Hieronder vindt u een verkorte lijst van Zeer Zorgwekkende Stoffen (ZZS) waarin een aantal stoffen is gegroepeerd. Groepering is gedaan op basis van chemische eigenschappen
of functionaliteit. Als u klikt op een groep vindt u alle ZZS uit deze groep, die in het Risico’s van stoffen zoeksysteem zijn opgenomen. Een stof kan in meer groepen vallen.
U kunt de lijst printen (op papier of als PDF) via de printfunctie van de browser. U kunt de lijst exporteren voor gebruik in een spreadsheet via de knop "Download deze lijst".
Bekijk de print en download instructies
(opens in a new tab).
Lees meer over ZZS
(opens in a new tab).
Vragen of opmerkingen over de lijst kunt u indienen via de Helpdesk "Risico's van stoffen"
(opens in a new tab).
CAS-nummer | EG-nummer | Nederlandse stofnaam | Engelse stofnaam | ZZS volgens EU gevaarsindeling | ZZS volgens REACH | ZZS volgens KRW | ZZS volgens OSPAR | ZZS volgens EU-POP Verordening | Stofklasse voor luchtemissies | Grensmassastroom | Emissiegrenswaarde | Datum toevoeging | Voetnoot |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
ZZS (dier)geneesmiddelen | Ja | Ja | |||||||||||
ZZS aardoliederivaten | Ja | ||||||||||||
ZZS acetamides | Ja | Ja | |||||||||||
ZZS acrylaten | Ja | Ja | Ja | ||||||||||
ZZS alkylfenolen en alkylfenolethoxylaten | Ja | Ja | Ja | Ja | |||||||||
ZZS aromatische amines | Ja | Ja | Ja | ||||||||||
ZZS arseen en arseenverbindingen | Ja | Ja | Ja | ||||||||||
ZZS benzidines | Ja | Ja | |||||||||||
ZZS beryllium en berylliumverbindingen | Ja | ||||||||||||
ZZS boorverbindingen | Ja | Ja | |||||||||||
ZZS butadienen | Ja | Ja | Ja | ||||||||||
ZZS cadmium en cadmiumverbindingen | Ja | Ja | Ja | Ja | |||||||||
ZZS chroom (VI) verbindingen | Ja | Ja | |||||||||||
ZZS dioxinen, PCBs en dioxineachtige verbindingen | Ja | Ja | Ja | ||||||||||
ZZS fenolen | Ja | Ja | Ja | Ja | Ja | ||||||||
ZZS formamides | Ja | Ja | |||||||||||
ZZS ftalaten | Ja | Ja | Ja | Ja | |||||||||
ZZS gebromeerde brandvertragers | Ja | Ja | Ja | Ja | Ja | ||||||||
ZZS gechloreerde benzenen | Ja | Ja | Ja | Ja | |||||||||
ZZS gechloreerde en gebromeerde koolwaterstoffen | Ja | Ja | Ja | Ja | Ja | ||||||||
ZZS geurstoffen | Ja | Ja | Ja | ||||||||||
ZZS gewasbeschermingsmiddelen en of biociden | Ja | Ja | Ja | Ja | Ja | ||||||||
ZZS glycol ethers | Ja | Ja | |||||||||||
ZZS hydrazines | Ja | Ja | |||||||||||
ZZS kleurstoffen inclusief azokleurstoffen | Ja | Ja | Ja | ||||||||||
ZZS kobaltverbindingen | Ja | Ja | |||||||||||
ZZS kwik en kwikverbindingen | Ja | Ja | Ja | ||||||||||
ZZS lood en loodverbindingen | Ja | Ja | Ja | ||||||||||
ZZS minerale vezels | Ja | Ja | |||||||||||
ZZS nikkel en nikkelverbindingen | Ja | ||||||||||||
ZZS nitrotoluenen | Ja | Ja | Ja | ||||||||||
ZZS nonylfenolen en nonylfenolethoxylaten | Ja | Ja | Ja | ||||||||||
ZZS organosiliciumverbindingen | Ja | Ja | |||||||||||
ZZS organotinverbindingen | Ja | Ja | Ja | Ja | |||||||||
ZZS oxiranen | Ja | Ja | |||||||||||
ZZS PFAS | Ja | Ja | Ja | Ja | Ja | ||||||||
ZZS polychloornaftalenen | Ja | Ja | |||||||||||
ZZS polycyclische aromatische koolwaterstoffen (PAKs) | Ja | Ja | Ja | Ja | Ja | ||||||||
ZZS steenkoolderivaten | Ja | Ja | |||||||||||
ZZS toluidines | Ja | Ja | |||||||||||
36861-47-9 | 253-242-6 | (±)-1,7,7-trimethyl-3-[(4-methylfenyl)methyleen]bicyclo[2.2.1]-2-heptanon (4-methylbenzylideenkamfer) | (±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one (4-Methylbenzylidenecamphor) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | ||||
(±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one covering any of the individual isomers and/or combinations thereof (4-MBC) | (±)-1,7,7-trimethyl-3-[(4-methylphenyl)methylene]bicyclo[2.2.1]heptan-2-one covering any of the individual isomers and/or combinations thereof (4-MBC) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | ||||||
95342-41-9 | (1R,3E,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanone | (1R,3E,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | |||||
