenol, branched and linear, ethoxylated | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| geëthoxyleerd nonylfenol (EO = 10) | nonylphenol, ethoxylated (EO = 10) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||||
| 939-975-0 | geëthoxyleerd nonylfenol (EO = 4) | nonylphenol, ethoxylated (EO = 4) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 938-618-6 | geëthoxyleerd nonylfenol (polymeer) | nonylphenol, ethoxylated (polymer) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 94551-62-9 | 305-411-1 | gegloeid lood-zinkerts concentraat | calcines, lead-zinc ore conc. | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 61788-32-7 | 262-967-7 | gehydrogeneerd terfenyl | terphenyl hydrogenated | Ja | MVP 1 | 0,05 mg/Nm3 | 6-7-2018 | ||||||
| 64741-62-4 | 265-064-6 | geklaarde oliën (aardolie), katalytisch gekraakt | clarified oils (petroleum), catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 68333-26-6 | 269-782-0 | geklaarde oliën (aardolie), met waterstof ontzwavelde katalytisch gekraakte | clarified oils (petroleum), hydrodesulfurized catalytic cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 95058-81-4 | 619-100-6 | gemcitabine | gemcitabine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 122111-03-9 | 601-823-3 | gemcitabine hydrochloride | gemcitabine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 12271-72-6 | 235-547-6 | germaniumarsenide | germanium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 77182-82-2 | 278-636-5 | glufosinaat-ammonium | ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 111-30-8 | 203-856-5 | glutaaraldehyde | glutaraldehyde | Ja | MVP 2 | 1 mg/Nm3 | 13-7-2021 | 81 | |||||
| 556-52-5 | 209-128-3 | glycidol | 2,3-epoxypropan-1-ol | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 125370-60-7 | 118-476-4 | glycidyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluornonylether, 96% | GLYCIDYL 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-HEXADECAFLUORONONYL ETHER, 96% | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 116-49-4 | 204-143-1 | glycobiarsol | glycobiarsol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| halonen | partially halogenated chlorofluorohydrocarbon | Ja | - | 18-11-2024 | 101, 102 | ||||||||
| 100784-20-1 | 600-130-3 | halosulfuronmethyl | halosulfuron-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | ||||||
| 151-67-7 | 205-796-5 | halothaan | halothane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 69806-34-4 | 615-015-3 | haloxyfop | haloxyfop | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 87237-48-7 | 402-560-5 | haloxyfop-ethoxyethyl | haloxyfop-etotyl | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2024 | 96, 98 | |||||
| 69806-40-2 | 634-735-9 | haloxyfop-methylester | haloxyfop-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 72619-32-0 | 406-250-0 | haloxyfop-P-methyl | haloxyfop-P-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 12035-71-1 | heazlewoodiet | heazlewoodite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 423-62-1 | 207-030-5 | henicosafluor-10-jooddecaan | henicosafluoro-10-iododecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 15166-06-0 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)- | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 15715-47-6 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, aluminium zout (3:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, aluminum salt (3:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 19742-57-5 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, ammoniumzout (1:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, ammonium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 15739-82-9 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, chroomzout (1:x) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, chromium salt (1:x) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 61436-04-2 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, ijzerzout (1:x) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, iron salt (1:x) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 29457-73-6 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, kalium zout (1:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)-, potassium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 18017-22-6 | heptaanzuur, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluor-6-(trifluormethyl)-, natrium zout (1:1) | heptanoic acid, 2,2,3,3,4,4,5,5,6,7,7,7-dodecafluoro-6-(trifluoromethyl)- , sodium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 909009-42-3 | heptaanzuur, 2,2,3,3,4,4,5,6,6,7,7,7-dodecafluor-5-(trifluormethyl)- | heptanoic acid, 2,2,3,3,4,4,5,6,6,7,7,7-dodecafluoro-5-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1144512-18-4 | heptaanzuur, 2,2,3,3,4,5,5,6,6,7,7,7-dodecafluor-4-(trifluormethyl)- | heptanoic acid, 2,2,3,3,4,5,5,6,6,7,7,7-dodecafluoro-4-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 705240-04-6 | heptaanzuur, 2,2,3,4,4,5,5,6,6,7,7,7-dodecafluor-3-(trifluormethyl)- | heptanoic acid, 2,2,3,4,4,5,5,6,6,7,7,7-dodecafluoro-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 207678-51-1 | heptaanzuur, 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluor-2-(trifluormethyl)- | heptanoic acid, 2,3,3,4,4,5,5,6,6,7,7,7-dodecafluoro-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 68928-80-3 | 273-031-2 | heptabroomdifenylether | heptabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 12-8-2014 | 35 | |||
| 446255-22-7 | heptabroomdifenylether | heptabromodiphenyl ether | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||||
| 76-44-8 | 200-962-3 | heptachloor | heptachlor | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1024-57-3 | 213-831-0 | heptachloorepoxide | heptachlor epoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 32241-08-0 | 250-969-0 | heptachloornaftaleen | heptachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 28680-45-7 | 249-153-7 | heptachloornorborneen | heptachlorobicyclo[2.2.1]hept-2-ene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84029-60-7 | 281-728-8 | heptadecafluor-1-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctyl)oxy]noneen | heptadecafluoro-1-[(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl)oxy]nonene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 507-63-1 | 208-079-5 | heptadecafluor-1-joodoctaan | heptadecafluoro-1-iodooctane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 423-60-9 | 624-359-3 | heptadecafluor-1-octaansulfonylchloride | Heptadecafluoro-1-octanesulfonyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 24448-09-7 | 246-262-1 | heptadecafluor-N-(2-hydroxyethyl)-N-methyloctaansulfonamide | heptadecafluoro-N-(2-hydroxyethyl)-N-methyloctanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 52447-23-1 | 623-759-5 | heptadecafluornonanoylchloride | Heptadecafluorononanoyl chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 754-91-6 | 212-046-0 | heptadecafluoroctaansulfonamide | heptadecafluorooctanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 9-5-2019 | 57, 96 | ||||
| 307-35-7 | 206-200-6 | heptadecafluoroctaansulfonyl fluoride | heptadecafluorooctanesulphonyl fluoride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 2252-84-8 | 811-906-8 | heptafluorpropaan | heptafluoropropane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 3330-15-2 | 671-353-1 | heptafluorpropyl 1,2,2,2-tetrafluorethylether | 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2,2-tetrafluoroethoxy)propane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 13601-55-3 | 624-520-8 | hexaaminenikkel(II) bromide | hexaaminenickel(II) bromide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 13859-68-2 | 625-736-5 | hexaaminenikkel(II) jodide | hexaaminenickel(II) iodide | MVP 1 | 0,05 mg/Nm3 | 20-8-2024 | 34, 57 | ||||||
| 10534-88-0 | 620-832-3 | hexaamminenikkel(II) chloride | hexaamminenikkel(II) chloride | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 1144512-34-4 | hexaanzuur, 2,2,3,3,4,4,6,6,6-nonafluor-5,5-bis(trifluormethyl)- | hexanoic acid, 2,2,3,3,4,4,6,6,6-nonafluoro-5,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-79-6 | hexaanzuur, 2,2,3,3,4,5,5,6,6,6-decafluor-4-(1,1,2,2,2-pentafluorethyl)- | hexanoic acid, 2,2,3,3,4,5,5,6,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1144512-36-6 | hexaanzuur, 2,2,3,3,4,5,6,6,6-nonafluor-4,5-bis(trifluormethyl)- | hexanoic acid, 2,2,3,3,4,5,6,6,6-nonafluoro-4,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1192593-79-5 | hexaanzuur, 2,2,3,3,5,5,6,6,6-nonafluor-4,4-bis(trifluormethyl)- | hexanoic acid, 2,2,3,3,5,5,6,6,6-nonafluoro-4,4-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-78-5 | hexaanzuur, 2,2,3,4,4,5,5,6,6,6-decafluor-3-(1,1,2,2,2-pentafluorethyl)- | hexanoic acid, 2,2,3,4,4,5,5,6,6,6-decafluoro-3-(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1144512-35-5 | hexaanzuur, 2,2,3,4,4,5,6,6,6-nonafluor-3,5-bis(trifluormethyl)- | hexanoic acid, 2,2,3,4,4,5,6,6,6-nonafluoro-3,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-81-0 | hexaanzuur, 2,2,3,4,5,5,6,6,6-nonafluor-3,4-bis(trifluormethyl)- | hexanoic acid, 2,2,3,4,5,5,6,6,6-nonafluoro-3,4-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1812247-20-3 | hexaanzuur, 2,2,4,4,5,5,6,6,6-nonafluor-3,3-bis(trifluormethyl)- | hexanoic acid, 2,2,4,4,5,5,6,6,6-nonafluoro-3,3-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 35605-76-6 | hexaanzuur, 2,3,3,4,4,5,5,6,6,6-decafluor-2-(1,1,2,2,2-pentafluorethyl)- | hexanoic acid, 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 13058-06-5 | hexaanzuur, 2,3,3,4,4,5,5,6,6,6-decafluor-2-(1,1,2,2,2-pentafluorethyl)-, ammoniumzout (1:1) | hexanoic acid, 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2- pentafluoroethyl)-, ammonium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1195164-59-0 | hexaanzuur, 2,3,3,4,4,5,5,6,6,6-decafluor-2-(1,1,2,2,2-pentafluorethyl)-, natrium zout (1:1) | hexanoic acid, 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)-, sodium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-80-9 | hexaanzuur, 2,3,3,4,4,5,6,6,6-nonafluor-2,5-bis(trifluormethyl)- | hexanoic acid, 2,3,3,4,4,5,6,6,6-nonafluoro-2,5-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1812247-19-0 | hexaanzuur, 2,3,3,4,5,5,6,6,6-nonafluor-2,4-bis(trifluormethyl)- | hexanoic acid, 2,3,3,4,5,5,6,6,6-nonafluoro-2,4-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1812247-18-9 | hexaanzuur, 2,3,4,4,5,5,6,6,6-nonafluor-2,3-bis(trifluormethyl)- | hexanoic acid, 2,3,4,4,5,5,6,6,6-nonafluoro-2,3-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1812247-17-8 | hexaanzuur, 3,3,4,4,5,5,6,6,6-nonafluor-2,2-bis(trifluormethyl)- | hexanoic acid, 3,3,4,4,5,5,6,6,6-nonafluoro-2,2-bis(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 36355-01-8 | 252-994-2 | hexabroombifenyl | hexabromo-1,1'-biphenyl | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 36483-60-0 | 253-058-6 | hexabroomdifenylether | hexabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 12-8-2014 | 35 | |||
| 813-19-4 | 212-383-3 | hexabutyldistannaan | hexabutyldistannane | 6-9-2022 | 15 | ||||||||
| 4808-30-4 | 225-369-7 | hexabutyldistannathiaan | Hexabutyldistannathiane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 118-74-1 | 204-273-9 | hexachloorbenzeen | hexachlorobenzene | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 31 | |||
| 87-68-3 | 201-765-5 | hexachloorbutadieen | hexachlorobuta-1,3-diene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 608-73-1 | 210-168-9 | hexachloorcyclohexaan | hexachlorocyclohexane (technical) | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 77-47-4 | 201-029-3 | hexachloorcyclopentadieen | hexachlorocyclopentadiene | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 55684-94-1 | hexachloordibenzofuranen | hexachlorodibenzofurans | ERS | 0,05 ng TEQ/Nm3 | 24-1-2020 | 57, 69 | |||||||
| 1335-87-1 | 215-641-3 | hexachloornaftaleen | hexachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 335-57-9 | 206-392-1 | hexadecafluorheptaan | hexadecafluoroheptane | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 96, 122 | |||||
| 3124-01-4 | 221-505-4 | hexafenyldilood | hexaphenyldiplumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 72301-81-6 | 695-459-2 | hexafluor-2-propaanon--(~2~H_2_)water (1/1) | hexafluoropropan-2-one--(~2~H_2_)water (1/1) | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 684-16-2 | 211-676-3 | hexafluoraceton | hexafluoro acetone | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 677-71-4 | 211-644-9 | hexafluoraceton-hydraat | hexafluoroacetone hydrate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 76-16-4 | 200-939-8 | hexafluorethaan | hexafluoroethane | Ja | gO.2 | 50 mg/Nm3 | 15-11-2024 | 44, 96 | |||||
| 116-15-4 | 204-127-4 | hexafluorpropeen | hexafluoropropene | Ja | gO.1 | 20 mg/Nm3 | 15-11-2024 | 44, 96 | |||||
| 48122-14-1 | 256-356-4 | hexahydro-1-methylftaalzuur-anhydride | hexahydro-1-methylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 57110-29-9 | 260-566-1 | hexahydro-3-methylftaalzuur-anhydride | hexahydro-3-methylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85-42-7 | 201-604-9 | hexahydroftaalzuur-anhydride | cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14166-21-3 | 238-009-9 | hexahydroftaalzuur-anhydride (trans-isomeer) | trans-cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 186406-49-5 | 110-668-6 | hexakis(1H,1H,8H-tetradecafluoroctyloxy)fosfazijn | HEXAKIS(1H,1H,8H-TETRADECAFLUOROOCTYLOXY)PHOSPHAZI | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 680-31-9 | 211-653-8 | hexamethylfosforamide | hexamethylphosphoric triamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12005-92-4 | 234-476-8 | holmium arsenide | holmium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7803-57-8 | 616-584-0 | hydraten van hydrazine | hydrates of hydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 302-01-2 | 206-114-9 | hydrazine | hydrazine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 13255-48-6 | 629-465-3 | hydrazine acetaat | hydrazine acetate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | |||||
| 13537-45-6 | hydrazine difluoride | hydrazine difluoride | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | ||||||
| 23268-00-0 | 245-543-6 | hydrazine dihydrobromide | hydrazine dihydrobromide | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | |||||
| 5341-61-7 | 226-283-2 | hydrazine dihydrochloride | hydrazine dihydrochloride | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | |||||
| 13464-98-7 | hydrazine dinitraat | hydrazine, dinitrate | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 69 | |||||||
| 23488-13-3 | hydrazine fosfaat | hydrazine phosphate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | ||||||
| 102096-80-0 | 694-328-7 | hydrazine hydraat-D6 | hydrazine hydrate-D6 | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 10217-52-4 | 600-285-7 | hydrazine monohydraat | hydrazine monohydrate | Ja | MVP 2 | 1 mg/Nm3 | 17-1-2022 | 57, 107 | |||||
| 27978-54-7 | hydrazine perchloraat | hydrazine perchlorate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | ||||||
| 73506-32-8 | hydrazine selenaat | hydrazine selenate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | ||||||
| 1184-66-3 | hydrazine sulfaat | hydrazine sulfate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | ||||||
| 88491-70-7 | 685-833-3 | hydrazine sulfaat-15N2 | hydrazine sulfate-15N2 | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 634-62-8 | 211-211-4 | hydrazine tartraat | hydrazine tartrate | Ja | MVP 2 | 1 mg/Nm3 | 9-2-2022 | 57, 112 | |||||
| 287488-18-0 | 687-243-1 | hydrazine-15N2 di-waterstofchloride | hydrazine-15N2 dihydrochloride | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 145571-73-9 | 685-220-0 | hydrazine-15N2 monohydraat | hydrazine-15N2 monohydrate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 148434-03-1 | 405-030-1 | hydrazinebis(3-carboxy-4-hydroxybenzeensulfonaat) | hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 312623-95-3 | 685-231-0 | hydrazine-D4 di-deuteriumchloride | hydrazine-D4 dideuteriochloride | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 4682-01-3 | 414-850-9 | hydrazine-tri-nitromethaan | hydrazine-tri-nitromethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 7335-65-1 | 230-845-2 | hydrazinium acetaat | hydrazinium acetate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 13775-80-9 | 237-412-7 | hydrazinium bromide | hydrazinium bromide | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 2644-70-4 | 220-154-4 | hydrazinium chloride | hydrazinium chloride | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 13464-97-6 | 236-690-7 | hydrazinium nitraat | hydrazinium nitrate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 10034-93-2 | 233-110-4 | hydrazinium(2+)sulfaat | hydrazinium(2+) sulphate | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 57 | |||||
| 122-66-7 | 204-563-5 | hydrazobenzeen | hydrazobenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 86676-91-7 | 626-171-7 | hydrogen peroxide--nikkel--water (1/1/1) | hydrogen peroxide--nickel--water (1/1/1) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 52806-53-8 | 641-868-6 | hydroxyflutamide | hydroxyflutamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 677-93-0 | 211-645-4 | icosafluor-10-jood-2-(trifluormethyl)decaan | icosafluoro-10-iodo-2-(trifluoromethyl)decane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 7321-53-1 | 230-794-6 | ijzer tris(2-ethylhexaanzuur) | iron tris(2-ethylhexanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-5-2024 | 84 | |||||
| 10102-50-8 | 233-275-2 | ijzer(II)arsenaat | iron bis(arsenate) | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 10102-49-5 | 233-274-7 | ijzer(III)arsenaat | ferric arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 63989-69-5 | ijzer(III)arseniet | ferric arsenite, basic | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | ||||||
| 6585-53-1 | ijzer; ijzer(3+); methyldioxido-oxo-$l^{5}-arseen | iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12044-16-5 | 234-947-8 | ijzerarsenide | iron arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12006-21-2 | 234-485-7 | ijzerdiarsenide | iron diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 5968-84-3 | 227-759-2 | ijzertris(dimethylarsinaat) | iron tris(dimethylarsinate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 109201-26-5 | 625-386-3 | imidazoliumdichromaat | imidazolium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 288-32-4 | 206-019-2 | imidazool | imidazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-9-2015 | ||||||
| in water onoplosbare zouten van arseenzuur | water-insoluble salts of arsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||||
| in water oplosbare zouten van arseenzuur | water-soluble salts of arsenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||||
| 95-13-6 | 202-393-6 | indeen | indene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 193-39-5 | 205-893-2 | indeno[1,2,3-cd]pyreen | indeno[1,2,3-cd]pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1303-11-3 | 215-115-3 | indium arsenide | indium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 57, 92 | |||||
| 22398-80-7 | 244-959-5 | indium fosfide | indium phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 173584-44-6 | 605-683-4 | indoxacarb | indoxacarb | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 125225-28-7 | 603-038-1 | ipconazool | ipconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | |||||
| 75-28-5 | 200-857-2 | isobutaan | isobutane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 32 | |||||
| 59571-08-3 | 261-812-0 | isobutyl (Z,Z)-10,10-dibutyl-2-methyl-5,8,12-trioxo-4,9,11-trioxa-10-stannapentadeca-6,13-dieen-15-oaat | isobutyl (Z,Z)-10,10-dibutyl-2-methyl-5,8,12-trioxo-4,9,11-trioxa-10-stannapentadeca-6,13-dien-15-oate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 4247-02-3 | 224-208-8 | isobutyl 4-hydroxybenzoaat | isobutyl 4-hydroxybenzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 81 | |||||
| 542-56-3 | 208-819-7 | isobutylnitriet | isobutyl nitrite | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| isocyanatobenzotrifluoriden | isocyanato benzotrifluorides | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 465-73-6 | 207-366-2 | isodrin | isodrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 26675-46-7 | 247-897-7 | isofluraan | isoflurane | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 27253-41-4 | 248-376-7 | isononaanzuur, loodzout | isononanoic acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 14, 57 | ||||||
| 11066-49-2 | 234-284-4 | isononylfenol | isononylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 57 | |||||
| 123116-17-6 | isooctaanzuur, pentadecafluor - | isooctanoic acid, pentadecafluoro- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| iso-octyl/nonyl-fenyl-polyglycolether (met 5 ethyleenoxide-eenheden) | Iso-octyl/nonyl-phenyl-polyglycol ether (with 5 ethylene oxide units) | gO.2 | 50 mg/Nm3 | 19-8-2024 | 44, 69 | ||||||||
| 78-79-5 | 201-143-3 | isopreen | isoprene (stabilised) | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 881685-58-1 | 632-619-2 | isopyrazam | isopyrazam | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 119-65-3 | 204-341-8 | isoquinoline | isoquinoline | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 11 | ||||||
| 141112-29-0 | 604-222-4 | isoxaflutool | isoxaflutole | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 127421-77-6 | 105-908-1 | jodotris(mesityl)lood | IODOTRIS(MESITYL)LEAD | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 127 | ||||||
| 676-75-5 | 211-630-2 | joodimethylarsine | iododimethylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 75-60-5 | 200-883-4 | kakodylzuur | cacodylic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 29420-49-3 | 249-616-3 | kalium 1,1,2,2,3,3,4,4,4-nonafluorbutaan-1-sulfonaat | potassium 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 444-340-1 | kalium 2-(3-trifluormethoxy-1,1,2,2,3,3-hexafluorpropoxy)-2,3,3,3-tetrafluorpropionaat | potassium 2-(3-trifluoromethoxy-1,1,2,2,3,3-hexafluoropropoxy)-2,3,3,3-tetrafluoropropionate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 67118-55-2 | 266-578-3 | kalium 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)propanoaat | potassium 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2019 | 96 | ||||
| 83310-58-1 | 280-373-6 | kalium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecanoaat | Potassium 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 17218-47-2 | 625-130-0 | kalium hexafluornikkelaat(IV) | potassium hexafluoronickelate(IV) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 21049-36-5 | kalium perfluorheptanoaat | potassium perfluoroheptanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 81, 96 | |||||
| 3871-99-6 | 223-393-2 | kalium perfluorhexaan-1-sulfonaat | potassium perfluorohexane-1-sulphonate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | ||||
| 183196-57-8 | 418-260-2 | kalium-1-methyl-3-morfolinocarbonyl-4-[3-(1-methyl-3-morfolinocarbonyl-5-oxo-2-pyrazoline-4-ylideen)-1-propenyl]pyrazool-5-olaat [met 0,5 procent of meer N,N-dimethylformamide (EC Nr 200-679-5)] | potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate, [containing ≥ 0.5 % N,N-dimethylformamide (EC No 200-679-5)] | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 10124-50-2 | 233-337-9 | kaliumarsenaat | potassium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 13464-35-2 | 236-680-2 | kaliumarseniet | potassium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 20-12-2021 | 57, 92 | |||||
| 7758-01-2 | 231-829-8 | kaliumbromaat | potassium bromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16037-50-6 | 240-174-7 | kaliumchloortrioxochromaat | potassium chlorotrioxochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 7789-00-6 | 232-140-5 | kaliumchromaat | potassium chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 7778-50-9 | 231-906-6 | kaliumdichromaat | potassium dichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 7784-41-0 | 232-065-8 | kaliumdihydroarsenaat | potassium dihydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 21416-85-3 | 881-273-0 | kaliumdimethylarsinaat | potassium dimethylarsinate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 2795-39-3 | 220-527-1 | kaliumheptadecafluoroctaan-1-sulfonaat | potassium heptadecafluorooctane-1-sulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||
| 17029-22-0 | 241-102-7 | kaliumhexafluorarsenaat | potassium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 591-89-9 | 209-735-3 | kalium-kwikcyanide | mercury potassium cyanide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 7783-33-7 | 231-990-4 | kalium-kwikjodide | potassium mercuric iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 13355-00-5 | 236-405-6 | kaliummelarsonyl | melarsonyl potassium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7778-73-6 | 231-911-3 | kaliumpentachloorfenolaat | potassium pentachlorophenolate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 57 | |||||
| 2395-00-8 | 219-248-8 | kaliumperfluoroctanoaat | potassium perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 8008-20-6 | 232-366-4 | kerosine | kerosene | 24-4-2023 | 4, 80 | ||||||||
| 64742-81-0 | 265-184-9 | kerosine (aardolie), met waterstof ontzwaveld | kerosine (petroleum), hydrodesulfurized | 19-5-2021 | 4, 80 | ||||||||
| 92045-37-9 | 295-418-5 | kerosine (aardolie), uit directe fractionering verkregen ruime fractie | kerosine (petroleum), straight-run wide-cut | 24-4-2023 | 4, 80 | ||||||||
| 65277-42-1 | 265-667-4 | ketoconazool | ketoconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68784-75-8 | 272-271-5 | kiezelzuur (H2Si2O5), bariumzout (1:1), gedoteerd met lood | silicic acid (H2Si2O5), barium salt (1:1), lead-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 68784-76-9 | kiezelzuur (H4SiO4), magnesium-mangaan(2+) zinkzout, arseen- en loodgedoopt | silicic acid (H4SiO4), magnesium manganese(2+) zinc salt, arsenic and lead-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 68957-75-5 | kiezelzuur (H4SiO4), tetraethylester, polymeer met arseenoxide (As2O3) | silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 93925-42-9 | 300-344-4 | kiezelzuur (H4SiO4), tetraethylester, reactieproducten met bis(acetyloxy)dibutylstannaan | silicic acid (H4SiO4), tetraethyl ester, reaction products with bis(acetyloxy)dibutylstannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 68611-46-1 | 271-895-5 | kiezelzuur (H4SiO4), zinkzout (1:2), arseen- en mangaan-gedoteerd | silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 11120-22-2 | 234-363-3 | kiezelzuur loodzout | silicic acid, lead salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 37321-15-6 | 253-461-7 | kiezelzuur nikkelzout | silicic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11113-70-5 | 234-347-6 | kiezelzuur, chroom loodzout | silicic acid, chromium lead salt | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 68130-19-8 | kiezelzuur, loodnikkelzout | silicic acid, lead nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||||
| 102184-95-2 | 310-077-5 | kiezelzuur, zirkoniumzout, ingekapseld cadmiumpigment | silicic acid, zirconium salt, cadmium pigment-encapsulated | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 86 | ||||||
| 7440-48-4 | 231-158-0 | kobalt | cobalt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-3-2020 | 52 | |||||
| 136-52-7 | 205-250-6 | kobalt bis(2-ethylhexanoaat) | cobalt bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 60459-08-7 | 628-130-9 | kobalt(II)sulfaat, hydraat | cobalt (II) sulfate, hydrate | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 57, 69 | ||||||
| 91782-60-4 | 295-032-7 | kobalt, boraat 2-ethylhexanoaat complexen | cobalt, borate 2-ethylhexanoate complexes | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 71-48-7 | 200-755-8 | kobaltacetaat | cobalt(II) diacetate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 67 | ||||
| 27016-73-5 | 248-168-6 | kobaltarsenide | cobalt arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12044-42-7 | kobaltarsenide (CoAs2) | cobalt arsenide (CoAs2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12256-04-1 | kobaltarsenide (CoAs3) | cobalt arsenide (CoAs3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 513-79-1 | 208-169-4 | kobaltcarbonaat | cobalt(II) carbonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 67 | ||||
| 7646-79-9 | 231-589-4 | kobaltdichloride | cobalt dichloride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 67 | ||||
| 72861-19-9 | kobaltdichloride decahydraat | cobalt dichloride decahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 16544-92-6 | kobaltdichloride dihydraat | cobalt chloride (CoCl2), dihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 7791-13-1 | 616-574-6 | kobaltdichloride hexahydraat | cobalt(II) chloride hexahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | |||||
| 69098-14-2 | 628-677-3 | kobaltdichloride hydraat | cobalt dichloride hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | |||||
| 146998-10-9 | kobaltdichloride hydraat (3:22) | cobalt dichloride hydrate (3:22) | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 18201-52-0 | kobaltdichloride monohydraat | cobalt chloride (CoCl2), monohydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 20579-56-0 | kobaltdichloride pentahydraat | cobalt dichloride pentahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 16890-89-4 | kobaltdichloride tetrahydraat | cobalt dichloride tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 65374-82-5 | kobaltdichloride trihydraat | cobalt dichloride trihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-5-2019 | 56, 57 | ||||||
| 68016-03-5 | 268-169-5 | kobaltdimolybdeennikkeloctaoxide | cobalt dimolybdenum nickel octaoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 182442-95-1 | 695-690-9 | kobalt-lithium-mangaan-nikkeloxide | cobalt lithium manganese nickel oxide | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 34, 57, 126 | ||||||
| 131344-56-4 | 442-750-5 | kobaltlithiumnikkeloxide | cobalt lithium nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68186-89-0 | 269-051-6 | kobaltnikkel grijze periklaas | cobalt nickel gray periclase | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 58591-45-0 | 261-346-8 | kobaltnikkeldioxide | cobalt nickel dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 951-904-5 | kobalt-nikkel-mangaanoxide | Cobalt Nickel Manganese Oxide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | |||||||
| 12737-30-3 | 620-395-9 | kobaltnikkeloxide | cobalt nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10141-05-6 | 233-402-1 | kobaltnitraat | cobalt nitrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 67 | ||||
| 10124-43-3 | 233-334-2 | kobaltsulfaat | cobalt sulphate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 67 | ||||
| koelgas | refrigerant gas | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98, 103 | |||||||
| 630-08-0 | 211-128-3 | koolmonoxide | carbon monoxide | Ja | 2-12-2013 | 17 | |||||||
| 94114-48-4 | 302-683-3 | koolvloeistoffen, vloeibaar solvent-extracten | coal liquids, liq. solvent extn. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 63 | |||||
| 94114-47-3 | 302-682-8 | koolvloeistoffen, vloeibaar solventextractie oplossing | Coal liquids, liq. solvent extn. soln. | Ja | 2-12-2013 | 4, 63 | |||||||
| 919-284-0 | koolwaterstoffen C10, aromatisch, >1% naftaleen | hydrocarbons, C10, aromatics, >1% naphthalene | MVP 1 | 0,05 mg/Nm3 | 19-5-2021 | 80, 82 | |||||||
| 97722-08-2 | 307-757-9 | koolwaterstoffen C11-17-, solvent-geëxtraheerde lichte naftenische | hydrocarbons, C11-17, solvent-extd. light naphthenic | Ja | 2-12-2013 | 4, 64 | |||||||
| 97675-86-0 | 307-660-1 | koolwaterstoffen C12-20-, waterstofbehandelde parafinische, lichte destillatiefracties | hydrocarbons, C12-20, hydrotreated paraffinic, distn. lights | Ja | 2-12-2013 | 4, 64 | |||||||
| 68527-16-2 | 271-259-7 | koolwaterstoffen C1-3 | hydrocarbons, C1-3 | Ja | 2-12-2013 | 4, 60 | |||||||
| 95371-04-3 | 305-971-7 | koolwaterstoffen C13-30-, rijk aan aromaten met solvent geëxtraheerd naftenisch destillaat | hydrocarbons, C13-30, arom.-rich, solvent-extd. naphthenic distillate | Ja | 2-12-2013 | 4, 62 | |||||||
| 68514-31-8 | 271-032-2 | koolwaterstoffen C1-4 | hydrocarbons, C1-4 | Ja | 2-12-2013 | 4, 60 | |||||||
| 68527-19-5 | 271-261-8 | koolwaterstoffen C1-4, butaanverwijdering-fractie | hydrocarbons, C1-4, debutanizer fraction | Ja | 2-12-2013 | 4, 60 | |||||||
| 68514-36-3 | 271-038-5 | koolwaterstoffen C1-4-, stankvrij gemaakt | hydrocarbons, C1-4, sweetened | Ja | 2-12-2013 | 4, 60 | |||||||
| 97722-10-6 | 307-760-5 | koolwaterstoffen C14-19-, met oplosmiddel geëxtraheerde lichte naftenische | hydrocarbons, C14-29, solvent-extd. light naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 97675-85-9 | 307-659-6 | koolwaterstoffen C16-20-waterstofbehandeld middendestillaat, lichte destillatiefracties | hydrocarbons, C16-20, hydrotreated middle distillate, distn. lights | Ja | 2-12-2013 | 4, 64 | |||||||
| 95371-05-4 | 305-972-2 | koolwaterstoffen C16-32-, rijk aan aromaten met solvent geëxtraheerd naftenisch destillaat | hydrocarbons, C16-32, arom. rich, solvent-extd. naphthenic distillate | Ja | 2-12-2013 | 4, 62 | |||||||
| 97862-82-3 | 308-132-3 | koolwaterstoffen C17-30-, met waterstof behandelde destillaten lichte destillatiefracties | hydrocarbons, C17-30, hydrotreated distillates, distn. lights | Ja | 2-12-2013 | 4, 62 | |||||||
| 97675-87-1 | 307-661-7 | koolwaterstoffen C17-30-, waterstofbehandeld met oplosmiddel gedeasfalteerd residu van de atmosferische destillatie, lichte destillatiefracties | hydrocarbons, C17-30, hydrotreated solvent-deasphalted atm. distn. residue, distn. lights, | Ja | 2-12-2013 | 4, 62 | |||||||
| 97722-06-0 | 307-755-8 | koolwaterstoffen C17-40-, met waterstofbehandeld met oplosmiddel gedeasfalteerd destillatieresidu, lichte vacuümdestillatiefracties | hydrocarbons, C17-40, hydrotreated solvent-deasphalted distn. residue, vacuum distn. lights | Ja | 2-12-2013 | 4, 62 | |||||||
| 90640-95-2 | 292-617-9 | koolwaterstoffen C20-50-, met oplosmiddel van was ontdane zware paraffinische, met waterstof behandeld | hydrocarbons, C20-50, solvent dewaxed heavy paraffinic, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 93924-61-9 | 300-257-1 | koolwaterstoffen C20-50-, residuolie hydrogenering vacuümdestillaat | hydrocarbons, C20-50, residual oil hydrogenation vacuum distillate | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-70-0 | 308-289-8 | koolwaterstoffen C20-58-, met waterstof behandeld | hydrocarbons, C20-58, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 68606-25-7 | 271-734-9 | koolwaterstoffen C2-4- | hydrocarbons, C2-4 | Ja | 2-12-2013 | 4, 60 | |||||||
| 68476-49-3 | 270-689-2 | koolwaterstoffen C2-4, rijk aan C3 | hydrocarbons, C2-4, C3-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 97722-04-8 | 307-753-7 | koolwaterstoffen C26-55, rijk aan aromaten | hydrocarbons C26-55, arom-rich | Ja | 2-12-2013 | 4 | |||||||
| 97862-81-2 | 308-131-8 | koolwaterstoffen C27-42-, gedearomatiseerd | hydrocarbons, C27-42, dearomatized | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-71-1 | 308-290-3 | koolwaterstoffen C27-42-, naftenisch | hydrocarbons, C27-42, naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 97926-68-6 | 308-287-7 | koolwaterstoffen C27-45-, gedearomatiseerd | hydrocarbons, C27-45, dearomatized | Ja | 2-12-2013 | 4, 62 | |||||||
| 97862-83-4 | 308-133-9 | koolwaterstoffen C27-45-, naftenische vacuümdestillatie | hydrocarbons, C27-45, naphthenic vacuum distn. | Ja | 2-12-2013 | 4, 62 | |||||||
| 68606-26-8 | 271-735-4 | koolwaterstoffen C3- | hydrocarbons, C3 | Ja | 2-12-2013 | 4, 60 | |||||||
| 68476-46-0 | 270-686-6 | koolwaterstoffen C3-11, destillaten uit katalytische kraker | hydrocarbons, C3-11, catalytic cracker distillates | Ja | 2-12-2013 | 4, 65 | |||||||
| 68476-40-4 | 270-681-9 | koolwaterstoffen C3-4 | hydrocarbons, C3-4 | Ja | 2-12-2013 | 4, 60 | |||||||
| 68512-91-4 | 270-990-9 | koolwaterstoffen C3-4-rijk aardoliedestillaat | hydrocarbons, C3-4-rich, petroleum distillate | Ja | 2-12-2013 | 4, 60 | |||||||
| 102110-14-5 | 310-012-0 | koolwaterstoffen C3-6-, rijk aan C5, stoomgekraakte nafta | hydrocarbons, C3-6, C5-rich, steam-cracked naphtha | Ja | 2-12-2013 | 4, 65 | |||||||
| 95371-08-7 | 305-975-9 | koolwaterstoffen C37-65-, met waterstof behandelde van asfalt ontdane vacuümdestillatieresiduen | hydrocarbons, C37-65, hydrotreated deasphalted vacuum distn. residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 95371-07-6 | 305-974-3 | koolwaterstoffen C37-68-, van was en asfalt ontdane met waterstof behandelde vacuümdestillatieresiduen | hydrocarbons, C37-68, dewaxed deasphalted hydrotreated vacuum distn. residues | Ja | 2-12-2013 | 4, 62 | |||||||
| 87741-01-3 | 289-339-5 | koolwaterstoffen C4- | hydrocarbons, C4 | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-23-3 | 295-405-4 | koolwaterstoffen C4-, stoomkrakerdestillaat | hydrocarbons, C4, steam-cracker distillate | Ja | 2-12-2013 | 4, 60 | |||||||
| 95465-89-7 | 306-004-1 | koolwaterstoffen C4-, vrij van 1,3-butadieen en isobuteen | hydrocarbons, C4, 1,3-butadiene- and isobutene-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 92045-63-1 | 295-445-2 | koolwaterstoffen C4-11-, naftakraken aromaatvrij | hydrocarbons, C4-11, naphtha-cracking, arom.-free | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-61-9 | 295-443-1 | koolwaterstoffen C4-12-, naftakraken waterstofbehandeld | hydrocarbons, C4-12, naphtha-cracking, hydrotreated | Ja | 2-12-2013 | 4, 65 | |||||||
| 68476-42-6 | 270-682-4 | koolwaterstoffen C4-5- | hydrocarbons, C4-5 | Ja | 2-12-2013 | 4, 60 | |||||||
| 91995-38-9 | 295-298-4 | koolwaterstoffen C4-6-, lichte fracties pentaanverwijdering, aromatische waterstofbehandelaar | hydrocarbons, C4-6, depentanizer lights, arom. hydrotreater | Ja | 2-12-2013 | 4, 65 | |||||||
| 93572-36-2 | 297-466-2 | koolwaterstoffen C5-11-, rijk aan niet-aromaten lichte fractie uit reforming | hydrocarbons, C5-11, nonaroms.-rich, reforming light fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 93763-33-8 | 297-852-0 | koolwaterstoffen C6-11-, waterstofbehandeld gedearomatiseerd | hydrocarbons, C6-11, hydrotreated, dearomatized | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-64-2 | 295-446-8 | koolwaterstoffen C6-7, naftakraken oplosmiddelgeraffineerd | hydrocarbons, C6-7, naphtha-cracking, solvent-refined | Ja | 2-12-2013 | 4, 65 | |||||||
| 101316-66-9 | 309-870-9 | koolwaterstoffen C6-8-, gehydrogeneerde, door sorptie gedearomatiseerde, tolueenraffinage | hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination | Ja | 2-12-2013 | 4, 65 | |||||||
| 93572-35-1 | 297-465-7 | koolwaterstoffen C7-12-, rijk aan C groter dan 9aromaten zware fractie uit reforming | hydrocarbons, C7-12, C≥9-arom.-rich, reforming heavy fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-62-0 | 295-444-7 | koolwaterstoffen C8-11-, naftakraken tolueenfractie | hydrocarbons, C8-11, naphtha-cracking, toluene cut | Ja | 2-12-2013 | 4, 65 | |||||||
| 101794-97-2 | 309-974-4 | koolwaterstoffen C8-12-, destillaten uit katalytische kraker | hydrocarbons, C8-12, catalytic cracker distillates | Ja | 2-12-2013 | 4, 65 | |||||||
| 92128-94-4 | 295-794-0 | koolwaterstoffen C8-12-, katalytisch gekraakte, chemisch geneutraliseerde | hydrocarbons, C8-12, catalytic-cracking, chem. neutralized | Ja | 2-12-2013 | 4, 65 | |||||||
| 93763-34-9 | 297-853-6 | koolwaterstoffen C9-12-, waterstofbehandeld gedearomatiseerd | hydrocarbons, C9-12, hydrotreated, dearomatized | Ja | 2-12-2013 | 4, 65 | |||||||
| 93763-38-3 | 297-857-8 | koolwaterstoffen met waterstof gekraakte paraffine-houdende destillatieresiduen met solvent van was ontdaan | hydrocarbons, hydrocracked paraffinic distn. residues, solvent-dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 68476-55-1 | 270-695-5 | koolwaterstoffen rijk aan C5 | hydrocarbons, C5-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 102110-15-6 | 310-013-6 | koolwaterstoffen rijk aan C5, dicyclopentadieen bevattend | hydrocarbons, C5-rich, dicyclopentadiene-contg. | Ja | 2-12-2013 | 4, 65 | |||||||
| 101316-67-0 | 309-871-4 | koolwaterstoffen rijk aan C6, waterstofbehandelde lichte naftadestillaten oplosmiddelgeraffineerd | hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-55-1 | 295-436-3 | koolwaterstoffen waterstofbehandelde lichte naftadestillaten oplosmiddelgeraffineerd | hydrocarbons, hydrotreated light naphtha distillates, solvent-refined | Ja | 2-12-2013 | 4, 65 | |||||||
| 68476-50-6 | 270-690-8 | koolwaterstoffen, C≥5, rijk aan C5-6 | hydrocarbons, C≥5, C5-6-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 1189173-42-9 | 918-811-1 | koolwaterstoffen, C10, aromaten, <1% naftaleen | hydrocarbons, C10, aromatics, <1% naphthalene | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 72, 82 | ||||||
| 922-153-0 | koolwaterstoffen, C10-C13, aromaten, <1% naftaleen | hydrocarbons, C10-C13, aromatics, <1% naphthalene | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 72, 82 | |||||||
| 97722-09-3 | 307-758-4 | koolwaterstoffen, C13-27-, met oplosmiddel geëxtraheerde lichte naftenische | hydrocarbons, C13-27, solvent-extd. light naphthenic | Ja | 2-12-2013 | 4, 62 | |||||||
| 68476-47-1 | 270-687-1 | koolwaterstoffen, C2-6-, katalytische reformer C6-8 | hydrocarbons, C2-6, C6-8 catalytic reformer | Ja | 2-12-2013 | 4, 65 | |||||||
| 101896-28-0 | 309-987-5 | koolwaterstoffen, C8-12-, katalytisch gekraakte, chemisch geneutraliseerde, stankvrij gemaakte | hydrocarbons, C8-12, catalytic cracking, chem. neutralized, sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 100801-65-8 | 309-748-5 | koolwaterstofoliën aromatisch gemengd met polyethyleen gepyrolyseerd lichte oliefractie | hydrocarbon oils, arom., mixed with polyethylene, pyrolyzed, light oil fraction | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 61, 63 | |||||
| 100801-66-9 | 309-749-0 | koolwaterstofoliën aromatisch gemengd met polystyreen gepyrolyseerd lichte oliefractie | hydrocarbon oils, arom., mixed with polystyrene, pyrolyzed, light oil fraction | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 61, 63 | |||||
| 100801-63-6 | 309-745-9 | koolwaterstofoliën, aromatisch, gemengd met polyethyleen en polypropyleen gepyrolyseerd lichte oliefractie | hydrocarbon oils, arom., mixed with polyethylene and polypropylene, pyrolyzed, light oil fraction | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 61, 63 | |||||
| 16337-84-1 | 240-408-8 | koolzuur nikkelzout | carbonic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16509-22-1 | 240-574-1 | koper diarseniet | copper diarsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 68411-07-4 | 942-164-4 | koper lood resorcylzuur salicylzuur complex | copper lead resorcylate salicylate complex | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||
| 12002-03-8 | 601-658-7 | koperacetoarseniet | copper acetoarsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 10290-12-7 | 233-644-8 | koperarseniet | copper arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 13548-42-0 | 236-922-7 | koperchromaat | copper chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 932-902-3 | koper-nikkel-mangaanoxide | copper-nickel-manganese-oxide | MVP 1 | 20-8-2024 | 34, 57 | ||||||||
| 14808-60-7 | 238-878-4 | kwarts | quartz (SiO2) | sA.2 | 0,5 mg/Nm3 | 19-5-2021 | 44, 83 | ||||||
| 7439-97-6 | 231-106-7 | kwik | mercury | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 10415-75-5 | 233-886-4 | kwik(I)nitraat | mercury(I) nitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 7784-37-4 | 232-062-1 | kwik(II)arsenaat | mercury(II)arsenate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 57, 92 | ||||
| 7487-94-7 | 231-299-8 | kwik(II)chloride | mercury(II) chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 10045-94-0 | 233-152-3 | kwik(II)nitraat | mercury(II) nitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 7783-35-9 | 231-992-5 | kwik(II)sulfaat | mercury(II) sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 1600-27-7 | 216-491-1 | kwikacetaat | mercury acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 583-15-3 | 209-499-1 | kwikbenzoaat | mercury benzoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| kwikbromiden | mercury bromides | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||||
| 592-04-1 | 209-741-6 | kwikcyanide | mercury dicyanide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 628-86-4 | 211-057-8 | kwikfulminaat | mercury fulminate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 63937-14-4 | kwikgluconate | mercury gluconate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 7783-30-4 | 231-988-3 | kwikjodide | mercury iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 12002-19-6 | kwiknucleaat | mercury nucleate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 1191-80-6 | 214-741-4 | kwikoleaat | mercury oleate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 21908-53-2 | 244-654-7 | kwikoxide | mercury oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 1335-31-5 | 215-629-8 | kwikoxycyanide | mercury cyanide oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 5970-32-1 | 227-760-8 | kwiksalicylaat | mercury salicylate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | ||||
| 592-85-8 | 209-773-0 | kwikthiocyanaat | mercury(II) thiocyanate | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| kwikverbindingen | mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 122384-78-5 | 310-191-5 | lagetemperatuurkoolteerolie, alkalische | low temperature tar oil, alkaline | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 91465-08-6 | 415-130-7 | lambda-cyhalothrin | lambda-cyhalothrin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 103577-45-3 | 627-144-2 | lansoprazool | lansoprazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 12255-04-8 | 235-502-0 | lanthaanarsenide | lanthanum arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 75706-12-6 | 616-254-6 | leflunomide | leflunomide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 93841-79-3 | 299-051-1 | leucomycine V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyraan-2-yl]-, [9(5S,6R)]-, [1,2-ethaandiylbis(imino-4,1-fenyleen)]bis[arsonaat] (1:1) (zout) | leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 65996-78-3 | 266-012-5 | lichte olie (kool), cokesoven | light oil (coal), coke-oven | Ja | 2-12-2013 | 4, 61 | |||||||
| 90641-11-5 | 292-635-7 | lichte olie (kool), semi-verkooksingsproces | light oil (coal), semi-coking process | Ja | 2-12-2013 | 4, 61 | |||||||
| 8032-32-4 | 232-453-7 | ligroïne | ligroine | Ja | 2-12-2013 | 4, 65 | |||||||
| lineaire en vertakte perfluorcarbonzuren met de formule CnF2n+1-C(= O)OH, waarbij n = 8, 9, 10, 11, 12 of 13 (C9-C14-PFCA’s), met inbegrip van zouten daarvan en alle combinaties van deze producten. Aan C9-C14-PFCA verwante stoffen die een rechtstreeks met een ander koolstofatoom verbonden perfluorgroep met de formule CnF2n+1 hebben, waarbij n = 8, 9, 10, 11, 12 of 13, met inbegrip van de zouten en alle combinaties daarvan. Aan C9-C14-PFCA verwante stoffen die geen rechtstreeks met een ander koolstofatoom verbonden perfluorgroep met de formule CnF2n+1 hebben, waarbij n = 9, 10, 11, 12, 13 of 14, als een van de structurele elementen, met inbegrip van de zouten en alle combinaties daarvan. De volgende stoffen zijn van deze omschrijving uitgesloten: — CnF2n+1-X, waarbij X = F, Cl, of Br waarbij n = 9, 10, 11, 12, 13 of 14, met inbegrip van combinaties daarvan; — CnF2n+1-C(= O)OX' waarbij n> 13 en X' = elke groep, met inbegrip van zouten. | linear and branched perfluorocarboxylic acids of the formula CnF2n +1-C(= O)OH where n = 8, 9, 10, 11, 12, or 13 (C9-C14 PFCAs), including their salts, and any combinations thereof; Any C9-C14 PFCA-related substance having a perfluoro group with the formula CnF2n +1- directly attached to another carbon atom, where n = 8, 9, 10, 11, 12, or 13, including their salts and any combinations thereof; Any C9-C14 PFCA-related substance having a perfluoro group with the formula CnF2n +1- that it is not directly attached to another carbon atom, where n = 9, 10, 11, 12, 13 or 14 as one of the structural elements, including their salts and any combinations thereof. The following substances are excluded from this designation — CnF2n +1-X, where X = F, Cl, or Br where n = 9, 10, 11, 12, 13 or 14, including any combinations thereof, — CnF2n +1-C(= O)OX' where n> 13 and X'=any group, including salts. | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 330-55-2 | 206-356-5 | linuron | linuron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 29935-35-1 | 249-963-0 | lithium hexafluorarsenaat | lithium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-1-2023 | 57, 92 | |||||
| 193214-24-3 | 803-110-4 | lithium nikkel kobalt aluminium oxide | lithium nickel cobalt aluminium oxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 113066-89-0 | 802-308-8 | lithium nikkel kobaltoxide | Lithium nickel cobaltoxide | MVP 1 | 0,05 mg/Nm3 | 18-1-2023 | 34, 57 | ||||||
| 346417-97-8 | 620-032-4 | lithium nikkel mangaan kobaltoxide | lithium nickel manganese cobalt oxide | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 13977-83-8 | 881-474-3 | lithium nikkel(II) fosfaat | lithium nickel(II) phosphate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 131651-65-5 | 671-827-8 | lithium perfluorbutaansulfonaat | lithium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 14307-35-8 | 238-244-7 | lithiumchromaat | lithium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 52478-50-9 | 630-438-3 | lithiumdichromaat hydraat | lithium dichromate hydrate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 29457-72-5 | 249-644-6 | lithiumheptadecafluoroctaansulfonaat | lithium heptadecafluorooctanesulfonate | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||
| 178-915-0 | lithium-mangaan-nikkel-kobaltoxide (NMC85:05:10) | Lithium Manganese Nickel Cobalt Oxide (NMC85:05:10) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | |||||||
| 12031-65-1 | 620-400-4 | lithiumnikkeldioxide | lithium nickel dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 210352-95-7 | 842-029-9 | lithium-nikkel-kaliumoxide | Lithium nickel potassium oxide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 935-842-6 | lithium-nikkel-mangaan-kobalt-oxide | lithium-nickel-manganese-cobalt-oxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 193215-96-2 | 881-347-2 | lithiumnikkel-mangaan-kobaltoxide (LiNi0,4Mn0,4Co0,2O2) | lithium nickel manganese cobalt oxide (LiNi0.4Mn0.4Co0.2O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 179802-95-0 | 878-728-0 | lithiumnikkel-mangaan-kobaltoxide (LiNi0,8Mn0,1Co0,1O2) | lithium nickel manganese cobalt oxide (LiNi0.8Mn0.1Co0.1O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 7439-92-1 | 231-100-4 | lood | lead | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 941-184-0 | lood - goud gravimetrisch concentraat | lead - gold gravimetric concentrate | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 57 | |||||||
| 19183-30-3 | 687-870-0 | lood (IV) propionaat | lead (IV) propionat | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 57 | ||||||
| 20936-32-7 | 244-118-2 | lood 2,4-dihydroxybenzoaat | lead 2,4-dihydroxybenzoate | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | ||||||
| 933-268-0 | lood 4,6-dinitro-2-aminofenolaat | lead 4,6-dinitro-2-aminophenolate | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | |||||||
| 41453-50-3 | 255-375-5 | lood bis(2,4-dihydroxybenzoaat) | lead bis(2,4-dihydroxybenzoate) | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | ||||||
| 301-08-6 | 206-107-0 | lood bis(2-ethylhexanoaat) | lead bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | ||||||
| 62637-99-4 | 263-663-7 | lood bis(4-cyclohexylbutyraat) | lead bis(4-cyclohexylbutyrate) | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | ||||||
| 10101-63-0 | 233-256-9 | lood di-jodide | lead diiodide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 12034-88-7 | 234-814-4 | lood diniobium hexaoxide | lead diniobium hexaoxide | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 57 | ||||||
| 12060-01-4 | 235-039-4 | lood zirkonium trioxide | lead zirconium trioxide | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 2101242-86-6 | 836-029-8 | lood(1-), tri-jood-, waterstof, verbinding met N,N-dimethylformamide en methaanamine (1:1:1:1) | plumbate(1-), triiodo-, hydrogen, compd. with N,N-dimethylformamide and methanamine (1:1:1:1) | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 57 | ||||||
| 13406-89-8 | 236-498-3 | lood(2+) 2,4-dinitroresorcinolaat | lead(2+) 2,4-dinitroresorcinolate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 65121-76-8 | 265-460-9 | lood(2+) 4,6-dinitro-o-cresolaat | lead(2+) 4,6-dinitro-o-cresolate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 13845-35-7 | 237-573-3 | lood(2+) tellurium tetraoxide | lead(2+) tellurium tetraoxide | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 13453-65-1 | 603-832-8 | lood(2+)fosfonaat | lead(2+) phosphonate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 7488-51-9 | 231-300-1 | lood(2+)seleniet | lead(2+) selenite | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 4146-73-0 | 620-612-7 | lood(II) 2,2,2-trifluoracetaat | lead(II) 2,2,2-trifluoroacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57, 96 | |||||
| 100929-97-3 | 631-307-3 | lood(II) 2-hydroxy-2-methylpropionaat | lead(II) 2-hydroxy-2-methylpropionate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 605-758-1 | lood(II) methaansulfonaat | lead(II) methanesulfonate | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 57 | |||||||
| 17570-76-2 | 401-750-5 | lood(II)methaansulfonaat | lead(II) methanesulphonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 79120-33-5 | 634-758-4 | lood(II)oxide rood | lead(II) oxide red | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 207500-00-3 | 682-758-8 | lood(II)perchloraat hydraat | lead(II) perchlorate hydrate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 13453-62-8 | 638-754-3 | lood(II)perchloraat trihydraat | lead(II) perchlorate trihydrate | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 69029-51-2 | 273-795-7 | lood, antimoon, slakken | lead, antimonial, dross | Ja | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 57, 92 | |||||
| 97808-88-3 | 308-011-5 | lood, edelmetaal | lead, bullion | MVP 1 | 0,05 mg/Nm3 | 30-3-2022 | 14, 57 | ||||||
| 84929-97-5 | 284-577-6 | lood, isononanoaat naftenaatcomplexen | lead, isononanoate naphthenate complexes | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 90431-40-6 | 291-563-3 | lood, isononanoaat naftenaatcomplexen, basisch | lead, isononanoate naphthenate complexes, basic | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 69029-52-3 | 273-796-2 | lood, slakken | lead, dross | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 57 | ||||||
| 69029-45-4 | 273-791-5 | lood, slakken, antimoonrijk | lead, dross, antimony-rich | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 57 | ||||||
| 69029-46-5 | 273-792-0 | lood, slakken, bismutrijk | lead, dross, bismuth-rich | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 57 | ||||||
| 69227-11-8 | 273-925-2 | lood, slakken, koperrijk | lead, dross, copper-rich | MVP 1 | 0,05 mg/Nm3 | 31-3-2022 | 14, 57 | ||||||
| 15347-57-6 | 239-379-4 | loodacetaat | lead acetate | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57, 69 | ||||||
| 1335-32-6 | 215-630-3 | loodacetaat, basisch | lead, bis(acetato-O)tetrahydroxytri- | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14466-01-4 | 238-458-0 | loodacrylaat | lead acrylate | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 14, 57 | ||||||
| loodalkylen | lead alkyls | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 7784-40-9 | 232-064-2 | loodarsenaat | lead hydrogen arsenate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | |||
| loodarsenaten | lead arsenates | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57, 92 | |||||||
| 10031-13-7 | 233-083-9 | loodarseniet | lead arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 19-12-2021 | 57, 92 | |||||
| loodarsenieten | lead arsenites | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | |||||||
| 69985-35-9 | loodazide | lead azide | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56, 57 | ||||||
| 91053-49-5 | 293-314-4 | loodbevattende uitloogresten van zinkerts | leach residues, zinc ore, lead-contg. | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 14, 57 | ||||||
| 13814-96-5 | 237-486-0 | loodbis(tetrafluorboraat) | lead bis(tetrafluoroborate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25510-11-6 | 247-054-3 | loodcarbonaat | lead carbonate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | ||||||
| 931-722-2 | loodcarbonaat intermediair | lead carbonate intermediate | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | |||||||
| loodcarbonaten | lead carbonates | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | ||||||||
| 12612-47-4 | loodchloride | lead chloride | MVP 1 | 0,05 mg/Nm3 | 9-1-2022 | 14, 57 | |||||||
| 947-517-6 | loodchloride hydroxiden, terugwinningsproducten van de productie van lood- en bismutchemicaliën | lead chloride hydroxides, recovery products from lead and bismuth chemicals manufacturing | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | |||||||
| 7758-97-6 | 231-846-0 | loodchromaat | lead chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 12656-85-8 | 235-759-9 | loodchromaatmolybdaatsulfaat | lead chromate molybdate sulfate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 934-253-1 | loodconcentraat | lead concentrate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | |||||||
| 20837-86-9 | 244-073-9 | loodcyanamidaat | lead cyanamidate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 592-05-2 | 209-742-1 | loodcyanide | lead cyanide | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | ||||||
| 301-04-2 | 206-104-4 | looddiacetaat | lead di(acetate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 13424-46-9 | 236-542-1 | looddiazide | lead diazide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 10031-22-8 | 233-084-4 | looddibromide | lead dibromide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 7758-95-4 | 231-845-5 | looddichloride | lead dichloride | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 7783-46-2 | 231-998-8 | looddifluoride | lead difluoride | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 25659-31-8 | 247-168-3 | looddijodide | lead diiodate | MVP 1 | 0,05 mg/Nm3 | 9-1-2022 | 14, 57 | ||||||
| 15773-55-4 | 239-869-8 | looddilauraat | lead dilaurate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 1309-60-0 | 215-174-5 | looddioxide | lead dioxide | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | ||||||
| 6477-64-1 | 229-335-2 | looddipicraat | lead dipicrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 15748-73-9 | 239-839-4 | looddisalicylaat | lead disalicylate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 1072-35-1 | 214-005-2 | looddistearaat | lead distearate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 12065-68-8 | 235-065-6 | loodditantalum hexaoxide | lead ditantalum hexaoxide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 592-87-0 | 209-774-6 | looddithiocyanaat | lead dithiocyanate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 10099-79-3 | 233-248-5 | looddivanadium hexaoxide | lead divanadium hexaoxide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 934-416-7 | looderst, concentraten | lead ores, concentrates | MVP 1 | 0,05 mg/Nm3 | 28-2-2022 | 14, 57 | |||||||
| 942-155-5 | looderts concentraat | lead ore concentrate | MVP 1 | 0,05 mg/Nm3 | 28-2-2022 | 14, 57 | |||||||
| 15187-16-3 | 628-401-1 | loodftalocyanine | lead phthalocyanine | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 13698-55-0 | 237-220-3 | loodfumeraat | lead fumarate | MVP 1 | 0,05 mg/Nm3 | 9-1-2022 | 14, 57 | ||||||
| 25808-74-6 | 247-278-1 | loodhexafluorsilikaat | lead hexafluorosilicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 19783-14-3 | 243-310-3 | loodhydroxide | lead hydroxide | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 943-147-4 | lood-ijzer-titanium-bismut-kaliumoxide | lead-iron-titanium-bismuth-potassium oxide | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | |||||||
| 84195-61-9 | 282-366-3 | loodlegering | speiss, lead | Ja | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57, 92 | |||||
| 69011-60-5 | 273-701-4 | loodlegering, base, Pb,Sn, slakken | lead alloy, base, Pb,Sn, dross | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 14, 57 | ||||||
| 69011-59-2 | 273-700-9 | loodlegering, base, slakken. Schuim gevormd op het oppervlak van gesmoten lood-base legering. Inclusief de gevallen waarin aluminium is gebruikt om arseen, nikkel en antimoon te verwijderen. | Lead alloy, base, dross A scum formed on the surface of molten lead-base alloys. Includes those cases in which aluminum is used to remove arsenic, nickel and antimony. | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 10190-55-3 | 233-459-2 | loodmolybdaat | lead molybdate | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 1317-36-8 | 215-267-0 | loodmonoxide | lead monoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 98246-91-4 | 308-765-5 | lood-nikkel legering | speiss, lead, nickel-contg. | Ja | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 34, 57, 92 | |||||
| 10099-74-8 | 233-245-9 | loodnitraat | lead dinitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 1314-41-6 | 215-235-6 | loodoranje | orange lead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 1335-25-7 | 215-626-1 | loodoxide | lead oxide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 12036-76-9 | 234-853-7 | loodoxidesulfaat | lead oxide sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 13637-76-8 | loodperchloraat | lead perchlorate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | |||||||
| 25721-38-4 | 684-862-9 | loodpicraat (droog) | lead picrate (dry) | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 37240-96-3 | 253-421-9 | loodrhodiumoxide | dilead dirhodium heptaoxide | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 12069-00-0 | 235-109-4 | loodselenide | lead selenide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 12412-93-0 | 802-730-2 | loodselenide-telluride (PbSe0.5Te0.5) | Lead selenide telluride (PbSe0.5Te0.5) | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 127 | ||||||
| 22569-74-0 | 245-090-4 | loodsilicaat | lead silicate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 69029-58-9 | 273-800-2 | loodsmeltovenslakken | slags, lead reverbatory smelting | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 69029-84-1 | 273-825-9 | loodsmeltslakken | slags, lead smelting | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 15245-44-0 | 239-290-0 | loodstyfnaat | lead styphnate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 7446-14-2 | 231-198-9 | loodsulfaat | lead sulphate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | ||||||
| 951-962-1 | loodsulfaat, terugwinningsproduct uit koper- en zinkstof | lead sulphate, recovery product from copper and zinc dusts | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | |||||||
| loodsulfaten | lead sulphates | MVP 1 | 0,05 mg/Nm3 | 31-05-2016 | 14, 57 | ||||||||
| 1314-87-0 | 215-246-6 | loodsulfide | lead sulphide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 1344-37-2 | 215-693-7 | loodsulfochromaat | lead sulfochromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 815-84-9 | 212-426-6 | loodtartraat | lead tartrate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 1314-91-6 | 215-247-1 | loodtelluur | lead telluride | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 546-67-8 | 208-908-0 | loodtetraacetaat | lead tetraacetate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 13478-50-7 | 236-780-6 | loodthiosulfaat | Lead thiosulphate | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 12036-31-6 | 234-844-8 | loodtintrioxide | lead tin trioxide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 12060-00-3 | 235-038-9 | loodtitaniumtrioxide | lead titanium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 12626-81-2 | 235-727-4 | loodtitaniumzirconiumoxide | lead titanium zirconium oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 85536-79-4 | 287-565-9 | looduranaatpigment | lead uranate pigment | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| loodverbindingen | lead compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 18 | |||||||
| 15845-52-0 | 239-952-9 | loodwaterstoforthofosfaat | lead hydrogenorthophosphate | MVP 1 | 0,05 mg/Nm3 | 22-2-2022 | 14, 57 | ||||||
| 7759-01-5 | 231-849-7 | loodwolfraamtetraoxide | lead tungsten tetraoxide | MVP 1 | 0,05 mg/Nm3 | 2-3-2022 | 14, 57 | ||||||
| 103055-07-8 | 410-690-9 | lufenuron | lufenuron | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 12005-94-6 | 234-477-3 | lutetium arsenide | lutetium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 507453-86-3 | 671-826-2 | magnesium perfluorbutaansulfonaat | magnesium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 10103-50-1 | 233-285-7 | magnesiumarsenaat | magnesium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 117746-50-6 | magnesiumarsenaat, decahydraat | magnesium arsenate, decahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13423-61-5 | 236-540-0 | magnesiumchromaat | magnesium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 23371-94-0 | 621-186-5 | magnesiumchromaat hydraat | magnesium chromate hydrate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 14104-85-9 | 237-959-1 | magnesiumdichromaat | magnesium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 8018-01-7 | 616-995-5 | mancozeb | mancozeb | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | |||||
| 13434-24-7 | 236-562-0 | mangaan bis(2-ethylhexanoaat) | manganese bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 27526-45-0 | mangaanarsenaat | manganese arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12005-95-7 | 234-478-9 | mangaanarsenide | manganese arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12005-96-8 | mangaanarsenide (Mn2As) | manganese arsenide (Mn2As) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7784-38-5 | 232-063-7 | mangaanwaterstofarsenaat | manganese hydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 101-90-6 | 202-987-5 | m-bis(2,3-epoxypropoxy)benzeen | m-bis(2,3-epoxypropoxy)benzene | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | |||||
| 86347-14-0 | 811-718-6 | medetomidine | medetomidine | MVP 1 | 0,05 mg/Nm3 | 14-7-2025 | 81, 121 | ||||||