852541-21-0 | (1R,3Z,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanone | (1R,3Z,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | |||||
741687-98-9 | (1R,4S)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanone | (1R,4S)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | |||||
852541-30-1 | (1S,3E,4R)-1,7,7-trimethyl-3-(4- methylbenzylideen)bicyclo[2.2.1]-2-heptanone | (1S,3E,4R)-1,7,7-trimethyl-3-(4- methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | |||||
852541-25-4 | (1S,3Z,4R)-1,7,7-trimethyl-3-(4-methylbenzylideen)bicyclo[2.2.1]-2-heptanone | (1S,3Z,4R)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | |||||
1782069-81-1 | 701-394-3 | (3E)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | (3E)-1,7,7-trimethyl-3-(4-methylbenzylidene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 21-1-2022 | 2 | ||||
108225-03-2 | 402-060-7 | (6-(4-hydroxy-3-(2-methoxyfenylazo)-2-sulfonato-7-naftylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium]-formaat | (6-(4-hydroxy-3-(2-methoxyphenylazo)-2-sulfonato-7-naphthylamino)-1,3,5-triazin-2,4-diyl)bis[(amino-1-methylethyl)ammonium] formate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
244235-47-0 | 627-083-1 | 1-(2-hydroxy-5-nonyl(vertakt)-fenyl)ethanon oxime | 1-(2-hydroxy-5-nonyl(branched)-phenyl)ethanone oxime | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 16-7-2020 | 15, 22 | |||||
288-88-0 | 206-022-9 | 1,2,4-triazool | 1,2,4-triazole | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 13-7-2021 | 26 | ||||
122-60-1 | 204-557-2 | 1,2-epoxy-3-fenoxypropaan | phenyl glycidyl ether | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
59653-74-6 | 423-400-0 | 1,3,5-tris-[(2S en 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H3H5H)-trion | 1,3,5-tris-[(2S and 2R)-2,3-epoxypropyl]-1,3,5-triazine-2,4,6-(1H,3H,5H)-trione | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||
1120-71-4 | 214-317-9 | 1,3-propaansulton | 1,3-propanesultone | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | ||||
57-57-8 | 200-340-1 | 1,3-propiolacton | 3-propanolide | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
123-91-1 | 204-661-8 | 1,4-dioxaan | 1,4-dioxane | Ja | Ja | gO.1 | 100 g/uur | 20 mg/Nm3 | 12-7-2021 | 9 | |||
4904-61-4 | 225-533-8 | 1,5,9-cyclododecatrieen | 1,5,9 cyclododecatriene | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
15087-24-8 | 239-139-9 | 1,7,7-trimethyl-3-(fenylmethyleen)bicyclo[2.2.1]-2-heptanon | 1,7,7-trimethyl-3-(phenylmethylene)bicyclo[2.2.1]heptan-2-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 11-2-2019 | |||||
70-25-7 | 200-730-1 | 1-methyl-3-nitro-1-nitrosoguanidine | 1-methyl-3-nitro-1-nitrosoguanidine | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
1072-63-5 | 214-012-0 | 1-vinylimidazool | 1-vinylimidazole | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 12-10-2018 | ||||
9036-19-5 | 618-541-1 | 2-(2-[4-(1,1,3,3-tetramethylbutyl)fenoxy]ethoxy)ethanol | 2-(2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy)ethanol | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 29-03-2019 | 15 | ||||
111-41-1 | 203-867-5 | 2-(2-aminoethylamino)ethanol | 2-(2-aminoethylamino)ethanol | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
111-77-3 | 203-906-6 | 2-(2-methoxyethoxy)ethanol | 2-(2-methoxyethoxy)ethanol | Ja | gO.2 | 500 g/uur | 50 mg/Nm3 | 8-7-2022 | 9 | ||||
1116-54-7 | 214-237-4 | 2,2'-(nitrosoimino)bisethanol | 2,2'-(nitrosoimino)bisethanol | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
57044-25-4 | 404-660-4 | 2,3-epoxypropaan-1-ol | R-2,3-epoxy-1-propanol | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
3033-77-0 | 221-221-0 | 2,3-epoxypropyl-trimethylammoniumchloride | 2,3-epoxypropyltrimethylammonium chloride | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