| meerwandige koolstofbuizen (synthetisch grafiet in buisvorm) met een geometrische buisdiameter ≥ 30 nm tot < 3 μm en een lengte ≥ 5 μm en een dimensieverhouding > 3:1, met inbegrip van meerwandige koolstofnanobuizen | multi-walled carbon tubes (synthetic graphite in tubular shape) with a geometric tube diameter range ≥ 30 nm to < 3 μm and a length ≥ 5 μm and aspect ratio > 3:1, including multi-walled carbon nanotubes | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 81 | |||||||
| 1417782-03-6 | 822-682-6 | mefentrifluconazool | mefentrifluconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 108-78-1 | 203-615-4 | melamine | melamine | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 81 | |||||
| 494-79-1 | 207-793-4 | melarsoprol | melarsoprol | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 700-161-3 | mengsel van (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)fosfaten, ammoniumzout | reaction mass of mixed (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) phosphates, ammonium salt | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 700-755-2 | mengsel van (3E)-1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluor-5-methoxyhept-3-een en (2E)-1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluor-4-methoxyhept-2-een en (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluor-3-methoxyhept-3-een | reaction mass of (3E)-1,1,1,2,2,3,4,5,6,6,7,7,7-tridecafluoro-5-methoxyhept-3-ene and (2E)-1,1,1,2,3,4,5,5,6,6,7,7,7-tridecafluoro-4-methoxyhept-2-ene and (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluoro-3-methoxyhept-3-ene | Ja | MVP 2 | 1 mg/Nm3 | 14-11-2024 | 96, 98 | ||||||
| 701-135-4 | mengsel van 1-(2,3-epoxypropoxy)-2,2-bis((2,3-epoxypropoxy)methyl)butaan en 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy) methyl)-2-hydroxymethylbutaan | reaction mass of 1-(2,3-epoxypropoxy)-2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy)methyl)-2-hydroxymethyl butane | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | ||||||
| 422-270-2 | mengsel van 1,1,2,3,3,3-hexafluor-1-methoxy-2-(trifluormethyl)propaan en 1,1,2,2,3,3,4,4,4-nonafluor-1-methoxybutaan | reaction mass of 1,1,2,3,3,3-hexafluoro-1-methoxy-2-(trifluoromethyl)propane and 1,1,2,2,3,3,4,4,4-nonafluoro-1-methoxybutane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 421-550-1 | mengsel van 1,3,5-tris(3-aminomethylfenyl)-1,3,5-(1H3H5H)-triazine-2,4,6-trion; mengsel van oligomeren van 3,5-bis(3-aminomethylfenyl)-1-poly[3,5-bis(3-aminomethylfenyl)-2,4,6-trioxo-1,3,5-(1H3H5H)-triazin-1-yl]-1,3,5-(1H3H5H)-triazine-2,4,6-trion | reaction mass of 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione; reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 911-694-8 | mengsel van 1,3-dioxaan-5-ol en 1,3-dioxolaan-4-ylmethanol | reaction mass of 1,3-dioxan-5-ol and 1,3-dioxolan-4-ylmethanol | Ja | MVP 2 | 1 mg/Nm3 | 10-1-2025 | 81 | ||||||
| 949-379-2 | mengsel van 1-methylpyrrolidine-2-one en poly(vinylideenfluoride) | reaction mass of 1-methylpyrrolidin-2-one and poly(vinylidene fluoride) | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | ||||||
| 473-390-7 | mengsel van 2,2,3,3,5,5,6,6-octafluor-4-(1,1,1,2,3,3,3-heptafluorpropaan-2-yl)morfoline en 2,2,3,3,5,5,6,6-octafluor-4-(heptafluorpropyl)morfoline | reaction mass of 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)morpholine and 2,2,3,3,5,5,6,6-octafluoro-4-(heptafluoropropyl)morpholine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 19-1-2023 | 81, 96 | |||||
| 947-368-7 | mengsel van 4,4'- [2,2,2-trifluor-1-(trifluormethyl) ethylideen]difenol en benzyltrifenylfosfonium, zout met 4,4'-[2,2,2-trifluor- 1-(trifluormethyl)ethylideen] difenol (1:1) | reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl) ethylidene]bis[phenol] (1:1) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81, 96 | |||||
| 943-265-6 | mengsel van 4,4'-[2,2,2-trifluor-1-(trifluormethyl) ethylideen]difenol en benzyl (diëthylamino)difenylfosfonium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyfenyl)propaan-2-yl] fenolaat (1:1) | reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate (1:1) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81, 96 | |||||
| 403-250-2 | mengsel van 4-[[bis-(4-fluorfenyl)methylsilyl]methyl]-4H-1,2,4-triazool en 1-[[bis-(4-fluorfenyl)methylsilyl]methyl]-1H-1,2,4-triazool | reaction mass of 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole and 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 700-927-7 | mengsel van 5-[(2R)-butaan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2R)-butaan-2-yl]-2-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2S)-butaan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2S)-butaan-2-yl]-2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan en 5-[(2S)-butaan-2-yl]-2-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxaan | reaction mass of 5-[(2R)-butan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2R)-butan-2-yl]-2-[(1R,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2S)-butan-2-yl]-2-[(1R,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2S)-butan-2-yl]-2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane and 5-[(2S)-butan-2-yl]-2-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2023 | 57 | ||||||
| 413-720-9 | mengsel van 5-sec-butyl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxaan en 5-sec-butyl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxaan | reaction mass of 5-sec-butyl-2-(2,4-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane and 5-sec-butyl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2022 | 57 | ||||||
| 939-191-9 | mengsel van amines, C10-14-vertakt en lineair alkyl, [1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) en amines, C10-14-vertakt en lineair alkyl, bis[1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) en amines, C10-14-vertakt en lineair alkyl, bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]chromaat(1-) | reaction mass of Amines, C10-14-branched and linear alkyl, [1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) and Amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) and Amines, C10-14-branched and linear alkyl, bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | |||||||
| 701-287-1 | mengsel van bariumchromaat, koperdichroomtetraoxide en koperoxide | reaction mass of barium chromate, copper dichromium tetraoxide and copper oxide | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | |||||||
| 957-225-0 | mengsel van benzeen en isopropylbenzeen | reaction mass of benzene and isopropylbenzene | MVP 2 | 1 mg/Nm3 | 22-9-2023 | 80, 82 | |||||||
| 935-119-5 | mengsel van cadmium sulfide (CdS), vaste oplossing met zinksulfide, gedoteerd met koperchloride en zinksulfide (ZnS), gedoteerd met zilverchloride en yttriumoxidesulfide (Y2O2S), gedoteerd met europium | blend of cadmium sulfide (CdS), solid soln. with zinc sulfide, copper chloride-doped and zinc sulfide (ZnS), silver chloride-doped and yttrium oxide sulfide (Y2O2S), europium-doped | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 57, 86 | |||||||
| mengsel van chloordifluormethaan en chloorpentafluorethaan | mixture of chlorodifluoromethane and chloropentafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 935-120-0 | mengsel van digadolinium-dioxidesulfide en cadmium-zinksulfide | blend of digadolinium dioxide sulphide and cadmium zinc sulphide | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 57, 86 | |||||||
| 909-880-9 | mengsel van di-ijzer trioxide en divanadium pentaoxide en nikkelmonoxide | reaction mass of diiron trioxide and divanadium pentaoxide and nickel monoxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 435-960-3 | mengsel van dimethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat, diethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat, methylethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat | reaction mass of dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate, diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate, methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 402-660-9 | mengsel van dinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatofenyl)pyrazool-4-yl)penta-2,4-dienylideen)-4,5-dihydro-5-oxopyrazool-1-yl)benzeensulfonaat en trinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatofenyl)pyrazool-4-yl)penta-2,4-dienylideen)-4,5-dihydro-5-oxopyrazool-1-yl)benzeensulfonaat | reaction mass of disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate and trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 915-270-3 | mengsel van DOTE en MOTE | reaction mass of 2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate and 2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-octyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate (reaction mass of DOTE and MOTE) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 91 | ||||||
| mengsel van ethyleenoxide en chloortetrafluorethaan | mixture of ethylene oxide and tetrafluoro chloroethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 28-11-2024 | 82, 104, 105 | ||||||
| mengsel van ethyleenoxide en dichloordifluormethaan | mixture of ethylene oxide and dichlorodifluoromethane | Ja | MVP 2 | 1 mg/Nm3 | 29-11-2024 | 82, 104 | |||||||
| mengsel van ethyleenoxide en kooldioxide | mixture of ethylene oxide and carbondioxide | Ja | MVP 2 | 1 mg/Nm3 | 29-11-2024 | 82, 104 | |||||||
| mengsel van ethyleenoxide en pentafluorethaan | mixture of ethylene oxide and pentafluoro ethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 82, 96, 104 | ||||||
| mengsel van ethyleenoxide en tetrafluorethaan | mixture of ethylene oxide and tetrafluoroethane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 28-11-2024 | 82, 96, 104 | ||||||
| 936-862-8 | mengsel van ijzerdichloride en mangaandichloride en natriumchromaat | reaction mass of iron dichloride and manganese dichloride and sodium chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | |||||||
| 937-062-1 | mengsel van ijzertrichloride en natriumdichromaat | reaction mass of iron trichloride and sodium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | |||||||
| 948-775-2 | mengsel van karayagom, dinatriumsulfaat, water, boraxdecahydraat, quarternaire ammoniumverbindingen, ethyl(gehydrogeneerde talk), geëthoxyleerd alkyl bis(hydroxyethyl) en sulfaten (zouten) | reaction mass of karaya gum and disodium sulfate and water and borax decahydrated and quaternary ammonium compounds, ethyl(hydrogenated tallow alkyl)bis(hydroxyethyl), ethoxylated, et sulfates (salts) | MVP 1 | 0,05 mg/Nm3 | 28-1-2022 | 74, 82 | |||||||
| 935-757-4 | mengsel van lanthanum carbonaat, cercium carbonaae, neodymium carbonaat en nikkel carbonaat | reaction mass of lanthanum carbonate, cercium carbonate, neodymium carbonate and nickel carbonate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 700-557-6 | mengsel van lithiumcarbonaat en nikkelhydroxide en kobalthydroxide en mangaanhydroxide en zuurstof | reaction product of lithium carbonate and nickel hydroxide and cobalt hydroxide and manganese hydroxide and oxygen | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 936-200-8 | mengsel van lood di(acetaat) en [ftalaat(2-)]oxodilood | reaction mass of lead di(acetate) and [phthalato(2-)]oxodilead | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | |||||||
| 934-478-5 | mengsel van lood, nikkel, thallium, cadmium en koper | reaction mass of lead and nickel and thallium and cadmium and copper | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 34, 57, 86 | |||||||
| 936-005-8 | mengsel van loodcarbonaat en kwarts (SiO2) | reaction mass of lead carbonate and Quartz (SiO2) | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | |||||||
| 412-790-8 | mengsel van N-[3-hydroxy-2-(2-methyl-acryloylamino-methoxy)-propoxymethyl]-2-methyl-acrylamide, N-[2,3-bis-(2-methyl-acryloylamino-methoxy)propoxymethyl]-2-methylacrylamide, methacrylamide, 2-methyl-N-(2-methyl-acryloylamino-methoxy-methyl)-acrylamide en N-(2,3-dihydroxy-propoxymethyl)-2-methyl-acrylamide | reaction mass of N-[3-hydroxy-2-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide, N-[2,3-bis-(2-methylacryloylaminomethoxy)propoxymethyl]-2-methylacrylamide; methacrylamide, 2-methyl-N-(2-methylacryloylaminomethoxymethyl)-acrylamide and N-(2,3-dihydroxypropoxymethyl)-2-methylacrylamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 910-417-8 | mengsel van nikkelmonoxide en siliciumdioxide | reaction mass of nickel monoxide and silicon dioxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 910-663-6 | mengsel van of kobalt sulfide en nikkel sulfide en trinikkel disulfide | reaction mass of cobalt sulphide and nickel sulphide and trinickel disulphide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 957-183-3 | mengsel van tert-butylacetaat en strontium chromaat en 2-heptanon en oxosilanediol en dioxotitanium en m-xyleen en 2-methoxy-1-methylethylacetaat en nafta oplosmiddel (petroleum), licht aromatisch en ethylbenzeen | reaction mass of tert-butyl acetate and strontium chromate and heptan-2-one and oxosilanediol and dioxotitanium and m-xylene and 2-methoxy-1-methylethyl acetate and solvent naphtha (petroleum), light arom. and ethylbenzene | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 80, 82 | |||||||
| 916-865-0 | mengsel van chromaat(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftaleen]acetamide(2-)][1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]-, waterstof, verbinding met N-cyclohexylcyclohexaanamine (1:1) en waterstof bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalato(2-)]chromaat(1-), verbinding met dicyclohexylamine (1:1) waterstof bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftyl]acetamide(2-)]chromaat(1-), verbinding met dicyclohexylamine (1:1) | reaction mass of Chromate(1-), [N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthalenyl]acetamidato(2-)][1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-, hydrogen, compd. with N-cyclohexylcyclohexanamine (1:1) and hydrogen bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphtholato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) and hydrogen bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthyl]acetamidato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | |||||||
| 118685-33-9 | 405-665-4 | mengsel van: dinatrium (6-(4-anisidino)-3-sulfonaat-2-(3,5-dinitro-2-oxidofenylazo)-1-naftalaat)(1-(5-chloor-2-oxidofenylazo)-2-naftalaat)chromaat(1-); trinatrium bis(6-(4-anisidine)-3-sulfonaat-2-(3,5-dinitro-2-oxidofenylazo)-1-naftalaat)chromaat(1-) | a mixture of: disodium (6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-); trisodium bis(6-(4-anisidino)-3-sulfonato-2-(3,5-dinitro-2-oxidophenylazo)-1-naphtholato)chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 192268-65-8 | 421-820-9 | mengsel van: trifenylthiofosfaat en tertiar gebutyleerde fenylderivaten | reaction mass of: triphenylthiophosphate and tertiary butylated phenyl derivatives | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | |||||
| 117527-94-3 | 403-720-7 | mengsel van: tert-alkyl(C12-C14)ammonium-bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]-chromaat(1-); tert-alkyl(C12-C14)ammonium-bis[1-[(2-hydroxy-4-nitrofenyl)azo]-2-naftalenolato(2-)]-chromaat(1-); tert-alkyl(C12-C14)ammonium-bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrofenyl]azo]-2-naftalenolato(2-)]-chromaat(1-); tert-alkyl(C12-C14)ammonium-[[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]-[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]]-chromaat(1-); tert-alkyl(C12-C14)ammonium-[[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrofenyl]azo]-2-naftalenolato(2-)]-[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalenolato(2-)]]-chromaat(1-); C12-14-tert-alkylammonium((1-(4(of 5)-nitro-2-oxidofenylazo)-2-naftolato)(1-(3-nitro-2-oxido-5-pentylfenylazo)-2-naftolato))chromaat(1-) | a mixture of: tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis[1-[(2-hydroxy-4-nitrophenyl)azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium bis[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-chromate(1-); tert-alkyl(C12-C14)ammonium [[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-); tert-alkyl(C12-C14)ammonium [[1-[[5-(1,1-dimethylpropyl)-2-hydroxy-3-nitrophenyl]azo]-2-naphthalenolato(2-)]-[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphthalenolato(2-)]]-chromate(1-); tert-alkyl(C12-C14)ammonium ((1-(4(or 5)-nitro-2-oxidophenylazo)-2-naphtholato)(1-(3-nitro-2-oxido-5-pentylphenylazo)-2-naphtholato))chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 110235-47-7 | 600-951-7 | mepanipyrim | mepanipyrim | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 117 | ||||||
| messingstaaf (met lood) | brass ingot (with Lead) | MVP 1 | 0,05 mg/Nm3 | 3-2-2022 | 14, 57 | ||||||||
| 10102-53-1 | meta-arseenzuur | arsenenic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 139968-49-3 | 604-167-6 | metaflumizon | metaflumizone | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 625-45-6 | 210-894-6 | methoxyazijnzuur | methoxyacetic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 72-43-5 | 200-779-9 | methoxychloor | methoxychlor | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 1239414-43-7 | methyl (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluorhept-3-een-3-yl ether | methyl (3E)-1,1,1,2,2,4,5,5,6,6,7,7,7-tridecafluorohept-3-en-3-yl ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 15546-11-9 | 239-594-3 | methyl (Z,Z)-8,8-dibutyl-3,6,10-trioxo-2,7,9-trioxa-8-stannatrideca-4,11-dieen-13-oaat | methyl (Z,Z)-8,8-dibutyl-3,6,10-trioxo-2,7,9-trioxa-8-stannatrideca-4,11-dien-13-oate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 900-77-6 | 212-983-5 | methyl 1,2,5,6-tetrahydro-1-methylnicotinaat, mono[(3-acetamido-4-hydroxyfenyl)arsonaat] | methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 80925-03-7 | 279-628-4 | methyl 17α-hydroxyyohimban-16α-carboxylaat, methylarsonaat (1:1) | methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 56554-52-0 | 670-445-9 | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluordodecanoaat | Methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 819-35-2 | 982-540-5 | methyl(nitroso)(2,2,2-trifluorethyl)amine | methyl(nitroso)(2,2,2-trifluoroethyl)amine | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 56296-78-7 | 260-101-2 | methyl[3-fenyl-3-[4-(trifluormethyl)fenoxy]propyl]ammoniumchloride | Methyl[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]ammonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 77402-05-2 | 403-230-3 | methylacrylamidoglycolaat [met 0,1 procent of meer acrylamide] | methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 77402-03-0 | 401-890-7 | methylacrylamidomethoxyacetaat [met 0,1 procent of meer acrylamide] | methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 124-58-3 | 204-705-6 | methylarsonzuur | methylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 19438-60-9 | 243-072-0 | methylcyclohexyl-1,6-dicarbonzuur-anhydride | hexahydro-4-methylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 945-48-2 | 213-414-3 | methyldifenylarsine | methyldiphenylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 21892-63-7 | 244-639-5 | methyleenbis(difenylarsine) | methylenebis(diphenylarsine) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| methylfenyleendiamine | methyl-phenylene diamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 25550-51-0 | 247-094-1 | methylhexahydroftaalzuur anhydride | hexahydromethylphthalic anhydride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 60-34-4 | 200-471-4 | methylhydrazine | methylhydrazine | Ja | MVP 2 | 1 mg/Nm3 | 30-05-2017 | ||||||
| 22967-92-6 | methylkwik | methylmercury | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||
| 163702-07-6 | 605-339-3 | methylnonafluorbutylether | methyl perfluorobutyl ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 163702-08-7 | 605-340-9 | methylnonafluorisobutylether | methyl perfluoroisobutyl ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 592-62-1 | 209-765-7 | methyl-ONN-azoxymethylacetaat | methyl-ONN-azoxymethyl acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 593-58-8 | 209-799-2 | methyloxoarsine | methyloxoarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 376-27-2 | 206-808-1 | methylperfluoroctanoaat | methyl perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1499-33-8 | 216-108-8 | methyltrifenylarsoniumjodide | methyltriphenylarsonium iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 9006-42-2 | 618-430-8 | metiram | metiram | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 118 | ||||||
| 21087-64-9 | 244-209-7 | metribuzin | metribuzin | MVP 1 | 0,05 mg/Nm3 | 10-7-2025 | 81, 119 | ||||||
| 90-94-8 | 202-027-5 | Michler's keton | Michler's ketone | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 15843-02-4 | 239-946-6 | mierenzuur nikkelzout | formic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68134-59-8 | 268-755-0 | mierenzuur, kopernikkelzout | formic acid, copper nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1314-04-1 | milleriet | millerite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 74869-21-9 | 278-011-7 | mineraal vet | lubricating greases | Ja | 2-12-2013 | 4, 64 | |||||||
| 2385-85-5 | 219-196-6 | mirex | mirex | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68130-36-9 | 268-585-7 | molybdeennikkelhydroxideoxidefosfaat | molybdenum nickel hydroxide oxide phosphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12673-58-4 | molybdeennikkeloxide | molybdenum nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 14177-55-0 | 238-034-5 | molybdeennikkeltetraoxide | molybdenum nickel tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| mono-, di- of tri-O-(alkyl)-derivaten van (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaantriol | any of the mono-, di- or tri-O- (alkyl) derivatives of (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) silanetriol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-11-2024 | 96, 98, 100 | |||||||
| 99688-47-8 | 402-210-1 | monomethyldibroomdifenylmethaan | monomethyl-dibromo-diphenyl methane bromobenzylbromotoluene, mixture of isomers | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 46 | ||||||
| monomethyldichloordifenylmethaan | monomethyl-dichloro-diphenyl methane | MVP 1 | 0,05 mg/Nm3 | 30-5-2017 | 46 | ||||||||
| 76253-60-6 | 278-404-3 | monomethyltetrachloordifenylmethaan | monomethyl-tetrachlorodiphenyl methane. Trade name: Ugilec 141 | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 46 | ||||||
| 12139-21-8 | monteponiet | monteponite | Ja | MVP 1 | 0,05 mg/Nm3 | 26-1-2024 | 57 | ||||||
| 503155-89-3 | 671-830-4 | morfolinium perfluorbutaansulfonaat | morpholinium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 81-15-2 | 201-329-4 | musk xyleen | musk xylene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 24280-93-1 | 246-119-3 | mycofenolinezuur | mycophenolic acid | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 73 | ||||||
| 793-24-8 | 212-344-0 | N-(1,3-dimethylbutyl)-N'-fenyl-1,4-benzeendiamine | N-1,3-dimethylbutyl-N'-phenyl-p-phenylenediamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 202914-84-9 | 692-734-9 | N-(2,2,2-trifluorethyl)-9-[4-[4-[[[4'-(trifluormethyl)[1,1'-bifenyl]2-yl]carbonyl]amino]-1-piperidinyl]butyl]-9H-fluoreen-9-carboxamde | N-(2,2,2-trifluoroethyl)-9-[4-[4-[[[4'-(trifluoromethyl)[1,1'-biphenyl]2-yl]carbonyl]amino]-1-piperidinyl]butyl]9H-fluoren-9-carboxamde | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 874819-71-3 | 477-690-9 | N-(2-nitrofenyl) fosforzuurtriamide | N-(2-nitrophenyl)phosphoric triamide | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 85938-56-3 | 288-891-4 | N-(3-aminopropyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaanamide | N-(3-aminopropyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 852527-48-1 | 632-942-9 | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)jodoacetamide | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)iodoacetamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 852527-40-3 | 632-939-2 | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecyl)maleimide | N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoroundecyl)maleimide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 21840-08-4 | 244-612-8 | N-(p-arsenosofenyl)-1,3,5-triazine-2,4,6-triamine | N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 54143-56-5 | 258-997-5 | N-(piperidine-2-ylmethyl)-2,5-bis(2,2,2-trifluorethoxy)benzamide monoazijnzuur | N-(piperidin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide monoacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 27366-72-9 | 435-470-1 | N,N-(dimethylamino)thioaceetamide hydrochloride | N,N-(dimethylamino)thioacetamide hydrochloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 603-48-5 | 210-043-9 | N,N,N',N',N'',N''-hexamethyl-4,4',4''-methylidynetrianiline | N,N,N',N',N'',N''-hexamethyl-4,4',4''-methylidynetrianiline | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 56, 57 | |||||
| 101-61-1 | 202-959-2 | N,N,N',N'-tetramethyl-4,4'-methyleendianiline | N,N,N',N'-tetramethyl-4,4'-methylenedianiline | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 108427-54-9 | N,N,N-tributyl-1-butylamine, zout met tridecafluorhexaansulfonzuur | 1-butanaminium, N,N,N-tributyl-, salt with1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 108427-55-0 | N,N,N-triethyl-ethylamine, zout met tridecafluorhexaansulfonzuur (1:1) | ethanaminium, N,N,N-triethyl-, salt with1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 189274-31-5 | N,N,N-trimethyl-methylamine, zout met tridecafluorhexaansulfonzuur (1:1) | methanaminium, N,N,N-trimethyl-, salt with1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 110-26-9 | 203-750-9 | N,N’-methyleendiacrylamide | N,N'-Methylenebisacrylamide | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 81 | |||||
| 5625-90-1 | 227-062-3 | N,N′-methyleendimorfoline | N,N′-methylenedimorpholine | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 58, 66 | |||||
| 14167-20-5 | 624-036-7 | N,N'-bis(salicylideen)ethyleendiaminonikkel(II) | N,N'-bis(salicylidene)ethylenediaminonickel(II) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 119-325-5 | N,N'-bis[3-tert-butyl-5-(heptadecafluoroctyl)salicylideen]-trans-1,2-cyclohexandiamino-kobalt(II) | N,N'-bis[3-tert-butyl-5-(heptadecafluorooctyl)salicylidene)-trans-1,2-cyclohexanediamino-cobalt(II). | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | ||||||
| 613-35-4 | 210-338-2 | N,N'-diacetylbenzidine | N,N'-diacetylbenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 127-19-5 | 204-826-4 | N,N-dimethylaceetamide | N,N-dimethylacetamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 68-12-2 | 200-679-5 | N,N-dimethylformamide | N,N-dimethylformamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 57-14-7 | 200-316-0 | N,N-dimethylhydrazine | N,N-dimethylhydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 99-97-8 | 202-805-4 | N,N-dimethyl-p-toluïdine | N,N-dimethyl-p-toluidine | Ja | MVP 2 | 1 mg/Nm3 | 25-1-2024 | 81 | |||||
| 956-988-7 | N-[1-(3-fluorpropyl)-3-azetidinyl]-6-[(6R,8S)-8-methyl-7-(2,2,2-trifluorethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinoline-6-yl]-3-pyridinamine | N-[1-(3-fluoropropyl)-3-azetidinyl]-6-[(6R,8S)-8-methyl-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinamine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | ||||||
| 956-989-2 | N-[1-(3-fluorpropyl)-3-azetidinyl]-6-[(6S,8S)-8-methyl-7-(2,2,2-trifluorethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinoline-6-yl]-3-pyridinamine | N-[1-(3-fluoropropyl)-3-azetidinyl]-6-[(6S,8S)-8-methyl-7-(2,2,2-trifluoroethyl)-6,7,8,9-tetrahydro-3H-pyrazolo[4,3-f]isoquinolin-6-yl]-3-pyridinamine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | ||||||
| 41358-63-8 | 255-327-3 | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaanamide | N-[3-[bis(2-hydroxyethyl)amino]propyl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 556050-49-8 | 622-942-7 | N-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)benzyloxycarbonyloxy]succinimide | N-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl) benzyloxycarbonyloxy]succinimide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 1310480-24-0 | N-[4-[[4-(diethylamino)fenyl][4-(ethylamino)-1-naftalenyl]methyleen]-2,5-cyclohexadieen-1-ylideen]-N-ethyl-ethylamine, tridecafluorhexaansulfonaat (1:1) | ethanaminium, N-[4-[[4-(diethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-ethyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 1310480-27-3 | N-[4-[[4-(dimethylamino)fenyl][4-(ethylamino)-1-naftalenyl]methyleen]-2,5-cyclohexadieen-1-ylideen]-N-methyl-methylamine, tridecafluorhexaansulfonaat (1:1) | methanaminium, N-[4-[[4-(dimethylamino)phenyl][4-(ethylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 1310480-28-4 | N-[4-[[4-(dimethylamino)fenyl][4-(fenylamino)-1-naftalenyl]methyleen]-2,5-cyclohexadieen-1-ylideen]-N-methyl-methylamine, tridecafluorhexaansulfonaat (1:1) | methanaminium, N-[4-[[4-(dimethylamino)phenyl][4-(phenylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 939-450-6 | n-[4-broom-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)sulfonyl]-2-hydroxy-2-methylpropaanamide | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | ||||||
| 131549-75-2 | 875-967-2 | n'-[4-chloor-2-(trifluormethyl)fenyl]-2-propoxyethanimidamide | n'-[4-chloro-2-(trifluoromethyl)phenyl]-2-propoxyethanimidamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 90357-51-0 | 618-536-4 | N-[4-cyaan-3-(trifluormethyl)fenyl]-2-methyloxiraan-2-carboxamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyloxirane-2-carboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 113299-40-4 | 692-949-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-(4-fluorfenyl)sulfonyl-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1159977-36-2 | 680-871-7 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(2-fluorfenyl)sulfonyl]-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(2-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 1166228-30-3 | 672-578-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(3-fluorfenyl)sulfonyl]-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(3-fluorophenyl)sulfonyl]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 90357-06-5 | 618-534-3 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)sulfonyl]-2-hydroxy-2-methylpropaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 906008-94-4 | 680-656-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)sulfonyl]-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 90356-78-8 | 618-533-8 | N-[4-cyano-3-(trifluormethyl)fenyl]-3-[(4-fluorfenyl)thio]-2-hydroxy-2-methyl-propaanamide | N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)thio]-2-hydroxy-2-methyl-propanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 84245-12-5 | 424-550-1 | N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]aceetamide | N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6596-96-9 | 694-740-7 | N-[bis(dimethylamino)arsanyl]-N-methylmethanamine | N-[bis(dimethylamino)arsanyl]-N-methylmethanamine | Ja | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 57, 92 | |||||
| 37793-53-6 | 624-434-0 | N-10-(trifluoracetyl)pteroïnezuur | N-10-(trifluoroacetyl)pteroic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 439588-75-7 | 639-444-0 | N2-[(1S)-1-carboxy-3-fenylpropyl]-N6-(trifluoracetyl)-L-lysyl-L-proline | N2-[(1S)-1-carboxy-3-phenylpropyl]-N6-(trifluoroacetyl)-L-lysyl-L-proline | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 8030-30-6 | 232-443-2 | nafta | naphtha | Ja | 2-12-2013 | 4, 65 | |||||||
| 68603-08-7 | 271-635-0 | nafta (aardolie), aromaathoudend | naphtha (petroleum), arom.-contg. | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-49-3 | 295-430-0 | nafta (aardolie), C4-12-butaanalkylaat, rijk aan isooctaan | naphtha (petroleum), C4-12, butane-alkylate, isooctane-rich | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-23-0 | 265-123-6 | nafta (aardolie), chemisch geneutraliseerde lichte | naphtha (petroleum), chemically neutralized light | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-22-9 | 265-122-0 | nafta (aardolie), chemisch geneutraliseerde zware | naphtha (petroleum), chemically neutralized heavy | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-70-4 | 265-073-5 | nafta (aardolie), isomerisatie- | naphtha (petroleum), isomerization | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-58-4 | 295-440-5 | nafta (aardolie), isomerisatie-, C6-fractie | naphtha (petroleum), isomerization, C6-fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 68783-09-5 | 272-185-8 | nafta (aardolie), katalytisch gekraakte lichte destillaten | naphtha (petroleum), catalytic cracked light distd. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68955-35-1 | 273-271-8 | nafta (aardolie), katalytisch gereformde | naphtha (petroleum), catalytic reformed | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 85116-59-2 | 285-510-3 | nafta (aardolie), katalytisch gereformde lichte, aromaatvrije fractie | naphtha (petroleum), catalytic reformed light, arom.-free fraction | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-66-1 | 265-170-2 | nafta (aardolie), katalytisch van was ontdaan | naphtha (petroleum), catalytic dewaxed | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-66-8 | 265-068-8 | nafta (aardolie), licht, gealkyleerd | naphtha (petroleum), light alkylate | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-46-4 | 265-046-8 | nafta (aardolie), lichte direct uit fractionering verkregen | naphtha (petroleum), light straight-run | Ja | 2-12-2013 | 4, 65 | |||||||
| 92201-97-3 | 296-028-8 | nafta (aardolie), lichte hitteverzadigde, stoomgekraakt | naphtha (petroleum), light heat-soaked, steam-cracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-55-5 | 265-056-2 | nafta (aardolie), lichte katalytisch gekraakte | naphtha (petroleum), light catalytic cracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-59-5 | 295-441-0 | nafta (aardolie), lichte katalytisch gekraakte, stankvrij gemaakt | naphtha (petroleum), light catalytic cracked sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-63-5 | 265-065-1 | nafta (aardolie), lichte katalytisch gereformde | naphtha (petroleum), light catalytic reformed | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 68513-03-1 | 270-993-5 | nafta (aardolie), lichte katalytisch gereformde, vrij van aromaten | naphtha (petroleum), light catalytic reformed, arom.-free | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-83-2 | 265-187-5 | nafta (aardolie), lichte stoomgekraakte | naphtha (petroleum), light steam-cracked | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 68527-23-1 | 271-264-4 | nafta (aardolie), lichte stoomgekraakte aromatische | naphtha (petroleum), light steam-cracked arom. | Ja | 2-12-2013 | 4, 65 | |||||||
| 98219-47-7 | 308-714-7 | nafta (aardolie), lichte stoomgekraakte, thermisch behandeld | naphtha (petroleum), light steam-cracked, thermally treated | Ja | 2-12-2013 | 4, 65 | |||||||
| 68527-26-4 | 271-266-5 | nafta (aardolie), lichte stoomgekraakte, van benzeen ontdaan | naphtha (petroleum), light steam-cracked, debenzenized | Ja | 2-12-2013 | 4, 65 | |||||||
| 98219-46-6 | 308-713-1 | nafta (aardolie), lichte stoomgekraakte, van benzeen ontdaan thermisch behandeld | naphtha (petroleum), light steam-cracked, debenzenized, thermally treated | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-74-8 | 265-075-6 | nafta (aardolie), lichte thermisch gekraakte | naphtha (petroleum), light thermal cracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-65-3 | 295-447-3 | nafta (aardolie), lichte thermisch gekraakte, stankvrij gemaakt | naphtha (petroleum), light thermal cracked, sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-69-1 | 265-071-4 | nafta (aardolie), lichte waterstofgekraakte | naphtha (petroleum), light hydrocracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-60-8 | 295-442-6 | nafta (aardolie), lichte, rijk aan C5, stankvrij gemaakt | naphtha (petroleum), light, C5-rich, sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 68783-66-4 | 272-206-0 | nafta (aardolie), lichte, stankvrij gemaakt | naphtha (petroleum), light, sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 101795-01-1 | 309-976-5 | nafta (aardolie), lichte, stankvrij gemaakt | naphtha (petroleum), sweetened light | Ja | 2-12-2013 | 4, 65 | |||||||
| 68527-22-0 | 271-263-9 | nafta (aardolie), met klei behandelde lichte direct door fractionering verkregen | naphtha (petroleum), clay-treated light straight-run | Ja | 2-12-2013 | 4, 65 | |||||||
| 68527-21-9 | 271-262-3 | nafta (aardolie), met klei behandelde totaalfractie direct door fractionering verkregen | naphtha (petroleum), clay-treated full-range straight-run | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-57-3 | 295-438-4 | nafta (aardolie), met stoom gekraakte lichte fractie, waterstofbehandeld | naphtha (petroleum), hydrotreated light steam-cracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-51-7 | 295-432-1 | nafta (aardolie), met stoom gekraakte zware fractie, gehydrogeneerd | naphtha (petroleum), heavy steam-cracked, hydrogenated | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-15-0 | 265-115-2 | nafta (aardolie), met zuur behandeld | naphtha (petroleum), acid-treated | Ja | 2-12-2013 | 4, 65 | |||||||
| 68783-12-0 | 272-186-3 | nafta (aardolie), niet stankvrij gemaakt | naphtha (petroleum), unsweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-84-0 | 265-086-6 | nafta (aardolie), oplosmiddelgeraffineerde lichte | naphtha (petroleum), solvent-refined light | Ja | 2-12-2013 | 4, 65 | |||||||
| 97488-96-5 | 307-035-3 | nafta (aardolie), solvent-geraffineerd met waterstof ontzwaveld zwaar | naphtha (petroleum), solvent-refined hydrodesulfurized heavy | Ja | 2-12-2013 | 4, 64 | |||||||
| 64741-87-3 | 265-089-2 | nafta (aardolie), stankvrij gemaakt | naphtha (petroleum), sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 68516-20-1 | 271-138-9 | nafta (aardolie), stoomgekraakte aromatische middenfracties | naphtha (petroleum), steam-cracked middle arom. | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-42-0 | 265-042-6 | nafta (aardolie), totaalfractie direct uit fractionering verkregen | naphtha (petroleum), full-range straight-run | Ja | 2-12-2013 | 4, 65 | |||||||
| 68527-27-5 | 271-267-0 | nafta (aardolie), totaalfractie gealkyleerd butaan bevattend | naphtha (petroleum), full-range alkylate, butane-contg. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68919-37-9 | 272-895-8 | nafta (aardolie), totaalfractie gereformde | naphtha (petroleum), full-range reformed | Ja | 2-12-2013 | 4, 65 | |||||||
| 68513-02-0 | 270-991-4 | nafta (aardolie), totaalfractie verkookser | naphtha (petroleum), full-range coker | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-64-6 | 265-066-7 | nafta (aardolie), totaalfractie, gealkyleerd | naphtha (petroleum), full-range alkylate | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-49-0 | 265-151-9 | nafta (aardolie), waterstofbehandelde lichte | naphtha (petroleum), hydrotreated light | Ja | 2-12-2013 | 4, 65 | |||||||
| 85116-61-6 | 285-512-4 | nafta (aardolie), waterstofbehandelde lichte fractie, cycloalkaan bevattend | naphtha (petroleum), hydrotreated light, cycloalkane-contg. | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-48-9 | 265-150-3 | nafta (aardolie), waterstofbehandelde zware | naphtha (petroleum), hydrotreated heavy | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 92045-52-8 | 295-433-7 | nafta (aardolie), waterstofontzwaveld totaalfractie | naphtha (petroleum), hydrodesulfurized full-range | Ja | 2-12-2013 | 4, 65 | |||||||
| 101316-76-1 | 309-879-8 | nafta (aardolie), waterstofontzwaveld totaalfractie uit verkookser | naphtha (petroleum), hydrodesulfurised full-range coker | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-73-0 | 265-178-6 | nafta (aardolie), waterstofontzwavelde lichte | naphtha (petroleum), hydrodesulfurized light | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-53-9 | 295-434-2 | nafta (aardolie), waterstofontzwavelde lichte, gedearomatiseerd | naphtha (petroleum), hydrodesulfurized light, dearomatized | Ja | 2-12-2013 | 4, 65 | |||||||
| 85116-60-5 | 285-511-9 | nafta (aardolie), waterstofontzwavelde thermisch gekraakte lichte fractie | naphtha (petroleum), hydrodesulfurized thermal cracked light | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-82-1 | 265-185-4 | nafta (aardolie), waterstofontzwavelde zware | naphtha (petroleum), hydrodesulfurized heavy | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-65-7 | 265-067-2 | nafta (aardolie), zwaar, gealkyleerd | naphtha (petroleum), heavy alkylate | Ja | 2-12-2013 | 4, 65 | |||||||
| 101631-20-3 | 309-945-6 | nafta (aardolie), zware direct door fractionering verkregen aromaathoudend | naphtha (petroleum), heavy straight run, arom.-contg. | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-41-9 | 265-041-0 | nafta (aardolie), zware direct uit fractionering verkregen | naphtha (petroleum), heavy straight-run | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-54-4 | 265-055-7 | nafta (aardolie), zware katalytisch gekraakte | naphtha (petroleum), heavy catalytic cracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 92045-50-6 | 295-431-6 | nafta (aardolie), zware katalytisch gekraakte, stankvrij gemaakt | naphtha (petroleum), heavy catalytic cracked, sweetened | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-68-0 | 265-070-9 | nafta (aardolie), zware katalytisch gereformde | naphtha (petroleum), heavy catalytic reformed | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-83-9 | 265-085-0 | nafta (aardolie), zware thermisch gekraakte | naphtha (petroleum), heavy thermal cracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 64741-78-2 | 265-079-8 | nafta (aardolie), zware waterstofgekraakte | naphtha (petroleum), heavy hydrocracked | Ja | 2-12-2013 | 4, 65 | |||||||
| 90641-12-6 | 292-636-2 | nafta (kool), destillatieresiduen | naphtha (coal), distn. residues | Ja | 2-12-2013 | 4, 61 | |||||||
| 94114-54-2 | 302-690-1 | nafta (kool), oplosmiddelextractie, waterstofgekraakt | naphtha (coal), solvent extn., hydrocracked | Ja | 2-12-2013 | 4, 61 | |||||||
| 93165-55-0 | 296-942-7 | nafta (petroleum), licht stoomgekraakt, gehydrogeneerd | naphtha (petroleum), light steam-cracked, hydrogenated | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 64741-92-0 | 265-095-5 | nafta (petroleum), oplosmiddelgeraffineerde zware | naphtha (petroleum), solvent-refined heavy | Ja | 2-12-2013 | 4, 65 | |||||||
| 91-20-3 | 202-049-5 | naftaleen | naphthalene | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | 10 | ||||||
| 54806-25-6 | 803-986-8 | naftaleen-1-ylbis(trifenylfosforanyl)nikkel(IV) chloride | naphthalen-1-ylbis(triphenylphosphoranyl)nickel(IV) chloride | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 64742-75-2 | 265-179-1 | nafteenhoudende oliën (aardolie), complexe van was ontdane zware | naphthenic oils (petroleum), complex dewaxed heavy | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-69-4 | 265-173-9 | nafteenhoudende oliën (aardolie), katalytisch van was ontdane lichte | naphthenic oils (petroleum), catalytic dewaxed light | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-68-3 | 265-172-3 | nafteenhoudende oliën (aardolie), katalytisch van was ontdane zware | naphthenic oils (petroleum), catalytic dewaxed heavy | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-76-3 | 265-180-7 | nafteenoliën (aardolie), complexe van was ontdane lichte | naphthenic oils (petroleum), complex dewaxed light | Ja | 2-12-2013 | 4, 62 | |||||||
| 61790-14-5 | 263-109-4 | nafteenzuren, loodzouten | naphthenic acids, lead salts | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 61788-71-4 | 263-000-1 | nafteenzuren, nikkelzouten | naphthenic acids, nickel salts | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 420-87-1 | 206-998-6 | natrium 2,2,2-trifluorethanolaat | Sodium 2,2,2-trifluoroethanolate | Ja | MVP 2 | 1 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 52556-42-0 | 258-004-5 | natrium 3-(allyloxy)-2-hydroxypropaansulfonaat | sodium 3-(allyloxy)-2-hydroxypropanesulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 81 | |||||
| 7681-83-6 | 231-680-9 | natrium 4-(glycolloylamino)fenylarsonaat | sodium 4-(glycolloylamino)phenylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 57206-83-4 | 260-617-8 | natrium bis[1-[[2-hydroxy-3-nitro-5-tert-pentylfenyl]azo]-2-naftolato(2-)]chromaat(1-) | sodium bis[1-[[2-hydroxy-3-nitro-5-tert-pentylphenyl]azo]-2-naphtholato(2-)]chromate(1-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 6131-99-3 | 682-793-9 | natrium cacodylaat trihydraat | sodium cacodylate trihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7789-12-0 | 616-541-6 | natrium dichromaat dihydraat | sodium dichromate dihydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11110-52-4 | 680-624-3 | natrium kwik amalgaam | sodium mercury amalgam | MVP 1 | 0,05 mg/Nm3 | 23-2-2022 | 42, 57 | ||||||
| 7775-19-1 | 231-891-6 | natrium metaboraat, anhydraat | sodium metaborate, anhydrous | MVP 1 | 0,05 mg/Nm3 | 15-9-2022 | 79, 81 | ||||||
| 1772-02-7 | 217-197-6 | natrium p-[[4-[3-(2-arsono-4-nitrofenyl)triazen-1-yl]fenyl]azo]benzeensulfonaat | sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 6634-88-4 | 229-632-7 | natrium p-arsonobenzeensulfonaat | sodium p-arsonobenzenesulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 335-95-5 | 206-404-5 | natrium pentadecafluoroctanoaat | sodium pentadecafluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 3830-45-3 | natrium perfluordecaanzuur | sodium perfluorodecanoate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | 96 | ||||
| 20109-59-5 | 243-518-4 | natrium perfluorheptanoaat | sodium perfluoroheptanoate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 19-1-2023 | 57, 96 | ||||
| 2923-18-4 | 220-879-6 | natrium trifluorazijnzuur | sodium trifluoroacetate | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 2923-26-4 | 220-881-7 | natrium undecafluorhexanoaat | sodium undecafluorohexanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 3016286-99-7 | 987-901-0 | natrium, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluorundecaan-1-sulfonzuur | sodium;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoroundecane-1-sulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 55588-51-7 | 259-714-8 | natriumacetarsol | acetarsol sodium | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 127-85-5 | 204-869-9 | natriumarsanilaat | sodium arsanilate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7631-89-2 | 231-547-5 | natriumarsenaat | sodium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 10048-95-0 | 677-900-0 | natriumarsenaat dibasisch heptahydraat | sodium arsenate dibasic heptahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 15120-17-9 | 239-171-3 | natriumarseniet | sodium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 16940-66-2 | 241-004-4 | natriumboorhydride | sodium borohydride | MVP 1 | 0,05 mg/Nm3 | 17-5-2021 | 79, 81 | ||||||
| 7775-11-3 | 231-889-5 | natriumchromaat | sodium chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 10588-01-9 | 234-190-3 | natriumdichromaat | sodium dichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 938-917-1 | natriumdichromaat oplossing | sodium dichromate solution | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | |||||||
| 7784-46-5 | 232-070-5 | natriumdioxoarseniet | sodium dioxoarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 20-12-2021 | 57, 92 | |||||
| 124-65-2 | 204-708-2 | natriumkakodylaat | sodium cacodylate | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 2163-80-6 | 218-495-9 | natriummethylarsonaat | sodium methylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 70161-44-3 | 274-357-8 | natrium-N-(hydroxymethyl)glycinaat | sodium N-(hydroxymethyl)glycinate | Ja | MVP 2 | 1 mg/Nm3 | 11-9-2020 | 81 | |||||
| 60189-99-3 | natriumoxidearseenzuur | sodium oxidoarsonous acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 131-52-2 | 205-025-2 | natriumpentachloorfenolaat | sodium pentachlorophenate | MVP 1 | 0,05 mg/Nm3 | 16-7-2019 | 57, 69 | ||||||
| 15120-21-5 | 239-172-9 | natriumperboraat | sodium perborate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| natriumperoxoboraat | sodium peroxoborate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 57 | |||||||
| natriumperoxoboraat, hexahydraat | sodium peroxoborate, hexahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 57 | |||||||
| 7632-04-4 | 231-556-4 | natriumperoxometaboraat | sodium peroxometaborate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 585-54-6 | 209-558-1 | natriumwaterstof [4-(acetamido)fenyl]arsonaat | sodium hydrogen [4-(acetamido)phenyl]arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 5892-48-8 | 227-573-1 | natriumwaterstof(3-acetamido-4-hydroxyfenyl)arsonaat | sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 140-45-4 | 205-415-2 | natriumwaterstof-[4-[(hydroxyacetyl)amino]fenyl]arsonaat | sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 94278-22-5 | 304-710-4 | natriumwaterstofallylarsonaat | sodium hydrogen allylarsonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 21049-39-8 | natriumzouten van perfluornonaanzuur | sodium salts of perfluorononan-1-oic-acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-2-2016 | 96 | ||||
| 11113-50-1 | 234-343-4 | natuurlijk ruw boorzuur met een gehalte aan H3BO3 van niet meer dan 85 gewichtsprocenten berekend op de droge stof | boric acid, crude natural, containing not more than 85 per cent of H3BO3 calculated on the dry weight | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 37696-83-6 | 119-340-7 | N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoroctaanamide | N-butyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanamide | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 1118-46-3 | 214-263-6 | n-butyltin trichloride | n-butyltin trichloride | 6-9-2022 | 15 | ||||||||
| 457-60-3 | 207-273-7 | neoarfenamine | neoarsphenamine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 51818-56-5 | 257-447-1 | neodecaanzuur, nikkelzout | neodecanoic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12255-09-3 | 235-504-1 | neodymiumarsenide | neodymium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 2687-91-4 | 220-250-6 | N-ethyl-2-pyrrolidon | N-ethyl-2-pyrrolidone | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 1691-99-2 | 216-887-4 | N-ethylheptadecafluor-N-(2-hydroxyethyl)octaansulfonamide | N-ethylheptadecafluoro-N-(2-hydroxyethyl)octanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 4151-50-2 | 223-980-3 | N-ethylperfluoroctaan-sulfonamide | N-ethylheptadecafluorooctanesulphonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 57, 96 | ||||
| 2991-50-6 | 221-061-1 | N-ethylperfluoroctaan-sulfonamidoazijnzuur | N-ethylperfluorooctanesulfonamidoacetic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 57, 69, 96 | |||||
| 7440-02-0 | 231-111-4 | nikkel | nickel | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 33 | ||||||
| 7785-20-8 | 680-452-9 | nikkel ammonium sulfaat hexahydraat | nickel ammonium sulfate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 13927-77-0 | 237-696-2 | nikkel bis(dibutyldithiocarbamaat) | nickel bis(dibutyldithiocarbamate) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 39430-27-8 | 641-002-7 | nikkel carbonaat hydroxide tetrahydraat | nickel carbonate hydroxide tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 7791-20-0 | 616-576-7 | nikkel chloride (NiCl2), hexahydraat | nickel chloride (NiCl2), hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 13940-83-5 | 604-130-4 | nikkel fluoride (NiF2), tetrahydraat | nickel fluoride (NiF2), tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 343630-64-8 | 684-201-4 | nikkel ionofoor I | nickel ionophore I | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 69012-50-6 | 273-749-6 | nikkel mat | nickel matte | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 932-422-4 | nikkel p-toluidine-2-sulfonaat | nickel p-toluidine-2-sulfonate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 207569-15-1 | 622-645-2 | nikkel(II) 2,9,16,23-tetrafenoxy-29H,31H-ftalocyanine | nickel(II) 2,9,16,23-tetraphenoxy-29H,31H-phthalocyanine | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 375387-13-6 | 806-937-9 | nikkel(II) 2-amino-5-methylbenzeensulfonaat | nickel(II) 2-amino-5-methylbenzenesulfonate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 14481-08-4 | 624-509-8 | nikkel(II) bis(2,2,6,6-tetramethyl-3,5-heptaandionaat) | nickel(II) bis(2,2,6,6-tetramethyl-3,5-heptanedionate) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 312696-09-6 | 626-117-2 | nikkel(II) bromide 2-methoxyethyl ether complex | nickel(II) bromide 2-methoxyethyl ether complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 28923-39-9 | 628-228-1 | nikkel(II) bromide ethyleen glycol dimethyl ether complex | nickel(II) bromide ethylene glycol dimethyl ether complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 7789-49-3 | 677-463-6 | nikkel(II) bromide trihydraat | nickel(II) bromide trihydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 12244-51-8 | 683-010-3 | nikkel(II) carbonaat hydroxide tetrahydraat | nickel(II) carbonate hydroxide tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 60871-84-3 | 663-776-5 | nikkel(II) trifluormethaansulfonaat | nickel(II) trifluormethanesulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 29-11-2022 | 34, 57, 96 | |||||
| 6018-89-9 | 611-946-4 | nikkel(II)acetaat tetrahydraat | acetic acid nickel(II) salt | MVP 1 | 0,05 mg/Nm3 | 11-02-2019 | 34, 57 | ||||||
| 13477-70-8 | 236-771-7 | nikkel(II)arsenaat | trinickel bis(arsenate) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | ||||
| 944-674-2 | nikkel(II)bis(ethoxyacetaat) | nickel(II)bis(ethoxyacetate) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 69098-15-3 | 677-901-6 | nikkel(II)chloride hydraat | nickel(II) chloride hydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 85508-43-6 | 287-468-1 | nikkel(II)isodecanoaat | nickel(II) isodecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 29317-63-3 | 249-555-2 | nikkel(II)isooctanoaat | nickel(II) isooctanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 85508-44-7 | 287-469-7 | nikkel(II)neodecanoaat | nickel(II) neodecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 93920-10-6 | 300-094-6 | nikkel(II)neononanoaat | nickel(II) neononanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 93920-09-3 | 300-093-0 | nikkel(II)neoündecanoaat | nickel(II) neoundecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13478-00-7 | 603-868-4 | nikkel(II)nitraathexahydraat | nickel(II) nitrate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 28-5-2019 | 57, 69 | ||||||
| 2223-95-2 | 218-744-1 | nikkel(II)octadecanoaat | nickel(II) stearate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 4995-91-9 | 225-656-7 | nikkel(II)octanoaat | nickel(II) octanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13654-40-5 | 237-138-8 | nikkel(II)palmitaat | nickel(II) palmitate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3349-08-4 | 222-102-6 | nikkel(II)propionaat | nickel(II) propionate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6944-05-4 | 678-499-5 | nikkel(II)p-tolueensulfonaat hexahydraat | nickel(II) p-toluenesulfonate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 10101-96-9 | 233-263-7 | nikkel(II)seleniet | nickel(II) selenite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 21784-78-1 | 244-578-4 | nikkel(II)silicaat | nickel(II) silicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15244-37-8 | 630-456-1 | nikkel(II)sulfaat hexa-/ heptahydraat | nickel(II) sulfate hexa-/ heptahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 10101-97-0 | 600-152-3 | nikkel(II)sulfaat hexahydraat | nickel (II)sulphate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 27-5-2019 | 57, 69 | ||||||
| 16812-54-7 | 240-841-2 | nikkel(II)sulfide | nickel sulphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 7757-95-1 | 231-827-7 | nikkel(II)sulfiet | nickel(II) sulfite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15684-36-3 | 671-251-7 | nikkel(II)tetrafluorboraat hexahydraat | nickel(II) tetrafluoroborate hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 16083-14-0 | 240-235-8 | nikkel(II)trifluoracetaat | nickel(II) trifluoroacetate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 18721-51-2 | 242-533-3 | nikkel(II)waterstofcitraat | nickel(II) hydrogen citrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 933-670-6 | nikkel-(III) oxy gehydroxyleerd | nickel -(III) oxy hydroxyd | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 700-710-7 | nikkel(III)oxy hydroxide | nickel(III) oxy hydroxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 68511-62-6 | 270-944-8 | nikkel, 5,5'-azobis-2,4,6(1H,3H,5H)-pyrimidinetrion complexen | nickel, 5,5'-azobis-2,4,6(1H,3H,5H)-pyrimidinetrione complexes | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 15629-92-2 | 605-052-3 | nikkel, dichloor[1,1'-(1,3-propaandiyl)bis[1,1-difenylfosfine-κP]]- | nickel, dichloro[1,1'-(1,3-propanediyl)bis[1,1-diphenylphosphine-κP]]- | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 52625-25-9 | 258-051-1 | nikkel-3,5-bis(tert-butyl)-4-hydroxybenzoaat | nickel 3,5-bis(tert-butyl)-4-hydroxybenzoate (1:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 72152-45-5 | 276-399-2 | nikkelaat(6-), [22-[[[3-[[4,5-dihydro-3-methyl-5-oxo-1-[3-sulfo-4-[2-[2-sulfo-4-[(2,5,6-trichloor-4-pyrimidinyl)amino]fenyl]ethenyl]fenyl]-1H-pyrazol-4-yl]azo]-4-sulfofenyl]amino]sulfonyl]-29H,31H-ftalocyanine-1,8,15-trisulfonato(8-)-N29,N30,N31,N32]-, hexanatrium, (SP-4-2)- | nickelate(6-), [22-[[[3-[[4,5-dihydro-3-methyl-5-oxo-1-[3-sulfo-4-[2-[2-sulfo-4-[(2,5,6-trichloro-4-pyrimidinyl)amino]phenyl]ethenyl]phenyl]-1H-pyrazol-4-yl]azo]-4-sulfophenyl]amino]sulfonyl]-29H,31H-phthalocyanine-1,8,15-trisulfonato(8-)-N29,N30,N31,N32]-, hexasodium, (SP-4-2)- | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 14998-37-9 | 239-086-1 | nikkelacetaat | nickel acetate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27016-75-7 | 248-169-1 | nikkelarsenide | nickel arsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | ||||
| 68610-24-2 | 271-853-6 | nikkelbariumtitanium lichtgeel prideriet | nickel barium titanium primrose priderite | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 4454-16-4 | 224-699-9 | nikkelbis(2-ethylhexanoaat) | nickel bis(2-ethylhexanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3906-55-6 | 223-463-2 | nikkelbis(4-cyclohexylbutyraat) | nickel bis(4-cyclohexylbutyrate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 39819-65-3 | 254-642-3 | nikkelbis(benzeensulfonaat) | nickel bis(benzenesulfonate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 18718-11-1 | 242-522-3 | nikkelbis(diwaterstoffosfaat) | nickel bis(dihydrogen phosphate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14507-36-9 | 238-511-8 | nikkelbis(fosfinaat) | nickel bis(phosphinate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 84852-37-9 | 284-349-6 | nikkelbis(isononanoaat) | nickel bis(isononanoate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13770-89-3 | 237-396-1 | nikkelbis(sulfamidaat) | nickel bis(sulfamidate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14708-14-6 | 238-753-4 | nikkelbis(tetrafluorboraat) | nickel bis(tetrafluoroborate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 65229-23-4 | nikkelboorfosfide | nickel boron phosphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 12007-00-0 | 234-493-0 | nikkelboride | nickel boride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3333-67-3 | 222-068-2 | nikkelcarbonaat | nickel carbonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 958638-02-3 | 110-971-3 | nikkelcarbonaathydroxide, hydraat | Nickel carbonate hydroxide,hydrate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | ||||||
| 14721-18-7 | 238-766-5 | nikkelchromaat | nickel chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 373-02-4 | 206-761-7 | nikkeldiacetaat | nickel di(acetate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12068-61-0 | 235-103-1 | nikkeldiarsenide | nickel diarsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57, 92 | ||||
| 553-71-9 | 209-046-8 | nikkeldibenzoaat | nickel dibenzoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14550-87-9 | 238-596-1 | nikkeldibromaat | nickel dibromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13462-88-9 | 236-665-0 | nikkeldibromide | nickel dibromide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 67952-43-6 | 267-897-0 | nikkeldichloraat | nickel dichlorate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 7718-54-9 | 231-743-0 | nikkeldichloride | nickel dichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15586-38-6 | 239-646-5 | nikkeldichromaat | nickel dichromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 557-19-7 | 209-160-8 | nikkeldicyanide | nickel dicyanide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10028-18-9 | 233-071-3 | nikkeldifluoride | nickel difluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 3349-06-2 | 222-101-0 | nikkeldiformiaat | nickel diformate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12054-48-7 | 235-008-5 | nikkeldihydroxide | nickel dihydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13462-90-3 | 236-666-6 | nikkeldijodide | nickel diiodide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 16039-61-5 | nikkeldilactaat | nickel dilactate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 13138-45-9 | 236-068-5 | nikkeldinitraat | nickel dinitrate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-36-8 | 234-823-3 | nikkeldioxide | nickel dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13637-71-3 | 237-124-1 | nikkeldiperchloraat | nickel diperchlorate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12201-89-7 | 235-379-3 | nikkeldisilicide | nickel disilicide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13689-92-4 | 237-205-1 | nikkeldithiocyanaat | nickel dithiocyanate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 52502-12-2 | 257-970-5 | nikkeldivanadiumhexaoxide | nickel divanadium hexaoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 36026-88-7 | 252-840-4 | nikkelfosfinaat | nickel phosphinate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 26043-11-8 | 247-430-7 | nikkelhexafluorsilicaat | nickel hexafluorosilicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11113-74-9 | 234-348-1 | nikkelhydroxide | nickel hydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 27637-46-3 | 248-585-3 | nikkelisooctanoaat | nickel isooctanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11132-10-8 | nikkelkaliumfluoride | nickel potassium fluoride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 189139-63-7 | 839-353-8 | nikkel-kobalt-mangaanhydroxide | nickel cobalt manganese hydroxide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57, 126 | ||||||
| 193215-05-3 | 878-730-1 | nikkellithium-mangaan-kobaltoxide (LiNi0,6Mn0,2Co0,2O2) | lithium nickel manganese cobalt oxide (LiNi0.6Mn0.2Co0.2O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 193215-53-1 | 878-731-7 | nikkellithium-mangaan-kobaltoxide (LiNi0.5Mn0.3Co0.2O2) | lithium nickel manganese cobalt oxide (LiNi0.5Mn0.3Co0.2O2) | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 34, 57 | ||||||
| 11099-02-8 | 234-323-5 | nikkelmonoxide | nickel monoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1313-99-1 | 215-215-7 | nikkelmonoxide | nickel oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 17861-62-0 | nikkelnitriet | nickel dinitrite | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 34, 57 | |||||||
| 547-67-1 | 208-933-7 | nikkeloxalaat | nickel oxalate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 934-643-1 | nikkeloxide volledig gestabiliseerd zircornium | nickel oxide full stablized zircornium | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 15060-62-5 | 239-125-2 | nikkelselenaat | nickel selenate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1314-05-2 | 215-216-2 | nikkelselenide | nickel selenide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 31748-25-1 | 250-788-7 | nikkelsilicaat | nickel silicate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-38-0 | 234-824-9 | nikkelstannaat | nickel tin trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-72-2 | 234-829-6 | nikkelsubsulfide | trinickel disulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 7786-81-4 | 232-104-9 | nikkelsulfaat | nickel sulfate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 10101-98-1 | 600-153-9 | nikkelsulfaat heptahydraat | nickel sulfate heptahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 124594-15-6 | 682-895-3 | nikkelsulfamaat tetrahydraat | nickel sulfamate tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 11113-75-0 | 234-349-7 | nikkelsulfide | nickel sulphide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-51-7 | 683-050-1 | nikkelsulfide (NiS2) | nickel sulfide (NiS2) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 12142-88-0 | 235-260-6 | nikkeltelluride | nickel telluride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15852-21-8 | 239-974-9 | nikkeltelluurtetraoxide | nickel tellurium tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15851-52-2 | 239-967-0 | nikkeltelluurtrioxide | nickel tellurium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13463-39-3 | 236-669-2 | nikkeltetracarbonyl | tetracarbonylnickel | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 12653-76-8 | 235-752-0 | nikkeltitaniumoxide | nickel titanium oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12035-39-1 | 234-825-4 | nikkeltitaniumtrioxide | nickel titanium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15780-33-3 | 239-876-6 | nikkeltriuraandecaoxide | nickel triuranium decaoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| nikkelverbindingen | nickel compounds | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 33 | ||||||||
| 14332-34-4 | 238-278-2 | nikkelwaterstoffosfaat | nickel hydrogen phosphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14177-51-6 | 238-032-4 | nikkelwolfraamtetraoxide | nickel tungsten tetraoxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 70692-93-2 | 274-755-1 | nikkelzirkoniumtrioxide | nickel zirkonium trioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12255-08-2 | 235-503-6 | niobiumarsenide | niobium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 98-72-6 | 202-695-8 | nitarson | nitarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13510-48-0 | 690-699-4 | nitraatzuur, beryllium zout, tetrahydraat | nitric acid, beryllium salt, tetrahydrate | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 57, 69 | ||||||