39156-41-7 | 254-323-9 | 2,4-diaminoanisoolsulfaat | 2,4-diaminoanisole sulphate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
119313-12-1 | 404-360-3 | 2-benzyl-2-dimethylamino-4′-morfolinobutyrofenon | 2-benzyl-2-dimethylamino-4′-morpholinobutyrophenone | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 12-10-2018 | ||||
4170-30-3 | 224-030-0 | 2-butenal | crotonaldehyde | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 24-11-2015 | 3 | |||||
94723-86-1 | 425-150-8 | 2-butyryl-3-hydroxy-5-thiocyclohexaan-3-ylcyclohex-2-een-1-on | 2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
149-57-5 | 205-743-6 | 2-ethylhexaanzuur | 2-ethylhexanoic acid | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2, 30 | ||||
80387-97-9 | 279-452-8 | 2-ethylhexyl-[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyfenyl]methyl]thio]acetaat | 2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
3121-61-7 | 221-499-3 | 2-methoxyethylacrylaat | 2-methoxyethyl acrylate | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 11-9-2020 | 2 | ||||
71868-10-5 | 400-600-6 | 2-methyl-1-(4-methylthiofenyl)-2-morfolinopropaan-1-on | 2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 30-05-2017 | ||||
75-55-8 | 200-878-7 | 2-methylaziridine | 2-methylaziridine | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
693-98-1 | 211-765-7 | 2-methylimidazool | 2-methylimidazole | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-3-2020 | ||||
91-23-6 | 202-052-1 | 2-nitroanisool | 2-nitroanisole | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
79-46-9 | 201-209-1 | 2-nitropropaan | 2-nitropropane | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
55525-54-7 | 259-695-6 | 3,3-(ureyleendimethyleen)bis(3,5,5-trimethylcyclohexyl)diisocyanaat | 3,3'-(ureylenedimethylene)bis(3,5,5-trimethylcyclohexyl) diisocyanate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
143860-04-2 | 421-150-7 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||
1453-58-3 | 215-925-7 | 3-methylpyrazool | 3-methylpyrazole | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 12-7-2021 | 26 | ||||
64049-29-2 | 4,4’-methylene-bis(2-chloroaniline) hydrochloride | 4,4'-Methylene-bis(2-chloroaniline) hydrochloride | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-2-2022 | 15, 19 | ||||||
104316-83-8 | 620-831-8 | 4-carboxypyridinium dichromaat | 4-Carboxypyridinium dichromate | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 9-1-2023 | 4, 15 | |||||
27147-75-7 | 608-055-8 | 4-isododecylfenol | Phenol, 4-isododecyl- | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 13-7-2021 | 2 | ||||
92-93-3 | 202-204-7 | 4-nitrobifenyl | 4-nitrobiphenyl | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
98-73-7 | 202-696-3 | 4-tert-butylbenzoëzuur | 4-tert-butylbenzoic acid | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
119-47-1 | 204-327-1 | 6,6'-di-tert-butyl-2,2'-methyleendi-p-cresol | p-cresol, 2,2'-methylenebis(6-tert- butyl- | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 12-7-2021 | 26 | |||
2156592-54-8 | 701-118-1 | 6-[(C10-C13)-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur | 6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
701-271-4 | 6-[C12-18-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur, natrium en tris (2-hydroxyethyl)-ammoniumzouten | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | |||||
701-162-1 | 6-[C12-18-alkyl-(vertakt, onverzadigd)-2,5-dioxopyrrolidine-1-yl] hexaanzuur | 6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | |||||
85136-74-9 | 400-340-3 | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(fenylazo)fenylazo]-1,2-dihydro-3-pyridinecarbonitril | 6-hydroxy-1-(3-isopropoxypropyl)-4-methyl-2-oxo-5-[4-(phenylazo)phenylazo]-1,2-dihydro-3-pyridinecarbonitrile | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
106-87-6 | 203-437-7 | 7-oxa-3-oxiranylbicyclo[4.1.0]heptaan | 7-oxa-3-oxiranylbicyclo[4.1.0]heptane | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 12-7-2021 | 26 | ||||