| 98-95-3 | 202-716-0 | nitrobenzeen | nitrobenzene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| nitrobenzotrifluoriden | nitrobenzo trifluorides | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 1836-75-5 | 217-406-0 | nitrofeen | nitrofen | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 621-64-7 | 210-698-0 | nitrosodipropylamine | nitrosodipropylamine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 872-50-4 | 212-828-1 | N-methyl-2-pyrrolidon | N-methyl-2-pyrrolidone | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 79-16-3 | 201-182-6 | N-methylacetamide | N-methylacetamide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 123-39-7 | 204-624-6 | N-methylformamide | N-methylformamide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 924-42-5 | 213-103-2 | N-methylolacrylamide | N-(hydroxymethyl)acrylamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | |||||
| 31506-32-8 | 250-665-8 | N-methylperfluorooctaan-sulfonamide | N-methylperfluorooctanesulfonamide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 57, 96 | ||||
| 2355-31-9 | N-methylperfluorooctaan-sulfonamidoazijnzuur | N-methylperfluorooctanesulfonamidoacetic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 57, 69, 96 | ||||||
| 62-75-9 | 200-549-8 | N-nitrosodimethylamine | dimethylnitrosoamine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 27753-52-2 | 248-637-5 | nonabroom-1,1'-bifenyl | nonabromo-1,1'-biphenyl | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 57 | ||||||
| 307-63-1 | 206-207-4 | nonacosafluor-1-joodtetradecaan | nonacosafluoro-1-iodotetradecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 558-97-4 | 209-199-0 | nonadecafluor-9-joodnonaan | nonadecafluoro-9-iodononane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 25154-52-3 | 246-672-0 | nonylfenol | nonylphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| nonylfenol en nonylfenolethoxylaten | nonylphenol and nonylphenolethoxylates | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 68412-54-4 | 500-209-1 | nonylfenol, vertakt, geëthoxyleerd | nonylphenol, branched, ethoxylated | Ja | MVP 1 | 0,05 mg/Nm3 | 12-11-2019 | 57 | |||||
| nonylfenolen | nonylphenols | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| nonylfenolethoxylaat met >8 ethoxymonomeren (NPEO>8) | nonylphenolethoxylate with >8 ethoxymonomers (NPEO>8) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| nonylfenolethoxylaat met 1-2 ethoxymonomeren (NPEO1+2) | nonylphenolethoxylate with 1-2 ethoxymonomers (NPEO1+2) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| nonylfenolethoxylaat met 1-2 ethoxymonomeren gecarboxyleerd (NPE1+2C) | nonylphenolethoxylate with 1-2 ethoxymonomers carboxylated (NPEO1+2C) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| nonylfenolethoxylaat met 3-8 ethoxymonomeren (NPEO3-8) | nonylphenolethoxylate with 3-8 ethoxymonomers (NPEO3-8) | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| 9016-45-9 | 500-024-6 | nonylfenolethoxylaten | nonylphenolethoxylates and related substances | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 932-998-7 | nonylfenolpolyglycolether | nonylphenolpolyglycolether | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | ||||||
| 116714-46-6 | 601-443-8 | novaluron | novaluron | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 776297-69-9 | N-pentyl-isopentylftalaat | N-pentyl-isopentylphthalate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 53 | |||||
| 852527-45-8 | 632-946-0 | N-succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluorundecanoaat | N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 597-82-0 | 209-909-9 | O,O,O-trifenylfosforthioaat | O,O,O-triphenyl phosphorothioate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | |||||
| 97-56-3 | 202-591-2 | o-aminoazotolueen | o-aminoazotoluene, 4-amino-2',3-dimethylazobenzene, 4-o-tolylazo-o-toluidine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 90-04-0 | 201-963-1 | o-anisidine | o-anisidine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 90480-55-0 | 291-790-8 | octaanzuur, pentadecafluor-, vertakt | octanoic acid, pentadecafluoro-, branched | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 90480-56-1 | 291-791-3 | octaanzuur, pentadecafluor-, vertakt, ammoniumzout | octanoic acid, pentadecafluoro-, branched, ammonium salt | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 32536-52-0 | 251-087-9 | octabroomdifenylether | diphenyl ether, octabromo derivative | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | ||||
| 2234-13-1 | 218-778-7 | octachloornaftaleen | octachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 3248-63-3 | 221-830-1 | octacosafluor-14-jood-2-(trifluormethyl)tetradecaan | octacosafluoro-14-iodo-2-(trifluoromethyl)tetradecane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 99955-83-6 | octadecaanzuur, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecylester | octadecanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 7428-48-0 | 231-068-1 | octadecanoaat, loodzout | stearic acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 360-89-4 | 206-640-9 | octafluor-2-buteen | octafluoro-2-butene | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 115-25-3 | 204-075-2 | octafluorcyclobutaan | cyclooctafluorobutane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 76-19-7 | 200-941-9 | octafluorpropaan | perflutren | Ja | gO.2 | 50 mg/Nm3 | 15-11-2024 | 44, 96 | |||||
| 556-67-2 | 209-136-7 | octamethyltetrasiloxaan | octamethylcyclotetrasiloxane | Ja | MVP 2 | 1 mg/Nm3 | 6-7-2018 | ||||||
| 107-51-7 | 203-497-4 | octamethyltrisiloxaan | octamethyltrisiloxane | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 13246-32-7 | 236-227-9 | O-fenyleenbis(dimethylarsine) | o-phenylenebis(dimethylarsine) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1758-48-1 | 217-154-1 | o-fenyleendiarsonzuur | o-phenylenediarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 109202-58-6 | 432-750-3 | O-hexyl-N-ethoxycarbonylthiocarbamaat | O-hexyl-N-ethoxycarbonylthiocarbamate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 103122-66-3 | 434-350-4 | O-isobutyl-N-ethoxycarbonylthiocarbamaat | O-isobutyl-N-ethoxy carbonylthiocarbamate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 92062-09-4 | 295-523-6 | olierijke paraffine (aardolie), met waterstof behandeld | slack wax (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 92062-10-7 | 295-524-1 | olierijke paraffine (aardolie), smeltend bij lage temperaturen | slack wax (petroleum), low-melting | Ja | 2-12-2013 | 4, 64 | |||||||
| 92062-11-8 | 295-525-7 | olierijke paraffine (aardolie), smeltend bij lage temperatuur, met waterstof behandeld | slack wax (petroleum), low-melting, hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 64742-61-6 | 265-165-5 | olierijke paraffinewas (aardolie) | slack wax (petroleum) | Ja | 2-12-2013 | 4, 64 | |||||||
| 100684-49-9 | 309-723-9 | olierijke paraffinewas (aardolie), behandeld met koolstof | slack wax (petroleum), carbon-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 97863-06-4 | 308-158-5 | olierijke paraffinewas (aardolie), laag-smeltend behandeld met kiezelzuur | slack wax (petroleum), low-melting, silicic acid-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 97863-05-3 | 308-156-4 | olierijke paraffinewas (aardolie), laagsmeltend behandeld met klei | slack wax (petroleum), low-melting, clay-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 97863-04-2 | 308-155-9 | olierijke paraffinewas (aardolie), laagsmeltend behandeld met kool | slack wax (petroleum), low-melting, carbon-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 90669-78-6 | 292-660-3 | olierijke paraffinewas (aardolie), met klei behandeld | alack wax (petroleum), clay-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 90669-77-5 | 292-659-8 | olierijke paraffinewas (aardolie), zuur-behandeld | slack wax (petroleum), acid-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| oligomeren van chroomzuur en dichroomzuur | oligomers of chromic acid and dichromic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | |||||||
| 700-960-7 | oligomerisatie- en alkyleringsreactieproducten van 2-fenylpropeen en fenol | oligomerisation and alkylation reaction products of 2-phenylpropene and phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 25-1-2024 | 81 | ||||||
| 68515-84-4 | 271-112-7 | olivijn nikkelgroen | olivine, nickel green | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 64742-89-8 | 265-192-2 | oplosmiddelnafta (aardolie), lichte alifatische | solvent naphtha (petroleum), light aliph. | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-95-6 | 265-199-0 | oplosmiddelnafta (aardolie), lichte aromatische | solvent naphtha (petroleum), light arom. | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 19, 65 | |||||
| 68512-78-7 | 270-988-8 | oplosmiddelnafta (aardolie), lichte aromatische, waterstofbehandeld | solvent naphtha (petroleum), light arom., hydrotreated | Ja | 2-12-2013 | 4, 65 | |||||||
| 92062-15-2 | 295-529-9 | oplosmiddelnafta (aardolie), waterstofbehandelde lichte, nafteenhoudend | solvent naphtha (petroleum), hydrotreated light naphthenic | Ja | 2-12-2013 | 4, 65 | |||||||
| 64742-94-5 | 265-198-5 | oplosmiddelnafta (aardolie), zwaar aromatisch | solvent naphtha (petroleum), heavy arom. | MVP 1 | 0,05 mg/Nm3 | 19-5-2021 | 80, 82 | ||||||
| 85536-19-2 | 287-500-4 | oplosmiddelnafta (kool), cumaroon -styreen bevattend | solvent naphtha (coal), coumarone-styrene contg. | Ja | 2-12-2013 | 4, 61 | |||||||
| 85536-17-0 | 287-498-5 | oplosmiddelnafta (kool), licht | solvent naphtha (coal), light | Ja | 2-12-2013 | 4, 61 | |||||||
| 85536-20-5 | 287-502-5 | oplosmiddelnafta (kool), xyleen-styreenfractie | solvent naphtha (coal), xylene-styrene cut | Ja | 2-12-2013 | 4, 61 | |||||||
| organische arseenverbindingen | organic arsenic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||||
| organische kwikverbindingen | organic mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||||
| organische tinverbindingen | organostannic compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| organoloodverbindingen | organic lead compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| 13840-56-7 | 237-560-2 | orthoboorzuur natriumzout | orthoboric acid, sodium salt | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 20786-60-1 | 244-038-8 | orthoboorzuur, kaliumzout | orthoboric acid, potassium salt | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 35498-15-8 | 252-594-8 | orthoboorzuur, lood(2+)zout | orthoboric acid, lead(2+) salt | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 26038-87-9 | 247-421-8 | orthoboorzuur, verbinding met 2-aminoethanol | orthoboric acid, compound with 2-aminoethanol | MVP 1 | 0,05 mg/Nm3 | 19-11-2019 | 57, 69 | ||||||
| 84-15-1 | 201-517-6 | o-terfenyl | o-terphenyl | Ja | MVP 1 | 0,05 mg/Nm3 | 24-7-2020 | 76 | |||||
| 304671-77-0 | 621-165-0 | o-tolidine dihydrochloride hydraat | o-Tolidine dihydrochloride hydrate | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | 57, 69 | ||||||
| 95-53-4 | 202-429-0 | o-toluidine | o-toluidine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 20543-06-0 | 243-867-2 | oxaalzuur nikkelzout | oxalic acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1003318-67-9 | 801-263-1 | oxathiapiproline | oxathiapiprolin | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 183146-60-3 | oxiraan, methyl-, polymeer met oxiraan, mono[2-hydroxy-3-[(γ-ω-perfluor-C8-20-alkyl) thio] propyl] ethers | oxirane, methyl-, polymer with oxirane, mono[2-hydroxy-3-[( γ-ω-perfluoro-C8-20-alkyl)thio]propyl] ethers | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 306-12-7 | 206-178-8 | oxofenarsenaat | oxophenarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 538-03-4 | 208-682-3 | oxofenarsine hydrochloride | oxophenarsine hydrochloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 30784-30-6 | 250-339-5 | p-(1,1-dimethylheptyl)fenol | p-(1,1-dimethylheptyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 80-46-6 | 201-280-9 | p-(1,1-dimethylpropyl)fenol | p-(1,1-dimethylpropyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||
| 17404-66-9 | 241-427-4 | p-(1-methyloctyl)fenol | p-(1-methyloctyl)phenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 326475-46-1 | palladium, dichloorbis[tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)fenyl]fosfine-κP ]- | palladium, dichlorobis[tris[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]phosphine-κP]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 64742-70-7 | 265-174-4 | paraffinehoudende oliën (aardolie), katalytisch van was ontdane zware | paraffin oils (petroleum), catalytic dewaxed heavy | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-71-8 | 265-176-5 | paraffineoliën (aardolie), katalytisch van was ontdane lichte | paraffin oils (petroleum), catalytic dewaxed light | Ja | 2-12-2013 | 4, 62 | |||||||
| 92129-09-4 | 295-810-6 | paraffineoliën (aardolie), solvent-geraffineerde van was ontdane zware | paraffin oils (petroleum), solvent-refined dewaxed heavy | Ja | 2-12-2013 | 4, 62 | |||||||
| 92045-71-1 | 295-454-1 | paraffinewassen (kool), bruinkool hoge temperatuur teer | paraffin waxes (coal), brown-coal-high-temp. tar | Ja | 2-12-2013 | 4, 63 | |||||||
| 97926-78-8 | 308-298-7 | paraffinewassen (kool), bruinkool hoge temperatuur teer, behandeld met kiezelzuur | paraffin waxes (coal), brown-coal high-temp tar, silicic acid-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97926-77-7 | 308-297-1 | paraffinewassen (kool), bruinkool hoge temperatuur teer, behandeld met klei | paraffin waxes (coal), brown-coal high-temp tar, clay-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 97926-76-6 | 308-296-6 | paraffinewassen (kool), bruinkool hoge temperatuur teer, behandeld met kool | paraffin waxes (coal), brown-coal high-temp. tar, carbon-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 92045-72-2 | 295-455-7 | paraffinewassen (kool), bruinkool hoge temperatuur teer, waterstofbehandeld | paraffin waxes (coal), brown-coal-high-temp. tar, hydrotreated | Ja | 2-12-2013 | 4, 63 | |||||||
| 140-66-9 | 205-426-2 | para-tert-octylfenol | octylphenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 37680-73-2 | PCB 101 | 2,4,5,2',5'-Pentachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 32598-14-4 | PCB 105 | 2,3,3',4,4'-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 74472-37-0 | PCB 114 | 2,3,4,4',5-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 31508-00-6 | PCB 118 | 2,3',4,4',5-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 65510-44-3 | PCB 123 | 2,3',4,4',5'-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 57465-28-8 | PCB 126 | 3,3',4,4',5-pentachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 35065-28-2 | PCB 138 | 2,2',3,4,4',5'-hexachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 35065-27-1 | 621-381-5 | PCB 153 | 2,2',4,4',5,5'-hexachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | ||||||
| 38380-08-4 | PCB 156 | 2,3,3',4,4',5-Hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 69782-90-7 | PCB 157 | 2,3,3',4,4',5'-hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 52663-72-6 | PCB 167 | 2,3',4,4',5,5'-hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 32774-16-6 | PCB 169 | 3,3',4,4',5,5'-hexachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 35065-29-3 | PCB 180 | 2,2',3,4,4',5,5'-heptachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 39635-31-9 | PCB 189 | 2,3,3',4,4',5,5'-heptachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 7012-37-5 | 230-293-2 | PCB 28 | 2,4,4'-trichlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | ||||||
| 35693-99-3 | PCB 52 | 2,2',5,5'-tetrachlorobiphenyl | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 9 | |||||||
| 32598-13-3 | PCB 77 | 3,3',4,4'-tetrachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 70362-50-4 | PCB 81 | 3,4,4',5-tetrachlorobiphenyl | Ja | ERS | 0,05 ng TEQ/Nm3 | 24-8-2015 | |||||||
| 5216-25-1 | 226-009-1 | p-chloorbenzotrichloride | p-chlorobenzotrichloride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 61789-60-4 | 263-072-4 | pek | pitch | Ja | 2-12-2013 | 4, 63 | |||||||
| 65996-93-2 | 266-028-2 | pek koolteer, hoge temperatuur | pitch, coal tar, high-temp. | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 90669-57-1 | 292-651-4 | pek koolteer, lage temperatuur | pitch, coal tar, low-temp | Ja | 2-12-2013 | 4, 63 | |||||||
| 90669-59-3 | 292-654-0 | pek koolteer, lage temperatuur, geoxideerd | pitch, coal tar, low-temp., oxidized | Ja | 2-12-2013 | 4, 63 | |||||||
| 90669-58-2 | 292-653-5 | pek koolteer, lage temperatuur, met warmte behandeld | pitch, coal tar, low-temp., heat-treated | Ja | 2-12-2013 | 4, 63 | |||||||
| 68187-57-5 | 269-109-0 | pek koolteer-aardolie | pitch, coal tar-petroleum | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 63 | |||||
| 94114-13-3 | 302-650-3 | pek, koolteer, hoge temperatuur, secundair | pitch, coal tar, high-temp., secondary | Ja | 2-12-2013 | 4, 63 | |||||||
| 121575-60-8 | 310-162-7 | pek, koolteer, hoge temperatuur, warmte-behandeld | pitch, coal tar, high-temp., heat-treated | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 63 | |||||
| 302911-86-0 | pentaandizuur, 3-[2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)oxy]-2-oxoethyl]-3-hydroxy-, 1,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl) ester | pentanedioic acid, 3-[2-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)oxy]-2-oxoethyl]-3-hydroxy-, 1,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) ester | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-68-3 | pentaanzuur, 2,2,3,4,5,5,5-heptafluor-3-(1,1,2,2,2-pentafluorethyl)-4-(trifluormethyl)- | pentanoic acid, 2,2,3,4,5,5,5-heptafluoro-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-75-2 | pentaanzuur, 2,2,3,5,5,5-hexafluor-3,4,4-tris(trifluormethyl)- | pentanoic acid, 2,2,3,5,5,5-hexafluoro-3,4,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-67-2 | pentaanzuur, 2,2,4,4,5,5,5-heptafluor-3-(1,1,2,2,2-pentafluorethyl)-3-(trifluormethyl)- | pentanoic acid, 2,2,4,4,5,5,5-heptafluoro-3-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-74-1 | pentaanzuur, 2,2,4,5,5,5-hexafluor-3,3,4-tris(trifluormethyl)- | pentanoic acid, 2,2,4,5,5,5-hexafluoro-3,3,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-77-4 | pentaanzuur, 2,3,3,4,4,5,5,5-octafluor-2-(1,1,2,2,3,3,3-heptafluorpropyl)- | pentanoic acid, 2,3,3,4,4,5,5,5-octafluoro-2-(1,1,2,2,3,3,3-heptafluoropropyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-76-3 | pentaanzuur, 2,3,3,4,4,5,5,5-octafluor-2-[1,2,2,2-tetrafluor-1-(trifluormethyl)ethyl]- | pentanoic acid, 2,3,3,4,4,5,5,5-octafluoro-2-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-65-0 | pentaanzuur, 2,3,3,4,5,5,5-heptafluor-2-(1,1,2,2,2-pentafluorethyl)-4-(trifluormethyl)- | pentanoic acid, 2,3,3,4,5,5,5-heptafluoro-2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-73-0 | pentaanzuur, 2,3,3,5,5,5-hexafluor-2,4,4-tris(trifluormethyl)- | pentanoic acid, 2,3,3,5,5,5-hexafluoro-2,4,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-64-9 | pentaanzuur, 2,3,4,4,5,5,5-heptafluor-2-(1,1,2,2,2-pentafluorethyl)-3-(trifluormethyl)- | pentanoic acid, 2,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,2-pentafluoroethyl)-3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-66-1 | pentaanzuur, 2,3,4,4,5,5,5-heptafluor-3-(1,1,2,2,2-pentafluorethyl)-2-(trifluormethyl)- | pentanoic acid, 2,3,4,4,5,5,5-heptafluoro-3-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-72-9 | pentaanzuur, 2,3,4,5,5,5-hexafluor-2,3,4-tris(trifluormethyl)- | pentanoic acid, 2,3,4,5,5,5-hexafluoro-2,3,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-71-8 | pentaanzuur, 2,4,4,5,5,5-hexafluor-2,3,3-tris(trifluormethyl)- | pentanoic acid, 2,4,4,5,5,5-hexafluoro-2,3,3-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-63-8 | pentaanzuur, 3,3,4,4,5,5,5-heptafluor-2-(1,1,2,2,2-pentafluorethyl)-2-(trifluormethyl)- | pentanoic acid, 3,3,4,4,5,5,5-heptafluoro-2-(1,1,2,2,2-pentafluoroethyl)-2-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-70-7 | pentaanzuur, 3,3,4,5,5,5-hexafluor-2,2,4-tris(trifluormethyl)- | pentanoic acid, 3,3,4,5,5,5-hexafluoro-2,2,4-tris(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 1882109-69-4 | pentaanzuur, 3,4,4,5,5,5-hexafluor-2,2,3-(trifluormethyl)- | pentanoic acid, 3,4,4,5,5,5-hexafluoro-2,2,3-(trifluoromethyl)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 71608-61-2 | pentaanzuur, 4,4-bis[(γ-ω-perfluor-C8-20-alkyl) thio] derivaten, verbindingen met diethanolamine | pentanoic acid, 4,4-bis[(γ-ω-perfluoro-C8-20-alkyl)thio]derivs., compds. with diethanolamine | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 32534-81-9 | 251-084-2 | pentabroomdifenylether | diphenyl ether, pentabromo derivative pentabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 35 | |||
| 85-22-3 | 201-593-0 | pentabroomethylbenzeen | 2,3,4,5,6-pentabromoethylbenzene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 1825-21-4 | pentachlooranisol | pentachloro-anisole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 608-93-5 | 210-172-0 | pentachloorbenzeen | pentachlorobenzene | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 133-49-3 | 205-107-8 | pentachloorbenzeenthiol | pentachlorobenzenethiol | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 49 | ||||||
| 76-01-7 | 200-925-1 | pentachloorethaan | pentachloroethane | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 87-86-5 | 201-778-6 | pentachloorfenol | pentachlorophenol | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 78 | ||||
| 3772-94-9 | 223-220-0 | pentachloorfenyl lauraat | pentachlorophenyl laurate | Ja | MVP 1 | 0,05 mg/Nm3 | 23-8-2024 | 57 | |||||
| 1321-64-8 | 215-320-8 | pentachloornaftaleen | pentachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 335-79-5 | pentadecaan, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12, 12,13,13,14,14,15,15-hentriacontafluor-15-jood- | pentadecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15-hentriacontafluoro-15-iodo- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 335-66-0 | 206-396-3 | pentadecafluoroctylfluoride | pentadecafluorooctyl fluoride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 7784-36-3 | 232-061-6 | pentafluorarsenaat | pentafluoroarsorane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 354-33-6 | 206-557-8 | pentafluorethaan | pentafluoroethane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 7786-36-9 | 232-096-7 | pentahydroxyarseen | pentahydroxyarsorane | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 7216-95-7 | 404-290-3 | pentakalium 2,2',2'',2''',2''''-(ethaan-1,2-diylnitrilo) penta-acetaat | pentapotassium 2,2’,2’’,2’’’,2’’’’-(ethane-1,2-diylnitrilo)pentaacetate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 12065-90-6 | 235-067-7 | pentaloodtetraoxidesulfaat | pentalead tetraoxide sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 140-01-2 | 205-391-3 | pentanatrium diethyleen-triaminepenta-azijnzuur | pentasodium pentetate | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | ||||||
| 49663-84-5 | 256-418-0 | pentazinkchromaatoctahydroxide | pentazinc chromate octahydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 183675-82-3 | 606-001-8 | penthiopyrad | (RS)-N-[2-(1,3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide | Ja | MVP 1 | 0,05 mg/Nm3 | 22-11-2024 | 96, 98 | |||||
| per- en polyfluoralkylstoffen | per- and polyfluoroalkyl substances | Ja | zie voetnoot | 14-11-2024 | 97, 99 | ||||||||
| 13517-20-9 | 603-902-8 | perboorzuur (H3BO2(O2)) mononatriumzout trihydraat | perboric acid (H3BO2(O2)), monosodium salt trihydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 10332-33-9 | 600-419-4 | perboorzuur (HBO(O2)) natriumzout monohydraat | perboric acid (HBO(O2)), sodium salt, monohydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 10486-00-7 | 600-611-8 | perboorzuur (HBO(O2)) natriumzout tetrahydraat | perboric acid (HBO(O2)), sodium salt, tetrahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 11138-47-9 | 234-390-0 | perboorzuur natriumzout | perboric acid, sodium salt | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 12040-72-1 | perboorzuur natriumzout monohydraat | perboric acid, sodium salt, monohydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 37244-98-7 | perboorzuur natriumzout tetrahydraat | perboric acid, sodium salt, tetrahydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 13520-61-1 | 677-691-6 | perchloorzuur, nikkel(2+)zout, hexahydraat | perchloric acid, nickel(2+) salt, hexahydrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 338-83-0 | 206-420-2 | perfluamine | perfluamine | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||
| 10493-43-3 | 234-018-7 | perfluor(ethylvilyl)ether | perfluoro(ethyl vinyl)ether | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 1187-93-5 | 214-703-7 | perfluor(methylvinyl)ether | perfluoro(methyl vinyl ether) | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 355-25-9 | 206-580-3 | perfluorbutaan | perflubutane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 375-73-5 | 206-793-1 | perfluorbutaansulfonzuur | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulphonic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 96 | ||||
| 799-977-0 | perfluorbutaansulfonzuur en zijn zouten | perfluorobutane sulfonic acid and its salts | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 96 | |||||
| 375-22-4 | 206-786-3 | perfluorbutaanzuur en zijn zouten en precursoren | perfluorobutanoic acid and its salts and precursors | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98, 100 | |||||
| 335-77-3 | 206-401-9 | perfluordecaansulfonaat | henicosafluorodecanesulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 335-76-2 | 206-400-3 | perfluordecaanzuur | nonadecafluorodecanoic acid | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | 96 | |||
| 307-55-1 | 206-203-2 | perfluordodecanoaat | tricosafluorododecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 375-92-8 | 206-800-8 | perfluorheptaansulfonaat | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 375-85-9 | 206-798-9 | perfluorheptaanzuur | perfluoroheptanoic acid | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 29-3-2021 | 88, 89, 96 | |||
| 355-42-0 | 206-585-0 | perfluorhexaan | perflexane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 355-46-4 | 206-587-1 | Perfluorhexaan-1-sulfonzuur | perfluorohexane-1-sulphonic acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 24-8-2017 | 50, 96 | |||
| 67905-19-5 | 267-638-1 | perfluorhexadecanoaat | perfluoropalmitic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 610800-34-5 | perfluorhexylperfluoroctyl fosfinaat | perfluorohexylperfluorooctyl phosphinate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 382-21-8 | perfluorisobuteen | perfluoroisobutylene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 8, 96 | ||||||
| perfluorkoolwaterstoffen (C1-C6) | perfluorohydrocarbons | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||||
| 375-95-1 | 206-801-3 | perfluornonaanzuur | perfluorononan-1-oic acid | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 22-2-2016 | 96 | |||
| 1763-23-1 | 217-179-8 | perfluoroctaansulfonzuur | heptadecafluorooctane-1-sulphonic acid | Ja | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 30, 96 | ||
| 335-67-1 | 206-397-9 | perfluoroctaanzuur | pentadecafluorooctanoic acid | Ja | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | 75, 96 | ||
| 33496-48-9 | 251-543-7 | perfluoroctaanzuuranhydride | perfluorooctanoic anhydride | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 16517-11-6 | 240-582-5 | perfluoroctadecanoaat | perfluorostearic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 3102-79-2 | 671-486-5 | perfluoroctylethyldichloormethyl silaan | perfluorooctylethyldichloromethyl silane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 74612-30-9 | 633-334-6 | perfluoroctylethyldimethylchloorsilaan | perfluorooctylethyldimethylchlorosilane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 78560-44-8 | 616-629-4 | perfluoroctylethyltrichloorsilaan | perfluorooctylethyltrichlorosilane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 83048-65-1 | 617-434-7 | perfluoroctylethyltrimethoxysilaan | perfluorooctylethyltrimethoxysilane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 678-26-2 | 211-647-5 | perfluorpentaan | perflenapent | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 2706-91-4 | 220-301-2 | perfluorpentaansulfonaat | perfluoropentane-1-sulphonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 2706-90-3 | 220-300-7 | perfluorpentanoaat | perfluorovaleric acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 376-06-7 | 206-803-4 | perfluortetradecaanzuur | heptacosafluorotetradecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 72629-94-8 | 276-745-2 | perfluortridecanoaat | pentacosafluorotridecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 2058-94-8 | 218-165-4 | perfluorundecanoaat | henicosafluoroundecanoic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 96 | ||||
| 81-33-4 | 201-344-6 | peryleen-3,4:9,10-tetracarboxydiimide | perylene-3,4:9,10-tetracarboxydiimide | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 10, 48 | ||||||
| pesticide, arseenverbinding | pesticide, arsenic compound | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||||
| pesticide, kwikverbinding | mercury based pesticide | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 42, 57 | ||||||||
| 8009-03-8 | 232-373-2 | petrolatum | petrolatum | Ja | 2-12-2013 | 4, 64 | |||||||
| 97862-98-1 | 308-150-1 | petrolatum (aardolie), behandeld met kiezelzuur | petrolatum (petroleum), silicic acid-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 100684-33-1 | 309-706-6 | petrolatum (aardolie), behandeld met klei | petrolatum (petroleum), clay-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 97862-97-0 | 308-149-6 | petrolatum (aardolie), behandeld met kool | petrolatum (petroleum), carbon-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 64743-01-7 | 265-206-7 | petrolatum (aardolie), geoxideerd | petrolatum (petroleum), oxidized | Ja | 2-12-2013 | 4, 64 | |||||||
| 85029-74-9 | 285-098-5 | petrolatum (aardolie), met alumina behandeld | petrolatum (petroleum), alumina-treated | Ja | 2-12-2013 | 4, 64 | |||||||
| 92045-77-7 | 295-459-9 | petrolatum (aardolie), met waterstof behandeld | petrolatum (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 64 | |||||||
| 68476-85-7 | 270-704-2 | petroleumgassen vloeibaar gemaakt | petroleum gases, liquefied | Ja | 2-12-2013 | 4, 60 | |||||||
| 68476-86-8 | 270-705-8 | petroleumgassen vloeibaar gemaakt, stankvrij gemaakt | petroleum gases, liquefied, sweetened | Ja | 2-12-2013 | 4, 60 | |||||||
| 137641-05-5 | 639-953-8 | picolinafen | picolinafen | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 117428-22-5 | 601-478-9 | picoxystrobin | picoxystrobin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2024 | 96, 98 | |||||
| 26543-97-5 | 247-770-6 | p-isononylfenol | p-isononylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2022 | 57 | |||||
| 31631-13-7 | p-isononyl-fenol, fosfiet (3:1) | phenol, p-isononyl-, phosphite (3:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 20-1-2022 | 57 | ||||||
| 12044-52-9 | platina arsenide (PtAs2) | platinum arsenide (PtAs2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 104-40-5 | 203-199-4 | p-nonylfenol | p-nonylphenol | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||
| 931-562-3 | poly(oxy-1,2-ethaandiyl), a-(nonylfenyl)-w-hydroxy- | poly(oxy-1,2-ethanediyl), a-(nonylphenyl)-w-hydroxy- (CAS 9016-45-9) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-5-2024 | 57 | ||||||
| 932-688-1 | poly(oxy-1,2-ethaandiyl), α-(nonylfenyl)-ω-hydroxy-, vertakt | poly(oxy-1,2-ethanediyl), α-(nonylphenyl)-ω-hydroxy-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 17-5-2024 | 57 | ||||||
| 59536-65-1 | polybroombifenylen | polybromobiphenyls | MVP 1 | 0,05 mg/Nm3 | 24-04-2017 | 13, 57 | |||||||
| polybroomdibenzodioxines | polybrominated dibenzo-p-dioxins | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| polybroomdibenzofuranen | polybrominated dibenzo furans | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| 1336-36-3 | 215-648-1 | polychloorbifenylen | polychlorinated biphenyls | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 39 | |||
| polychloordibenzofuranen | polychlorinated dibenzofurans | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | ||||||
| polychloordibenzo-p-dioxinen | polychlorinated dibenzo-p-dioxins | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | ||||||
| 70776-03-3 | 274-864-4 | polychloornaftalenen | polychlorinated naphthalenes | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 61788-33-8 | 262-968-2 | polychloorterfenylen | polychlorinated terphenyls | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 45 | ||||||
| polycyclische aromatische koolwaterstoffen | polycyclic aromatic hydrocarbons | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 37486-69-4 | polyfluor-5,8,11,14-tetrakis(polyfluoralkyl)polyoxaalkaan | polyfluoro-5,8,11,14-tetrakis(polyfluoralkyl)-polyoxaalkane | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| polyhalogeendibenzodioxines | polyhalogen dibenzo dioxins | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| polyhalogeendibenzofuranen | polyhalogen dibenzo furans | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | 8 | ||||||||
| 9002-84-0 | 618-337-2 | polytetrafluorethyleen | polytetrafluoroethylene | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 24937-79-9 | 607-458-6 | polyvinylideenfluoride | polyvinylidene fluoride | Ja | S | 3 mg/Nm3 | 15-11-2024 | 44, 96 | |||||
| 12044-28-9 | 234-953-0 | praseodymium arsenide | praseodymium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 157283-68-6 | 682-028-9 | propaan-2-yl (5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluormethyl)fenoxy]-1-buteen-1-yl]cyclopentyl]-5-heptenoaat | propan-2-yl (5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-en-1-yl]cyclopentyl]hept-5-enoate | Ja | MVP 1 | 0,05 mg/Nm3 | 18-11-2024 | 96, 98 | |||||
| 68187-42-8 | 269-095-6 | propaanamide, 3-[(γ-ω-perfluor-C4-10-alkyl) thio]-derivaten | propanamide, 3-[(γ-ω-perfluoro-C4-10-alkyl)thio] derivs. | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 1623-05-8 | 216-600-2 | propaanperfluorpropyl vinyl ether | 1,1,1,2,2,3,3-heptafluoro-3-[(trifluorovinyl)oxy]propane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 75579-40-7 | propaanzuur, 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)-, (-)- | propanoic acid, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-, (-)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 57, 96 | |||||
| 75579-39-4 | propaanzuur, 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)-, (+)- | propanoic acid, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-, (+)- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 57, 96 | |||||
| 60207-90-1 | 262-104-4 | propiconazool | propiconazole | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | ||||||
| 107-34-6 | 203-482-2 | propylarsonzuur | propylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 75-56-9 | 200-879-2 | propyleenoxide | propylene oxide | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 94125-34-5 | 619-000-2 | prosulfuron | prosulfuron | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 15122-58-4 | 239-179-7 | proustiet (Ag3(AsS3)) | proustite (Ag3(AsS3)) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 106599-06-8 | p-sec-nonyl-fenol, fosfiet | phenol, p-sec-nonyl-, phosphite | Ja | MVP 1 | 0,05 mg/Nm3 | 20-1-2022 | 57 | ||||||
| 3969-54-8 | 223-588-2 | p-tolylarseenzuur | p-tolylarsonic acid | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 129-00-0 | 204-927-3 | pyreen | pyrene | Ja | MVP 1 | 0,05 mg/Nm3 | 27-05-2016 | ||||||
| 179101-81-6 | 605-845-4 | pyridalyl | pyridalyl | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 68391-11-7 | 269-929-9 | pyridine, alkylderivaten | pyridine, alkyl derivs. | Ja | 2-12-2013 | 4, 61 | |||||||
| 26299-14-9 | 247-595-5 | pyridiniumchloorchromaat | pyridinium chlorochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 20039-37-6 | 243-478-8 | pyridiniumdichromaat | pyridinium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 83042-08-4 | 625-358-0 | pyridiniumfluorchromaat | pyridinium fluorochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 13463-41-7 | 236-671-3 | pyrithionzink | pyrithione zinc | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | |||||
| 8012-00-8 | 232-382-1 | pyrochlore, antimoonlood geel | pyrochlore, antimony lead yellow | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 422556-08-9 | pyroxsulam | pyroxsulam | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | ||||||
| 148-24-3 | 205-711-1 | quinolin-8-ol | quinolin-8-ol | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 56549-24-7 | 621-797-7 | quinoliniumdichromaat | quinolinium dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 124495-18-7 | 602-997-3 | quinoxyfen | quinoxyfen | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68410-71-9 | 270-088-5 | raffinaten (aardolie), katalytische reformer, ethyleenglycol-water-tegenstroomextractie | raffinates (petroleum), catalytic reformer ethylene glycol-water countercurrent exts. | Ja | 2-12-2013 | 4, 65 | |||||||
| 68425-35-4 | 270-349-3 | raffinaten (aardolie), reformer, Lurgi-afscheider | raffinates (petroleum), reformer, Lurgi unit-sepd. | Ja | 2-12-2013 | 4, 65 | |||||||
| 97722-19-5 | 307-769-4 | raffinaten (aardolie), stoomgekraakte C4-fractie, cuproammoniumacetaatextractie, C3-5- en C3-5-onverzadigd, vrij van butadieen | raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 1303-22-6 | rammelsbergiet (NiAs2) | rammelsbergite (NiAs2) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 1471311-26-8 | 939-460-0 | reactieproduct van 1,3,4-thiadiazolidin-2,5-dithion, formaldehyde en fenol, heptyl derivaten | reaction product of 1,3,4-thiadiazolidine-2,5-dithione, formaldehyde and phenol, heptyl derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 25-11-2022 | 57 | |||||
| reactieproducten van 1,3,4-thiadiazolidin-2,5-dithion, formaldehyde en vertakt en lineair 4-heptylfenol | reaction products of 1,3,4-thiadiazolidine-2,5-dithione, formaldehyde and 4-heptylphenol, branched and linear | Ja | MVP 1 | 0,05 mg/Nm3 | 22-1-2018 | 55 | |||||||
| reactieproducten van paraformaldehyde en 2-hydroxypropylamine (ratio 3:2) | reaction products from paraformaldehyde and 2-hydroxypropylamine (ratio 3:2) | Ja | MVP 1 | 0,05 mg/Nm3 | 30-5-2017 | 58, 66 | |||||||
| reactieproducten van paraformaldehyde met 2-hydroxypropylamine (ratio 1:1) | reaction products of paraformaldehyde with 2-hydroxypropylamine (ratio 1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 58, 66 | |||||||
| 701-179-4 | reactieproducten van vetzuren, C18 (onverzadigd) alkyl met zwaveltrioxide, kaliumzouten | reaction products of fatty acids, C18 (unsaturated) alkyl with sulfur trioxide, potassium salts | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | ||||||
| 927-629-1 | residue, uitloging van nikkel mat | residue, nickel matte leaching | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 68607-30-7 | 271-763-7 | residuen (aardolie), aftopinrichting, laag zwavelgehalte | residues (petroleum), topping plant, low-sulfur | Ja | 2-12-2013 | 4 | |||||||
| 68513-66-6 | 271-010-2 | residuen (aardolie), alkyleringssplitter, C4-rijk | residues (petroleum), alkylation splitter, C4-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68333-22-2 | 269-777-3 | residuen (aardolie), atmosferische destillatie | residues (petroleum), atmospheric | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-45-3 | 265-045-2 | residuen (aardolie), atmosferische destillatietoren | residues (petroleum), atm. tower | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 68478-12-6 | 270-791-7 | residuen (aardolie), butaansplitter-bodemfracties | residues (petroleum), butane splitter bottoms | Ja | 2-12-2013 | 4, 65 | |||||||
| 92062-00-5 | 295-514-7 | residuen (aardolie), gehydrogeneerde met stoom gekraakte nafta- | residues (petroleum), hydrogenated steam-cracked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 92061-97-7 | 295-511-0 | residuen (aardolie), katalytische kraak- | residues (petroleum), catalytic cracking | Ja | 2-12-2013 | 4 | |||||||
| 64741-67-9 | 265-069-3 | residuen (aardolie), katalytische reformator-fractioneerder | residues (petroleum), catalytic reformer fractionator | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 68478-13-7 | 270-792-2 | residuen (aardolie), katalytische reformator-fractioneerder-residu destillatie- | residues (petroleum), catalytic reformer fractionator residue distn. | Ja | 2-12-2013 | 4 | |||||||
| 68478-15-9 | 270-794-3 | residuen (aardolie), katalytische reformer C6-8 | residues (petroleum), C6-8 catalytic reformer | Ja | 2-12-2013 | 4, 65 | |||||||
| 68512-62-9 | 270-984-6 | residuen (aardolie), lichte vacuüm- | residues (petroleum), light vacuum | Ja | 2-12-2013 | 4 | |||||||
| 64742-78-5 | 265-181-2 | residuen (aardolie), met waterstof ontzwaveld atmosferische destillatietoren | residues (petroleum), hydrodesulfurized atmospheric tower | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64742-90-1 | 265-193-8 | residuen (aardolie), stoomgekraakt | residues (petroleum), steam-cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 90669-75-3 | 292-657-7 | residuen (aardolie), stoomgekraakt, destillaten | residues (petroleum), steam-cracked, distillates | Ja | 2-12-2013 | 4 | |||||||
| 68955-36-2 | 273-272-3 | residuen (aardolie), stoomgekraakt, harsachtig | residues (petroleum), steam-cracked, resinous | Ja | 2-12-2013 | 4 | |||||||
| 68513-69-9 | 271-013-9 | residuen (aardolie), stoomgekraakte lichte | residues (petroleum), steam-cracked light | Ja | 2-12-2013 | 4 | |||||||
| 102110-55-4 | 310-057-6 | residuen (aardolie), stoomgekraakte lichte, aromatisch | residues (petroleum), steam-cracked light, arom. | Ja | 2-12-2013 | 4, 65 | |||||||
| 92062-04-9 | 295-517-3 | residuen (aardolie), stoomgekraakte naftadestillatie | residues (petroleum), steam-cracked naphtha distn. | Ja | 2-12-2013 | 4 | |||||||
| 93763-85-0 | 297-905-8 | residuen (aardolie), stoomgekraakte uitputtend verhitte nafta | residues (petroleum), steam-cracked heat-soaked naphtha | Ja | 2-12-2013 | 4 | |||||||
| 64741-80-6 | 265-081-9 | residuen (aardolie), thermisch gekraakt | residues (petroleum), thermal cracked | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 90669-76-4 | 292-658-2 | residuen (aardolie), vacuüm-, lichte | residues (petroleum), vacuum, light | Ja | 2-12-2013 | 4 | |||||||
| 68783-13-1 | 272-187-9 | residuen (aardolie), verkookser-gasreiniger, bevat aromaten met gecondenseerde ringen | residues (petroleum), coker scrubber, condensed-ring-arom.-contg. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 21 | |||||
| 64741-75-9 | 265-076-1 | residuen (aardolie), waterstofgekraakt | residues (petroleum), hydrocracked | Ja | 2-12-2013 | 4 | |||||||
| 68478-17-1 | 270-796-4 | residuen (aardolie), zware uit verkookser afkomstige gasolie- en vacuümgasolie- | residues (petroleum), heavy coker gas oil and vacuum gas oil | Ja | 2-12-2013 | 4 | |||||||
| 68512-61-8 | 270-983-0 | residuen (aardolie), zware verkookser- en lichte vacuüm- | residues (petroleum), heavy coker and light vacuum | Ja | 2-12-2013 | 4 | |||||||
| 94114-46-2 | 302-681-2 | residuen (kool), vloeibaar solvent extracten | residues (coal), liq. solvent extn. | Ja | 2-12-2013 | 4, 63 | |||||||
| 92061-93-3 | 295-506-3 | residuen (koolteer), creosootolie-destillatie | residues (coal tar), creosote oil distn. | Ja | 2-12-2013 | 4, 63 | |||||||
| 92061-94-4 | 295-507-9 | residuen (koolteer), pekdestillatie- | residues (coal tar), pitch distn. | Ja | 2-12-2013 | 4, 63 | |||||||
| 98219-64-8 | 308-733-0 | residuen stoomgekraakt, thermisch behandeld | residues, steam cracked, thermally treated | Ja | 2-12-2013 | 4 | |||||||
| 102110-49-6 | 310-050-8 | residuen van koper-ijzer-lood-nikkel mat, onoplosbaar in in zwavelzuur | residues, copper-iron-lead-nickel matte, sulfuric acid-insol. | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 34, 57 | ||||||
| 90669-74-2 | 292-656-1 | residue-oliën (aardolie), met water behandeld en met oplosmiddel van was ontdaan | residual oils (petroleum), hydrotreated solvent dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 93821-66-0 | 298-754-0 | residu-oliën (aardolie) | residual oils (petroleum) | Ja | 2-12-2013 | 4 | |||||||
| 100684-38-6 | 309-711-3 | residu-oliën (aardolie), behandeld met klei en met oplosmiddel van was ontdaan | residual oils (petroleum), clay-treated solvent-dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 100684-37-5 | 309-710-8 | residu-oliën (aardolie), behandeld met koolstof en met oplosmiddel van was ontdaan | residual oils (petroleum), carbon-treated solvent-dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 68478-16-0 | 270-795-9 | residu-oliën (aardolie), butaanverwijderingstoren | residual oils (petroleum), deisobutanizer tower | Ja | 2-12-2013 | 4, 65 | |||||||
| 91770-57-9 | 294-843-3 | residu-oliën (aardolie), katalytisch van was ontdaan | residual oils (petroleum), catalytic dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-41-2 | 265-143-5 | residu-oliën (aardolie), met klei behandeld | residual oils (petroleum), clay-treated | Ja | 2-12-2013 | 4, 62 | |||||||
| 64741-95-3 | 265-096-0 | residuoliën (aardolie), met oplosmiddel gedeasfalteerde | residual oils (petroleum), solvent deasphalted | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-01-4 | 265-101-6 | residu-oliën (aardolie), met oplosmiddel geraffineerde | residual oils (petroleum,) solvent-refined | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-62-7 | 265-166-0 | residu-oliën (aardolie), met oplosmiddel van was ontdaan | residual oils (petroleum), solvent-dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 64742-57-0 | 265-160-8 | residu-oliën (aardolie), met waterstof behandeld | residual oils (petroleum), hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 92061-86-4 | 295-499-7 | residu-oliën (aardolie), waterstof gekraakte met zuur behandelde met oplosmiddel van was ontdane | residual oils (petroleum), hydrocracked acid-treated solvent-dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| respirabel kristallijn silicastof | respirable crystalline silica dust | 19-5-2021 | 44, 83 | ||||||||||
| 68952-80-7 | 273-174-0 | restgas (aardolie), direct door fractionering verkregen nafta, waterstofontzwavelaar | tail gas (petroleum), straight-run naphtha hydrodesulfurizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-10-1 | 269-630-3 | restgas (aardolie), direct uit fractionering verkregen destillaat, waterstofontzwavelaar, waterstofsulfide-vrij | tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-24-0 | 270-804-6 | restgas (aardolie), fractionator van gecombineerde producten uit katalytische kraker, katalytische reformer en waterstofontzwavelaar | tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionater | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-06-5 | 269-626-1 | restgas (aardolie), fractionator van waterstofontzwaveld destillaat en waterstofontzwavelde nafta, zuurvrij | tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-04-3 | 269-624-0 | restgas (aardolie), gasterugwinning-installatie | tail gas (petroleum), gas recovery plant | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-05-4 | 269-625-6 | restgas (aardolie), gasterugwinning-installatie, ethaanverwijdering | tail gas (petroleum), gas recovery plant deethanizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-08-7 | 269-628-2 | restgas (aardolie), geïsomeriseerde nafta, fractioneringsstabilisator | tail gas (petroleum), isomerized naphtha fractionation stabilizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-29-5 | 270-809-3 | restgas (aardolie), gekraakt destillaat, waterstofbehandelaar, afscheider | tail gas (petroleum), cracked distillate hydrotreater separator | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-01-0 | 269-620-9 | restgas (aardolie), gekraakt destillaat, waterstofbehandelingsstripper | tail gas (petroleum), cracked distillate hydrotreater stripper | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-32-0 | 270-813-5 | restgas (aardolie), gemengde stroom uit de verzadigd-gasinstallatie, rijk aan C4 | tail gas (petroleum), saturate gas plant mixed stream, C4-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68307-98-2 | 269-617-2 | restgas (aardolie), katalytisch gekraakt destillaat en katalytisch gekraakte nafta, fractioneringsabsorptievat | tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorber | Ja | 2-12-2013 | 4, 60 | |||||||
| 68952-77-2 | 273-170-9 | restgas (aardolie), katalytisch gekraakt destillaat, naftastabilisator | tail gas (petroleum), catalytic cracked distillate and naphtha stabilizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-21-7 | 270-802-5 | restgas (aardolie), katalytisch gekraakte geklaarde olie en thermisch gekraakt vacuümresidu, fractioneringsterugloopvat | tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drum | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-22-8 | 270-803-0 | restgas (aardolie), katalytisch gekraakte nafta, stabilisatie-absorbeerder | tail gas (petroleum), catalytic cracked naphtha stabilization absorber | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-26-2 | 270-806-7 | restgas (aardolie), katalytisch gereformde nafta, fractioneringsstabilisator | tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-00-9 | 269-619-3 | restgas (aardolie), katalytisch gereformde nafta, fractioneringsstabilisator, waterstofsulfide-vrij | tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-28-4 | 270-808-8 | restgas (aardolie), katalytisch gereformde nafta-stabilisator | tail gas (petroleum), catalytic reformed naphtha stabilizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-27-3 | 270-807-2 | restgas (aardolie), katalytisch gereformde, nafta-afscheider | tail gas (petroleum), catalytic reformed naphtha separator | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-03-2 | 269-623-5 | restgas (aardolie), katalytisch kraken van gasolie, absorptievat | tail gas (petroleum), gas oil catalytic cracking absorber | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-25-1 | 270-805-1 | restgas (aardolie), katalytisch krakenrefractioneringsabsorbeerder | tail gas (petroleum), catalytic cracker refractionation absorber | Ja | 2-12-2013 | 4, 60 | |||||||
| 68952-79-4 | 273-173-5 | restgas (aardolie), katalytisch waterstof-ontzwavelde nafta, afscheider | tail gas (petroleum), catalytic hydrodesulfurized naphtha separator | Ja | 2-12-2013 | 4, 60 | |||||||
| 68307-99-3 | 269-618-8 | restgas (aardolie), katalytische polymerisatie van nafta, fractioneringsstabilisator | tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-11-2 | 269-631-9 | restgas (aardolie), propaan-propyleenalkyleringstoevoer, preparatieve ethaanverwijdering | tail gas (petroleum), propane-propylene alkylation feed prep deethanizer | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-09-8 | 269-629-8 | restgas (aardolie), stabilisator van lichte direct uit fractionering verkregen nafta, vrij van waterstofsulfide | tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-07-6 | 269-627-7 | restgas (aardolie), stripper van waterstofontzwavelde gasolie uit vacuümdestillatie, vrij van waterstofsulfide | tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68952-81-8 | 273-175-6 | restgas (aardolie), thermisch gekraakt destillaat, gasolie en nafta-absorptievat | tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorber | Ja | 2-12-2013 | 4, 60 | |||||||
| 68952-82-9 | 273-176-1 | restgas (aardolie), thermisch gekraakte koolwaterstof, fractioneringsstabilisator, aardolieverkooksing | tail gas (petroleum), thermal cracked hydrocarbon fractionation stabilizer, petroleum coking | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-34-2 | 270-815-6 | restgas (aardolie), thermische vacuümresiduenkraker | tail gas (petroleum), vacuum residues thermal cracker | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-33-1 | 270-814-0 | restgas (aardolie), verzadigd- gasterugwinningsinstallatie, rijk aan C1-2 | tail gas (petroleum), saturate gas recovery plant, C1-2-rich | Ja | 2-12-2013 | 4, 60 | |||||||
| 68308-12-3 | 269-632-4 | restgas (aardolie), waterstofontzwavelaar van gasolie uit vacuümdestillatie, vrij van waterstofsulfide | tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-free | Ja | 2-12-2013 | 4, 60 | |||||||
| 68478-30-8 | 270-810-9 | restgas (aardolie), waterstofontzwaveling van door directe fractionering verkregen nafta, afscheider | tail gas (petroleum), hydrodesulfurized straight-run naphtha separator | Ja | 2-12-2013 | 4, 60 | |||||||
| 121-19-7 | 204-453-7 | roxarsone | roxarsone | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 13446-72-5 | 236-601-1 | rubidium chromaat | rubidium chromate | MVP 1 | 0,05 mg/Nm3 | 7-12-2022 | 12, 57 | ||||||
| 13464-57-8 | 630-763-0 | rubidium diwaterstofarsenaat | rubidium dihydrogenarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 255881-94-8 | 401-850-9 | S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(of 9)-yl O-(isopropyl of isobutyl of 2-ethylhexyl) O-(isopropyl of isobutyl of 2-ethylhexyl) fosfordithioaat | S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 81 | |||||
| S-(tricyclo[5.2.1.0'2,6]deca-3-en-8(of 9)-yl) O-isopropyl O’-isopropyl fosfordithioaat | S-(tricyclo[5.2.1.0'2,6]deca-3-en- 8(or 9)-yl) O-isopropyl O’-isopropyl phosphorodithioate | Ja | MVP 2 | 1 mg/Nm3 | 21-1-2022 | 56, 81 | |||||||
| 94-59-7 | 202-345-4 | safrool | safrole | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 14216-75-2 | 238-076-4 | salpeterzuur nikkelzout | nitric acid, nickel salt | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12255-39-9 | 235-506-2 | samariumarsenide | samarium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| silicavezels, met name cristoballiet en tridymiet | silica fibers, in particular cristoballite and tridymite | sA.1 | 0,05 mg/Nm3 | 31-10-2023 | 44, 83 | ||||||||
| 409-21-2 | 206-991-8 | siliciumcarbide (vezelvormig) | silicon carbide | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | |||||
| 102110-60-1 | 310-061-8 | slijm en slib, batterijschroot, antimoon- en loodrijk | slimes and Sludges, battery scrap, antimony- and lead-rich | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 948-652-3 | slijm en slib, elektrolytische raffinage van tin-, lood- en zilverhoudende legeringen | slimes and sludges, electrolytic refining of tin, lead and silver containing alloy | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | |||||||
| 74869-22-0 | 278-012-2 | smeeroliën | lubricating oils | Ja | 2-12-2013 | 4, 62 | |||||||
| 93572-43-1 | 297-474-6 | smeeroliën (aardolie), basisoliën, paraffine-houdende | lubricating oils (petroleum), base oils, paraffinic | Ja | 2-12-2013 | 4, 62 | |||||||
| 101316-69-2 | 309-874-0 | smeeroliën (aardolie), C groter dan 25, solventgeëxtraheerd gedeasfalteerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C >25, solvent-extd., deasphalted, dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 62 | |||||||
| 72623-86-0 | 276-737-9 | smeeroliën (aardolie), C15-30-, met waterstof behandelde uit neutrale olie verkregen | lubricating oils (petroleum), C15-30, hydrotreated neutral oil-based | Ja | 2-12-2013 | 4, 62 | |||||||
| 101316-70-5 | 309-875-6 | smeeroliën (aardolie), C17-32-, solventgeëxtraheerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 62 | |||||||
| 92045-42-6 | 295-423-2 | smeeroliën (aardolie), C17-35-, solvent-geëxtraheerd van was ontdaan met water behandeld | lubricating oils (petroleum), C17-35, solvent-extd., dewaxed, hydrotreated | Ja | 2-12-2013 | 4, 62 | |||||||
| 97488-95-4 | 307-034-8 | smeeroliën (aardolie), C18-27-, waterstofgekraakt met solvent van was ontdaan | lubricating oils (petroleum), C18-27, hydrocracked solvent-dewaxed | Ja | 2-12-2013 | 4, 62 | |||||||
| 94733-16-1 | 305-595-3 | smeeroliën (aardolie), C18-40-, met oplosmiddel van was ontdaan verkregen uit gehydrogeneerd raffinaat | lubricating oils (petroleum), C18-40, solvent-dewaxed hydrogenated raffinate-based | Ja | 2-12-2013 | 4, 62 | |||||||
| 94733-15-0 | 305-594-8 | smeeroliën (aardolie), C18-40, met oplosmiddel van was ontdane waterstofgekraakte uit destillaat verkregen | lubricating oils (petroleum), C18-40, solvent-dewaxed hydrocracked distillate-based | Ja | 2-12-2013 | 4, 62 | |||||||
| 101316-71-6 | 309-876-1 | smeeroliën (aardolie), C20-35,- solventgeëxtraheerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 62 | |||||||
| 72623-85-9 | 276-736-3 | smeeroliën (aardolie), C20-50-, met waterstof behandelde uit neutrale olie verkregen hoge viscositeit | lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based, high-viscosity | Ja | 2-12-2013 | 4, 62 | |||||||
| 72623-87-1 | 276-738-4 | smeeroliën (aardolie), C20-50-, uit met waterstof behandelde neutrale olie verkregen | lubricating oils (petroleum), C20-50, hydrotreated neutral oil-based | Ja | 2-12-2013 | 4, 62 | |||||||
| 101316-72-7 | 309-877-7 | smeeroliën (aardolie), C24-50, solvent-geëxtraheerd van was ontdaan gehydrogeneerd | lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated | Ja | 2-12-2013 | 4, 62 | |||||||
| 92045-43-7 | 295-424-8 | smeeroliën (aardolie), met waterstof gekraakte niet-aromatische met solvent gedeparaffineerde | lubricating oils (petroleum), hydrocracked nonarom. solvent-deparaffined | Ja | 2-12-2013 | 4, 62 | |||||||
| 65996-79-4 | 266-013-0 | solventnafta (kool) | solvent naphtha (coal) | Ja | 2-12-2013 | 4, 61 | |||||||
| 148477-71-8 | 604-636-5 | spirodiclofen | spirodiclofen | Ja | MVP 1 | 0,05 mg/Nm3 | 12-10-2018 | ||||||
| 85508-00-5 | 287-424-1 | stannaan, dibutyl-, bis(C8-18 en C18-onverzadigd vetacyloxy) derivaten | stannane, dibutyl-, bis(C8-18 and C18-unsatd. fatty acyloxy) derivs. | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 15, 57 | ||||||
| 91648-39-4 | 293-901-5 | stannaan, dioctyl-, bis (kokos-acyloxy)derivaten | stannane, dioctyl-, bis (coco acyloxy) derivs. | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 57 | ||||
| 97674-02-7 | 641-308-0 | stannaan, tributyl(1-ethoxyethenyl)- | Stannane, tributyl(1-ethoxyethenyl)- | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 100073-15-2 | 873-088-9 | stannaan, tributyl(1-methylethenyl)- | stannane, tributyl(1-methylethenyl)- | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 20420-43-3 | 891-892-8 | stannaan, tributyl(2-ethoxyethenyl)-, (Z)- | stannane, tributyl(2-ethoxyethenyl)-, (Z)- | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 15, 57 | ||||||
| 19411-60-0 | 694-756-4 | stannaan, tributylethyl- | Stannane, tributylethyl- | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 8052-41-3 | 232-489-3 | stoddard-oplosmiddel | stoddard solvent | Ja | 2-12-2013 | 4, 65 | |||||||
| 68476-32-4 | 270-674-0 | stookolie, zware stookolie, gasoliën verkregen uit residuen van direkte destillatie, hoog zwavelgehalte | fuel oil, residues-straight-run gas oils, high-sulfur | Ja | 2-12-2013 | 4 | |||||||
| 2457-02-5 | 219-536-3 | strontium bis(2-ethylhexanoaat) | strontium bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 61462-16-6 | strontiumarsenide (SrAs3) | strontium arsenide (SrAs3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 15195-06-9 | strontiumarseniet | strontium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | ||||||
| 91724-16-2 | strontiumarseniet (Sr(As2O4)) | strontium arsenite (Sr(As2O4)) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 7789-06-2 | 232-142-6 | strontiumchromaat | strontium chromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | ||||
| 100258-44-4 | 309-388-9 | strychnidin-10-één, arseniet (1:1) | strychnidin-10-one, arsenite (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 80879-64-7 | 279-614-8 | strychnidin-10-one, verbinding met methylarsonaat (1:1) | strychnidin-10-one, compd. with methylarsonate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 10476-82-1 | 233-970-0 | strychnine arsenaat | strychnine arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 10476-87-6 | 233-973-7 | strychnine dimethylarsinaat | strychnine dimethylarsinate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 95-06-7 | 202-388-9 | sulfallaat | sulfallate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 618-82-6 | 210-564-1 | sulfarfenamine | sulfarsphenamine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 946578-00-3 | 807-366-8 | sulfoxaflor | sulfoxaflor | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 135821-03-3 | syn-dodecachloorpentacyclooctadecadieen | syn-dodecachloropentacyclooctadecadiene | Ja | MVP 1 | 0,05 mg/Nm3 | 13-5-2019 | 57 | ||||||
| 101316-83-0 | 309-885-0 | teer, bruinkool | tar brown-coal | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22 | |||||
| 101316-84-1 | 309-886-6 | teer, bruinkool lage temperatuur | tar, brown-coal, low-temp. | Ja | 2-12-2013 | 4 | |||||||
| 100684-51-3 | 309-726-5 | teer, kool hoge temperatuur, residuen | tar, coal, high-temp., residues | Ja | 2-12-2013 | 4, 63 | |||||||
| 65996-90-9 | 266-025-6 | teer, kool lage temperatuur | tar, coal, low-temp. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22 | |||||
| 101316-85-2 | 309-887-1 | teer, kool lage temperatuur, destillatieresiduen | tar, coal, low-temp., distn. residues | Ja | 2-12-2013 | 4, 63 | |||||||
| 65996-89-6 | 266-024-0 | teer, kool, hoge temperatuur | tar, coal, high-temp. | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22 | |||||
| 68990-61-4 | 273-615-7 | teer, kool-, hoge temperatuur, hoge gehaltes aan vaste stof | tar, coal, high-temp., high-solids | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 22, 63 | |||||
| 91082-50-7 | 293-764-1 | teer, kool, opslagresiduen | tar, coal, storage residues | Ja | 2-12-2013 | 4, 63 | |||||||
| 8007-45-2 | 232-361-7 | teer, steenkool | tar, coal | Ja | 2-12-2013 | 4 | |||||||
| 92062-27-6 | 295-541-4 | teerbasen kool anilinefractie | tar bases, coal, aniline fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 92062-28-7 | 295-543-5 | teerbasen kool collidinefractie | tar bases, coal, collidine fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 92062-29-8 | 295-544-0 | teerbasen kool destillatieresiduen | tar bases, coal, distn. residues | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 68513-87-1 | 271-020-7 | teerbasen, chinolinederivaten | tar bases, quinoline derivs. | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 70321-67-4 | 274-560-1 | teerbasen, kool, fractie van chinolinederivaten | tar bases, coal, quinoline derivs. fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 91082-52-9 | 293-766-2 | teerbasen, kool, lutidinefractie | tar bases, coal, lutidine fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 92062-33-4 | 295-548-2 | teerbasen, kool, picolinefractie | tar bases, coal, picoline fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 65996-84-1 | 266-018-8 | teerbasen, kool, ruw | tar bases, coal, crude | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 91082-53-0 | 293-767-8 | teerbasen, kool, toluïdinefractie | tar bases, coal, toluidine fraction | Ja | 2-12-2013 | 4, 61 | |||||||
| 101316-87-4 | 309-889-2 | teeroliën kool lage temperatuur | tar oils, coal, low-temp. | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 94114-40-6 | 302-674-4 | teeroliën, bruinkool | tar oils, brown-coal | Ja | 2-12-2013 | 4, 61 | |||||||
| 65996-82-9 | 266-016-7 | teeroliën, kool | tar oils, coal, Carbolic Oil [The distillate from high temperature coal tar having an approximate distillation range of 130°C to 250°C (266°F to 410°F). Composed primarily of naphthalene, alkylnaphthalenes, phenolic compounds, and aromatic nitrogen bases.] | Ja | 2-12-2013 | 4, 61 | |||||||
| 84989-07-1 | 284-896-0 | teerzuren 3,5-xylenolfractie | tar acids, 3,5-xylenol fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 92062-22-1 | 295-536-7 | teerzuren bruinkoolvergassing | tar acids, brown-coal gasification | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 96690-55-0 | 306-251-5 | teerzuren destillatieresiduen | tar acids, distn. residues | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84989-03-7 | 284-891-3 | teerzuren ethylfenolfractie | tar acids, ethylphenol fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 92062-26-5 | 295-540-9 | teerzuren kresylhoudend | tar acids, cresylic | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 68555-24-8 | 271-418-0 | teerzuren kresylhoudend residuen | tar acids, cresylic, residues | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84989-04-8 | 284-892-9 | teerzuren methylfenolfractie | tar acids, methylphenol fraction, distillate phenols [the fraction of tar acid rich in 3- and 4-methylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84989-05-9 | 284-893-4 | teerzuren polyalkylfenolfractie | tar acids, polyalkylphenol fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 68477-23-6 | 270-713-1 | teerzuren residuen destillaten voorloop | tar acids, residues, distillates, first-cut | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 84989-06-0 | 284-895-5 | teerzuren xylenolfractie | tar acids, xylenol fraction, distillate phenols [the fraction of tar acids, rich in 2,4- and 2,5-dimethylphenol, recovered by distillation of low-temperature coal tar crude tar acids.] | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 94114-29-1 | 302-662-9 | teerzuren, bruinkool, C2-alkylfenolfractie | tar acids, brown-coal, C2-alkylphenol fraction | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 101316-86-3 | 309-888-7 | teerzuren, bruinkool, ruw | tar acids, brown-coal, crude | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 65996-85-2 | 266-019-3 | teerzuren, kool, ruw | tar acids, coal, crude | Ja | 2-12-2013 | 4, 61, 63 | |||||||
| 79538-32-2 | 616-699-6 | tefluthrin | tefluthrin | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 13494-80-9 | 236-813-4 | tellurium | tellurium | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 7446-07-3 | 231-193-1 | tellurium dioxide | Tellurium dioxide | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 69029-86-3 | 273-828-5 | tellurium, slakken | slags, tellurium | MVP 1 | 0,05 mg/Nm3 | 6-4-2023 | 80, 82 | ||||||
| 335104-84-2 | 608-879-8 | tembotrion | tembotrione | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 12006-08-5 | 234-479-4 | terbium arsenide | terbium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 26140-60-3 | 247-477-3 | terfenyl | terphenyl | MVP 1 | 0,05 mg/Nm3 | 24-7-2020 | 77 | ||||||
| 119-046-9 | tert-butyl 2-[4-(tributylstannyl)-1H-1,2,3-triazol-1-yl]acetaat | tert-butyl 2-[4-(tributylstannyl)-1H-1,2,3-triazol-1-yl]acetate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | |||||||
| 3006-82-4 | 221-110-7 | tert-butyl 2-ethylperoxyhexanoaat | tert-butyl 2-ethylperoxyhexanoate | Ja | MVP 1 | 0,05 mg/Nm3 | 10-1-2025 | 81 | |||||