94551-87-8 | 305-433-1 | afvalslik en bezinksel, elektrolytische koperzuivering, ontkoperd | slimes and sludges, copper electrolyte refining, decopperised | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
12124-97-9 | 235-183-8 | ammonium bromide | Ammonium bromide | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
103-33-3 | 203-102-5 | azobenzeen | azobenzene | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
71-43-2 | 200-753-7 | benzeen | benzene | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
552-30-7 | 209-008-0 | benzeen-1,2,4-tricarbonzuur-1,2-anhydride | benzene-1,2,4-tricarboxylic acid 1,2 anhydride | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 24-4-2018 | |||||
119-61-9 | 204-337-6 | benzofenon | benzophenone | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
80-43-3 | 201-279-3 | bis(α,α-dimethylbenzyl)peroxide | bis(α,α-dimethylbenzyl) peroxide | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 11-9-2020 | 2 | ||||
96-29-7 | 202-496-6 | butanon oxime | 2-butanone oxime | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 24-3-2020 | |||||
701-251-5 | calcium, vertakt alkylfenaatsulfide | calcium branched alkyl phenate sulphide | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 18-5-2021 | 25, 27 | ||||||
13149-00-3 | 236-086-3 | cis-cyclohexaan-1,2-dicarbonzuuranhydride | cis-cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
64-86-8 | 200-598-5 | colchicine | colchicine | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
8021-39-4 | 232-419-1 | creosoot, hout | creosote wood | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 30-05-2017 | 11 | |||||
98-82-8 | 202-704-5 | cumeen | cumene | Ja | gO.2 | 500 g/uur | 50 mg/Nm3 | 8-7-2022 | 9 | ||||
5571-36-8 | 427-230-8 | cyclisch 3-(1,2-ethaandiylacetaal)oestra-5(10),9(11)-dieen-3,17-dion | cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
294-62-2 | 206-033-9 | cyclododecaan | cyclododecane | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
541-02-6 | 208-764-9 | decamethylcyclopentasiloxaan | decamethylcyclopentasiloxane | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 6-7-2018 | |||||
derivaten van benzidine | benzidine and/or its derivatives | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||||
64742-47-8 | 265-149-8 | destillaten (aardolie), met waterstof behandelde lichte fractie | Distillates (petroleum), hydrotreated light | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 10-11-2022 | 12, 25 | |||||
25376-45-8 | 246-910-3 | diaminotolueen, isomerenmengsel van 2,4-tolueendiamine en 2,6-tolueendiamine | diaminotoluene | 31-1-2023 | 22 | ||||||||
334-88-3 | 206-382-7 | diazomethaan | diazomethane | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
67-43-6 | 200-652-8 | Di-ethyleentriaminepenta-azijnzuur | N-carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
64-67-5 | 200-589-6 | diethylsulfaat | diethyl sulphate | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | ||||
110488-70-5 | 404-200-2 | dimethomorf | dimethomorph | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 13-7-2021 | 26 | ||||
79-44-7 | 201-208-6 | dimethylcarbamoylchloride | dimethylcarbamoyl chloride | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
77-78-1 | 201-058-1 | dimethylsulfaat | dimethyl sulphate | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | ||||
13360-57-1 | 236-412-4 | dimethylsulfamoylchloride | dimethylsulfamoylchloride | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
540-97-6 | 208-762-8 | dodecamethylcyclohexasiloxaan | dodecamethylcyclohexasiloxane | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 6-7-2018 | 13 | ||||
123-73-9 | 204-647-1 | E-2-butenal | (E)-crotonaldehyde | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | 3 | |||||
75-07-0 | 200-836-8 | ethanal | acetaldehyde | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 12-10-2018 | |||||