| 1557287-99-6 | 809-153-5 | tert-butyl N-(2-aminoethyl)-N-[(tributylstannyl)methyl]carbamaat | tert-butyl N-(2-aminoethyl)-N-[(tributylstannyl)methyl]carbamate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 243972-26-1 | 663-174-2 | tert-butyl N-[5-(tributylstannyl)-1,3-thiazol-2-yl]carbamaat | tert-butyl N-[5-(tributylstannyl)-1,3-thiazol-2-yl]carbamate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1189-85-1 | tert-butylchromaat | tert-butyl chromate | MVP 1 | 0,05 mg/Nm3 | 3-10-2017 | 12, 57 | |||||||
| 139111-44-7 | 981-644-8 | tert-butyl-N-[(2E)-3-(tributylstannyl)prop-2-een-1-yl]carbamaat | tert-butyl N-[(2E)-3-(tributylstannyl)prop-2-en-1-yl]carbamate | MVP 1 | 0,05 mg/Nm3 | 19-8-2024 | 15, 57 | ||||||
| 466-490-7 | tetra(natrium/kalium) 7-[(E)-{2-acetamido-4-[(E)-(4-{[4-chloor-6-({2-[(4-fluor-6-{[4-(vinylsulfonyl)fenyl]amino}-1,3,5-triazine-2-yl)amino]propyl}amino)-1,3,5-triazine-2-yl]amino}-5-sulfonato-1-naftyl)diazenyl]-5-methoxyfenyl}diazenyl]-1,3,6-naftaleentrisulfonaat | tetra(sodium/potassium) 7-[(E)-{2-acetamido-4-[(E)-(4-{[4-chloro-6-({2-[(4-fluoro-6-{[4-(vinylsulfonyl)phenyl]amino}-1,3,5-triazine-2-yl)amino]propyl}amino)-1,3,5-triazine-2-yl]amino}-5-sulfonato-1-naphthyl)diazenyl]-5-methoxyphenyl}diazenyl]-1,3,6-naphthalenetrisulfonate | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 | ||||||
| 12279-90-2 | tetraarseen tetrasulfide | tetraarsenic tetrasulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12512-13-9 | tetraarseensulfide | tetraarsenic trisulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12267-73-1 | 235-541-3 | tetraboordinatriumheptaoxide hydraat | tetraboron disodium heptaoxide, hydrate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 27858-07-7 | 248-696-7 | tetrabroom(tetrabroomfenyl)benzeen | tetrabromo(tetrabromophenyl)benzene | MVP 1 | 0,05 mg/Nm3 | 7-4-2023 | 13, 57 | ||||||
| 21850-44-2 | 244-617-5 | tetrabroombisfenol A bis(2,3-dibroompropyl ether) | tetrabromobisphenol A bis(2,3-dibromopropyl ether) | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 13, 57 | ||||||
| 40088-47-9 | 254-787-2 | tetrabroomdifenylether | tetrabromodiphenyl ether | Ja | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 12-8-2014 | 35 | |||
| 79-27-6 | 201-191-5 | tetrabroomethaan | tetrabromoethane | gO.1 | 20 mg/Nm3 | 25-9-2023 | 13, 44 | ||||||
| 558-13-4 | 209-189-6 | tetrabroom-methaan | carbon tetrabromide | MVP 2 | 1 mg/Nm3 | 19-8-2024 | 13, 84 | ||||||
| 68401-87-6 | 672-592-4 | tetrabutylammonium bis(1,3-dithiol-2-thion-4,5-dithiolato)nikkel(III) complex | tetrabutylammonium bis(1,3-dithiole-2-thione-4,5-dithiolato)nickel(III) complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 87314-12-3 | 811-124-7 | tetrabutylammonium bis(3,4,6-trichloor-1,2-benzeendithiolato)nikkelaat | tetrabutylammonium Bis(3,4,6-trichloro-1,2-benzenedithiolato)nickelate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 87314-14-5 | 808-216-4 | tetrabutylammonium bis(3,6-dichloor-1,2-benzeendithiolato)nikkelaat | tetrabutylammonium Bis(3,6-dichloro-1,2-benzenedithiolato)nickelate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 15492-42-9 | 630-872-3 | tetrabutylammonium bis(4-methyl-1,2-benzeendithiolato)nikkelaat | tetrabutylammonium bis(4-methyl-1,2-benzeendithiolato)nikkelaat | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 55401-12-2 | 678-624-3 | tetrabutylammonium bis(maleonitrieldithiolato)nikkel(III) complex | tetrabutylammonium bis(maleonitriledithiolato)nickel(III) complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 54712-57-1 | 621-795-6 | tetrabutylammonium chloorchromaat | tetrabutylammonium chlorochromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 105029-70-7 | 678-623-8 | tetrabutylfosfonium bis(1,3-dithiol-2-thion-4,5-dithiolato)nikkel(III) complex | tetrabutylphosphonium bis(1,3-dithiole-2-thione-4,5-dithiolato)nickel(III) complex | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 220689-12-3 | 444-440-5 | tetrabutylfosfonium perfluorbutaansulfonaat | tetrabutylphosphonium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 1461-25-2 | 215-960-8 | tetrabutyltin | tetrabutyltin | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 57 | ||||||
| 1335-88-2 | 215-642-9 | tetrachloornaftaleen | tetrachloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 198840-65-2 | tetradecaan, chloorderivaten | tetradecane, chloro derivs. | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 81 | ||||||
| 56773-42-3 | 260-375-3 | tetraethylammonium heptadecafluoroctaansulfonzuur | tetraethylammonium heptadecafluorooctanesulphonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 25628-08-4 | 700-536-1 | tetraethylammonium perfluorbutaansulfonaat | tetraethylazanium nonafluorobutane-1-sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 5964-71-6 | 624-087-5 | tetraethylammonium tetrachloornikkelaat(II) | tetraethylammonium tetrachloronickelate(II) | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 78-00-2 | 201-075-4 | tetra-ethyllood | tetraethyllead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 21006-73-5 | 244-144-4 | tetrafenylarsonium (waterstofdichloride) | tetraphenylarsonium (hydrogen dichloride) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 123334-18-9 | 621-302-4 | tetrafenylarsonium chloride hydrochloride hydraat | tetraphenylarsonium chloride hydrochloride hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 507-27-7 | 208-069-0 | tetrafenylarsoniumbromide | tetraphenylarsonium bromide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 507-28-8 | 208-070-6 | tetrafenylarsoniumchloride | tetraphenylarsonium chloride | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 116-14-3 | 204-126-9 | tetrafluorethyleen | tetrafluoroethylene | Ja | MVP 1 | 0,05 mg/Nm3 | 24-3-2020 | ||||||
| 75-73-0 | 200-896-5 | tetrafluormethaan | carbon tetrafluoride | Ja | gO.2 | 50 mg/Nm3 | 15-11-2024 | 44, 96 | |||||
| 143-24-8 | 205-594-7 | tetraglyme | bis(2-(2-methoxyethoxy)ethyl)ether | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | ||||
| 97-99-4 | 202-625-6 | tetrahydro-2-furylmethanol | tetrahydro-2-furylmethanol | Ja | MVP 2 | 1 mg/Nm3 | 3-2-2015 | ||||||
| 2455-24-5 | 219-529-5 | tetrahydrofurfurylmethacrylaat | tetrahydrofurfuryl methacrylate | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 61571-06-0 | 407-330-8 | tetrahydrothiopyraan-3-carboxaldehyde | tetrahydrothiopyran-3-carboxaldehyde | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 89952-87-4 | 685-066-4 | tetrakis(pyridine)zilver(I)dichromaat | tetrakis(pyridine)silver(I) dichromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 12202-17-4 | 235-380-9 | tetraloodtrioxidesulfaat | tetralead trioxide sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 5814-20-0 | 695-153-9 | tetramethylarsoniumjodide | tetramethylarsonium iodide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 471-35-2 | 207-440-4 | tetramethyldiarsine | tetramethyldiarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 75-74-1 | 200-897-0 | tetramethyllood | tetramethyl lead | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57, 85 | |||||
| 41825-71-2 | 105-903-4 | tetra-m-tolyllood | Tetra-m-tolyllead | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 127 | ||||||
| 2602-46-2 | 220-012-1 | tetranatrium-3,3'-[[1,1'-bifenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaftaleen-2,7-disulfonaat] | tetrasodium 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[5-amino-4-hydroxynaphthalene-2,7-disulphonate] | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 73003-83-5 | 277-208-5 | tetraphenylarsoniumchloride, verbinding met zoutzuur (1:1) | tetraphenylarsonium chloride, compound with hydrochloric acid (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 57427-55-1 | tetrapropyleenfenol | Phenol, tetrapropylene- | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57 | ||||||
| 2227-13-6 | 218-761-4 | tetrasul | tetrasul | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 73513-16-3 | tetrazido lood | tetraazidolead(IV) | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | ||||||
| 12006-09-6 | 234-481-5 | thallium arsenide | thallium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 16142-89-5 | thalliumarseenselenide | thallium arsenic selenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 84057-85-2 | 281-902-3 | thalliumtriarsenide | thallium triarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 58-55-9 | 200-385-7 | theofylline | theophylline | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2022 | 81 | |||||
| 111988-49-9 | 601-147-9 | thiacloprid | thiacloprid | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 62-55-5 | 200-541-4 | thioaceetamide | thioacetamide | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 13367-92-5 | 236-436-5 | thiobis[methylarsine], anhydrosulfide | thiobis[methylarsine], anhydrosulphide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 70969-47-0 | 687-657-2 | thiolen, C8-20, .gamma.-.omega.- perfluor, telomeren met acrylamide | thiols, C8-20, .gamma.-.omega.-perfluoro, telomers with acrylamide | Ja | Ja | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96, 110 | ||
| 54-64-8 | 200-210-4 | thiomersal | thiomersal | Ja | MVP 1 | 0,05 mg/Nm3 | 21-2-2022 | 42, 57 | |||||
| 12006-10-9 | 234-482-0 | thulium arsenide | thulium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 301-10-0 | 206-108-6 | tin bis(2-ethylhexanoaat) | tin bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 54068-28-9 | 682-474-4 | tin, dioctylbis(2,4-pentaandionato-.kappa.O2,.kappa.O4)- | tin, dioctylbis(2,4-pentanedionato-.kappa.O2,.kappa.O4)- | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 15, 57 | ||||||
| 12397-66-9 | tinarsenide (Sn4As3) | tin arsenide (Sn4As3) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12044-32-5 | tinarsenide (SnAs) | tin arsenide (SnAs) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 65321-67-7 | 265-697-8 | tolueen-2,4-diammoniumsulfaat | toluene-2,4-diammonium sulphate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 8001-35-2 | 232-283-3 | toxafeen | toxaphene | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 66711-86-2 | 811-213-0 | trans-1,1,1,4,4,4‐hexafluor‐2‐buteen | (2E)-1,1,1,4,4,4-hexafluoro-2-butene | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 14275-61-7 | 664-439-5 | trans-1,2-bis(tri-n-butylstannyl)ethyleen | trans-1,2-Bis(tri-n-butylstannyl)ethylene | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 77536-68-6 | 616-473-7 | tremoliet | tremolite | Ja | sA.1 | 0,05 mg/Nm3 | 13-03-2019 | 57 | |||||
| 14567-73-8 | 604-486-0 | tremoliet (Ca2[(Mg0.9-1Fe0-0.1)4.5-5Al0-0.5](Si7.5-8Al0-0.5)(OH)2O22) | tremolite (Ca2[(Mg0.9-1Fe0-0.1)4.5-5Al0-0.5](Si7.5-8Al0-0.5)(OH)2O22) | sA.1 | 0,05 mg/Nm3 | 19-8-2024 | 57, 69 | ||||||
| 201742-34-9 | 635-669-3 | tri(o-tolyl)lood | tri(o-tolyl)lead | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 57 | ||||||
| 55219-65-3 | 259-537-6 | triadimenol | triadimenol | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | ||||||
| 24719-13-9 | 246-428-3 | triammoniumarsenaat | triammonium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12255-36-6 | 235-505-7 | triantimoonarsenide | triantimony arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13477-04-8 | 236-762-8 | tribariumdiarsenaat | tribarium diarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12255-50-4 | 235-508-3 | tribariumdiarsenide | tribarium diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 121359-48-6 | 626-624-9 | tributyl(1,3-thiazol-2-yl)stannaan | tributyl(1,3-thiazol-2-yl)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 81177-90-4 | 837-963-9 | tributyl(1-methoxyethenyl)stannaan | tributyl(1-methoxyethenyl)stannane | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 57, 69 | ||||||
| 446286-25-5 | 803-906-1 | tributyl(2-chloorpyrimidin-4-yl)stannaan | Tributyl(2-chloropyrimidin-4-yl)stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 125769-77-9 | 682-759-3 | tributyl(4,5-dihydrofuraan-2-yl)stannaan | tributyl(4,5-dihydrofuran-2-yl)stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1257527-55-1 | 693-895-8 | tributyl(4-morfolinofenyl)stannaan | Tributyl(4-morpholinophenyl)stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 109669-45-6 | 663-424-0 | tributyl(5,6-dihydro-4H-pyraan-2-yl)stannaan | Tributyl(5,6-dihydro-4H-pyran-2-yl)stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1426-66-0 | 673-914-6 | tributyl(pentafluorethyl)stannaan | Tributyl(pentafluoroethyl)stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1045-56-3 | 802-289-6 | tributyl(pentafluorfenyl)tin | Tributyl(pentafluorophenyl)tin | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 64099-82-7 | 626-507-2 | tributyl(prop-1-yn-1-yl)stannaan | tributyl(prop-1-yn-1-yl)stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 7486-35-3 | 231-291-4 | tributyl(vinyl)tin | tributylvinylstannane | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15, 57 | ||||||
| 5035-67-6 | 225-726-7 | tributyl[(2-ethylhexanoyl)oxy]stannaan | tributyl[(2-ethylhexanoyl)oxy]stannane | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 57, 69 | ||||||
| 170941-63-6 | 107-066-0 | tributyl[2,2-difluor-1-(2-methoxyethoxymethoxy)vinyl]stannaan | Tributyl[2,2-Difluoro-1-(2-Methoxyethoxymethoxy)Vinyl]Stannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 468-740-0 | tributyl-2-methoxypropylfosfonium zout met 4,4'-[2,2,2-trifluor-1-(trifluormethyl)ethylideen]bis[fenol] | tributyl-2-methoxypropylphosphonium salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98 | ||||||
| 688-74-4 | 211-706-5 | tributylboraat | tributyl borate | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 57, 69 | ||||||
| 2179-92-2 | 627-847-4 | tributylcyanostannaan | Tributylcyanostannane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 4342-30-7 | 224-397-7 | tributylstannylsalicylaat | Tributylstannyl salicylate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 68725-14-4 | 625-305-1 | tributylstannyltrifluormethaansulfonaat | Tributylstannyl trifluoromethane sulfonate | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 688-73-3 | 211-704-4 | tributyltin | tri-n-butyltin hydride | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 15 | ||||||
| 2857-03-6 | 105-346-7 | tributyltin 4-acetamidobenzoaat | TRIBUTYLTIN 4-ACETAMIDOBENZOATE | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 1983-10-4 | 217-847-9 | tributyltin fluoride | tributyltin fluoride | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 29-11-2024 | 57, 108 | ||||
| tributyltin verbindingen | tributyltin compounds | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 38 | ||||||
| 36643-28-4 | tributyltin-kation | tributyltin cation | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 56-35-9 | 200-268-0 | tributyltinoxide | bis(tributyltin) oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12006-15-4 | 234-484-1 | tricadmium diarsenide | tricadmium diarsenide | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 86, 92 | ||||
| 27152-57-4 | 248-266-9 | tricalcium diarseniet | tricalcium diarsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 21-12-2021 | 57, 92 | |||||
| 12255-53-7 | 235-509-9 | tricalciumdiarsenide | tricalcium diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12002-48-1 | 234-413-4 | trichloorbenzenen som | trichlorobenzenes | Ja | 30-05-2016 | 1, 41 | |||||||
| 79-01-6 | 201-167-4 | trichlooretheen | trichloroethylene | Ja | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | |||||
| 1321-65-9 | 215-321-3 | trichloornaftaleen | trichloronaphthalene | Ja | Ja | ERS | 0,05 ng TEQ/Nm3 | 2-12-2013 | |||||
| 24719-19-5 | 246-429-9 | tricobaltdiarsenaat | tricobalt diarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12005-75-3 | 234-472-6 | tricoperarsenide | tricopper arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 376-04-5 | tridecaan, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12, 12,13,13-heptacosafluor-13-jood- | tridecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-heptacosafluoro-13-iodo- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 92011-17-1 | tridecafluorhexaansulfonzuur, cesiumzout (1:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, cesium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 341035-71-0 | tridecafluorhexaansulfonzuur, galliumzout (9CI) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, gallium salt (9CI) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 55120-77-9 | tridecafluorhexaansulfonzuur, lithiumzout (1:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, lithium salt (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 82382-12-5 | tridecafluorhexaansulfonzuur, natriumzout | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, sodiumsalt | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 41184-65-0 | tridecafluorhexaansulfonzuur, neodymium(3+) zout (3:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, neodymium(3+) salt (3:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 350836-93-0 | tridecafluorhexaansulfonzuur, scandium(3+) zout (3:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, scandium(3+) salt (3:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 70225-16-0 | 274-462-9 | tridecafluorhexaansulfonzuur, verbinding met 2,2'-iminodiethanol (1:1) | tridecafluorohexanesulphonic acid, compound with 2,2'-iminodiethanol (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | ||||
| 202189-84-2 | tridecafluorhexaansulfonzuur, verbinding met 2-methyl-2-propaanamine (1:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, compd.with 2-methyl-2-propanamine (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 72033-41-1 | tridecafluorhexaansulfonzuur, verbinding met N,N-diethylethanamine (1:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, compd. with N,N-diethylethanamine (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 1187817-57-7 | tridecafluorhexaansulfonzuur, verbinding met pyrrolidine (1:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, compd. with pyrrolidine (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 41242-12-0 | tridecafluorhexaansulfonzuur, yttrium(3+) zout (3:1) | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, yttrium(3+) salt (3:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 70136-72-0 | tridecafluorhexaansulfonzuur, zinkzout | 1-hexanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-, zinc salt | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 24602-86-6 | 246-347-3 | tridemorf | tridemorph | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 15468-32-3 | 239-487-1 | tridymiet | crystalline silica, tridymite | sA.1 | 0,05 mg/Nm3 | 19-5-2021 | 44, 83 | ||||||
| 51851-37-7 | 257-473-3 | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaan | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 101947-16-4 | 435-230-4 | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluordecyl)silaan | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 3141-12-6 | 221-543-1 | triethyl arseniet | triethyl arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 15606-95-8 | 427-700-2 | triethylarsenaat | triethyl arsenate | Ja | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 92 | |||
| 617-75-4 | 210-526-4 | triethylarsine | triethylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 150-46-9 | 205-760-9 | triethylboraat | triethyl borate | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 57, 69 | ||||||
| 2587-81-7 | 624-392-3 | triethylloodacetaat | triethyllead acetate | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 57 | ||||||
| 170275-23-7 | 807-672-1 | triethylmethylammonium 2-ethylhexanoaat | triethylmethylammonium 2-ethylhexanoate | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 5072-98-0 | 637-141-8 | trifenyl(2-fenylethynyl)lood | triphenyl(2-phenylethynyl)plumbane | MVP 1 | 0,05 mg/Nm3 | 3-5-2022 | 14, 87 | ||||||
| 1000597-52-3 | trifenyl(fenylmethyl)-fosfonium, tridecafluorhexaansulfonaat (1:1) | phosphonium, triphenyl(phenylmethyl)-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 15590-77-9 | 654-801-0 | trifenyl(fenylthio)-lood (7CI) | lead, triphenyl(phenylthio)- (7CI) | MVP 1 | 0,05 mg/Nm3 | 4-4-2022 | 14, 57 | ||||||
| 603-32-7 | 210-032-9 | trifenylarsine | triphenylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 1153-05-5 | 214-571-0 | trifenylarsine oxide | triphenylarsine oxide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 115-86-6 | 204-112-2 | trifenylfosfaat | triphenyl phosphate | Ja | gO.1 | 20 mg/Nm3 | 29-11-2024 | 44 | |||||
| 603-35-0 | 210-036-0 | trifenylfosfine | triphenylphosphine | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 8 | ||||||
| 144317-44-2 | 478-340-8 | trifenylsulfonium perfluorbutaansulfonaat | triphenylsulfanium perfluorobutane sulfonate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 24-1-2020 | 57, 96 | ||||
| 144116-10-9 | trifenylsulfonium, tridecafluorhexaansulfonaat (1:1) | sulfonium, triphenyl-, 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonate (1:1) | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 57900-42-2 | 261-009-5 | trifenylsulfoniumhexafluorarsenaat(1-) | triphenylsulphonium hexafluoroarsenate(1-) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 892-20-6 | 212-967-8 | trifenyltin | triphenyltin-hydride | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 7, 15 | ||||||
| 668-34-8 | 694-821-7 | trifenyltin (kation) | fentin | MVP 1 | 0,05 mg/Nm3 | 16-12-2022 | 7, 15 | ||||||
| 900-95-8 | 212-984-0 | trifenyltinacetaat | fentin acetate | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 7, 15 | ||||||
| 639-58-7 | 211-358-4 | trifenyltinchloride | fentin chloride | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 7, 15 | ||||||
| 76-87-9 | 200-990-6 | trifenyltinhydroxide | fentin hydroxide | MVP 1 | 0,05 mg/Nm3 | 30-4-2014 | 16 | ||||||
| 141517-21-7 | 604-237-6 | trifloxystrobine | trifloxystrobin | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 68694-11-1 | triflumizool | triflumizole | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 4-1-2017 | 96 | |||||
| 64628-44-0 | 264-980-3 | triflumuron | 2-chloro-N-[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]benzamide | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 354-32-5 | 206-556-2 | trifluoracetylchloride | trifluoroacetyl chloride | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 7784-35-2 | 232-060-0 | trifluorarsenaat | trifluoroarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 76-05-1 | 200-929-3 | trifluorazijnzuur | trifluoroacetic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 77568-66-2 | 688-578-6 | trifluorethanol-O-d | Trifluoroethanol-O-d | Ja | MVP 2 | 1 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 1702-15-4 | 809-906-8 | trifluormethyltetrazool natriumzout | 2H-tetrazole, 5-(trifluoromethyl)-, sodium salt (1:1) | Ja | MVP 2 | 1 mg/Nm3 | 10-7-2025 | 96, 98 | |||||
| 1582-09-8 | 216-428-8 | trifluraline | trifluralin | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 126535-15-7 | 603-146-9 | triflusulfuron-methyl | triflusulfuron-methyl | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 2451-62-9 | 219-514-3 | triglycidyl isocyanuraat | triglycidyl isocyanurate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 112-49-2 | 203-977-3 | triglyme | 1,2-bis(2-methoxyethoxy)ethane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 13464-36-3 | trikalium arsenaat | arsenic acid, tripotassium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 12044-21-2 | 234-949-9 | trikaliumarsenide | Tripotassium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13478-14-3 | 236-773-8 | trilithiumarsenaat | trilithium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12044-22-3 | 234-950-4 | trilithiumarsenide | trilithium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 512-26-5 | 208-141-1 | trilood dicitraat | trilead dicitrate | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 57 | ||||||
| 13692-88-1 | 869-249-8 | trilood divanadaat | trilead divanadate | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 57 | ||||||
| 1319-46-6 | 215-290-6 | trilood-bis(carbonaat)-dihydroxide | trilead bis(carbonate) dihydroxide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 7446-27-7 | 231-205-5 | triloodbis(orthofosfaat) | trilead bis(orthophosphate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 3687-31-8 | 222-979-5 | trilooddiarsenaat | trilead diarsenate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 92 | ||||
| 12141-20-7 | 235-252-2 | trilooddioxidefosfonaat | trilead dioxide phosphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 12044-49-4 | 234-954-6 | trimagnesiumdiarsenide | trimagnesium diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 61219-26-9 | 262-667-6 | trimangaanarsenide | trimanganese arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 85857-16-5 | 288-657-1 | trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoroctyl)silaan | trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| 17955-46-3 | 628-849-8 | trimethyl(tributylstannyl)silaan | trimethyl(tributylstannyl)silane | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 15, 57 | ||||||
| 593-88-4 | 209-815-8 | trimethylarsine | trimethylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 121-43-7 | 204-468-9 | trimethylboraat | trimethyl borate | Ja | MVP 2 | 1 mg/Nm3 | 10-1-2025 | 81 | |||||
| 512-56-1 | 208-144-8 | trimethylfosfaat | trimethyl phosphate | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 6148-48-7 | 622-688-7 | trimethyllood bromide | trimethyl lead bromide | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 57 | ||||||
| 520-10-5 | 208-285-5 | trinatrium 2-(-waterstofarsonatofenylazo)-1,8-dihydroxynaftaleen-3,6-disulfonaat | trisodium 2-(-hydrogen arsonatophenylazo)-1,8-dihydroxynaphthalene-3,6-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 66019-20-3 | 266-069-6 | trinatrium 3-[(o-arsonatofenyl)azo]-4,5-dihydroxynaftaleen-2,7-disulfonaat | trisodium 3-[(o-arsonatophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 53669-45-7 | 258-693-2 | trinatrium 4-[(o-arsonofenyl)azo]-3-oxidonaftaleen-2,7-disulfonaat | trisodium 4-[(o-arsonophenyl)azo]-3-oxidonaphthalene-2,7-disulphonate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13464-38-5 | 236-682-3 | trinatrium arsenaat | trisodium arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 75234-41-2 | 278-145-6 | trinatrium bis[2-[[2,4-dihydroxy-3-[(2-methyl-4-sulfofenyl)azo]fenyl]azo]benzoaat(3-)]chromaat(3-) | trisodium bis[2-[[2,4-dihydroxy-3-[(2-methyl-4-sulphophenyl)azo]phenyl]azo]benzoato(3-)]chromate(3-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 61916-41-4 | 263-319-6 | trinatrium bis[4-[(4,5-dihydro-3-methyl-5-oxo-1-fenyl-1H-pyrazol-4-yl)azo]-3-hydroxynaftaleen-1-sulfonaat(3-)]chromaat(3-) | trisodium bis[4-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-3-hydroxynaphthalene-1-sulphonato(3-)]chromate(3-) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 14312-40-4 | 238-253-6 | trinatrium orthoboraat | trisodium orthoborate | Ja | MVP 1 | 0,05 mg/Nm3 | 13-7-2021 | 57 | |||||
| 13510-46-8 | trinatrium;trioxido(oxo)-$l^{5}-arsaan;dodecahydraat | trisodium;trioxido(oxo)-$l^{5}-arsane;dodecahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 164058-22-4 | 413-590-3 | trinatrium-[4'-(8-acetylamino-3,6-disulfonato-2-nafthylazo)-4''-(6-benzoylamino-3-sulfonato-2-nafthylazo)-bifenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']koper(II) | trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12044-25-6 | 234-952-5 | trinatriumarsenide | trisodium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 13464-37-4 | 236-681-8 | trinatriumarseniet | trisodium arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 74646-29-0 | trinikkelbis(arseniet) | trinickel bis(arsenite) | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 92 | |||||
| 10381-36-9 | 233-844-5 | trinikkelbis(orthofosfaat) | trinickel bis(orthophosphate) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 12007-02-2 | 234-495-1 | trinikkelboride | trinickel boride | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 6018-92-4 | 227-873-2 | trinikkeldicitraat | trinickel dicitrate | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 12059-19-7 | 822-331-7 | trinikkelfosfide | trinickel phosphide | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 12137-12-1 | trinikkeltetrasulfide | trinickel tetrasulfide | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 62702-52-7 | tripotassiumarsenaat 3/2hydraat | tripotassium arsenate 3/2hydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 2896-10-8 | 220-776-6 | tri-p-tolylarsine | tri-p-tolylarsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 126-72-7 | 204-799-9 | tris(2,3-dibroompropyl)fosfaat | tris(2,3-dibromopropyl) phosphate | MVP 1 | 0,05 mg/Nm3 | 2-3-2017 | 13, 57 | ||||||
| 40334-70-1 | tris(2-chlooretheenyl)arsine | arsine, tris(2-chloroethenyl)- | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 115-96-8 | 204-118-5 | tris(2-chloorethyl)fosfaat | tris(2-chloroethyl) phosphate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 51136-86-8 | 257-004-2 | tris(2-ethylhexaanzuur), tri-anhydride met boorzuur | tris(2-ethylhexanoic) acid, trianhydride with boric acid | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 57, 69 | ||||||
| 1067-53-4 | 213-934-0 | tris(2-methoxyethoxy)vinylsilaan | tris(2-methoxyethoxy)vinylsilane | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 11-9-2020 | 81 | ||||
| 284472-92-0 | 622-446-0 | tris(4-(heptadecafluoroctyl)fenyl)fosfine | Tris(4-(heptadecafluorooctyl)phenyl)-phosphine | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 701-028-2 | tris(4-nonylfenyl, vertakt) fosfiet | tris(4-nonylphenyl, branched) phosphite | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57, 69 | |||||||
| 111-911-9 | tris(bipyridyl)nikkel dibromide | Trisbipyridylnickel dibromide | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 57, 126 | |||||||
| 26523-78-4 | 247-759-6 | tris(nonylfenyl) fosfiet | tris(nonylphenyl) phosphite | Ja | MVP 1 | 0,05 mg/Nm3 | 8-11-2019 | 57 | |||||
| 67251-38-1 | 266-621-6 | tris(pentaan-2,4-dionato-O,O')siliciumhexafluorarsenaat | tris(pentane-2,4-dionato-O,O')silicon hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 17729-30-5 | 821-113-9 | tris(trimethylsilyl)arsine | tris(trimethylsilyl)arsine | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 799-976-5 | tris(vertakt en lineair 4-nonylfenyl) fosfiet [met ≥ 0.1 gewichtsprocent vertakt en lineair 4-nonylfenol] | tris(branched and linear 4-nonylphenyl) phosphite [with ≥ 0.1% w/w of branched and linear 4-nonylphenol] | Ja | MVP 1 | 0,05 mg/Nm3 | 16-7-2019 | |||||||
| 94138-87-1 | 303-002-2 | tris[(8α)-6'-methoxycinchonan-9(R)-ol] arseniet | tris[(8α)-6'-methoxycinchonan-9(R)-ol] arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 549-59-7 | 208-971-4 | tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenaat) | tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenate) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 425670-70-8 | tris[4-(1,1-dimethylethyl)fenyl]-sulfonium, zout met tridecafluorhexaansulfonzuur | sulfonium, tris[4-(1,1-dimethylethyl)phenyl]-, salt with 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-1-hexanesulfonic acid | Ja | Ja | MVP 2 | 1 mg/Nm3 | 13-12-2021 | 57, 96 | |||||
| 13464-68-1 | 236-684-4 | tristrontium diarsenaat | tristrontium diarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 39297-24-0 | 254-407-5 | tristrontiumdiarsenide | tristrontium diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 9002-93-1 | 618-344-0 | triton X-100 | octylphenylpolyethylene glyol | Ja | MVP 1 | 0,05 mg/Nm3 | 14-03-2019 | 57 | |||||
| 142469-14-5 | 604-291-0 | tritosulfuron | tritosulfuron | Ja | MVP 1 | 0,05 mg/Nm3 | 28-11-2024 | 96, 98 | |||||
| 437-15-0 | 207-111-5 | trityliumhexafluorarsenaat | tritylium hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12519-85-6 | 235-688-3 | triwaterstofhydroxybis[orthosilicato(4-)]trinikkelaat(3-) | trihydrogen hydroxybis[orthosilicato(4-)]trinickelate(3-) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 25155-23-1 | 246-677-8 | trixylyl fosfaat | trixylyl phosphate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 13510-44-6 | 236-841-7 | trizilverarsenaat | trisilver arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 12417-99-1 | 235-652-7 | trizilverarsenide | trisilver arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12006-40-5 | 234-486-2 | trizink diarsenide | trizinc diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 554-72-3 | 209-070-9 | tryparsamide | tryparsamide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| tweewaardige anorganische kwikverbindingen | divalent inorganic mercury compounds | Ja | MVP 1 | 0,05 mg/Nm3 | 4-7-2016 | 42, 57 | |||||||
| uit chroomtrioxide gevormde zuren en oligomeren daarvan | acids generated from chromium trioxide and their oligomers | Ja | MVP 1 | 0,05 mg/Nm3 | 17-1-2022 | 57 | |||||||
| 91053-44-0 | 293-309-7 | uitloogresten, cadmiumkoek | leach residues, cadmium cake | MVP 1 | 0,05 mg/Nm3 | 24-8-2023 | 57, 86 | ||||||
| 307-50-6 | undecaan, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-tricosafluor-11-jood- | undecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-tricosafluoro-11-iodo- | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | |||||
| 200112-75-0 | 628-752-0 | undecaan, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluor-11-jood- | Undecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodo-;Undecane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-11-iodo- | Ja | MVP 1 | 0,05 mg/Nm3 | 26-11-2025 | 124, 125 | |||||