97925-95-6 | 308-208-6 | ethanol, 2,2'-iminobis-, N- (C13-15-vertakt en lineair alkyl)-derivaten | ethanol, 2,2'-iminobis-, N-(C13-15-branched and linear alkyl) derivs. | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-3-2020 | |||||
51000-52-3 | 256-905-8 | ethenyl ester van neodecaanzuur | vinyl neodecanoate | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
107-15-3 | 203-468-6 | ethyleendiamine | ethylenediamine | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 6-7-2018 | |||||
96-45-7 | 202-506-9 | ethyleenthioureum | ethylene thiourea | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||
50-00-0 | 200-001-8 | formaldehyde | formaldehyde | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 3-2-2015 | |||||
110-00-9 | 203-727-3 | furaan | furan | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | ||||
61788-32-7 | 262-967-7 | gehydrogeneerd terfenyl | terphenyl hydrogenated | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 6-7-2018 | |||||
111-30-8 | 203-856-5 | glutaaraldehyde | glutaraldehyde | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 13-7-2021 | 2 | ||||
85-42-7 | 201-604-9 | hexahydroftaalzuur-anhydride | cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
14166-21-3 | 238-009-9 | hexahydroftaalzuur-anhydride (trans-isomeer) | trans-cyclohexane-1,2-dicarboxylic anhydride | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
680-31-9 | 211-653-8 | hexamethylfosforamide | hexamethylphosphoric triamide | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
22398-80-7 | 244-959-5 | indium fosfide | indium phosphide | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
542-56-3 | 208-819-7 | isobutylnitriet | isobutyl nitrite | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
78-79-5 | 201-143-3 | isopreen | isoprene (stabilised) | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
7758-01-2 | 231-829-8 | kaliumbromaat | potassium bromate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
630-08-0 | 211-128-3 | koolmonoxide | carbon monoxide | Ja | 2-12-2013 | 7 | |||||||
918-811-1 | koolwaterstoffen C10, aromaten, <1% naftaleen | hydrocarbons, C10, aromatics, <1% naphthalene | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 24-1-2020 | 21 | ||||||
919-284-0 | koolwaterstoffen C10, aromatisch, >1% naftaleen | hydrocarbons, C10, aromatics, >1% naphthalene | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 19-5-2021 | 25, 27 | ||||||
605-758-1 | Lood(II) methaansulfonaat | Lead(II) methanesulfonate | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 6-12-2022 | 5, 20 | ||||||
8018-01-7 | 616-995-5 | mancozeb | mancozeb | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 13-7-2021 | 2 | ||||
101-90-6 | 202-987-5 | m-bis(2,3-epoxypropoxy)benzeen | m-bis(2,3-epoxypropoxy)benzene | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 11-9-2020 | 2 | ||||
108-78-1 | 203-615-4 | melamine | melamine | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 19-1-2023 | 26 | ||||
403-250-2 | mengsel van 4-[[bis-(4-fluorfenyl)methylsilyl]methyl]-4H-1,2,4-triazool en 1-[[bis-(4-fluorfenyl)methylsilyl]methyl]-1H-1,2,4-triazool | reaction mass of 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole and 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||||
402-660-9 | mengsel van dinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatofenyl)pyrazool-4-yl)penta-2,4-dienylideen)-4,5-dihydro-5-oxopyrazool-1-yl)benzeensulfonaat en trinatrium-4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatofenyl)pyrazool-4-yl)penta-2,4-dienylideen)-4,5-dihydro-5-oxopyrazool-1-yl)benzeensulfonaat | reaction mass of disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate and trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||||
421-550-1 | mengsel van: 1,3,5-tris(3-aminomethylfenyl)-1,3,5-(1H3H5H)-triazine-2,4,6-trion; mengsel van oligomeren van 3,5-bis(3-aminomethylfenyl)-1-poly[3,5-bis(3-aminomethylfenyl)-2,4,6-trioxo-1,3,5-(1H3H5H)-triazin-1-yl]-1,3,5-(1H3H5H)-triazine-2,4,6-trion | reaction mass of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione; reaction mass of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||||