| 307-24-4 | 206-196-6 | undecafluorhexaanzuur | undecafluorohexanoic acid | Ja | MVP 2 | 1 mg/Nm3 | 15-11-2024 | 96, 98 | |||||
| undecafluorhexaanzuur (PFHxA), zijn zouten en gerelateerde stoffen | undecafluorohexanoic acid (PFHxA), its salts and related substances | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98, 100 | |||||||
| undecafluorhexaanzuur en zijn ammoniumzouten | undecafluorohexanoic acid and its ammonium salt | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98, 100 | |||||||
| undecafluorhexaanzuur en zijn anorganische zouten | undecafluorohexanoic acid and its inorganic salts | Ja | MVP 1 | 0,05 mg/Nm3 | 15-11-2024 | 96, 98, 100 | |||||||
| 51-79-6 | 200-123-1 | urethaan | urethane | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 73962-07-9 | 622-090-6 | urethaan-d5 (ethyl-d5) | urethane-d5 (ethyl-d5) | MVP 2 | 1 mg/Nm3 | 27-5-2019 | 57, 68 | ||||||
| 99035-51-5 | 308-917-0 | vanadium(4+) diarsenaat (1:1) | vanadium(4+) diarsenate (1:1) | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 1314-62-1 | 215-239-8 | vanadiumpentoxide | divanadium pentaoxide | Ja | sA.1 | 0,05 mg/Nm3 | 27-10-2020 | 44 | |||||
| 94552-05-3 | 305-449-9 | vaste afvalstoffen, loodzilveranode | waste solids, lead silver anode | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 57 | ||||||
| 92062-34-5 | 295-549-8 | vaste afvalstoffen, verkooksing van koolteerpek | waste solids, coal-tar pitch coking | Ja | 2-12-2013 | 4, 63 | |||||||
| 701-090-0 | veldspar mineralen, hematiet en kwarts, calcineringsproducten van kopermijnresiduen | feldspar minerals, hematite and quartz, calcination products of copper mining residues | MVP 1 | 0,05 mg/Nm3 | 23-9-2024 | 14, 57 | |||||||
| 944-188-0 | veldspar mineralen, magnetiet en kwarts, calcineringsproducten van kopermijnresiduen | veldspar minerals, magnetite and quartz, calcination products of copper mining residues | MVP 1 | 0,05 mg/Nm3 | 23-9-2024 | 14, 57 | |||||||
| 937-850-5 | verbrandingsproducten van nikkeloxide en kiezelzuur | combustion products of nickel oxid and silicic acid | MVP 1 | 20-8-2024 | 34, 57 | ||||||||
| vertakt en lineair 4-heptylfenol | 4-heptylphenol, branched and linear | Ja | MVP 1 | 0,05 mg/Nm3 | 13-1-2017 | ||||||||
| 90481-04-2 | 291-844-0 | vertakt nonylfenol | phenol, nonyl-, branched | Ja | MVP 1 | 0,05 mg/Nm3 | 14-1-2022 | 57 | |||||
| 127087-87-0 | 500-315-8 | vertakt, geëthoxyleerd 4-nonylfenol | branched, ethoxylated 4-nonylphenol | Ja | MVP 1 | 0,05 mg/Nm3 | 11-1-2022 | 57 | |||||
| 68333-92-6 | 269-801-2 | vet zuren, C7-13, perfluor | fatty acids, C7-13, perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 91031-62-8 | 292-966-7 | vetzuren, C16-18, loodzouten | fatty acids, C16-18, lead salts | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 91697-41-5 | 294-302-1 | vetzuren, C6-19-vertakte, nikkelzouten | fatty acids, C6-19-branched, nickel salts | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 68603-83-8 | 271-675-9 | vetzuren, C6-C19 vertakte, loodzouten, basic | Fatty acids, C6-19-branched, lead salts, basic | MVP 1 | 0,05 mg/Nm3 | 6-12-2022 | 14, 57 | ||||||
| 91032-01-8 | 293-007-5 | vetzuren, C7-19, perfluor | fatty acids, C7-19, perfluoro | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 84776-45-4 | 283-972-0 | vetzuren, C8-18- en C18-onverzadigd, nikkelzouten | fatty acids, C8-18 and C18-unsaturated, nickel salts | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 50471-44-8 | 256-599-6 | vinchlozolin | vinclozolin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 593-60-2 | 209-800-6 | vinylbromide | bromoethylene | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 75-01-4 | 200-831-0 | vinylchloride | vinyl chloride | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||
| 75-02-5 | 200-832-6 | vinylfluoride | fluoroethylene | Ja | MVP 2 | 1 mg/Nm3 | 8-7-2025 | 81 | |||||
| 8028-73-7 | 232-434-3 | vliegas, arseenhoudend. Gevormd wanneer arseen en metaaloxide deeltjes verdreven worden gedurende roosting en omzetting van koper concentraten en mat bij de productie van koper anodes | flue dust, arsenic-contg. Formed when arsenic and metal oxide particles are driven off during the roasting and converting of copper concentrates and matte in the production of anode copper | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 69029-67-0 | 273-809-1 | vliegas, loodraffinage | flue dust, lead-refining | Ja | MVP 1 | 0,05 mg/Nm3 | 7-2-2022 | 57, 92 | |||||
| vuurvaste keramische vezels, vezels voor speciale toepassingen, met uitzondering van minerale wol zoals gedefinieerd in bijlage VI van de EU-CLP/GHS | refractory ceramic fibres, special purpose fibres, with the exception of mineral wool as defined in Annex VI of the EU-CLP/GHS | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 59 | |||||||
| 81-81-2 | 201-377-6 | warfarine | warfarin | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 74421-71-9 | 277-864-2 | waterstof bis[1-[(2-hydroxy-5-nitrofenyl)azo]-2-naftalaat(2-)]chromaat(1-), verbinding met with dicyclohexylamine (1:1) | hydrogen bis[1-[(2-hydroxy-5-nitrophenyl)azo]-2-naphtholato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 71839-90-2 | 276-074-5 | waterstof bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrofenyl)azo]-1-naftyl]acetamidaat(2-)]chromaat(1-), verbinding met dicyclohexylamine (1:1) | hydrogen bis[N-[7-hydroxy-8-[(2-hydroxy-5-nitrophenyl)azo]-1-naphthyl]acetamidato(2-)]chromate(1-) , compound with dicyclohexylamine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 76899-34-8 | 278-569-1 | waterstof chloortrioxochromaat(1-), verbinding met 2,2'-bipyridine (1:1) | hydrogen chlorotrioxochromate(1-) , compound with 2,2'-bipyridine (1:1) | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 17068-85-8 | 241-128-9 | waterstofhexafluorarsenaat | hydrogen hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12006-12-1 | 234-483-6 | ytterbium arsenide | ytterbium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12255-48-0 | 235-507-8 | yttriumarsenide | yttrium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 12005-82-2 | 624-776-0 | zilver hexafluorarsenaat | silver hexafluoroarsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| 335-93-3 | 206-402-4 | zilver(1+) perfluoroctanoaat | silver(1+) perfluorooctanoate | Ja | Ja | MVP 2 | 1 mg/Nm3 | 7-10-2024 | 57, 95, 96 | ||||
| 7784-08-9 | 232-048-5 | zilverarseniet | trisilver arsenite | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 57, 92 | |||||
| 7784-01-2 | 232-043-8 | zilverchromaat | silver chromate | MVP 1 | 0,05 mg/Nm3 | 25-8-2023 | 12, 57 | ||||||
| 13464-44-3 | 236-683-9 | zink arsenaat | zinc arsenate | Ja | MVP 1 | 0,05 mg/Nm3 | 21-1-2022 | 57, 92 | |||||
| 136-53-8 | 205-251-1 | zink bis(2-ethylhexanoaat) | zinc bis(2-ethylhexanoate) | MVP 1 | 0,05 mg/Nm3 | 29-1-2024 | 69, 81 | ||||||
| 12044-55-2 | 234-956-7 | zink diarsenide | zinc diarsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| zinkarsenaat of zinkarseniet of zinkarsenaat en zinkarseniet, mengsel | zinc arsenate, zinc arsenite or zinc arsenate and zinc arsenite mixture | Ja | MVP 1 | 0,05 mg/Nm3 | 30-05-2017 | 92 | |||||||
| 13510-72-0 | zinkarsenaat, octahydraat | zinc arsenate, octahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 1303-39-5 | zinkarsenaatoxide (Zn5(AsO3)4O3), tetrahydraat | zinc arsenenate oxide (Zn5(AsO3)4O3), tetrahydrate | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 56450-43-2 | zinkarsenide | zinc arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | ||||||
| 13530-65-9 | 236-878-9 | zinkchromaat | zinc chromate | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| 11103-86-9 | 234-329-8 | zinkkaliumchromaat | potassium hydroxyoctaoxodizincatedichromate | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||
| 68585-90-0 | 271-598-0 | zinksulfide (ZnS), gedoteerd met koper en lood | zinc sulfide (ZnS), copper and lead-doped | MVP 1 | 0,05 mg/Nm3 | 12-4-2022 | 14, 57 | ||||||
| 11146-73-9 | 631-215-3 | zirconium-nikkel legering | zirconium-nickel alloy | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | ||||||
| 953-058-2 | zirconium-nikkel legering 30/70 A | zirconium nickel alloy 30/70 A | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 34, 57 | |||||||
| 936-037-2 | zirkonium aluminiumsilicaat vuurvaste keramische vezels | zirconia aluminosilicate refractory ceramic fibres | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| 60909-47-9 | 262-524-8 | zirkoniumarsenide | zirconium arsenide | Ja | MVP 1 | 0,05 mg/Nm3 | 5-3-2024 | 57, 92 | |||||
| zouten en esters van dinoseb | salts and esters of dinoseb | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | |||||||
| zouten en esters van dinoterb | salts and esters of dinoterb | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| zouten van 3,3'-dichloorbenzidine | salts of 3,3'-dichlorobenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| zouten van 3,3'-dimethoxybenzidine | salts of 3,3'-dimethoxybenzidine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| zouten van 4,4’-bi-o-toluïdine | salts of 4,4'-bi-o-toluidine | Ja | MVP 1 | 0,05 mg/Nm3 | 18-2-2022 | ||||||||
| zouten van 4,4'-methyleenbis(2-chlooraniline) | salts of 4,4'-methylenebis(2-chloroaniline) | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| zouten van 4,4'-thiodianiline | salts of 4,4'-thiodianiline | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| zouten van 4-aminobifenyl | salts of biphenyl-4-ylamine | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||||
| zouten van arseenzuur | salts of arsenic acid | Ja | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 92 | ||||||
| 531-86-2 | 208-520-1 | zouten van benzidine | benzidine and its salts | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | ||||||
| zouten van hydrazine | salts of hydrazine | Ja | MVP 2 | 1 mg/Nm3 | 2-12-2013 | ||||||||
| 92045-14-2 | 295-396-7 | zware stookolie, hoog zwavelgehalte | fuel oil, heavy, high-sulfur | Ja | 2-12-2013 | 4 | |||||||
| 15739-80-7 | 239-831-0 | zwavelzuur loodzout | sulphuric acid, lead salt | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 14, 57 | ||||||
| 62229-08-7 | 263-467-1 | zwavelzuur, loodzout, dibasisch | sulfurous acid, lead salt, dibasic | Ja | MVP 1 | 0,05 mg/Nm3 | 2-12-2013 | 57 | |||||
| 65272-71-1 | 613-764-0 | zwavelzuur, mengsel met chroomzuur (H2Cr2O7) kaliumzout (1:2) | sulfuric acid, mixt. with chromic acid (H2Cr2O7) potassium salt (1:2) | MVP 1 | 0,05 mg/Nm3 | 22-9-2023 | 80, 82 | ||||||
| 65272-70-0 | 863-656-4 | zwavelzuur-chroomtrioxide mengsel | sulfuric acid-chromium trioxide mixture | MVP 1 | 0,05 mg/Nm3 | 22-8-2024 | 12, 57 | ||||||
| 94-91-7 | 202-374-2 | α,α'-propyleendinitrilodi-o-cresol | α,α'-propylenedinitrilodi-o-cresol | Ja | MVP 1 | 0,05 mg/Nm3 | 8-7-2025 | 81 |
- <p>Aangezien alle individuele trichloorbenzenen ZZS zijn, wordt ook de stofgroep trichloorbenzenen als ZZS weergegeven.</p>
- <p>Alleen tetra-, penta-, hexa- en heptabroomdifenylether (respectievelijk CAS-nummers 40088-47-9, 32534-81-9, 36483-60-0, 68928-80-3).</p>
- Berylliumverbindingen met uitzondering van beryllium-aluminiumsilicaat, en met uitzondering van de in bijlage VI van de CLP verordening (EG 1272/2008) met name genoemde verbindingen
- De meeste aardolie- en steenkool derivaten zijn niet als ZZS opgenomen in bijlage III van het BAL. Alleen als deze producten minder dan 0,1 % aan ZZS componenten bevatten, kan stofklasse gO.2 worden aangehouden. Als er meer dan 0,1 % ZZS componenten aanwezig zijn, moet het product als ZZS worden beschouwd. Bij de aanwezigheid van vluchtige ZZS-componenten adviseren we de stofklasse MVP 2 te hanteren; bij de aanwezigheid van niet-vluchtige ZZS-componenten adviseren we de stofklasse MVP 1 te hanteren. Voor meer gedetailleerde criteria voor stoffen en mengsels met een ZZS-component zie: rvs.rivm.nl/stoffenlijsten/Zeer-Zorgwekkende-Stoffen/ZZS-in-mengels. Advies voor vergunningverlening voor mengsels en stoffen met ZZS-bestanddelen wordt gegeven op de website van het IPLO: https://iplo.nl/thema/zeer-zorgwekkende-stoffen-zzs/mengsels-zzs/
- De verbindingen die onder deze vermelding vallen staan als afzonderlijke stof op de ZZS lijst
- Deze vermelding geldt voor alle chroom(VI)verbindingen, met uitzondering van bariumchromaat
- Deze stof of stofgroep is niet als ZZS opgenomen in bijlage III van het BAL maar is qua structuur, fysisch-chemische eigenschappen en toxiciteit van het kation gelijkwaardig aan trifenyltinhydroxide. De weergegeven stofklasse en emissiegrenswaarde zijn daarom gelijk aan die van trifenyltinhydroxide.
- Deze stof wordt als ZZS aangemerkt omdat het onder de NeR een MVP of ERS stof was.
- Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder de ZZS-stofgroep polychloorbifenylen
- <p>Deze stof staat op de ZZS-lijst omdat deze onder de ZZS-stofgroep voor PAKs valt. Op basis van de POP verordening worden alle PAKs als Zeer Zorgwekkende Stof geïdentificeerd.</p>
- Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder de ZZS stofgroep voor PAKs. Op basis van de POP verordening worden alle PAKs als Zeer Zorgwekkende Stof geïdentificeerd. Deze stof is een heterocyclische PAK, deze worden ook tot de PAKs gerekend.
- Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder de ZZS-stofgroep chroom (VI) verbindingen
- <p>Deze stof staat op de-ZZS lijst omdat deze onder de ZZS-stofgroep gebromeerde brandvertragers valt.</p>
- <p>Deze stof staat op de ZZS-lijst omdat deze onder de ZZS-stofgroep loodverbindingen valt.</p>
- Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder de ZZS-stofgroep organische tinverbindingen
- Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder een ZZS-stofgroep en was onder de NeR een MVP of ERS stof.
- Deze verbinding is voor luchtemissies niet ingedeeld in een stofklasse en heeft geen emissiegrenswaarde
- Deze vermelding omvat zowel organische als anorganische loodverbindingen, de getoonde emissiegrenswaarde geldt voor anorganische loodverbindingen
- Dit aardolie- of steenkoolderivaat bevat een groot gehalte aan benzeen, daarom worden hier de stofklasse en emissiegrenswaarde van benzeen weergegeven.
- Dit aardolie- of steenkoolderivaat bevat een groot gehalte aan butadieen, daarom worden hier de stofklasse en emissiegrenswaarde van butadieen weergegeven.
- Dit aardolie- of steenkoolderivaat bevat een groot gehalte aan PAKs, daarom worden hier de stofklasse en emissiegrenswaarde voor PAKs weergegeven.
- Dit steenkoolderivaat bevat een groot gehalte aan PAKs, daarom worden hier de stofklasse en emissiegrenswaarde voor PAKs weergegeven.
- Geldt ook voor de zouten van 3,3'-dimethylbenzidine
- Geldt ook voor oligomeren van deze stof
- Geldt ook voor: zouten van 2-naftylamine; zouten van 2-naftaleenamine
- Geldt ook voor: zouten van 3,3-dichloorbenzidine
- Geldt ook voor: zouten van 4,4'-oxydianiline; zouten van p-aminofenylether
- Geldt ook voor: zouten van 4,4'-thiodianiline
- Geldt ook voor: zouten van benzidine; zouten van 4,4'-diaminobifenyl
- Geldt ook voor: zouten van perfluoroctaansulfonzuur
- Het EG nummer 200-273-9 voor hexachloorbenzeen wordt gebruikt in de EU POP- en CLP/GHS verordeningen. Dit nummer is niet correct en zou 204-273-9 moeten zijn
- Butaan is alleen ZZS als dit 0,1 % of meer butadieen (203-450-8) bevat
- Nikkel en de stofgroep nikkelverbindingen worden op zichzelf niet als ZZS geïdentificeerd maar gezien het grote aantal nikkelverbindingen dat ZZS is, worden ook nikkel en nikkelverbindingen volgens het BAL als ZZS aangemerkt.
- <p>Deze stof staat op de ZZS-lijst omdat deze onder de ZZS-stofgroep nikkelverbindingen valt</p>
- Op basis van de NeR zijn alle gebromeerde difenylethers met uitzondering van decabroomdifenyl ethers ingedeeld als ERS
- Op de NeR stond deze stof ook vermeld onder CAS-nummer 117955-40-5
- Op de REACH kandidaatslijst wordt ook casnummer 31119-53-6 gebruikt.
- Op basis van de CLP worden niet alle tributyltinverbindingen als ZZS aangemerkt maar op basis van de KRW wel.
- Voor de KRW betreft dit 12 dioxineachtige polychloorbifenylen (DL-PCB) die vallen onder de dioxinen en dioxineachtige verbindingen: 3,3’,4,4’-T4CB (PCB 77, CAS 32598-13-3), 3,3’,4’,5-T4CB (PCB 81, CAS 70362- 50-4), 2,3,3’,4,4’-P5CB (PCB 105, CAS 32598-14-4), 2,3,4,4’,5-P5CB (PCB 114, CAS 74472-37-0), 2,3’,4,4’,5-P5CB (PCB 118, CAS 31508-00-6), 2,3’,4,4’,5’-P5CB (PCB 123, CAS 65510-44-3), 3,3’,4,4’,5-P5CB (PCB 126, CAS 57465-28-8), 2,3,3’,4,4’,5-H6CB (PCB 156, CAS 38380-08-4), 2,3,3’,4,4’,5’-H6CB (PCB 157, CAS 69782-90-7), 2,3’,4,4’,5,5’-H6CB (PCB 167, CAS 52663 72-6), 3,3’,4,4’,5,5’-H6CB (PCB 169, CAS 32774-16-6), 2,3,3’,4,4’,5,5’-H7CB (PCB 189, CAS 39635-31-9).
- Zouten van 2-naftylamine
- Deze stofgroep omvat de drie verschillende trichloorbenzenen, voor de stofklasse en de bijbehorende emissiegrenswaard zie de individuele stoffen
- Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder de ZZS-stofgroep kwikverbindingen of organische kwikverbindingen
- Deze stof is een isomeer van hexachloorcyclohexaan, de getoonde stofklasse en emissiegrenswaarde zijn die van hexachloorcyclohecaan en zijn ook geldig voor deze isomeer.
- Deze stof staat nog niet als ZZS in bijlage III van het BAL. In de toekomst zal deze stof worden ingedeeld in een MVP1 of MVP2 stofklasse met bijbehorende emissiegrenswaarde
- Deze stof wordt als ZZS aangemerkt omdat deze is opgenomen in Annex XVII van REACH vanwege risico's gelijkwaardig aan die van PCBs. Aangezien PCBs ZZS zijn, wordt geconcludeerd dat PCTs dat dan ook zijn.
- Deze stof wordt als ZZS aangemerkt omdat deze is opgenomen in Annex XVII van REACH vanwege PBT eigenschappen.
- Deze stof wordt als ZZS aangemerkt omdat deze is opgenomen in Annex XVII van REACH vanwege de hoge gehalten aan creosoot wat zelf een ZZS stof is.
- Deze stof staat niet als ZZS in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn die voor PAKs en zijn ook van toepassing voor deze stof.
- Deze stof wordt als ZZS aangemerkt omdat onder voorgaande Europese regelgeving is vastgesteld dat deze aan de PBT/vPvB criteria voldoet
- Geldt ook voor: zouten van perfluorhexaan-1-sulfonzuur
- Berekend als Sb
- geldt ook voor rook
- Deze stof wordt zonder CAS-nummer vermeld op annex VI van de CLP verordening onder catalogus nummer 607-426-00-1
- Deze vermelding omvat alle anti- en syn-isomeren van deze verbinding en combinaties daarvan.
- Elk reactieproduct, inclusief een eventueel oplosmiddel, dat aan deze beschijving voldoet en dat meer dan ≥0,1 % w/w vertakt of lineair 4-heptylfenol bevat valt onder deze vermelding.
- Deze stof staat niet op de kandidaatslijst maar wordt genoemd in een support document voor opname op de kandidaatslijst
- Deze stof staat niet in bijlage III van het BAL maar valt onder een andere stof of stofgroep, de getoonde stofklasse en emissiegrenswaarde zijn die van de andere stof of stofgroep en zijn ook geldig voor deze stof.
- De stof hoeft volgens CLP niet als kankerverwekkend te worden ingedeeld als kan worden aangetoond dat de theoretische maximumconcentratie van formaldehyde die kan vrijkomen uit het mengsel zoals het in de handel wordt gebracht, ongeacht de bron, lager is dan 0,1 %. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- Indeling als kankerverwekkend is volgens CLP niet noodzakelijk voor vezels waarvan de naar de lengte gewogen meetkundig gemiddelde diameter, minus tweemaal de meetkundige standaardfout, groter is dan 6 μm. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als kankerverwekkend of mutageen te worden ingedeeld als kan worden aangetoond dat zij minder dan 0,1 % (g/g) 1,3-butadieen (Einecs-nr. 203-450-8) bevat. Als de stof niet als kankerverwekkend of mutageen wordt ingedeeld, gelden hiervoor minimaal de voorzorgsmaatregelen (P102-)P210-P403. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als kankerverwekkend of mutageen te worden ingedeeld als kan worden aangetoond dat zij minder dan 0,1 % (g/g) benzeen (EINECS-nr. 200-753-7) bevat. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als kankerverwekkend te worden ingedeeld als kan worden aangetoond dat zij minder dan 3 % Dmso-extract bevat, gemeten volgens IP 346 „Determination of polycyclic aromatics in unused lubricating base oils and asphaltene free petroleum fractions — Dimethyl sulphoxide extraction refractive index method”, Institute of Petroleum, Londen. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als kankerverwekkend te worden ingedeeld als kan worden aangetoond dat zij minder dan 0,005 % (g/g) benzo[a]pyreen (EINECS-nr. 200-028-5) bevat. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als kankerverwekkend te worden ingedeeld als volledig bekend is hoe de raffinage daarvan is verlopen en kan worden aangetoond dat zij is geproduceerd uit een stof die niet kankerverwekkend is. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als kankerverwekkend of mutageen te worden ingedeeld als kan worden aangetoond dat zij minder dan 0,1 % (g/g) benzeen (Einecs-nr. 200-753-7) bevat. Als de stof niet als kankerverwekkend wordt ingedeeld, gelden hiervoor minimaal de voorzorgsmaatregelen (P102-)P260-P262- P301 + P310-P331. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- De stof hoeft volgens CLP niet als mutageen te worden ingedeeld als kan worden aangetoond dat de theoretische maximumconcentratie van formaldehyde die kan vrijkomen uit het mengsel zoals het in de handel wordt gebracht, ongeacht de bron, lager is dan 1 %. De stof kan dan echter toch een ZZS zijn. Andere componenten erin kunnen bijvoorbeeld schadelijk zijn voor de voortplanting of PBT (Persistent, Bioaccumulerend én Toxisch) zijn. Om te concluderen dat de stof geen ZZS is moet duidelijk zijn dat het geen van deze componenten bevat.
- Deze vermelding geldt ook voor alle hydraten van deze verbinding.
- <p>Dit is een <sup>2</sup>H en/of <sup>13</sup>C gelabelde vorm van een ZZS (zie behoort tot bij de stofgegevens) en wordt daarom ook als ZZS aangemerkt.</p>
- <p>Deze stof staat op de ZZS-lijst omdat deze onder een ZZS-stof valt (zie behoort tot bij stofgegevens).</p>
- Deze vermelding geldt ook voor zouten en acylhaliden van deze verbinding inclusief hun individuele isomeren en combinaties daarvan
- <p>Bij de beoordeling van dibroomnitrilopropiamide als werkzame stof in een biocide is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 528/2012. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="BDNPA 2023" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=CELEX:32023D0459">UITVOERINGSBESLUIT (EU) 2023/459 VAN DE COMMISSIE van 2 maart 2023</a>; <a title="DBNPA 2025" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202500937">UITVOERINGSVERORDENING (EU) 2025/937 VAN DE COMMISSIE van 21 mei 2025 </a></p>
- Deze stof is als ZZS geïdentificeerd omdat deze volgens de stofnaam mogelijk meer dan 0,1 % van de ZZS naftaleen bevat. Als kan worden aangetoond dat het gehalte aan naftaleen lager is dan 0,1 % en er ook geen andere ZZS in de stof aanwezig zijn in een concentratie hoger dan 0,1 % hoeft de stof niet als ZZS te worden beschouwd.
- Deze stof is als ZZS geïdentificeerd omdat bij de toelating als geneesmiddel is vastgesteld dat deze schadelijk is voor de voortplanting.
- Deze stof wordt niet in de algemene bronnen voor ZZS-identificatie genoemd maar bevat een ZZS
- geldt ook voor: zouten en aanverwante verbindingen van perfluoroctaanzuur
- <p>o-Terfenyl staat niet zelf op de kandidaatslijst maar is een significant bestanddeel van de ZZS gehydrogeneerd terfenyl (262-967-7). O-Terfenyl is de reden dat gehydrogeneerd terfenyl als vPvB is aangemerkt en op de kandidaatslijst is geplaatst. Daarom is o-terfenyl ook op de ZZS-lijst geplaatst.</p>
- Terfenyl wordt als ZZS aangemerkt omdat in ieder geval een van de isomeren (o-terfenyl, ec nr. 201-517-6) ZZS is
- Deze vermelding geldt ook voor zouten en esters van deze verbinding omdat deze in bijlage I van de POP verordening bij deze stof staan vermeld
- Deze stof wordt als ZZS aangemerkt omdat deze in water wordt omgezet in de ZZS boorzuur
- Deze stof wordt als ZZS geïdentificeerd omdat deze volgens de gegevens bij ECHA (echa.europa.eu) één of meerdere ZZS bevat. In overeenkomst met de mengselnotitie wordt de stof dan als ZZS geïdentificeerd.
- Deze stof staat niet in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn een voorstel op basis van de (geschatte) dampdruk.
- Deze stof staat niet in bijlage III van het BAL maar bevat één of meerdere ZZS. De stofklasse van de ZZS met de strengste stofklasse is weergegeven.
- Deze stof wordt als ZZS geidentificeerd omdat in EU verordening 2017/2398/CE staat dat er voldoende bewijs is dat respirabel kristallijn silicastof carcinogeen is
- Deze stof staat niet in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn een voorstel op basis van de (geschatte) dampdruk en toxiciteit.
- Deze stof staat niet als individuele CMR stof vermeld op Annex VI van CLP, maar valt onder een groepsvermelding.
- <p>Deze stof staat op de ZZS-lijst omdat deze onder de ZZS-stofgroep cadmiumverbindingen valt</p>
- <p>Deze stof staat niet in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn die voor organoloodverbindingen</p>
- Deze vermelding geldt ook voor de zouten van deze stof
- <p>Deze stof staat nog niet in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn een voorstel. Deze stof heeft een dampspanning groter dan 10 Pa, op basis van andere stofeigenschappen wordt echter ingeschat dat de stof niet gasvormig geëmitteerd zal worden maar aan aerosolen zal sorberen. Op basis hiervan wordt de stofklasse MVP 1 geadviseerd.</p>
- Deze vermelding geldt ook voor de isomeren van deze stof en/of combinaties daarvan
- Deze stof is als SVHC geïdentificeerd omdat de stof voldoet aan de criteria van artikel 57 (c) van de REACH verordening omdat DOTE is geclassificeerd als toxisch voor de reproductie categorie 1B.
- <p>Alle arseen verbindingen worden als ZZS aangemerkt omdat deze zijn opgenomen in Annex XVII van REACH vanwege het voldoen aan de criteria carcinogeen en mutageen.</p>
- <p>Deze stof wordt niet als individuele stof als ZZS geïdentificeerd maar valt onder de ZZS-stofgroep berylliumverbindingen.</p>
- <p>Volgens informatie bij ECHA behoort deze stof bij de PFOA verbindingen onder de POP-verordening</p>
- <p>Deze stof staat niet zelf in de POP-verordening maar is door de POP-review commissie aangewezen als een van de PFOA stoffen.</p>
- <p>Deze stof staat op basis van OSPAR op de ZZS-lijst omdat deze onder de ZZS-stofgroep per- en polyfluoralkylstoffen (PFAS) valt.</p>
- <p>Zoals aangegeven in het OSPAR achtergronddocument betreft deze vermelding alle per- en polyfluoralkylstoffen (PFAS) volgens de OECD definitie uit 2021 (<a href="https://one.oecd.org/document/ENV/CBC/MONO(2021)25/En/pdf">https://one.oecd.org/document/ENV/CBC/MONO(2021)25/En/pdf</a>).</p>
- <p>Deze specifieke PFAS-verbinding staat niet in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn een voorstel op basis van de (geschatte) dampdruk.</p>
- <p>Dit is een brede stofgroep, individuele PFAS hebben verschillende stofklassen. Voor een deel van de PFAS is een stofklasse vastgesteld in bijlage III van het BAL, voor een ander deel wordt in ons zoeksysteem een stofklasse voorgesteld op basis van de (geschatte) dampdruk. Als er voor een individuele PFAS nog geen stofklasse getoond wordt, kan het bevoegd gezag het RIVM via de helpdesk van de risico’s van stoffen website om advies vragen.</p>
- <p>Voor individuele stoffen en subgroepen in deze stofgroep kan een afwijkende stofklasse van toepassing zijn.</p>
- <p>Dit is een brede stofgroep. Individuele leden zijn PFAS, die zijn op basis van OSPAR allemaal ZZS. Ook andere stoffen in deze groep kunnen aan de ZZS-criteria voldoen.</p>
- <p>Dit is een brede stofgroep. Individuele leden vallen in verschillende stofklassen.</p>
- <p>De ADR-nummers 3337, 3338, 3339 en 3340 die onder "koelgas"vallen vermelden één of meerdere PFAS.</p>
- <p>Deze stof staat op basis van de EU gevaarsindeling op de ZZS-lijst omdat deze ethyleenoxide bevat.</p>
- <p>Deze stof staat op basis van OSPAR op de ZZS-lijst omdat deze een PFAS bevat.</p>
- <p>Deze stof staat op basis van de EU gevaarsindeling op de ZZS-lijst omdat deze hydrazine bevat.</p>
- <p>Deze stof staat op basis van de REACH SVHC-lijst op de ZZS-lijst omdat deze hydrazine bevat.</p>
- <p>Deze stof staat op basis van de EU gevaarsindeling en de KRW op de ZZS-lijst omdat het een tributyltin verbinding is.</p>
- <p>Deze stof staat op basis van OSPAR en de POP-verordening op de ZZS-lijst omdat het een PCB is.</p>
- <p>Deze stof staat op basis van deze bron op de ZZS-lijst omdat deze acrylamide bevat.</p>
- <p>Omdat deze stof onder de Nederlandse Emissierichtlijn voor lucht (NEr) een MVP stof was is deze in 2013 wegens beleidscontinuiteit op de ZZS-lijst geplaatst. Inmiddels wordt de stof als ZZS geïdentificeerd wegens een geharmoniseerde classificatie als Carc. 1B.</p>
- <p>Deze stof staat op basis van de EU gevaarsindeling op de ZZS-lijst omdat dit een zout van hydrazine is.</p>
- <p>Bij de beoordeling van asulam-natrium als werkzame stof in een gewasbeschermingsmiddel is geconcludeerd dat asulam en asulam-natrium hormoonverstorende eigenschappen hebben volgens de criteria in EU verordening 1107/2009. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) worden deze stoffen als ZZS aangemerkt. <a title="UITVOERINGSVERORDENING (EU) 2024/425 VAN DE COMMISSIE van 2 februari 2024 tot niet-goedkeuring van de werkzame stof asulam-natrium" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202400425&qid=1752132525878" target="_blank" rel="noopener">UITVOERINGSVERORDENING (EU) 2024/425 VAN DE COMMISSIE van 2 februari 2024 tot niet-goedkeuring van de werkzame stof asulam-natrium</a>; <a title="Beoordeling van Asulam" href="https://efsa.onlinelibrary.wiley.com/doi/full/10.2903/j.efsa.2018.5251">Beoordeling van Asulam</a></p>
- <p>Bij de beoordeling van benthiavalicarb als werkzame stof in een gewasbeschermingsmiddel is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 1107/2009. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="benthiavalicarb" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202302657" target="_blank" rel="noopener">UITVOERINGSVERORDENING (EU) 2023/2657 VAN DE COMMISSIE van 6 november 2023</a></p>
- <p>Bij de beoordeling van clofentezine als werkzame stof in een gewasbeschermingsmiddel is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 1107/2009. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="Clofentezine" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202302456">UITVOERINGSVERORDENING (EU) 2023/2456 VAN DE COMMISSIE van 7 november 2023</a></p>
- <p>Bij de beoordeling van cyanamide als werkzame stof in een biocide is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 528/2012. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="cyanamide" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=CELEX:32023D1097">UITVOERINGSBESLUIT (EU) 2023/1097 VAN DE COMMISSIE van 5 juni 2023</a></p>
- <p>Bij de beoordeling van mepanipyrim als werkzame stof in een gewasbeschermingsmiddel is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 1107/2009. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="mepanipyrim" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202401217">UITVOERINGSVERORDENING (EU) 2024/1217 VAN DE COMMISSIE van 29 april 2024</a></p>
- <p>Bij de beoordeling van metiram als werkzame stof in een gewasbeschermingsmiddel is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 1107/2009. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="metiram" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202302455">UITVOERINGSVERORDENING (EU) 2023/2455 VAN DE COMMISSIE van 7 november 2023</a></p>
- <p>Bij de beoordeling van metribuzin als werkzame stof in een gewasbeschermingsmiddel is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 1107/2009. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="metribuzin" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202402806">UITVOERINGSVERORDENING (EU) 2024/2806 VAN DE COMMISSIE van 31 oktober 2024</a></p>
- <p>Bij de beoordeling van colecalciferol als werkzame stof in een biocide is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 528/2012. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="colecalciferol" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=CELEX:32019R0637">UITVOERINGSVERORDENING (EU) 2019/637 VAN DE COMMISSIE van 23 april 2019</a></p>
- <p>Bij de beoordeling van medetomidine als werkzame stof in een biocide is geconcludeerd dat deze stof hormoonverstorende eigenschappen heeft volgens de criteria in EU verordening 528/2012. Op basis van artikel 5.22a-2b van het Besluit Activiteiten Leefomgeving (Bal) wordt deze stof als ZZS aangemerkt. <a title="Medetomidine" href="https://eur-lex.europa.eu/legal-content/NL/TXT/PDF/?uri=OJ:L_202500953" target="_blank" rel="noopener">UITVOERINGSBESLUIT (EU) 2025/953 VAN DE COMMISSIE van 23 mei 2025</a></p>
- <p>Deze stof wordt sinds 2-12-2013 als ZZS aangemerkt omdat het onder de NeR een MVP of ERS stof was.</p>
- <p>Geldt alleen voor tetra-, penta-, hexa-, hepta- en decabroomdifenylethers</p>
- Deze stof staat op basis van OSPAR op de ZZS-lijst omdat deze onder de ZZS-stofgroep per- en polyfluoralkylstoffen (PFAS) valt.
- Deze specifieke PFAS-verbinding staat niet in bijlage III van het BAL. De weergegeven stofklasse en emissiegrenswaarde zijn een voorstel op basis van de (geschatte) dampdruk.
- Deze stof staat op de ZZS-lijst omdat deze onder de ZZS-stofgroep nikkelverbindingen valt
- Deze stof staat op de ZZS-lijst omdat deze onder de ZZS-stofgroep loodverbindingen valt.