435-960-3 | mengsel van: dimethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat, diethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat, methylethyl(2-(hydroxymethylcarbamoyl)ethyl)fosfonaat | reaction mass of dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate, diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate, methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||||
methylfenyleendiamine | methyl-phenylene diamine | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||||
592-62-1 | 209-765-7 | methyl-ONN-azoxymethylacetaat | methyl-ONN-azoxymethyl acetate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
874819-71-3 | 477-690-9 | N-(2-nitrofenyl) fosforzuurtriamide | N-(2-nitrophenyl)phosphoric triamide | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
5625-90-1 | 227-062-3 | N,N′-methyleendimorfoline | N,N′-methylenedimorpholine | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 30-05-2017 | 16, 17 | ||||
11110-52-4 | 680-624-3 | natrium amalgaam | sodium mercury amalgam | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 23-2-2022 | 8, 15 | |||||
7784-46-5 | 232-070-5 | natriumdioxoarseniet | sodium dioxoarsenate | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 20-12-2021 | 10, 15 | |||||
2687-91-4 | 220-250-6 | N-ethyl-2-pyrrolidon | N-ethyl-2-pyrrolidone | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
98-95-3 | 202-716-0 | nitrobenzeen | nitrobenzene | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | ||||
621-64-7 | 210-698-0 | nitrosodipropylamine | nitrosodipropylamine | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
872-50-4 | 212-828-1 | N-methyl-2-pyrrolidon | N-methyl-2-pyrrolidone | Ja | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | ||||
62-75-9 | 200-549-8 | N-nitrosodimethylamine | dimethylnitrosoamine | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
556-67-2 | 209-136-7 | octamethyltetrasiloxaan | octamethylcyclotetrasiloxane | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 6-7-2018 | |||||
109202-58-6 | 432-750-3 | O-hexyl-N-ethoxycarbonylthiocarbamaat | O-hexyl-N-ethoxycarbonylthiocarbamate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
103122-66-3 | 434-350-4 | O-isobutyl-N-ethoxycarbonylthiocarbamaat | O-isobutyl-N-ethoxy carbonylthiocarbamate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
84-15-1 | 201-517-6 | o-terfenyl | o-terphenyl | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 24-7-2020 | 23 | ||||
7216-95-7 | 404-290-3 | pentakalium 2,2',2'',2''',2''''-(ethaan-1,2-diylnitrilo) penta-acetaat | pentapotassium 2,2’,2’’,2’’’,2’’’’-(ethane-1,2-diylnitrilo)pentaacetate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
140-01-2 | 205-391-3 | pentanatrium diethyleen-triaminepenta-azijnzuur | pentasodium pentetate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 24-1-2020 | |||||
31631-13-7 | p-isononyl-fenol, phosphite (3:1) | phenol, p-isononyl-, phosphite (3:1) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 20-1-2022 | 2 | |||||
75579-40-7 | propaanzuur, 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)-, (-)- | propanoic acid, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-, (-)- | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 21-1-2022 | 15 | |||||
75579-39-4 | propaanzuur, 2,3,3,3-tetrafluor-2-(heptafluorpropoxy)-, (+)- | propanoic acid, 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)-, (+)- | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 21-1-2022 | 15 | |||||
106599-06-8 | p-sec-nonyl-fenol, fosfiet | phenol, p-sec-nonyl-, phosphite | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 20-1-2022 | 29 | |||||
1471311-26-8 | 939-460-0 | reactieproduct van 1,3,4-thiadiazolidin-2,5-dithion, formaldehyde en fenol, heptyl derivaten | reaction product of 1,3,4-thiadiazolidine-2,5-dithione, formaldehyde and phenol, heptyl derivs. | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 25-11-2022 | 2, 14 | ||||
reactieproducten van paraformaldehyde en 2-hydroxypropylamine (ratio 3:2) | reaction products from paraformaldehyde and 2-hydroxypropylamine (ratio 3:2) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 30-5-2017 | 2, 16, 17 | ||||||
reactieprodukten van paraformaldehyde met 2-hydroxypropylamine (ratio 1:1) | reaction products of paraformaldehyde with 2-hydroxypropylamine (ratio 1:1) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 30-05-2017 | 2, 16, 17 | ||||||
respirabel kristallijn silicastof | respirable crystalline silica dust | 19-5-2021 | 9, 28 | ||||||||||
255881-94-8 | 401-850-9 | S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(of 9)-yl O-(isopropyl of isobutyl of 2-ethylhexyl) O-(isopropyl of isobutyl of 2-ethylhexyl) fosfordithioaat | S-(tricyclo(5.2.1.0'2,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 21-1-2022 | 2 | ||||
S-(tricyclo[5.2.1.0 2,6]deca-3-en-8(of 9)-yl) O-isopropyl O’-isopropyl fosfordithioaat | S-(tricyclo[5.2.1.0 2,6]deca-3-en- 8(or 9)-yl) Oisopropyl O’- isopropyl phosphorodithio ate | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 21-1-2022 | 2, 14 | ||||||
94-59-7 | 202-345-4 | safrool | safrole | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
14464-46-1 | 238-455-4 | silicium(di)oxide - cristoballiet | cristobalite | sA.1 | 0,25 g/uur | 0,05 mg/Nm3 | 19-5-2021 | 9, 28 | |||||
14808-60-7 | 238-878-4 | silicium(di)oxide - kwarts | quartz (SiO2) | sA.2 | 2,5 g/uur | 0,5 mg/Nm3 | 19-5-2021 | 9, 28 | |||||
15468-32-3 | 239-487-1 | silicium(di)oxide - tridymiet | crystalline silica, tridymite | sA.1 | 0,25 g/uur | 0,05 mg/Nm3 | 19-5-2021 | 9, 28 | |||||
13494-80-9 | 236-813-4 | tellurium | tellurium | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
7446-07-3 | 231-193-1 | tellurium dioxide | Tellurium dioxide | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 8-7-2022 | 2 | ||||
26140-60-3 | 247-477-3 | terfenyl | terphenyl | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 24-7-2020 | 24 | |||||
97-99-4 | 202-625-6 | tetrahydro-2-furylmethanol | tetrahydro-2-furylmethanol | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 3-2-2015 | |||||
61571-06-0 | 407-330-8 | tetrahydrothiopyraan-3-carboxaldehyde | tetrahydrothiopyran-3-carboxaldehyde | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
65321-67-7 | 265-697-8 | tolueen-2,4-diammoniumsulfaat | toluene-2,4-diammonium sulphate | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
603-35-0 | 210-036-0 | trifenylfosfine | triphenylphosphine | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | 3 | |||||
668-34-8 | 694-821-7 | trifenyltin (kation) | fentin | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 16-12-2022 | 1, 6 | |||||
2451-62-9 | 219-514-3 | triglycidyl isocyanuraat | triglycidyl isocyanurate | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||
164058-22-4 | 413-590-3 | trinatrium-[4'-(8-acetylamino-3,6-disulfonato-2-nafthylazo)-4''-(6-benzoylamino-3-sulfonato-2-nafthylazo)-bifenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']koper(II) | trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4''-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3'',1'''-tetraolato-O,O',O'',O''']copper(II) | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | |||||
25155-23-1 | 246-677-8 | trixylyl fosfaat | trixylyl phosphate | Ja | Ja | MVP 1 | 0,15 g/uur | 0,05 mg/Nm3 | 2-12-2013 | ||||
51-79-6 | 200-123-1 | urethaan | urethane | Ja | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 2-12-2013 | |||||
73962-07-9 | 622-090-6 | urethaan-d5 (ethyl-d5) | urethane-d5 (ethyl-d5) | MVP 2 | 2,5 g/uur | 1 mg/Nm3 | 27-5-2019 | 15, 18 | |||||
1314-62-1 | 215-239-8 | vanadiumpentoxide | divanadium pentaoxide | Ja | sA.1 | 0,25 g/uur | 0,05 mg/Nm3 | 27-10-2020 | 9 |